From 8a12ea97c1d9be80ef0a3a7e9e791b53f0c0f706 Mon Sep 17 00:00:00 2001 From: Aadhavan Srinivasan Date: Tue, 1 Jul 2025 15:29:32 -0400 Subject: [PATCH] Added interactive fretboard code --- js/.DS_Store | Bin 0 -> 6148 bytes js/src/.DS_Store | Bin 0 -> 6148 bytes js/src/guitar-diagrams-config.mjs | 429 + js/src/guitar-diagrams-marker.mjs | 286 + js/src/guitar-diagrams-web-component.mjs | 931 + js/src/guitar-diagrams.mjs | 3 + js/src/index.html | 14 + js/src/index.js | 37 + js/src/tone.js | 20118 +++++++++++++++++++++ 9 files changed, 21818 insertions(+) create mode 100644 js/.DS_Store create mode 100644 js/src/.DS_Store create mode 100644 js/src/guitar-diagrams-config.mjs create mode 100644 js/src/guitar-diagrams-marker.mjs create mode 100644 js/src/guitar-diagrams-web-component.mjs create mode 100644 js/src/guitar-diagrams.mjs create mode 100644 js/src/index.html create mode 100644 js/src/index.js create mode 100644 js/src/tone.js diff --git a/js/.DS_Store b/js/.DS_Store new file mode 100644 index 0000000000000000000000000000000000000000..7e678a88341752032566a44abd629113ac936ce3 GIT binary patch literal 6148 zcmeHKNlwE+5Ue(l65tZS1tB5%0|fB{6NLk3K7g}emN=0TB60Mc$M6td#0jcrMj>7h zIU$6)rJicHd-2p*9uENNug2#<7eI%q80~Us5WTNjlPGxFL~%7zEO3f3?vd7_&G8o* z(6u{8h85TBiL3Utei`i)IhI_}5$2fTmN6N6^gUpCHJy)!)A^A3`tn>*dmm0{ZBsLM z-5xPvpXQpcm70e?JZEDSIjL0H<1A);M<;k@-#gAa$Fw{fd8y=dN;$RJ%X=lh&8o`S zgdJ+pQC5jQSVuFKZ0qwa>05ABa@Ls9uJ9ebvBud3-@G(228;n?U~2}rXRCDfJ=$mt z7z4(@ngRVj#8ky3VByhyIykr^0I@~46WaPas5x=KBw*o@cPQdhi9S`r5kq`B{c(s( z0u~;9IwTxEBy^T=LJ`-U^X7t26p^qSNH$R@6Z3`B)c*OjDdf}fV2kJ zgFdGe_SV|ubgzx6H&hjkD?F}KXt=GIvAPu>QJv5qt3gZx79Q!L*pGmt!3JaCR~h&O DzdwJ5 literal 0 HcmV?d00001 diff --git a/js/src/.DS_Store b/js/src/.DS_Store new file mode 100644 index 0000000000000000000000000000000000000000..7e678a88341752032566a44abd629113ac936ce3 GIT binary patch literal 6148 zcmeHKNlwE+5Ue(l65tZS1tB5%0|fB{6NLk3K7g}emN=0TB60Mc$M6td#0jcrMj>7h zIU$6)rJicHd-2p*9uENNug2#<7eI%q80~Us5WTNjlPGxFL~%7zEO3f3?vd7_&G8o* z(6u{8h85TBiL3Utei`i)IhI_}5$2fTmN6N6^gUpCHJy)!)A^A3`tn>*dmm0{ZBsLM z-5xPvpXQpcm70e?JZEDSIjL0H<1A);M<;k@-#gAa$Fw{fd8y=dN;$RJ%X=lh&8o`S zgdJ+pQC5jQSVuFKZ0qwa>05ABa@Ls9uJ9ebvBud3-@G(228;n?U~2}rXRCDfJ=$mt z7z4(@ngRVj#8ky3VByhyIykr^0I@~46WaPas5x=KBw*o@cPQdhi9S`r5kq`B{c(s( z0u~;9IwTxEBy^T=LJ`-U^X7t26p^qSNH$R@6Z3`B)c*OjDdf}fV2kJ zgFdGe_SV|ubgzx6H&hjkD?F}KXt=GIvAPu>QJv5qt3gZx79Q!L*pGmt!3JaCR~h&O DzdwJ5 literal 0 HcmV?d00001 diff --git a/js/src/guitar-diagrams-config.mjs b/js/src/guitar-diagrams-config.mjs new file mode 100644 index 0000000..372b239 --- /dev/null +++ b/js/src/guitar-diagrams-config.mjs @@ -0,0 +1,429 @@ +/** + * @file Guitar Diagrams JS config class. + * @module js/lib/Guitar-Diagrams-JS/guitar-diagrams-config.mjs + * @link https://github.com/KCarlile/guitar-diagrams-js + * + * @author Kenny Carlile + * @link https://www.kcarlile.com/ + * @link https://github.com/KCarlile + */ + +/** + * Class representing the Guitar Diagrams JS configuration. + */ +export class GuitarDiagramsJSConfig { + // ========== BEGIN private members + // ----- References + #canvasID = "gdjCanvas"; + + // ----- Colors + #colorFretboard = "#795548"; + #colorNut = "#F2F3F4"; + #colorFrets = "#808B96"; + #colorStrings = "#CFD8DC"; + #colorNutOutline = "#000000"; + #colorFretMarkers = "#FFFFFF"; + #colorDiagramBackground = null; + #colorLabel = "#000000"; + + // Markers + #markerStrokeWidth = 2; + #markerFontSize = 16; + + // ----- Dimensions/Orientation + #fretCount = 5; + #scaleFactor = 1; + #orientHorizontally = false; + + // ----- Features + #fretMarkersEnabled = true; + #fretStartingNumber = 0; + #stringNamesEnabled = true; + #stringNames = ["E", "A", "D", "G", "B", "e"]; + #controlsEnabled = false; + #downloadImageEnabled = false; + #changeOrientationEnabled = false; + + // ========== END private members + + // ========== BEGIN static members + // ========== END static members + + // ========== BEGIN constructors + /** + * Create a GuitarDiagramsJSConfig object instance. + */ + constructor(paramCanvasID = null) { + if (paramCanvasID != null) { + this.#canvasID = paramCanvasID; + } // end if test + } // end default constructor + // ========== END constructors + + // ========== BEGIN properties + // ----- References + /** + * Gets the ID attribute of the canvas HTML element. + * @return {string} The ID attribute of the canvas HTML element. + */ + get canvasID() { + return this.#canvasID; + } // end get canvasID property + + /** + * Sets the ID attribute of the canvas HTML element. + * @param {string} paramCanvasID - The ID attribute of the canvas HTML element. + */ + set canvasID(paramCanvasID) { + this.#canvasID = paramCanvasID; + } // end get canvasID property + + // ----- Colors + /** + * Gets the HTML color code of the fretboard. + * @return {string} The HTML color code of the fretboard. + */ + get colorFretboard() { + return this.#colorFretboard; + } // end get colorFretboard property + + /** + * Sets the HTML color code of the fretboard. + * @param {string} paramColorFretboard - The HTML color code of the fretboard. + */ + set colorFretboard(paramColorFretboard) { + this.#colorFretboard = paramColorFretboard; + } // end get colorFretboard property + + /** + * Gets the HTML color code of the nut. + * @return {string} The HTML color code of the nut. + */ + get colorNut() { + return this.#colorNut; + } // end get colorNut property + + /** + * Sets the HTML color code of the nut. + * @param {string} paramColorNut - The HTML color code of the nut. + */ + set colorNut(paramColorNut) { + this.#colorNut = paramColorNut; + } // end get colorNut property + + /** + * Gets the HTML color code of the nut outline. + * @return {string} The HTML color code of the nut outline. + */ + get colorNutOutline() { + return this.#colorNutOutline; + } // end get colorNutOutline property + + /** + * Sets the HTML color code of the nut outline. + * @param {string} paramColorNutOutline - The HTML color code of the nut outline. + */ + set colorNutOutline(paramColorNutOutline) { + this.#colorNutOutline = paramColorNutOutline; + } // end get colorNutOutline property + + /** + * Gets the HTML color code of the frets. + * @return {string} The HTML color code of the frets. + */ + get colorFrets() { + return this.#colorFrets; + } // end get colorFrets property + + /** + * Gets the HTML color code of the frets. + * @param {string} paramColorFrets - The HTML color code of the frets. + */ + set colorFrets(paramColorFrets) { + this.#colorFrets = paramColorFrets; + } // end get colorFrets property + + /** + * Gets the HTML color code of the strings. + * @return {string} The HTML color code of the strings. + */ + get colorStrings() { + return this.#colorStrings; + } // end get colorStrings property + + /** + * Gets the HTML color code of the strings. + * @param {string} paramColorFrets - The HTML color code of the strings. + */ + set colorStrings(paramColorStrings) { + this.#colorStrings = paramColorStrings; + } // end get colorStrings property + + /** + * Gets the HTML color code of the fret markers. + * @return {string} The HTML color code of the fret markers. + */ + get colorFretMarkers() { + return this.#colorFretMarkers; + } // end get colorFretMarkers property + + /** + * Gets the HTML color code of the fret markers. + * @param {string} paramColorFretMarkers - The HTML color code of the fret markers. + */ + set colorFretMarkers(paramColorFretMarkers) { + this.#colorFretMarkers = paramColorFretMarkers; + } // end get colorFretMarkers property + + /** + * Gets the HTML color code of the diagram background. + * @return {string} The HTML color code of the diagram background. + */ + get colorDiagramBackground() { + return this.#colorDiagramBackground; + } // end get colorDiagramBackground property + + /** + * Gets the HTML color code of the diagram background. + * @param {string} paramColorDiagramBackground - The HTML color code of the diagram background. + */ + set colorDiagramBackground(paramColorDiagramBackground) { + if ( + paramColorDiagramBackground == "" || + paramColorDiagramBackground == null + ) { + paramColorDiagramBackground = "transparent"; + } // end if test + + this.#colorDiagramBackground = paramColorDiagramBackground; + } // end get colorDiagramBackground property + + /** + * Gets HTML color code of the label text for string names and fret number. + * @return {string} The HTML color code of the label text for string names and fret number. + */ + get colorLabel() { + return this.#colorLabel; + } // end get colorLabel property + + /** + * Gets the HTML color code of the label text for string names and fret number. + * @param {string} paramColorLabel - The HTML color code of the label text for string names and fret number. + */ + set colorLabel(paramColorLabel) { + this.#colorLabel = paramColorLabel; + } // end get colorLabel property + + // ----- Markers + /** + * Gets the marker's stroke width. + * @return {number} The marker's stroke width. + */ + get markerStrokeWidth() { + return this.#markerStrokeWidth; + } // end get markerStrokeWidth property + + /** + * Gets the marker's stroke width. + * @param {number} paramMarkerStrokeWidth - The marker's stroke width. + */ + set markerStrokeWidth(paramMarkerStrokeWidth) { + this.#markerStrokeWidth = paramMarkerStrokeWidth; + } // end get markerStrokeWidth property + + /** + * Gets the marker's font size. + * @return {number} The marker's font size. + */ + get markerFontSize() { + return this.#markerFontSize; + } // end get markerFontSize property + + /** + * Gets the marker's font size. + * @param {number} paramMarkerFontSize - The marker's font size. + */ + set markerFontSize(paramMarkerFontSize) { + this.#markerFontSize = paramMarkerFontSize; + } // end get markerFontSize property + + // ----- Dimensions/Orientation + /** + * Gets the number of frets on the diagram. + * @return {number} The number of frets on the diagram. + */ + get fretCount() { + return this.#fretCount; + } // end get fretCount property + + /** + * Sets the number of frets on the diagram. + * @param {number} paramFretCount - The number of frets on the diagram. + */ + set fretCount(paramFretCount) { + this.#fretCount = paramFretCount; + } // end get fretCount property + + /** + * Gets the scale factor of the diagram. + * @return {number} The scale factor of the diagram. + */ + get scaleFactor() { + return this.#scaleFactor; + } // end get scaleFactor property + + /** + * Sets the scale factor of the diagram. + * @param {number} paramScaleFactor - The scale factor of the diagram. + */ + set scaleFactor(paramScaleFactor) { + this.#scaleFactor = paramScaleFactor; + } // end get scaleFactor property + + /** + * Gets the horizontal status of the diagram. + * @return {boolean} The horizontal status of diagram. + */ + get orientHorizontally() { + return this.#orientHorizontally; + } // end get orientHorizontally property + + /** + * Sets the horizontal status of the diagram. + * @param {boolean} paramOrientHorizontally - The horizontal status of diagram. + */ + set orientHorizontally(paramOrientHorizontally) { + this.#orientHorizontally = paramOrientHorizontally; + } // end get orientHorizontally property + + // ----- Features + /** + * Gets the enabled status of fret markers. + * @return {boolean} The enabled status of fret markers. + */ + get fretMarkersEnabled() { + return this.#fretMarkersEnabled; + } // end get fretMarkersEnabled property + + /** + * Sets the enabled status of fret markers. + * @param {boolean} paramFretMarkersEnabled - The enabled status of fret markers. + */ + set fretMarkersEnabled(paramFretMarkersEnabled) { + this.#fretMarkersEnabled = paramFretMarkersEnabled; + } // end get fretMarkersEnabled property + + /** + * Gets the starting fret number. + * @return {number} The starting fret number. + */ + get fretStartingNumber() { + return this.#fretStartingNumber; + } // end get fretStartingNumber property + + /** + * Sets the starting fret number. + * @param {number} paramFretStartingNumber - The starting fret number. + */ + set fretStartingNumber(paramFretStartingNumber) { + this.#fretStartingNumber = paramFretStartingNumber; + } // end get fretStartingNumber property + + /** + * Gets the enabled status of string names. + * @return {boolean} The enabled status of string names. + */ + get stringNamesEnabled() { + return this.#stringNamesEnabled; + } // end get stringNamesEnabled property + + /** + * Sets the enabled status of string names. + * @param {boolean} paramStringNamesEnabled - The enabled status of string names. + */ + set stringNamesEnabled(paramStringNamesEnabled) { + this.#stringNamesEnabled = paramStringNamesEnabled; + } // end get stringNamesEnabled property + + /** + * Gets the array of string names. + * @return {array} The array of string names. + */ + get stringNames() { + return this.#stringNames; + } // end get stringNames property + + /** + * Sets the array of string names. + * @param {array} paramStringNames - The array of string names. + */ + set stringNames(paramStringNames) { + this.#stringNames = paramStringNames; + } // end get stringNames property + + /** + * Gets the enabled status of the controls. + * @return {boolean} The enabled status of the controls. + */ + get controlsEnabled() { + return this.#controlsEnabled; + } // end get controlsEnabled property + + /** + * Sets the enabled status of the controls. + * @param {boolean} paramControlsEnabled - The enabled status of the controls. + */ + set controlsEnabled(paramControlsEnabled) { + this.#controlsEnabled = paramControlsEnabled; + } // end get controlsEnabled property + + /** + * Gets the enabled status of the download image button. + * @return {boolean} The enabled status of the download image button. + */ + get downloadImageEnabled() { + return this.#downloadImageEnabled; + } // end get downloadImageEnabled property + + /** + * Sets the enabled status of the download image button. + * @param {boolean} paramDownloadImageEnabled - The enabled status of the download image button. + */ + set downloadImageEnabled(paramDownloadImageEnabled) { + this.#downloadImageEnabled = paramDownloadImageEnabled; + } // end get downloadImageEnabled property + + /** + * Gets the enabled status of the change orientation button. + * @return {boolean} The enabled status of the change orientation button. + */ + get changeOrientationEnabled() { + return this.#changeOrientationEnabled; + } // end get changeOrientationEnabled property + + /** + * Sets the enabled status of the change orientation button. + * @param {boolean} paramChangeOrientationEnabled - The enabled status of the change orientation button. + */ + set changeOrientationEnabled(paramChangeOrientationEnabled) { + this.#changeOrientationEnabled = paramChangeOrientationEnabled; + } // end get changeOrientationEnabled property + // ========== END properties + + // ========== BEGIN private methods + // ========== END private methods + + // ========== BEGIN public methods + /** + * Enables control functionality and all available individual controls by setting their enabled status to true. + */ + enableAllControls() { + this.controlsEnabled = true; + this.downloadImageEnabled = true; + this.changeOrientationEnabled = true; + } // end enableAllControls method + // ========== END public methods + + // ========== BEGIN static methods + // ========== END static methods +} // end GuitarDiagramsJSConfig class diff --git a/js/src/guitar-diagrams-marker.mjs b/js/src/guitar-diagrams-marker.mjs new file mode 100644 index 0000000..372f410 --- /dev/null +++ b/js/src/guitar-diagrams-marker.mjs @@ -0,0 +1,286 @@ +/** + * @file Guitar Diagrams JS marker class. + * @module js/lib/Guitar-Diagrams-JS/guitar-diagrams-marker.mjs + * @link https://github.com/KCarlile/guitar-diagrams-js + * + * @author Kenny Carlile + * @link https://www.kcarlile.com/ + * @link https://github.com/KCarlile + */ + +/** + * Class representing a Guitar Diagrams JS marker. + */ +export class GuitarDiagramsJSMarker { + // ========== BEGIN private members + // ----- Position and scale + #string; + #fret; + #shape; + #scale = 1; + + // ----- Event handling + #eventCallbacks; // map of events to callback functions + + // ----- Appearance + #colorFill = "#000000"; + #colorStroke = "#DDDDDD"; + #colorFont = "#FFFFFF"; + #text = ""; + #relativePosX; + #relativePosY; + #posX; + #posY; + #playSound; // bool - whether or not the marker will play a sound when clicked + + // ========== END private members + + // ========== BEGIN static members + // ========== END static members + + // ========== BEGIN constructors + /** + * Create a GuitarDiagramsJSMarker object instance. + */ + constructor() {} // end default constructor + // ========== END constructors + + // ========== BEGIN properties + // ----- Position and scale + /** + * Gets the string number of the marker. + * @return {number} The string number. + */ + get string() { + return this.#string; + } // end get string property + + /** + * Sets the string number of the marker. + * @param {number} paramString - The string number of the marker. + */ + set string(paramString) { + this.#string = paramString; + } // end get string property + + /** + * Gets the fret number of the marker. + * @return {number} The fret number. + */ + get fret() { + return this.#fret; + } // end get fret property + + /** + * Gets the shape of the marker. + * @return {string} The shape of the marker. + */ + get shape() { + return this.#shape; + } // end get shape property + + /** + * Sets the shape of the marker. + * @param {string} paramShape - The shape of the marker. + */ + set shape(paramShape) { + this.#shape = paramShape; + } // end set shape property + + /** + * Gets the playSound property of the marker + * @return {boolean} The playSound property + */ + get playSound() { + return this.#playSound; + } // end get playSound property + + /** + * Sets the playSound property of the marker. + * @param {boolean} playsound - The playSound property of the marker. + */ + set playSound(playsound) { + this.#playSound = playsound; + } // end set playsound property + + /** + * Sets the fret number of the marker. + * @param {number} paramFret - The fret number of the marker. + */ + set fret(paramFret) { + this.#fret = paramFret; + } // end get fret property + + /** + * Gets the relative scale of the marker. + * @return {number} The relative scale of the marker. + */ + get scale() { + return this.#scale; + } // end get scale property + + /** + * Sets the relative scale of the marker. + * @param {number} paramScale - The relative scale of the marker. + */ + set scale(paramScale) { + this.#scale = paramScale; + } // end get scale property + + /** + * Gets the event callbacks for the marker. + * @return {Map} The map of events to their respective callbacks + */ + get eventCallbacks() { + return this.#eventCallbacks; + } // end get eventCallbacks property + + /** + * Sets the event callbacks for the marker. + * @param {Map} The map of events to their respective callbacks + */ + set eventCallbacks(eventCallbacks) { + this.#eventCallbacks = eventCallbacks; + } // end get eventCallbacks property + + // ----- Appearance + /** + * Gets the HTML color code for fill. + * @return {string} The HTML color code for fill. + */ + get colorFill() { + return this.#colorFill; + } // end get colorFill property + + /** + * Sets the HTML color code for fill. + * @param {string} paramColorFill - The HTML color code for fill. + */ + set colorFill(paramColorFill) { + this.#colorFill = paramColorFill; + } // end get colorFill property + + /** + * Gets the HTML color code for stroke. + * @return {string} The HTML color code for stroke. + */ + get colorStroke() { + return this.#colorStroke; + } // end get colorStroke property + + /** + * Sets the HTML color code for stroke. + * @param {string} paramColorStroke - The HTML color code for stroke. + */ + set colorStroke(paramColorStroke) { + this.#colorStroke = paramColorStroke; + } // end get colorStroke property + + /** + * Gets the HTML color code for font. + * @return {string} The HTML color code for font. + */ + get colorFont() { + return this.#colorFont; + } // end get colorFont property + + /** + * Sets the HTML color code for font. + * @param {string} paramColorFont - The HTML color code for font. + */ + set colorFont(paramColorFont) { + this.#colorFont = paramColorFont; + } // end get colorFont property + + /** + * Gets the X-position of the marker. + * @return {number|null} The event name or null if none set. + */ + get posX() { + return this.#posX; + } // end get posX property + + /** + * Sets the X-position of the marker + * @param {number} posX - The x-position + */ + set posX(xPos) { + this.#posX = xPos; + } // end set posX property + + /** + * Gets the relative X-position of the marker. + * @return {number|null} The relative x-position or null if none set. + */ + get relativePosX() { + return this.#relativePosX; + } // end get relativePosX property + + /** + * Sets the relative X-position of the marker + * @param {number} relativePosX - The x-position + */ + set relativePosX(relativeXPos) { + this.#relativePosX = relativeXPos; + } // end set relativePosX property + + /** + * Gets the Y-position of the marker. + * @return {number|null} The event name or null if none set. + */ + get relativePosY() { + return this.#relativePosY; + } // end get relativePosY property + + /** + * Sets the relativer Y-position of the marker + * @param {number} posY - The y-position + */ + set relativePosY(relativeYPos) { + this.#relativePosY = relativeYPos; + } // end set relativePosY property + + /** + * Gets the text. + * @return {string} The text. + */ + get text() { + return this.#text; + } // end get text property + + /** + * Sets the text. + * @param {string} paramText - The text. + */ + set text(paramText) { + this.#text = paramText; + } // end get text property + + // ========== END properties + + // ========== BEGIN private methods + // ========== END private methods + + // ========== BEGIN public methods + + /** + * Returns a string representation of the marker GuitarDiagramsJSMarker instance. + * @returns {string} The string representation of the GuitarDiagramsJSMarker instance. + */ + + toString() { + const newline = "\n"; + const indent = " "; + + let toString = "[GuitarDiagramsJSMarker] {" + newline; + toString += indent + "text: " + this.#text + "," + newline; + toString += indent + "string: " + this.#string + "," + newline; + toString += indent + "fret: " + this.#fret + "," + newline; + toString += "}"; + return toString; + } // end toString method + // ========== END public methods + + // ========== BEGIN static methods + // ========== END static methods +} // end GuitarDiagramsJSMarker class diff --git a/js/src/guitar-diagrams-web-component.mjs b/js/src/guitar-diagrams-web-component.mjs new file mode 100644 index 0000000..1aa443b --- /dev/null +++ b/js/src/guitar-diagrams-web-component.mjs @@ -0,0 +1,931 @@ +import { GuitarDiagramsJSConfig } from "./guitar-diagrams-config.mjs"; +import { GuitarDiagramsJSMarker } from "./guitar-diagrams-marker.mjs"; +import "./tone.js"; +import { SampleLibrary } from "./tonejs-instruments/Tonejs-Instruments.js"; + +class GuitarDiagramsWebComponent extends HTMLElement { + // ========== BEGIN private members + #config; + #markers = []; + #events = []; + #eventTarget = null; + #outputSpeaker; + #docRoot; + + // ========== BEGIN static members + // These are hard coded as they are relative sizes to each other. + // Sizing can be changed by using the scaling method. + static stringSpacing = 30; + static fretboardPadding = 20; + static nutThickness = 10; + + static stringBaseWidth = 3; + static stringWidthFactor = 0.75; + static stringIndent = 20; + static stringSpacing = 30; + + static fretSpacing = 100; + static fretThickness = 6; + static fretMarkerRadius = 8; + + static markerRadius = 14; + + static stringNameFontSize = 20; + static fretNumberFontSize = 24; + + static stringNamePaddingFactor = 1.5; + + /** + * Enumeration for marker shapes. + * @readonly + * @enum {string} + */ + static Shape = { + Circle: "circle", + Square: "square", + Triangle: "triangle", + Diamond: "diamond", + }; // end Shape enumeration + + /** + * Enumeration for notation symbols. + * @readonly + * @enum {string} + */ + static Symbols = { + Flat: "♭", + Sharp: "♯", + Natural: "♮", + DoubleFlat: "𝄫", + DoubleSharp: "𝄪", + }; // end Symbols enumeration + // ========== END static members + + /** + * Gets the target element for events. + * @return {Element|null} DOM element to attach events to + */ + get eventTarget() { + return this.#eventTarget; + } // end get eventTarget property + + /** + * Sets the target element for events. + * @param {Element|null} paramEventTarget - DOM element to attach events to + */ + set eventTarget(paramEventTarget) { + this.#eventTarget = paramEventTarget; + } // end set eventTarget property + + constructor() { + super(); + this.attachShadow({ mode: "open" }); + this.#config = new GuitarDiagramsJSConfig(); + this.#outputSpeaker = SampleLibrary.load({ + instruments: "guitar-acoustic", + ext: ".ogg", + }); + this.#outputSpeaker.toMaster(); + + const canvasElement = document.createElement("canvas"); + this.#config.canvasID = this.getAttribute("canvas-id"); + canvasElement.id = this.#config.canvasID; + canvasElement.classList.add("guitar-diagrams-canvas"); + + this.#docRoot = this.shadowRoot; + this.shadowRoot.appendChild(canvasElement); + } + + connectedCallback() { + this.drawNeck(); + + let markerList = Array.from(this.getElementsByTagName("marker")); + markerList.forEach((marker) => { + this.addMarker( + marker.getAttribute("string"), + marker.getAttribute("fret"), + marker.getAttribute("text") || "", + null, + true, + null, + ); + }); + + let chordsButton = document.createElement("button"); + const canvas = this.shadowRoot.getElementById(this.#config.canvasID); + chordsButton.setAttribute( + "onclick", + "this.getRootNode().host.playAllMarkers()", + ); + chordsButton.innerHTML = "Play chord"; + + this.#docRoot.appendChild(chordsButton); + + this.drawAllMarkers(); + } + + static get observedAttributes() { + return ["canvas-id", "orient-horizontally", "fret-count", "scale-factor"]; + } + + attributeChangedCallback(name, oldValue, newValue) { + switch (name) { + case "canvas-id": + this.#config.canvasID = newValue; + break; + case "orient-horizontally": + this.#config.orientHorizontally = newValue === "true"; + break; + case "fret-count": + this.#config.fretCount = parseInt(newValue, 10); + break; + case "scale-factor": + this.#config.scaleFactor = parseFloat(newValue); + break; + } + this.drawNeck(); + this.drawAllMarkers(); + } + + #initializeDrawing() { + this.eventTarget = this.shadowRoot.getElementById(this.#config.canvasID); + const canvas = this.shadowRoot.getElementById(this.#config.canvasID); + const context = canvas.getContext("2d"); + + let fretNumberFontSize = this.#scale( + GuitarDiagramsWebComponent.fretNumberFontSize, + ); + let fretNumberIndent = + this.#config.fretStartingNumber == 0 ? 0 : fretNumberFontSize; + let stringNameFontSize = this.#scale( + GuitarDiagramsWebComponent.stringNameFontSize, + ); + let stringNameIndent = + this.#config.stringNamesEnabled == false + ? 0 + : stringNameFontSize * + GuitarDiagramsWebComponent.stringNamePaddingFactor; + let canvasHeight = + this.#scale(this.#getFretboardLength()) + stringNameIndent; + let canvasWidth = this.#scale(this.#getFretboardWidth()) + fretNumberIndent; + + if (this.#config.orientHorizontally == true) { + [canvasHeight, canvasWidth] = [canvasWidth, canvasHeight]; + } + + canvas.setAttribute("width", canvasWidth); + canvas.setAttribute("height", canvasHeight); + + let colorDiagramBackground = this.#config.colorDiagramBackground; + + if (colorDiagramBackground == "" || colorDiagramBackground == null) { + context.clearRect(0, 0, canvasWidth, canvasHeight); + } else { + context.fillStyle = this.#config.colorDiagramBackground; + context.fillRect(0, 0, canvasWidth, canvasHeight); + } + } + + #drawStringNames() { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + + if (this.#config.stringNamesEnabled) { + let stringSpacing = this.#scale(GuitarDiagramsWebComponent.stringSpacing); + let stringIndent = this.#scale(GuitarDiagramsWebComponent.stringIndent); + let stringNameFontSize = this.#scale( + GuitarDiagramsWebComponent.stringNameFontSize, + ); + let fretNumberFontSize = this.#scale( + GuitarDiagramsWebComponent.fretNumberFontSize, + ); + let stringNamesIndent = + this.#config.fretStartingNumber == 0 ? 0 : fretNumberFontSize; + let posX; + let posY; + let stringNames = [...this.#config.stringNames]; + + if (this.#config.orientHorizontally == true) { + stringNames = stringNames.reverse(); + } + + for (const [stringNumber, stringName] of Object.entries(stringNames)) { + if (this.#config.orientHorizontally == true) { + posX = stringNameFontSize / 2; + posY = + stringIndent + stringNumber * stringSpacing + stringNamesIndent; + } else { + posX = + stringIndent + stringNumber * stringSpacing + stringNamesIndent; + posY = stringNameFontSize / 2; + } + + canvas.beginPath(); + canvas.fillStyle = this.#config.colorLabel; + canvas.font = stringNameFontSize + "px Arial"; + canvas.textAlign = "center"; + canvas.textBaseline = "middle"; + canvas.stroke(); + canvas.fillText(stringName, posX, posY); + canvas.closePath(); + } + + if (this.#config.orientHorizontally == true) { + canvas.translate( + stringNameFontSize * + GuitarDiagramsWebComponent.stringNamePaddingFactor, + 0, + ); + } else { + canvas.translate( + 0, + stringNameFontSize * + GuitarDiagramsWebComponent.stringNamePaddingFactor, + ); + } + } + } + + #drawFretNumber() { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let fretNumberFontSize = this.#scale( + GuitarDiagramsWebComponent.fretNumberFontSize, + ); + + if (this.#config.fretStartingNumber != 0) { + canvas.beginPath(); + canvas.fillStyle = this.#config.colorLabel; + canvas.font = fretNumberFontSize + "px Arial"; + canvas.textAlign = "right"; + canvas.textBaseline = "middle"; + canvas.stroke(); + canvas.fillText( + this.#config.fretStartingNumber, + fretNumberFontSize / 2, + fretNumberFontSize / 2, + ); + canvas.closePath(); + + if (this.#config.orientHorizontally == true) { + canvas.translate(0, fretNumberFontSize); + } else { + canvas.translate(fretNumberFontSize, 0); + } + } + } + + #drawFretboard() { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let fretboardWidth = this.#scale(this.#getFretboardWidth()); + let fretboardLength = this.#scale(this.#getFretboardLength()); + + if (this.#config.orientHorizontally == true) { + [fretboardWidth, fretboardLength] = [fretboardLength, fretboardWidth]; + } + + canvas.beginPath(); + canvas.fillStyle = this.#config.colorFretboard; + canvas.fillRect(0, 0, fretboardWidth, fretboardLength); + canvas.closePath(); + } + + #drawNut() { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let fretboardWidth = this.#scale(this.#getFretboardWidth()); + let nutThickness = this.#scale(GuitarDiagramsWebComponent.nutThickness); + + if (this.#config.orientHorizontally == true) { + [fretboardWidth, nutThickness] = [nutThickness, fretboardWidth]; + } + + if (this.#config.fretStartingNumber == 0) { + canvas.beginPath(); + canvas.fillStyle = this.#config.colorNut; + canvas.strokeStyle = this.#config.colorNutOutline; + canvas.rect(0, 0, fretboardWidth, nutThickness); + canvas.fill(); + canvas.stroke(); + canvas.closePath(); + } + } + + #drawAllFretMarkers() { + if (this.#config.fretMarkersEnabled) { + if ( + this.#config.fretStartingNumber != 0 && + this.#config.fretStartingNumber % 2 == 0 + ) { + this.#drawFretMarker(1); + this.#drawFretMarker(3); + } else { + if (this.#config.fretStartingNumber != 0) { + this.#drawFretMarker(0); + } + + this.#drawFretMarker(2); + this.#drawFretMarker(4); + } + } + } + + #drawFretMarker(paramFretNumber) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let fretboardWidth = this.#scale(this.#getFretboardWidth()); + let fretSpacing = this.#scale(GuitarDiagramsWebComponent.fretSpacing); + let fretMarkerRadius = this.#scale( + GuitarDiagramsWebComponent.fretMarkerRadius, + ); + let posX = fretboardWidth / 2; + let posY = fretSpacing / 2 + fretSpacing * paramFretNumber; + + if (this.#config.orientHorizontally == true) { + [posX, posY] = [posY, posX]; + } + + canvas.beginPath(); + canvas.arc(posX, posY, fretMarkerRadius, 0, 2 * Math.PI); + canvas.fillStyle = this.#config.colorFretMarkers; + canvas.fill(); + canvas.closePath(); + } + + #drawAllFrets() { + for (let i = 0; i <= this.#config.fretCount; i++) { + if (i == 0 && this.#config.fretStartingNumber == 0) { + continue; + } + this.#drawFret(i); + } + } + + #drawFret(paramFretNumber) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let fretThickness = this.#scale(GuitarDiagramsWebComponent.fretThickness); + let fretSpacing = this.#scale(GuitarDiagramsWebComponent.fretSpacing); + let fretboardWidth = this.#scale(this.#getFretboardWidth()); + let posX = 0; + let posY = fretSpacing * paramFretNumber - fretThickness / 2; + + if (posY < 0) { + posY = 0; + } + + if (this.#config.orientHorizontally == true) { + [posX, posY] = [posY, posX]; + [fretboardWidth, fretThickness] = [fretThickness, fretboardWidth]; + } + + canvas.beginPath(); + canvas.fillStyle = this.#config.colorFrets; + canvas.rect(posX, posY, fretboardWidth, fretThickness); + canvas.fill(); + canvas.closePath(); + } + + #drawAllStrings() { + for (let i = 1; i <= this.#config.stringNames.length; i++) { + this.#drawString(i); + } + } + + #drawString(paramStringNumber) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + const stringCount = this.#config.stringNames.length; + let stringIndent = this.#scale(GuitarDiagramsWebComponent.stringIndent); + let stringSpacing = this.#scale(GuitarDiagramsWebComponent.stringSpacing); + let stringBaseWidth = this.#scale( + GuitarDiagramsWebComponent.stringBaseWidth, + ); + let stringWidthFactor = this.#scale( + GuitarDiagramsWebComponent.stringWidthFactor, + ); + let fretboardLength = this.#scale(this.#getFretboardLength()); + let fretboardWidth = this.#scale(this.#getFretboardWidth()); + let posX = 0; + let posY = 0; + let endX = 0; + let endY = 0; + + if (this.#config.orientHorizontally == true) { + posX = 0; + posY = + fretboardWidth - + stringIndent - + (paramStringNumber - 1) * stringSpacing - + stringBaseWidth / 2; + endX = fretboardLength; + endY = + stringBaseWidth + + (stringCount - (paramStringNumber - 1)) * stringWidthFactor; + } else { + posX = + stringIndent + + (paramStringNumber - 1) * stringSpacing - + stringBaseWidth / 2; + posY = 0; + endX = + stringBaseWidth + + (stringCount - (paramStringNumber - 1)) * stringWidthFactor; + endY = fretboardLength; + } + + canvas.beginPath(); + canvas.fillStyle = this.#config.colorStrings; + canvas.moveTo(posX, posY); + canvas.rect(posX, posY, endX, endY); + canvas.fill(); + canvas.closePath(); + } + + #drawMarker(paramMarker) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let stringCount = this.#config.stringNames.length; + let fretSpacing = this.#scale(GuitarDiagramsWebComponent.fretSpacing); + let nutThickness = this.#scale(GuitarDiagramsWebComponent.nutThickness); + let stringSpacing = this.#scale(GuitarDiagramsWebComponent.stringSpacing); + let stringIndent = this.#scale(GuitarDiagramsWebComponent.stringIndent); + let strokeWidth = this.#scale(this.#config.markerStrokeWidth); + let markerFontSize = this.#scale(this.#config.markerFontSize); + let posX = + stringIndent + + (stringCount - paramMarker.string) * stringSpacing + + strokeWidth * 0.5; + let posY = (paramMarker.fret - 1) * fretSpacing + fretSpacing / 2; + + if (paramMarker.fret == 0) { + posY = nutThickness / 2; + } + + if (this.#config.orientHorizontally == true) { + posX = + stringIndent + + (paramMarker.string - 1) * stringSpacing + + strokeWidth * 0.5; + [posX, posY] = [posY, posX]; + } + + const boundingRect = this.shadowRoot + .querySelector("canvas") + .getBoundingClientRect(); + + paramMarker.relativePosX = posX; + paramMarker.relativePosY = posY; + + paramMarker.posX = paramMarker.relativePosX; + paramMarker.posY = paramMarker.relativePosY; + + if (this.#config.orientHorizontally == true) { + paramMarker.posX += + GuitarDiagramsWebComponent.stringNameFontSize * + GuitarDiagramsWebComponent.stringNamePaddingFactor * + this.#config.scaleFactor; + } else { + paramMarker.posY += + GuitarDiagramsWebComponent.stringNameFontSize * + GuitarDiagramsWebComponent.stringNamePaddingFactor * + this.#config.scaleFactor; + } + + // paramMarker.posX = posX + boundingRect.left - window.pageXOffset; + // paramMarker.posY = + // posY + + // boundingRect.top - + // window.pageYOffset + + // GuitarDiagramsWebComponent.stringNameFontSize * + // GuitarDiagramsWebComponent.stringNamePaddingFactor * + // this.#config.scaleFactor; + // if (this.#config.orientHorizontally == true) { + // paramMarker.posX += + // GuitarDiagramsWebComponent.stringNameFontSize * + // GuitarDiagramsWebComponent.stringNamePaddingFactor * + // this.#config.scaleFactor; + // paramMarker.posY -= + // GuitarDiagramsWebComponent.stringNameFontSize * + // GuitarDiagramsWebComponent.stringNamePaddingFactor * + // this.#config.scaleFactor; + // } + + canvas.beginPath(); + canvas.fillStyle = paramMarker.colorFill; + canvas.strokeStyle = paramMarker.colorStroke; + canvas.lineWidth = strokeWidth; + + switch (paramMarker.shape) { + case GuitarDiagramsWebComponent.Shape.Square: + this.#drawMarkerSquare(posX, posY); + break; + case GuitarDiagramsWebComponent.Shape.Triangle: + this.#drawMarkerTriangle(posX, posY); + break; + case GuitarDiagramsWebComponent.Shape.Diamond: + this.#drawMarkerDiamond(posX, posY); + break; + default: + this.#drawMarkerCircle(posX, posY); + } + + canvas.closePath(); + + canvas.beginPath(); + canvas.fillStyle = paramMarker.colorFont; + canvas.textAlign = "center"; + canvas.textBaseline = "middle"; + canvas.font = markerFontSize + "px Arial"; + canvas.fillText(paramMarker.text, posX, posY + strokeWidth); + canvas.fill(); + canvas.closePath(); + } + + #drawMarkerSquare(paramPosX, paramPosY) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let markerRadius = this.#scale(GuitarDiagramsWebComponent.markerRadius); + + canvas.fillRect( + paramPosX - markerRadius, + paramPosY - markerRadius, + markerRadius * 2, + markerRadius * 2, + ); + canvas.strokeRect( + paramPosX - markerRadius, + paramPosY - markerRadius, + markerRadius * 2, + markerRadius * 2, + ); + } + + #drawMarkerCircle(paramPosX, paramPosY) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let markerRadius = this.#scale(GuitarDiagramsWebComponent.markerRadius); + + canvas.arc(paramPosX, paramPosY, markerRadius, 0, 2 * Math.PI); + canvas.fill(); + canvas.stroke(); + } + + #drawMarkerTriangle(paramPosX, paramPosY) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let markerRadius = this.#scale(GuitarDiagramsWebComponent.markerRadius); + let triangleMarkerRadius = markerRadius * 1.25; + let triangleMarkerHeight = triangleMarkerRadius * 2 * (Math.sqrt(3) / 2); + + canvas.moveTo(paramPosX, paramPosY - triangleMarkerRadius); + canvas.lineTo( + paramPosX + triangleMarkerRadius, + paramPosY - triangleMarkerRadius + triangleMarkerHeight, + ); + canvas.lineTo( + paramPosX - triangleMarkerRadius, + paramPosY - triangleMarkerRadius + triangleMarkerHeight, + ); + canvas.lineTo(paramPosX, paramPosY - triangleMarkerRadius); + canvas.fill(); + canvas.stroke(); + } + + #drawMarkerDiamond(paramPosX, paramPosY) { + const canvas = this.shadowRoot.querySelector("canvas").getContext("2d"); + let markerRadius = this.#scale(GuitarDiagramsWebComponent.markerRadius); + let diamondMarkerRadius = markerRadius * 1.25; + + canvas.moveTo(paramPosX, paramPosY - diamondMarkerRadius); + canvas.lineTo(paramPosX + diamondMarkerRadius, paramPosY); + canvas.lineTo(paramPosX, paramPosY + diamondMarkerRadius); + canvas.lineTo(paramPosX - diamondMarkerRadius, paramPosY); + canvas.lineTo(paramPosX, paramPosY - diamondMarkerRadius); + canvas.fill(); + canvas.stroke(); + } + + #addControls() { + if (this.#config.controlsEnabled) { + const controlMargins = ".5em .5em 0 0"; + const controlClass = "guitar-diagrams-control"; + const controlClassPrefix = "guitar-diagrams-"; + + const canvasElement = this.shadowRoot.querySelector("canvas"); + + const controlsDiv = this.#docRoot.createElement("div"); + controlsDiv.style = "display: block; margin-top: .5em"; + canvasElement.insertAdjacentElement("afterend", controlsDiv); + + if ( + this.#config.changeOrientationEnabled && + !this.#docRoot.getElementById( + this.#config.canvasID + "-change-orientation-button", + ) + ) { + let changeOrientationButton = this.#docRoot.createElement("input"); + + changeOrientationButton.type = "button"; + changeOrientationButton.id = + this.#config.canvasID + "-change-orientation-button"; + changeOrientationButton.style = "margin: " + controlMargins + ";"; + changeOrientationButton.classList.add( + controlClassPrefix + "change-orientation-button", + ); + changeOrientationButton.classList.add(controlClass); + changeOrientationButton.value = String.fromCodePoint(0x1f500); + + changeOrientationButton.addEventListener("click", () => { + this.#config.orientHorizontally = !this.#config.orientHorizontally; + this.drawNeck(); + this.drawAllMarkers(); + }); + + controlsDiv.insertAdjacentElement("afterend", changeOrientationButton); + } + + if ( + this.#config.downloadImageEnabled && + !this.#docRoot.getElementById( + this.#config.canvasID + "-download-image-button", + ) + ) { + let downloadButton = this.#docRoot.createElement("input"); + + downloadButton.type = "button"; + downloadButton.id = this.#config.canvasID + "-download-image-button"; + downloadButton.style = "margin: " + controlMargins + ";"; + downloadButton.classList.add( + controlClassPrefix + "download-image-button", + ); + downloadButton.classList.add(controlClass); + downloadButton.value = String.fromCodePoint(0x1f4be); + + downloadButton.addEventListener("click", () => { + const canvas = this.shadowRoot.querySelector("canvas"); + const dataURL = canvas.toDataURL("image/png"); + let a = this.#docRoot.createElement("a"); + a.href = dataURL; + a.download = this.#config.canvasID + ".png"; + a.click(); + }); + + controlsDiv.insertAdjacentElement("afterend", downloadButton); + } + } + } + + #getFretboardLength() { + let fretSpacing = GuitarDiagramsWebComponent.fretSpacing; + let fretLength = GuitarDiagramsWebComponent.fretThickness; + let fretboardLength = this.#config.fretCount * fretSpacing + fretLength / 2; + + return fretboardLength; + } + + #getFretboardWidth() { + let stringSpacing = GuitarDiagramsWebComponent.stringSpacing; + let stringIndent = GuitarDiagramsWebComponent.stringIndent; + let fretboardWidth = + this.#config.stringNames.length * stringSpacing + stringIndent / 2; + + return fretboardWidth; + } + + #scale(paramVector) { + let scale = paramVector; + scale = this.#config.scaleFactor * paramVector; + + return scale; + } + + drawNeck() { + this.#initializeDrawing(); + this.#drawStringNames(); + this.#drawFretNumber(); + this.#drawFretboard(); + this.#drawNut(); + this.#drawAllFretMarkers(); + this.#drawAllFrets(); + this.#drawAllStrings(); + this.#addControls(); + } + + addMarker( + paramString, + paramFret, + paramText = "", + paramShape = null, + playSound = false, + callbacks = null, + ) { + let stringCount = this.#config.stringNames.length; + let minFret = 0; + let maxFret = this.#config.fretCount; + + if ( + paramString < 1 || + paramString > stringCount || + paramFret < minFret || + paramFret > maxFret + ) { + console.log( + "[State] GuitarDiagramsWebComponent.addMarker(): " + + "{ minFret: " + + minFret + + " | maxFret: " + + maxFret + + " }", + ); + console.log( + "[Error] GuitarDiagramsWebComponent.addMarker(): Fret marker could not be placed on fretboard." + + " { paramString: " + + paramString + + " | paramFret: " + + paramFret + + " | paramText: " + + paramText + + " | paramShape: " + + paramShape + + " }", + ); + } else { + let marker = new GuitarDiagramsJSMarker(); + marker.string = paramString; + marker.fret = paramFret; + marker.text = paramText; + marker.playSound = playSound; + marker.shape = + paramShape == null + ? GuitarDiagramsWebComponent.Shape.Circle + : paramShape; + marker.eventCallbacks = callbacks == null ? new Map() : callbacks; + + if (playSound) { + marker.eventCallbacks.set("click", (elem) => { + this.#outputSpeaker.triggerAttackRelease( + this.markerToNoteFrequency(marker), + "2n", + ); + }); + marker.eventCallbacks.set("mousemove", (elem) => { + console.log("marker hovered"); + }); + } + + marker.eventCallbacks.forEach((v, k) => { + if (!this.#events.includes(k)) { + this.#events.push(k); + } + }); + this.#markers.push(marker); + } + } + + setUpEventListeners() { + this.#events.forEach((event) => { + this.eventTarget.addEventListener(event, (event) => { + // Get the canvas element and its current bounding rectangle + const canvas = this.shadowRoot.querySelector("canvas"); + const rect = canvas.getBoundingClientRect(); + + // Calculate mouse position relative to the canvas + const mouseX = event.clientX - rect.left; + const mouseY = event.clientY - rect.top; + + let markersWithEvent = this.#markers.filter((marker) => { + if (marker.eventCallbacks.size > 0) { + let markerEvents = Array.from(marker.eventCallbacks.keys()); + return markerEvents.length > 0 && markerEvents.includes(event.type); + } + }); + if (event.type == "click") { + markersWithEvent.forEach((marker) => { + if (marker.shape == GuitarDiagramsWebComponent.Shape.Circle) { + if ( + Math.pow(marker.posX - mouseX, 2) + + Math.pow(marker.posY - mouseY, 2) < + Math.pow( + GuitarDiagramsWebComponent.markerRadius * + this.#config.scaleFactor, + 2, + ) + ) { + marker.eventCallbacks.get(event.type)(); + } + } + }); + } + if (event.type == "mousemove") { + console.log("x: " + mouseX + "\ty: " + mouseY); + let cursorPointer = false; + markersWithEvent.forEach((marker) => { + if (marker.shape == GuitarDiagramsWebComponent.Shape.Circle) { + if ( + Math.pow(marker.posX - mouseX, 2) + + Math.pow(marker.posY - mouseY, 2) < + Math.pow( + GuitarDiagramsWebComponent.markerRadius * + this.#config.scaleFactor, + 2, + ) + ) { + cursorPointer = true; + const canvas = this.shadowRoot + .querySelector("canvas") + .getContext("2d"); + canvas.beginPath(); + canvas.fillStyle = "yellow"; + this.#drawMarkerCircle( + marker.relativePosX, + marker.relativePosY, + ); + canvas.closePath(); + } else { + const canvas = this.shadowRoot + .querySelector("canvas") + .getContext("2d"); + canvas.beginPath(); + canvas.fillStyle = marker.colorFill; + this.#drawMarkerCircle( + marker.relativePosX, + marker.relativePosY, + ); + canvas.closePath(); + } + } + }); + if (cursorPointer == true) { + canvas.style.cursor = "pointer"; + } else { + canvas.style.cursor = "default"; + } + } + }); + }); + } + + playAllMarkers() { + let allNoteFrequencies = this.#markers.map((marker) => + this.markerToNoteFrequency(marker), + ); + + // play slowly + let timeGap = 0; + let now = Tone.now(); + allNoteFrequencies.forEach((freq) => { + this.#outputSpeaker.triggerAttack(freq, now + timeGap); + timeGap += 0.5; + }); + this.#outputSpeaker.triggerRelease(allNoteFrequencies, now + timeGap + 0.5); + timeGap += 0.5; + + // play faster + allNoteFrequencies.forEach((freq) => { + this.#outputSpeaker.triggerAttack(freq, now + timeGap); + timeGap += 0.055; + }); + this.#outputSpeaker.triggerRelease(allNoteFrequencies, now + timeGap + 2); + } + + drawAllMarkers() { + const self = this; + this.#markers.forEach((marker) => { + this.#drawMarker(marker); + }); + this.setUpEventListeners(); + } + + logAllMarkers() { + if (this.#markers.length > 0) { + this.#markers.forEach((marker) => { + console.log("Marker text: " + marker); + }); + } + } + + getCanvasElement() { + let canvasElement = document.createElement("canvas"); + canvasElement.id = this.#config.canvasID; + canvasElement.classList.add("guitar-diagrams-canvas"); + + return canvasElement; + } + + markerToNoteFrequency(marker) { + let baseFreq = 0; + if (marker.string == 1) { + baseFreq = 330; + } else if (marker.string == 2) { + baseFreq = 247; + } else if (marker.string == 3) { + baseFreq = 196; + } else if (marker.string == 4) { + baseFreq = 147; + } else if (marker.string == 5) { + baseFreq = 110; + } else { + baseFreq = 82; + } + + const semitoneOffset = Math.pow(2, marker.fret / 12); + let finalNote = baseFreq * semitoneOffset; + return finalNote; + } +} + +customElements.define("my-fretboard", GuitarDiagramsWebComponent); + +export { GuitarDiagramsJSConfig } from "./guitar-diagrams-config.mjs"; +export { GuitarDiagramsJSMarker } from "./guitar-diagrams-marker.mjs"; diff --git a/js/src/guitar-diagrams.mjs b/js/src/guitar-diagrams.mjs new file mode 100644 index 0000000..ce76b43 --- /dev/null +++ b/js/src/guitar-diagrams.mjs @@ -0,0 +1,3 @@ + + + diff --git a/js/src/index.html b/js/src/index.html new file mode 100644 index 0000000..1443d63 --- /dev/null +++ b/js/src/index.html @@ -0,0 +1,14 @@ + + + + + Test + + +
+ + diff --git a/js/src/index.js b/js/src/index.js new file mode 100644 index 0000000..d910f8f --- /dev/null +++ b/js/src/index.js @@ -0,0 +1,37 @@ +import { GuitarDiagramsJS } from "./guitar-diagrams.mjs"; +import { GuitarDiagramsJSMarker } from "./guitar-diagrams-marker.mjs"; + +let gdj2 = new GuitarDiagramsJS(); +gdj2.config.canvasID = "diagram-2-canvas"; +gdj2.config.stringNamesEnabled = true; +gdj2.config.orientHorizontally = true; // set horizontal orientation +gdj2.config.scaleFactor = 2; +gdj2.addCanvasToElement("diagram-1"); +gdj2.drawNeck(); +gdj2.addMarker(4, 2, "", null, true); // add a default (circle) marker on string 3, fret 1, text empty +gdj2.addMarker(3, 0, "", null, true); +gdj2.eventTarget = document.getElementById("diagram-2-canvas"); +gdj2.addMarker(2, 2, "", null, true, null); +gdj2.addMarker(1, 0, "", null, true, null); +gdj2.addMarker(5, 0, "", null, true, null); +// gdj2.addMarker( +// 4, +// 3, +// "", +// null, +// new Map([ +// [ +// "click", +// function () { +// console.log("Marker clicked:", this.toString()); +// }, +// ], +// [ +// "mouseenter", +// function () { +// console.log("Marker clicked:", this.toString()); +// }, +// ], +// ]), +// ); +gdj2.drawAllMarkers(); // draw the markersgdj1.addCanvasToElement("diagram-1"); // add the canvas to the specified element ID on the page diff --git a/js/src/tone.js b/js/src/tone.js new file mode 100644 index 0000000..e774e5f --- /dev/null +++ b/js/src/tone.js @@ -0,0 +1,20118 @@ +/*! For license information please see Tone.js.LICENSE.txt */ !(function ( + t, + e, +) { + "object" == typeof exports && "object" == typeof module + ? (module.exports = e()) + : "function" == typeof define && define.amd + ? define([], e) + : "object" == typeof exports + ? (exports.Tone = e()) + : (t.Tone = e()); +})("undefined" != typeof self ? self : this, () => + (() => { + var t = { + 18: (t) => { + ((t.exports = function () { + throw new TypeError( + "Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.", + ); + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 113: (t) => { + ((t.exports = function (t, e) { + (null == e || e > t.length) && (e = t.length); + for (var s = 0, n = Array(e); s < e; s++) n[s] = t[s]; + return n; + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 327: (t, e, s) => { + var n = s(564).default; + ((t.exports = function (t, e) { + if ("object" != n(t) || !t) return t; + var s = t[Symbol.toPrimitive]; + if (void 0 !== s) { + var i = s.call(t, e || "default"); + if ("object" != n(i)) return i; + throw new TypeError( + "@@toPrimitive must return a primitive value.", + ); + } + return ("string" === e ? String : Number)(t); + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 474: (t) => { + ((t.exports = function (t, e) { + var s = + null == t + ? null + : ("undefined" != typeof Symbol && t[Symbol.iterator]) || + t["@@iterator"]; + if (null != s) { + var n, + i, + o, + r, + a = [], + c = !0, + h = !1; + try { + if (((o = (s = s.call(t)).next), 0 === e)) { + if (Object(s) !== s) return; + c = !1; + } else + for ( + ; + !(c = (n = o.call(s)).done) && + (a.push(n.value), a.length !== e); + c = !0 + ); + } catch (t) { + ((h = !0), (i = t)); + } finally { + try { + if ( + !c && + null != s.return && + ((r = s.return()), Object(r) !== r) + ) + return; + } finally { + if (h) throw i; + } + } + return a; + } + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 498: (t, e, s) => { + var n = s(564).default, + i = s(327); + ((t.exports = function (t) { + var e = i(t, "string"); + return "symbol" == n(e) ? e : e + ""; + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 564: (t) => { + function e(s) { + return ( + (t.exports = e = + "function" == typeof Symbol && + "symbol" == typeof Symbol.iterator + ? function (t) { + return typeof t; + } + : function (t) { + return t && + "function" == typeof Symbol && + t.constructor === Symbol && + t !== Symbol.prototype + ? "symbol" + : typeof t; + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports), + e(s) + ); + } + ((t.exports = e), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 569: (t) => { + ((t.exports = function (t) { + if (Array.isArray(t)) return t; + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 744: (t, e, s) => { + var n = s(113); + ((t.exports = function (t, e) { + if (t) { + if ("string" == typeof t) return n(t, e); + var s = {}.toString.call(t).slice(8, -1); + return ( + "Object" === s && t.constructor && (s = t.constructor.name), + "Map" === s || "Set" === s + ? Array.from(t) + : "Arguments" === s || + /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(s) + ? n(t, e) + : void 0 + ); + } + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 805: (t) => { + ((t.exports = function (t, e) { + if (!(t instanceof e)) + throw new TypeError("Cannot call a class as a function"); + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 821: (t, e, s) => { + var n = s(569), + i = s(474), + o = s(744), + r = s(18); + ((t.exports = function (t, e) { + return n(t) || i(t, e) || o(t, e) || r(); + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + 871: function (t, e, s) { + !(function (t, e, s, n) { + "use strict"; + var i = function (t, e, s) { + return { + endTime: e, + insertTime: s, + type: "exponentialRampToValue", + value: t, + }; + }, + o = function (t, e, s) { + return { + endTime: e, + insertTime: s, + type: "linearRampToValue", + value: t, + }; + }, + r = function (t, e) { + return { + startTime: e, + type: "setValue", + value: t, + }; + }, + a = function (t, e, s) { + return { + duration: s, + startTime: e, + type: "setValueCurve", + values: t, + }; + }, + c = function (t, e, s) { + var n = s.startTime, + i = s.target, + o = s.timeConstant; + return i + (e - i) * Math.exp((n - t) / o); + }, + h = function (t) { + return "exponentialRampToValue" === t.type; + }, + l = function (t) { + return "linearRampToValue" === t.type; + }, + u = function (t) { + return h(t) || l(t); + }, + p = function (t) { + return "setValue" === t.type; + }, + d = function (t) { + return "setValueCurve" === t.type; + }, + f = function t(e, s, n, i) { + var o = e[s]; + return void 0 === o + ? i + : u(o) || p(o) + ? o.value + : d(o) + ? o.values[o.values.length - 1] + : c(n, t(e, s - 1, o.startTime, i), o); + }, + _ = function (t, e, s, n, i) { + return void 0 === s + ? [n.insertTime, i] + : u(s) + ? [s.endTime, s.value] + : p(s) + ? [s.startTime, s.value] + : d(s) + ? [ + s.startTime + s.duration, + s.values[s.values.length - 1], + ] + : [s.startTime, f(t, e - 1, s.startTime, i)]; + }, + m = function (t) { + return "cancelAndHold" === t.type; + }, + g = function (t) { + return "cancelScheduledValues" === t.type; + }, + v = function (t) { + return m(t) || g(t) + ? t.cancelTime + : h(t) || l(t) + ? t.endTime + : t.startTime; + }, + y = function (t, e, s, n) { + var i = n.endTime, + o = n.value; + return s === o + ? o + : (0 < s && 0 < o) || (s < 0 && o < 0) + ? s * Math.pow(o / s, (t - e) / (i - e)) + : 0; + }, + x = function (t, e, s, n) { + return s + ((t - e) / (n.endTime - e)) * (n.value - s); + }, + w = function (t, e) { + var s = e.duration, + n = e.startTime, + i = e.values; + return (function (t, e) { + var s = Math.floor(e), + n = Math.ceil(e); + return s === n + ? t[s] + : (1 - (e - s)) * t[s] + (1 - (n - e)) * t[n]; + })(i, ((t - n) / s) * (i.length - 1)); + }, + b = function (t) { + return "setTarget" === t.type; + }, + T = (function () { + return n( + function t(e) { + (s(this, t), + (this._automationEvents = []), + (this._currenTime = 0), + (this._defaultValue = e)); + }, + [ + { + key: Symbol.iterator, + value: function () { + return this._automationEvents[Symbol.iterator](); + }, + }, + { + key: "add", + value: function (t) { + var e = v(t); + if (m(t) || g(t)) { + var s = this._automationEvents.findIndex( + function (s) { + return g(t) && d(s) + ? s.startTime + s.duration >= e + : v(s) >= e; + }, + ), + n = this._automationEvents[s]; + if ( + (-1 !== s && + (this._automationEvents = + this._automationEvents.slice(0, s)), + m(t)) + ) { + var c = + this._automationEvents[ + this._automationEvents.length - 1 + ]; + if (void 0 !== n && u(n)) { + if (void 0 !== c && b(c)) + throw new Error( + "The internal list is malformed.", + ); + var p = + void 0 === c + ? n.insertTime + : d(c) + ? c.startTime + c.duration + : v(c), + f = + void 0 === c + ? this._defaultValue + : d(c) + ? c.values[c.values.length - 1] + : c.value, + _ = h(n) ? y(e, p, f, n) : x(e, p, f, n), + w = h(n) + ? i(_, e, this._currenTime) + : o(_, e, this._currenTime); + this._automationEvents.push(w); + } + if ( + (void 0 !== c && + b(c) && + this._automationEvents.push( + r(this.getValue(e), e), + ), + void 0 !== c && + d(c) && + c.startTime + c.duration > e) + ) { + var T = e - c.startTime, + S = (c.values.length - 1) / c.duration, + k = Math.max(2, 1 + Math.ceil(T * S)), + A = (T / (k - 1)) * S, + C = c.values.slice(0, k); + if (A < 1) + for (var O = 1; O < k; O += 1) { + var D = (A * O) % 1; + C[O] = + c.values[O - 1] * (1 - D) + c.values[O] * D; + } + this._automationEvents[ + this._automationEvents.length - 1 + ] = a(C, c.startTime, T); + } + } + } else { + var M = this._automationEvents.findIndex( + function (t) { + return v(t) > e; + }, + ), + E = + -1 === M + ? this._automationEvents[ + this._automationEvents.length - 1 + ] + : this._automationEvents[M - 1]; + if (void 0 !== E && d(E) && v(E) + E.duration > e) + return !1; + var R = h(t) + ? i(t.value, t.endTime, this._currenTime) + : l(t) + ? o(t.value, e, this._currenTime) + : t; + if (-1 === M) this._automationEvents.push(R); + else { + if ( + d(t) && + e + t.duration > v(this._automationEvents[M]) + ) + return !1; + this._automationEvents.splice(M, 0, R); + } + } + return !0; + }, + }, + { + key: "flush", + value: function (t) { + var e = this._automationEvents.findIndex(function (e) { + return v(e) > t; + }); + if (e > 1) { + var s = this._automationEvents.slice(e - 1), + n = s[0]; + (b(n) && + s.unshift( + r( + f( + this._automationEvents, + e - 2, + n.startTime, + this._defaultValue, + ), + n.startTime, + ), + ), + (this._automationEvents = s)); + } + }, + }, + { + key: "getValue", + value: function (t) { + if (0 === this._automationEvents.length) + return this._defaultValue; + var s = this._automationEvents.findIndex(function (e) { + return v(e) > t; + }), + n = this._automationEvents[s], + i = + (-1 === s ? this._automationEvents.length : s) - 1, + o = this._automationEvents[i]; + if ( + void 0 !== o && + b(o) && + (void 0 === n || !u(n) || n.insertTime > t) + ) + return c( + t, + f( + this._automationEvents, + i - 1, + o.startTime, + this._defaultValue, + ), + o, + ); + if (void 0 !== o && p(o) && (void 0 === n || !u(n))) + return o.value; + if ( + void 0 !== o && + d(o) && + (void 0 === n || + !u(n) || + o.startTime + o.duration > t) + ) + return t < o.startTime + o.duration + ? w(t, o) + : o.values[o.values.length - 1]; + if (void 0 !== o && u(o) && (void 0 === n || !u(n))) + return o.value; + if (void 0 !== n && h(n)) { + var r = _( + this._automationEvents, + i, + o, + n, + this._defaultValue, + ), + a = e(r, 2), + m = a[0], + g = a[1]; + return y(t, m, g, n); + } + if (void 0 !== n && l(n)) { + var T = _( + this._automationEvents, + i, + o, + n, + this._defaultValue, + ), + S = e(T, 2), + k = S[0], + A = S[1]; + return x(t, k, A, n); + } + return this._defaultValue; + }, + }, + ], + ); + })(); + ((t.AutomationEventList = T), + (t.createCancelAndHoldAutomationEvent = function (t) { + return { + cancelTime: t, + type: "cancelAndHold", + }; + }), + (t.createCancelScheduledValuesAutomationEvent = function (t) { + return { + cancelTime: t, + type: "cancelScheduledValues", + }; + }), + (t.createExponentialRampToValueAutomationEvent = function (t, e) { + return { + endTime: e, + type: "exponentialRampToValue", + value: t, + }; + }), + (t.createLinearRampToValueAutomationEvent = function (t, e) { + return { + endTime: e, + type: "linearRampToValue", + value: t, + }; + }), + (t.createSetTargetAutomationEvent = function (t, e, s) { + return { + startTime: e, + target: t, + timeConstant: s, + type: "setTarget", + }; + }), + (t.createSetValueAutomationEvent = r), + (t.createSetValueCurveAutomationEvent = a)); + })(e, s(821), s(805), s(989)); + }, + 989: (t, e, s) => { + var n = s(498); + + function i(t, e) { + for (var s = 0; s < e.length; s++) { + var i = e[s]; + ((i.enumerable = i.enumerable || !1), + (i.configurable = !0), + "value" in i && (i.writable = !0), + Object.defineProperty(t, n(i.key), i)); + } + } + ((t.exports = function (t, e, s) { + return ( + e && i(t.prototype, e), + s && i(t, s), + Object.defineProperty(t, "prototype", { + writable: !1, + }), + t + ); + }), + (t.exports.__esModule = !0), + (t.exports.default = t.exports)); + }, + }, + e = {}; + + function s(n) { + var i = e[n]; + if (void 0 !== i) return i.exports; + var o = (e[n] = { + exports: {}, + }); + return (t[n].call(o.exports, o, o.exports, s), o.exports); + } + ((s.d = (t, e) => { + for (var n in e) + s.o(e, n) && + !s.o(t, n) && + Object.defineProperty(t, n, { + enumerable: !0, + get: e[n], + }); + }), + (s.o = (t, e) => Object.prototype.hasOwnProperty.call(t, e)), + (s.r = (t) => { + ("undefined" != typeof Symbol && + Symbol.toStringTag && + Object.defineProperty(t, Symbol.toStringTag, { + value: "Module", + }), + Object.defineProperty(t, "__esModule", { + value: !0, + })); + })); + var n = {}; + return ( + (() => { + "use strict"; + (s.r(n), + s.d(n, { + AMOscillator: () => Ho, + AMSynth: () => Or, + Abs: () => dr, + Add: () => ir, + AmplitudeEnvelope: () => kr, + Analyser: () => Ya, + AudioToGain: () => Yo, + AutoFilter: () => pa, + AutoPanner: () => fa, + AutoWah: () => ma, + BaseContext: () => Ci, + BiquadFilter: () => Dr, + BitCrusher: () => va, + Buffer: () => Oc, + BufferSource: () => Mc, + Buffers: () => Dc, + Channel: () => nc, + Chebyshev: () => xa, + Chorus: () => ka, + Clock: () => vo, + Compressor: () => cc, + Context: () => Oi, + Convolver: () => fc, + CrossFade: () => ha, + DCMeter: () => Ka, + Delay: () => yo, + Destination: () => yc, + Distortion: () => Aa, + Draw: () => Sc, + DuoSynth: () => qr, + EQ3: () => dc, + Emitter: () => Ai, + Envelope: () => wr, + FFT: () => Ja, + FMOscillator: () => Jo, + FMSynth: () => Ir, + FatOscillator: () => tr, + FeedbackCombFilter: () => Ur, + FeedbackDelay: () => Oa, + Filter: () => Mr, + Follower: () => _a, + Freeverb: () => qa, + Frequency: () => Ji, + FrequencyClass: () => Yi, + FrequencyEnvelope: () => Er, + FrequencyShifter: () => Ma, + Gain: () => ho, + GainToAudio: () => fr, + Gate: () => hc, + GrainPlayer: () => pr, + GreaterThan: () => vr, + GreaterThanZero: () => gr, + IntervalTimeline: () => Mo, + JCReverb: () => Na, + LFO: () => ar, + Limiter: () => lc, + Listener: () => bc, + Loop: () => Hr, + LowpassCombFilter: () => Qr, + Master: () => xc, + MembraneSynth: () => Nr, + Merge: () => ba, + MetalSynth: () => Vr, + Meter: () => Ha, + MidSideCompressor: () => uc, + MidSideMerge: () => Ua, + MidSideSplit: () => Ba, + Midi: () => Ao, + MidiClass: () => ko, + Mono: () => ic, + MonoSynth: () => Rr, + MultibandCompressor: () => pc, + MultibandSplit: () => oc, + Multiply: () => $o, + Negate: () => _r, + Noise: () => zo, + NoiseSynth: () => Pr, + Offline: () => To, + OfflineContext: () => qi, + OmniOscillator: () => nr, + OnePoleFilter: () => Gr, + Oscillator: () => Xo, + PWMOscillator: () => er, + PanVol: () => sc, + Panner: () => da, + Panner3D: () => rc, + Param: () => no, + Part: () => Jr, + Pattern: () => aa, + Phaser: () => za, + PingPongDelay: () => ja, + PitchShift: () => La, + Player: () => lr, + Players: () => ur, + PluckSynth: () => Zr, + PolySynth: () => Xr, + Pow: () => Fo, + PulseOscillator: () => Ko, + Recorder: () => ac, + Reverb: () => Wa, + Sampler: () => Yr, + Scale: () => or, + ScaleExp: () => yr, + Sequence: () => ca, + Signal: () => po, + Solo: () => ec, + Split: () => wa, + StateTimeline: () => so, + StereoWidener: () => Qa, + Subtract: () => mr, + SyncedSignal: () => xr, + Synth: () => Ar, + Ticks: () => Oo, + TicksClass: () => Co, + Time: () => Xi, + TimeClass: () => Zi, + Timeline: () => wi, + ToneAudioBuffer: () => Ri, + ToneAudioBuffers: () => So, + ToneAudioNode: () => io, + ToneBufferSource: () => Lo, + ToneEvent: () => $r, + ToneOscillatorNode: () => Zo, + Transport: () => gc, + TransportTime: () => to, + TransportTimeClass: () => Ki, + Tremolo: () => Za, + Unit: () => e, + UserMedia: () => Go, + Vibrato: () => Xa, + Volume: () => xo, + WaveShaper: () => Io, + Waveform: () => tc, + Zero: () => rr, + connect: () => ro, + connectSeries: () => oo, + connectSignal: () => fo, + context: () => Ac, + dbToGain: () => ji, + debug: () => t, + defaultArg: () => pi, + disconnect: () => ao, + fanIn: () => co, + ftom: () => Bi, + gainToDb: () => Li, + getContext: () => Vi, + getDestination: () => wc, + getDraw: () => kc, + getListener: () => Tc, + getTransport: () => vc, + immediate: () => mc, + intervalToFrequencyRatio: () => zi, + isArray: () => Ln, + isBoolean: () => jn, + isDefined: () => Fn, + isFunction: () => Vn, + isNote: () => Wn, + isNumber: () => Nn, + isObject: () => Pn, + isString: () => zn, + isUndef: () => In, + loaded: () => Cc, + mtof: () => Gi, + now: () => _c, + optionsFromArguments: () => ui, + setContext: () => Ni, + start: () => Pi, + supported: () => qn, + version: () => i, + })); + var t = {}; + (s.r(t), + s.d(t, { + assert: () => Bn, + assertContextRunning: () => Gn, + assertRange: () => Un, + assertUsedScheduleTime: () => Yn, + enterScheduledCallback: () => Xn, + log: () => Jn, + setLogger: () => Hn, + warn: () => Kn, + })); + var e = {}; + s.r(e); + const i = "15.1.22"; + var o = s(871); + const r = new WeakSet(), + a = new WeakMap(), + c = new WeakMap(), + h = new WeakMap(), + l = new WeakMap(), + u = new WeakMap(), + p = new WeakMap(), + d = new WeakMap(), + f = new WeakMap(), + _ = new WeakMap(), + m = { + construct: () => m, + }, + g = + /^import(?:(?:[\s]+[\w]+|(?:[\s]+[\w]+[\s]*,)?[\s]*\{[\s]*[\w]+(?:[\s]+as[\s]+[\w]+)?(?:[\s]*,[\s]*[\w]+(?:[\s]+as[\s]+[\w]+)?)*[\s]*}|(?:[\s]+[\w]+[\s]*,)?[\s]*\*[\s]+as[\s]+[\w]+)[\s]+from)?(?:[\s]*)("([^"\\]|\\.)+"|'([^'\\]|\\.)+')(?:[\s]*);?/, + v = (t, e) => { + const s = []; + let n = t.replace(/^[\s]+/, ""), + i = n.match(g); + for (; null !== i; ) { + const t = i[1].slice(1, -1), + o = i[0] + .replace(/([\s]+)?;?$/, "") + .replace(t, new URL(t, e).toString()); + (s.push(o), + (n = n.slice(i[0].length).replace(/^[\s]+/, "")), + (i = n.match(g))); + } + return [s.join(";"), n]; + }, + y = (t) => { + if (void 0 !== t && !Array.isArray(t)) + throw new TypeError( + "The parameterDescriptors property of given value for processorCtor is not an array.", + ); + }, + x = (t) => { + if ( + !((t) => { + try { + new new Proxy(t, m)(); + } catch { + return !1; + } + return !0; + })(t) + ) + throw new TypeError( + "The given value for processorCtor should be a constructor.", + ); + if (null === t.prototype || "object" != typeof t.prototype) + throw new TypeError( + "The given value for processorCtor should have a prototype.", + ); + }, + w = (t, e) => { + const s = t.get(e); + if (void 0 === s) + throw new Error("A value with the given key could not be found."); + return s; + }, + b = (t, e) => { + const s = Array.from(t).filter(e); + if (s.length > 1) throw Error("More than one element was found."); + if (0 === s.length) throw Error("No element was found."); + const [n] = s; + return (t.delete(n), n); + }, + T = (t, e, s, n) => { + const i = w(t, e), + o = b(i, (t) => t[0] === s && t[1] === n); + return (0 === i.size && t.delete(e), o); + }, + S = (t) => w(p, t), + k = (t) => { + if (r.has(t)) throw new Error("The AudioNode is already stored."); + (r.add(t), S(t).forEach((t) => t(!0))); + }, + A = (t) => "port" in t, + C = (t) => { + if (!r.has(t)) throw new Error("The AudioNode is not stored."); + (r.delete(t), S(t).forEach((t) => t(!1))); + }, + O = (t, e) => { + !A(t) && e.every((t) => 0 === t.size) && C(t); + }, + D = { + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + fftSize: 2048, + maxDecibels: -30, + minDecibels: -100, + smoothingTimeConstant: 0.8, + }, + M = (t, e) => t.context === e, + E = (t) => { + try { + t.copyToChannel(new Float32Array(1), 0, -1); + } catch { + return !1; + } + return !0; + }, + R = () => new DOMException("", "IndexSizeError"), + q = (t) => { + var e; + t.getChannelData = + ((e = t.getChannelData), + (s) => { + try { + return e.call(t, s); + } catch (t) { + if (12 === t.code) throw R(); + throw t; + } + }); + }, + I = { + numberOfChannels: 1, + }, + F = -34028234663852886e22, + V = -F, + N = (t) => r.has(t), + P = { + buffer: null, + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + loop: !1, + loopEnd: 0, + loopStart: 0, + playbackRate: 1, + }, + j = (t) => w(a, t), + L = (t) => w(h, t), + z = (t, e) => { + const { activeInputs: s } = j(t); + s.forEach((s) => + s.forEach(([s]) => { + e.includes(t) || z(s, [...e, t]); + }), + ); + const n = ((t) => "playbackRate" in t)(t) + ? [t.playbackRate] + : A(t) + ? Array.from(t.parameters.values()) + : ((t) => "frequency" in t && "gain" in t)(t) + ? [t.Q, t.detune, t.frequency, t.gain] + : ((t) => "offset" in t)(t) + ? [t.offset] + : ((t) => !("frequency" in t) && "gain" in t)(t) + ? [t.gain] + : ((t) => "detune" in t && "frequency" in t)(t) + ? [t.detune, t.frequency] + : ((t) => "pan" in t)(t) + ? [t.pan] + : []; + for (const t of n) { + const s = L(t); + void 0 !== s && s.activeInputs.forEach(([t]) => z(t, e)); + } + N(t) && C(t); + }, + W = (t) => { + z(t.destination, []); + }, + B = (t) => "context" in t, + U = (t) => B(t[0]), + G = (t, e, s, n) => { + for (const e of t) + if (s(e)) { + if (n) return !1; + throw Error("The set contains at least one similar element."); + } + return (t.add(e), !0); + }, + Q = (t, e, [s, n], i) => { + G(t, [e, s, n], (t) => t[0] === e && t[1] === s, i); + }, + Z = (t, [e, s, n], i) => { + const o = t.get(e); + void 0 === o + ? t.set(e, new Set([[s, n]])) + : G(o, [s, n], (t) => t[0] === s, i); + }, + X = (t) => "inputs" in t, + Y = (t, e, s, n) => { + if (X(e)) { + const i = e.inputs[n]; + return (t.connect(i, s, 0), [i, s, 0]); + } + return (t.connect(e, s, n), [e, s, n]); + }, + $ = (t, e, s) => { + for (const n of t) + if (n[0] === e && n[1] === s) return (t.delete(n), n); + return null; + }, + H = (t, e) => { + if (!S(t).delete(e)) + throw new Error("Missing the expected event listener."); + }, + J = (t, e, s) => { + const n = w(t, e), + i = b(n, (t) => t[0] === s); + return (0 === n.size && t.delete(e), i); + }, + K = (t, e, s, n) => { + X(e) ? t.disconnect(e.inputs[n], s, 0) : t.disconnect(e, s, n); + }, + tt = (t) => w(c, t), + et = (t) => w(l, t), + st = (t) => d.has(t), + nt = (t) => !r.has(t), + it = (t, e) => + new Promise((s) => { + if (null !== e) s(!0); + else { + const e = t.createScriptProcessor(256, 1, 1), + n = t.createGain(), + i = t.createBuffer(1, 2, 44100), + o = i.getChannelData(0); + ((o[0] = 1), (o[1] = 1)); + const r = t.createBufferSource(); + ((r.buffer = i), + (r.loop = !0), + r.connect(e).connect(t.destination), + r.connect(n), + r.disconnect(n), + (e.onaudioprocess = (n) => { + const i = n.inputBuffer.getChannelData(0); + (Array.prototype.some.call(i, (t) => 1 === t) + ? s(!0) + : s(!1), + r.stop(), + (e.onaudioprocess = null), + r.disconnect(e), + e.disconnect(t.destination)); + }), + r.start()); + } + }), + ot = (t, e) => { + const s = new Map(); + for (const e of t) + for (const t of e) { + const e = s.get(t); + s.set(t, void 0 === e ? 1 : e + 1); + } + s.forEach((t, s) => e(s, t)); + }, + rt = (t) => "context" in t, + at = (t) => { + const e = new Map(); + ((t.connect = ( + (t) => + (s, n = 0, i = 0) => { + const o = rt(s) ? t(s, n, i) : t(s, n), + r = e.get(s); + return ( + void 0 === r + ? e.set(s, [ + { + input: i, + output: n, + }, + ]) + : r.every((t) => t.input !== i || t.output !== n) && + r.push({ + input: i, + output: n, + }), + o + ); + } + )(t.connect.bind(t))), + (t.disconnect = ((s) => (n, i, o) => { + if ((s.apply(t), void 0 === n)) e.clear(); + else if ("number" == typeof n) + for (const [t, s] of e) { + const i = s.filter((t) => t.output !== n); + 0 === i.length ? e.delete(t) : e.set(t, i); + } + else if (e.has(n)) + if (void 0 === i) e.delete(n); + else { + const t = e.get(n); + if (void 0 !== t) { + const s = t.filter( + (t) => + t.output !== i && (t.input !== o || void 0 === o), + ); + 0 === s.length ? e.delete(n) : e.set(n, s); + } + } + for (const [s, n] of e) + n.forEach((e) => { + rt(s) + ? t.connect(s, e.output, e.input) + : t.connect(s, e.output); + }); + })(t.disconnect))); + }, + ct = (t, e, s, n, i) => { + const [o, r] = ((t, e, s, n) => { + const { activeInputs: i, passiveInputs: o } = j(e), + r = $(i[n], t, s); + return null === r ? [T(o, t, s, n)[2], !1] : [r[2], !0]; + })(t, s, n, i); + if ( + (null !== o && + (H(t, o), !r || e || st(t) || K(tt(t), tt(s), n, i)), + N(s)) + ) { + const { activeInputs: t } = j(s); + O(s, t); + } + }, + ht = (t, e, s, n) => { + const [i, o] = ((t, e, s) => { + const { activeInputs: n, passiveInputs: i } = L(e), + o = $(n, t, s); + return null === o ? [J(i, t, s)[1], !1] : [o[2], !0]; + })(t, s, n); + null !== i && + (H(t, i), !o || e || st(t) || tt(t).disconnect(et(s), n)); + }; + class lt { + constructor(t) { + this._map = new Map(t); + } + get size() { + return this._map.size; + } + entries() { + return this._map.entries(); + } + forEach(t, e = null) { + return this._map.forEach((s, n) => t.call(e, s, n, this)); + } + get(t) { + return this._map.get(t); + } + has(t) { + return this._map.has(t); + } + keys() { + return this._map.keys(); + } + values() { + return this._map.values(); + } + } + const ut = { + channelCount: 2, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: 1, + numberOfOutputs: 1, + parameterData: {}, + processorOptions: {}, + }; + + function pt(t, e, s, n, i) { + if ("function" == typeof t.copyFromChannel) + (0 === e[s].byteLength && (e[s] = new Float32Array(128)), + t.copyFromChannel(e[s], n, i)); + else { + const o = t.getChannelData(n); + if (0 === e[s].byteLength) e[s] = o.slice(i, i + 128); + else { + const t = new Float32Array( + o.buffer, + i * Float32Array.BYTES_PER_ELEMENT, + 128, + ); + e[s].set(t); + } + } + } + const dt = (t, e, s, n, i) => { + "function" == typeof t.copyToChannel + ? 0 !== e[s].byteLength && t.copyToChannel(e[s], n, i) + : 0 !== e[s].byteLength && t.getChannelData(n).set(e[s], i); + }, + ft = (t, e) => { + const s = []; + for (let n = 0; n < t; n += 1) { + const t = [], + i = "number" == typeof e ? e : e[n]; + for (let e = 0; e < i; e += 1) t.push(new Float32Array(128)); + s.push(t); + } + return s; + }, + _t = async (t, e, s, n, i, o, r) => { + const a = + null === e ? 128 * Math.ceil(t.context.length / 128) : e.length, + c = n.channelCount * n.numberOfInputs, + h = i.reduce((t, e) => t + e, 0), + l = 0 === h ? null : s.createBuffer(h, a, s.sampleRate); + if (void 0 === o) + throw new Error("Missing the processor constructor."); + const u = j(t), + p = await ((t, e) => { + const s = w(_, t), + n = tt(e); + return w(s, n); + })(s, t), + d = ft(n.numberOfInputs, n.channelCount), + f = ft(n.numberOfOutputs, i), + m = Array.from(t.parameters.keys()).reduce( + (t, e) => ({ ...t, [e]: new Float32Array(128) }), + {}, + ); + for (let h = 0; h < a; h += 128) { + if (n.numberOfInputs > 0 && null !== e) + for (let t = 0; t < n.numberOfInputs; t += 1) + for (let s = 0; s < n.channelCount; s += 1) + pt(e, d[t], s, s, h); + void 0 !== o.parameterDescriptors && + null !== e && + o.parameterDescriptors.forEach(({ name: t }, s) => { + pt(e, m, t, c + s, h); + }); + for (let t = 0; t < n.numberOfInputs; t += 1) + for (let e = 0; e < i[t]; e += 1) + 0 === f[t][e].byteLength && (f[t][e] = new Float32Array(128)); + try { + const t = d.map((t, e) => + 0 === u.activeInputs[e].size ? [] : t, + ), + e = r(h / s.sampleRate, s.sampleRate, () => + p.process(t, f, m), + ); + if (null !== l) + for (let t = 0, e = 0; t < n.numberOfOutputs; t += 1) { + for (let s = 0; s < i[t]; s += 1) dt(l, f[t], s, e + s, h); + e += i[t]; + } + if (!e) break; + } catch (e) { + t.dispatchEvent( + new ErrorEvent("processorerror", { + colno: e.colno, + filename: e.filename, + lineno: e.lineno, + message: e.message, + }), + ); + break; + } + } + return l; + }, + mt = { + Q: 1, + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + detune: 0, + frequency: 350, + gain: 0, + type: "lowpass", + }, + gt = { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: 6, + }, + vt = { + channelCount: 6, + channelCountMode: "explicit", + channelInterpretation: "discrete", + numberOfOutputs: 6, + }, + yt = { + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + offset: 1, + }, + xt = { + buffer: null, + channelCount: 2, + channelCountMode: "clamped-max", + channelInterpretation: "speakers", + disableNormalization: !1, + }, + wt = (t) => { + const { port1: e, port2: s } = new MessageChannel(); + return new Promise((n) => { + const i = () => { + ((s.onmessage = null), e.close(), s.close(), n()); + }; + s.onmessage = () => i(); + try { + e.postMessage(t, [t]); + } catch { + } finally { + i(); + } + }); + }, + bt = { + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + delayTime: 0, + maxDelayTime: 1, + }, + Tt = (t, e, s) => { + const n = e[s]; + if (void 0 === n) throw t(); + return n; + }, + St = { + attack: 0.003, + channelCount: 2, + channelCountMode: "clamped-max", + channelInterpretation: "speakers", + knee: 30, + ratio: 12, + release: 0.25, + threshold: -24, + }, + kt = { + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + gain: 1, + }, + At = () => new DOMException("", "InvalidStateError"), + Ct = () => new DOMException("", "InvalidAccessError"), + Ot = { + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + }, + Dt = (t, e, s, n, i, o, r, a, c, h, l) => { + const u = h.length; + let p = a; + for (let a = 0; a < u; a += 1) { + let u = s[0] * h[a]; + for (let e = 1; e < i; e += 1) { + const n = (p - e) & (c - 1); + ((u += s[e] * o[n]), (u -= t[e] * r[n])); + } + for (let t = i; t < n; t += 1) u += s[t] * o[(p - t) & (c - 1)]; + for (let s = i; s < e; s += 1) u -= t[s] * r[(p - s) & (c - 1)]; + ((o[p] = h[a]), (r[p] = u), (p = (p + 1) & (c - 1)), (l[a] = u)); + } + return p; + }, + Mt = { + channelCount: 2, + channelCountMode: "explicit", + channelInterpretation: "speakers", + }, + Et = (t) => { + const e = new Uint32Array([ + 1179011410, 40, 1163280727, 544501094, 16, 131073, 44100, 176400, + 1048580, 1635017060, 4, 0, + ]); + try { + const s = t.decodeAudioData(e.buffer, () => {}); + return void 0 !== s && (s.catch(() => {}), !0); + } catch {} + return !1; + }, + Rt = (t, e, s) => { + const n = e[s]; + void 0 !== n && n !== t[s] && (t[s] = n); + }, + qt = (t, e) => { + (Rt(t, e, "channelCount"), + Rt(t, e, "channelCountMode"), + Rt(t, e, "channelInterpretation")); + }, + It = (t) => "function" == typeof t.getFloatTimeDomainData, + Ft = (t, e, s) => { + const n = e[s]; + void 0 !== n && n !== t[s].value && (t[s].value = n); + }, + Vt = (t) => { + t.start = ( + (e) => + (s = 0, n = 0, i) => { + if (("number" == typeof i && i < 0) || n < 0 || s < 0) + throw new RangeError("The parameters can't be negative."); + e.call(t, s, n, i); + } + )(t.start); + }, + Nt = (t) => { + var e; + t.stop = + ((e = t.stop), + (s = 0) => { + if (s < 0) + throw new RangeError("The parameter can't be negative."); + e.call(t, s); + }); + }, + Pt = (t, e) => + null === t + ? 512 + : Math.max( + 512, + Math.min(16384, Math.pow(2, Math.round(Math.log2(t * e)))), + ), + jt = (t, e) => { + const s = t.createBiquadFilter(); + return ( + qt(s, e), + Ft(s, e, "Q"), + Ft(s, e, "detune"), + Ft(s, e, "frequency"), + Ft(s, e, "gain"), + Rt(s, e, "type"), + s + ); + }, + Lt = (t, e) => { + const s = t.createChannelSplitter(e.numberOfOutputs); + return ( + qt(s, e), + ((t) => { + const e = t.numberOfOutputs; + (Object.defineProperty(t, "channelCount", { + get: () => e, + set: (t) => { + if (t !== e) throw At(); + }, + }), + Object.defineProperty(t, "channelCountMode", { + get: () => "explicit", + set: (t) => { + if ("explicit" !== t) throw At(); + }, + }), + Object.defineProperty(t, "channelInterpretation", { + get: () => "discrete", + set: (t) => { + if ("discrete" !== t) throw At(); + }, + })); + })(s), + s + ); + }, + zt = (t, e) => ( + (t.connect = e.connect.bind(e)), + (t.disconnect = e.disconnect.bind(e)), + t + ), + Wt = (t, e) => { + const s = t.createDelay(e.maxDelayTime); + return (qt(s, e), Ft(s, e, "delayTime"), s); + }, + Bt = (t, e) => { + const s = t.createGain(); + return (qt(s, e), Ft(s, e, "gain"), s); + }; + + function Ut(t, e) { + const s = e[0] * e[0] + e[1] * e[1]; + return [ + (t[0] * e[0] + t[1] * e[1]) / s, + (t[1] * e[0] - t[0] * e[1]) / s, + ]; + } + + function Gt(t, e) { + let s = [0, 0]; + for (let o = t.length - 1; o >= 0; o -= 1) + ((i = e), + (s = [ + (n = s)[0] * i[0] - n[1] * i[1], + n[0] * i[1] + n[1] * i[0], + ]), + (s[0] += t[o])); + var n, i; + return s; + } + const Qt = (t, e, s, n) => t.createScriptProcessor(e, s, n), + Zt = () => new DOMException("", "NotSupportedError"), + Xt = { + numberOfChannels: 1, + }, + Yt = { + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + detune: 0, + frequency: 440, + periodicWave: void 0, + type: "sine", + }, + $t = { + channelCount: 2, + channelCountMode: "clamped-max", + channelInterpretation: "speakers", + coneInnerAngle: 360, + coneOuterAngle: 360, + coneOuterGain: 0, + distanceModel: "inverse", + maxDistance: 1e4, + orientationX: 1, + orientationY: 0, + orientationZ: 0, + panningModel: "equalpower", + positionX: 0, + positionY: 0, + positionZ: 0, + refDistance: 1, + rolloffFactor: 1, + }, + Ht = { + disableNormalization: !1, + }, + Jt = { + channelCount: 2, + channelCountMode: "explicit", + channelInterpretation: "speakers", + pan: 0, + }, + Kt = () => new DOMException("", "UnknownError"), + te = { + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + curve: null, + oversample: "none", + }, + ee = (t, e, s) => + void 0 === t.copyFromChannel + ? t.getChannelData(s)[0] + : (t.copyFromChannel(e, s), e[0]), + se = (t) => { + if (null === t) return !1; + const e = t.length; + return e % 2 != 0 + ? 0 !== t[Math.floor(e / 2)] + : t[e / 2 - 1] + t[e / 2] !== 0; + }, + ne = (t, e, s, n) => { + let i = t; + for (; !i.hasOwnProperty(e); ) i = Object.getPrototypeOf(i); + const { get: o, set: r } = Object.getOwnPropertyDescriptor(i, e); + Object.defineProperty(t, e, { + get: s(o), + set: n(r), + }); + }, + ie = (t, e, s) => { + try { + t.setValueAtTime(e, s); + } catch (n) { + if (9 !== n.code) throw n; + ie(t, e, s + 1e-7); + } + }, + oe = (t) => { + const e = t.createOscillator(); + try { + e.start(-1); + } catch (t) { + return t instanceof RangeError; + } + return !1; + }, + re = (t) => { + const e = t.createBuffer(1, 1, 44100), + s = t.createBufferSource(); + ((s.buffer = e), s.start(), s.stop()); + try { + return (s.stop(), !0); + } catch { + return !1; + } + }, + ae = (t) => { + const e = t.createOscillator(); + try { + e.stop(-1); + } catch (t) { + return t instanceof RangeError; + } + return !1; + }, + ce = () => { + try { + new DOMException(); + } catch { + return !1; + } + return !0; + }, + he = () => + new Promise((t) => { + const e = new ArrayBuffer(0), + { port1: s, port2: n } = new MessageChannel(); + ((s.onmessage = ({ data: e }) => t(null !== e)), + n.postMessage(e, [e])); + }), + le = (t, e) => { + const s = e.createGain(); + t.connect(s); + const n = ((e) => () => { + (e.call(t, s), t.removeEventListener("ended", n)); + })(t.disconnect); + (t.addEventListener("ended", n), + zt(t, s), + (t.stop = ((e) => { + let n = !1; + return (i = 0) => { + if (n) + try { + e.call(t, i); + } catch { + s.gain.setValueAtTime(0, i); + } + else (e.call(t, i), (n = !0)); + }; + })(t.stop))); + }, + ue = (t, e) => (s) => { + const n = { + value: t, + }; + return ( + Object.defineProperties(s, { + currentTarget: n, + target: n, + }), + "function" == typeof e ? e.call(t, s) : e.handleEvent.call(t, s) + ); + }, + pe = ( + (t) => + (e, s, [n, i, o], r) => { + t(e[i], [s, n, o], (t) => t[0] === s && t[1] === n, r); + } + )(G), + de = ( + (t) => + (e, s, [n, i, o], r) => { + const a = e.get(n); + void 0 === a + ? e.set(n, new Set([[i, s, o]])) + : t(a, [i, s, o], (t) => t[0] === i && t[1] === s, r); + } + )(G), + fe = ( + (t) => (e, s, n, i) => + t(e[i], (t) => t[0] === s && t[1] === n) + )(b), + _e = new WeakMap(), + me = ((t) => (e) => { + var s; + return null !== (s = t.get(e)) && void 0 !== s ? s : 0; + })(_e), + ge = + ((ve = new Map()), + (ye = new WeakMap()), + (t, e) => { + const s = ye.get(t); + if (void 0 !== s) return s; + const n = ve.get(t); + if (void 0 !== n) return n; + try { + const s = e(); + return s instanceof Promise + ? (ve.set(t, s), + s + .catch(() => !1) + .then((e) => (ve.delete(t), ye.set(t, e), e))) + : (ye.set(t, s), s); + } catch { + return (ye.set(t, !1), !1); + } + }); + var ve, ye; + const xe = "undefined" == typeof window ? null : window, + we = ((t, e) => (s, n) => { + const i = s.createAnalyser(); + if ((qt(i, n), !(n.maxDecibels > n.minDecibels))) throw e(); + return ( + Rt(i, n, "fftSize"), + Rt(i, n, "maxDecibels"), + Rt(i, n, "minDecibels"), + Rt(i, n, "smoothingTimeConstant"), + t(It, () => It(i)) || + ((t) => { + t.getFloatTimeDomainData = (e) => { + const s = new Uint8Array(e.length); + t.getByteTimeDomainData(s); + const n = Math.max(s.length, t.fftSize); + for (let t = 0; t < n; t += 1) + e[t] = 0.0078125 * (s[t] - 128); + return e; + }; + })(i), + i + ); + })(ge, R), + be = ((t) => (e) => { + const s = t(e); + if (null === s.renderer) + throw new Error( + "Missing the renderer of the given AudioNode in the audio graph.", + ); + return s.renderer; + })(j), + Te = ((t, e, s) => async (n, i, o) => { + const r = t(n); + await Promise.all( + r.activeInputs + .map((t, r) => + Array.from(t).map(async ([t, a]) => { + const c = e(t), + h = await c.render(t, i), + l = n.context.destination; + s(t) || (n === l && s(n)) || h.connect(o, a, r); + }), + ) + .reduce((t, e) => [...t, ...e], []), + ); + })(j, be, st), + Se = ((t, e, s) => () => { + const n = new WeakMap(); + return { + render(i, o) { + const r = n.get(o); + return void 0 !== r + ? Promise.resolve(r) + : (async (i, o) => { + let r = e(i); + if (!M(r, o)) { + const e = { + channelCount: r.channelCount, + channelCountMode: r.channelCountMode, + channelInterpretation: r.channelInterpretation, + fftSize: r.fftSize, + maxDecibels: r.maxDecibels, + minDecibels: r.minDecibels, + smoothingTimeConstant: r.smoothingTimeConstant, + }; + r = t(o, e); + } + return (n.set(o, r), await s(i, o, r), r); + })(i, o); + }, + }; + })(we, tt, Te), + ke = + ((Ae = u), + (t) => { + const e = Ae.get(t); + if (void 0 === e) throw At(); + return e; + }); + var Ae; + const Ce = ((t) => + null === t + ? null + : t.hasOwnProperty("OfflineAudioContext") + ? t.OfflineAudioContext + : t.hasOwnProperty("webkitOfflineAudioContext") + ? t.webkitOfflineAudioContext + : null)(xe), + Oe = ( + (t) => (e) => + null !== t && e instanceof t + )(Ce), + De = new WeakMap(), + Me = ((t) => + class { + constructor(t) { + ((this._nativeEventTarget = t), + (this._listeners = new WeakMap())); + } + addEventListener(e, s, n) { + if (null !== s) { + let i = this._listeners.get(s); + (void 0 === i && + ((i = t(this, s)), + "function" == typeof s && this._listeners.set(s, i)), + this._nativeEventTarget.addEventListener(e, i, n)); + } + } + dispatchEvent(t) { + return this._nativeEventTarget.dispatchEvent(t); + } + removeEventListener(t, e, s) { + const n = null === e ? void 0 : this._listeners.get(e); + this._nativeEventTarget.removeEventListener( + t, + void 0 === n ? null : n, + s, + ); + } + })(ue), + Ee = ((t) => + null === t + ? null + : t.hasOwnProperty("AudioContext") + ? t.AudioContext + : t.hasOwnProperty("webkitAudioContext") + ? t.webkitAudioContext + : null)(xe), + Re = ( + (t) => (e) => + null !== t && e instanceof t + )(Ee), + qe = ( + (t) => (e) => + null !== t && + "function" == typeof t.AudioNode && + e instanceof t.AudioNode + )(xe), + Ie = ( + (t) => (e) => + null !== t && + "function" == typeof t.AudioParam && + e instanceof t.AudioParam + )(xe), + Fe = ((t) => + null === t + ? null + : t.hasOwnProperty("AudioWorkletNode") + ? t.AudioWorkletNode + : null)(xe), + Ve = ((t, e, s, n, i, o, r, a, h, l, u, d, f, _, m, g) => + class extends l { + constructor(e, n, i, o) { + (super(i), (this._context = e), (this._nativeAudioNode = i)); + const r = u(e); + (d(r) && !0 !== s(it, () => it(r, g)) && at(i), + c.set(this, i), + p.set(this, new Set()), + "closed" !== e.state && n && k(this), + t(this, o, i)); + } + get channelCount() { + return this._nativeAudioNode.channelCount; + } + set channelCount(t) { + this._nativeAudioNode.channelCount = t; + } + get channelCountMode() { + return this._nativeAudioNode.channelCountMode; + } + set channelCountMode(t) { + this._nativeAudioNode.channelCountMode = t; + } + get channelInterpretation() { + return this._nativeAudioNode.channelInterpretation; + } + set channelInterpretation(t) { + this._nativeAudioNode.channelInterpretation = t; + } + get context() { + return this._context; + } + get numberOfInputs() { + return this._nativeAudioNode.numberOfInputs; + } + get numberOfOutputs() { + return this._nativeAudioNode.numberOfOutputs; + } + connect(t, s = 0, a = 0) { + if (s < 0 || s >= this._nativeAudioNode.numberOfOutputs) + throw i(); + const c = u(this._context), + l = m(c); + if (f(t) || _(t)) throw o(); + if (B(t)) { + const i = tt(t); + try { + const e = Y(this._nativeAudioNode, i, s, a), + n = nt(this); + ((l || n) && this._nativeAudioNode.disconnect(...e), + "closed" !== this.context.state && !n && nt(t) && k(t)); + } catch (t) { + if (12 === t.code) throw o(); + throw t; + } + if (e(this, t, s, a, l)) { + const e = h([this], t); + ot(e, n(l)); + } + return t; + } + const p = et(t); + if ("playbackRate" === p.name && 1024 === p.maxValue) throw r(); + try { + (this._nativeAudioNode.connect(p, s), + (l || nt(this)) && this._nativeAudioNode.disconnect(p, s)); + } catch (t) { + if (12 === t.code) throw o(); + throw t; + } + if ( + ((t, e, s, n) => { + const { activeInputs: i, passiveInputs: o } = L(e), + { outputs: r } = j(t), + a = S(t), + c = (r) => { + const a = tt(t), + c = et(e); + if (r) { + const e = J(o, t, s); + (Q(i, t, e, !1), n || st(t) || a.connect(c, s)); + } else { + const e = ((t, e, s) => + b(t, (t) => t[0] === e && t[1] === s))(i, t, s); + (Z(o, e, !1), n || st(t) || a.disconnect(c, s)); + } + }; + return ( + !!G(r, [e, s], (t) => t[0] === e && t[1] === s, !0) && + (a.add(c), + N(t) ? Q(i, t, [s, c], !0) : Z(o, [t, s, c], !0), + !0) + ); + })(this, t, s, l) + ) { + const e = h([this], t); + ot(e, n(l)); + } + } + disconnect(t, e, s) { + let n; + const r = u(this._context), + c = m(r); + if (void 0 === t) + n = ((t, e) => { + const s = j(t), + n = []; + for (const i of s.outputs) + (U(i) ? ct(t, e, ...i) : ht(t, e, ...i), n.push(i[0])); + return (s.outputs.clear(), n); + })(this, c); + else if ("number" == typeof t) { + if (t < 0 || t >= this.numberOfOutputs) throw i(); + n = ((t, e, s) => { + const n = j(t), + i = []; + for (const o of n.outputs) + o[1] === s && + (U(o) ? ct(t, e, ...o) : ht(t, e, ...o), + i.push(o[0]), + n.outputs.delete(o)); + return i; + })(this, c, t); + } else { + if (void 0 !== e && (e < 0 || e >= this.numberOfOutputs)) + throw i(); + if (B(t) && void 0 !== s && (s < 0 || s >= t.numberOfInputs)) + throw i(); + if ( + ((n = ((t, e, s, n, i) => { + const o = j(t); + return Array.from(o.outputs) + .filter( + (t) => + !( + t[0] !== s || + (void 0 !== n && t[1] !== n) || + (void 0 !== i && t[2] !== i) + ), + ) + .map( + (s) => ( + U(s) ? ct(t, e, ...s) : ht(t, e, ...s), + o.outputs.delete(s), + s[0] + ), + ); + })(this, c, t, e, s)), + 0 === n.length) + ) + throw o(); + } + for (const t of n) { + const e = h([this], t); + ot(e, a); + } + } + })( + ((Ne = a), + (t, e, s) => { + const n = []; + for (let t = 0; t < s.numberOfInputs; t += 1) n.push(new Set()); + Ne.set(t, { + activeInputs: n, + outputs: new Set(), + passiveInputs: new WeakMap(), + renderer: e, + }); + }), + ((t, e, s, n, i, o, r, a, c, h, l, u, p) => { + const d = new WeakMap(); + return (f, _, m, g, v) => { + const { activeInputs: y, passiveInputs: x } = o(_), + { outputs: w } = o(f), + b = a(f), + S = (o) => { + const a = c(_), + h = c(f); + if (o) { + const e = T(x, f, m, g); + (t(y, f, e, !1), + v || u(f) || s(h, a, m, g), + p(_) && k(_)); + } else { + const t = n(y, f, m, g); + (e(x, g, t, !1), v || u(f) || i(h, a, m, g)); + const s = r(_); + if (0 === s) l(_) && O(_, y); + else { + const t = d.get(_); + (void 0 !== t && clearTimeout(t), + d.set( + _, + setTimeout(() => { + l(_) && O(_, y); + }, 1e3 * s), + )); + } + } + }; + return ( + !!h( + w, + [_, m, g], + (t) => t[0] === _ && t[1] === m && t[2] === g, + !0, + ) && + (b.add(S), + l(f) ? t(y, f, [m, g, S], !0) : e(x, g, [f, m, S], !0), + !0) + ); + }; + })(pe, de, Y, fe, K, j, me, S, tt, G, N, st, nt), + ge, + ((t, e, s, n, i, o) => (r) => (a, c) => { + const h = t.get(a); + if (void 0 === h) { + if (!r && o(a)) { + const t = n(a), + { outputs: o } = s(a); + for (const s of o) + if (U(s)) { + const i = n(s[0]); + e(t, i, s[1], s[2]); + } else { + const e = i(s[0]); + t.disconnect(e, s[1]); + } + } + t.set(a, c); + } else t.set(a, h + c); + })(d, K, j, tt, et, N), + R, + Ct, + Zt, + ((t, e, s, n, i, o, r, a) => (c, h) => { + const l = e.get(c); + if (void 0 === l) + throw new Error("Missing the expected cycle count."); + const u = o(c.context), + p = a(u); + if (l === h) { + if ((e.delete(c), !p && r(c))) { + const e = n(c), + { outputs: o } = s(c); + for (const s of o) + if (U(s)) { + const i = n(s[0]); + t(e, i, s[1], s[2]); + } else { + const t = i(s[0]); + e.connect(t, s[1]); + } + } + } else e.set(c, l - h); + })(Y, d, j, tt, et, ke, N, Oe), + ((t, e, s) => + function n(i, o) { + const r = B(o) ? o : s(t, o); + if (((t) => "delayTime" in t)(r)) return []; + if (i[0] === r) return [i]; + if (i.includes(r)) return []; + const { outputs: a } = e(r); + return Array.from(a) + .map((t) => n([...i, r], t[0])) + .reduce((t, e) => t.concat(e), []); + })(De, j, w), + Me, + ke, + Re, + qe, + Ie, + Oe, + Fe, + ); + var Ne; + const Pe = ((t, e, s, n, i, o) => + class extends t { + constructor(t, s) { + const r = i(t), + a = { ...D, ...s }, + c = n(r, a); + (super(t, !1, c, o(r) ? e() : null), + (this._nativeAnalyserNode = c)); + } + get fftSize() { + return this._nativeAnalyserNode.fftSize; + } + set fftSize(t) { + this._nativeAnalyserNode.fftSize = t; + } + get frequencyBinCount() { + return this._nativeAnalyserNode.frequencyBinCount; + } + get maxDecibels() { + return this._nativeAnalyserNode.maxDecibels; + } + set maxDecibels(t) { + const e = this._nativeAnalyserNode.maxDecibels; + if ( + ((this._nativeAnalyserNode.maxDecibels = t), + !(t > this._nativeAnalyserNode.minDecibels)) + ) + throw ((this._nativeAnalyserNode.maxDecibels = e), s()); + } + get minDecibels() { + return this._nativeAnalyserNode.minDecibels; + } + set minDecibels(t) { + const e = this._nativeAnalyserNode.minDecibels; + if ( + ((this._nativeAnalyserNode.minDecibels = t), + !(this._nativeAnalyserNode.maxDecibels > t)) + ) + throw ((this._nativeAnalyserNode.minDecibels = e), s()); + } + get smoothingTimeConstant() { + return this._nativeAnalyserNode.smoothingTimeConstant; + } + set smoothingTimeConstant(t) { + this._nativeAnalyserNode.smoothingTimeConstant = t; + } + getByteFrequencyData(t) { + this._nativeAnalyserNode.getByteFrequencyData(t); + } + getByteTimeDomainData(t) { + this._nativeAnalyserNode.getByteTimeDomainData(t); + } + getFloatFrequencyData(t) { + this._nativeAnalyserNode.getFloatFrequencyData(t); + } + getFloatTimeDomainData(t) { + this._nativeAnalyserNode.getFloatTimeDomainData(t); + } + })(Ve, Se, R, we, ke, Oe), + je = new WeakSet(), + Le = ((t) => + null === t + ? null + : t.hasOwnProperty("AudioBuffer") + ? t.AudioBuffer + : null)(xe), + ze = ((We = new Uint32Array(1)), (t) => ((We[0] = t), We[0])); + var We; + const Be = ((t, e) => (s) => { + ((s.copyFromChannel = (n, i, o = 0) => { + const r = t(o), + a = t(i); + if (a >= s.numberOfChannels) throw e(); + const c = s.length, + h = s.getChannelData(a), + l = n.length; + for (let t = r < 0 ? -r : 0; t + r < c && t < l; t += 1) + n[t] = h[t + r]; + }), + (s.copyToChannel = (n, i, o = 0) => { + const r = t(o), + a = t(i); + if (a >= s.numberOfChannels) throw e(); + const c = s.length, + h = s.getChannelData(a), + l = n.length; + for (let t = r < 0 ? -r : 0; t + r < c && t < l; t += 1) + h[t + r] = n[t]; + })); + })(ze, R), + Ue = ((t) => (e) => { + ((e.copyFromChannel = ( + (s) => + (n, i, o = 0) => { + const r = t(o), + a = t(i); + if (r < e.length) return s.call(e, n, a, r); + } + )(e.copyFromChannel)), + (e.copyToChannel = ( + (s) => + (n, i, o = 0) => { + const r = t(o), + a = t(i); + if (r < e.length) return s.call(e, n, a, r); + } + )(e.copyToChannel))); + })(ze), + Ge = ((t, e, s, n, i, o, r, a) => { + let c = null; + return class h { + constructor(h) { + if (null === i) + throw new Error( + "Missing the native OfflineAudioContext constructor.", + ); + const { + length: l, + numberOfChannels: u, + sampleRate: p, + } = { ...I, ...h }; + null === c && (c = new i(1, 1, 44100)); + const d = + null !== n && e(o, o) + ? new n({ + length: l, + numberOfChannels: u, + sampleRate: p, + }) + : c.createBuffer(u, l, p); + if (0 === d.numberOfChannels) throw s(); + return ( + "function" != typeof d.copyFromChannel + ? (r(d), q(d)) + : e(E, () => E(d)) || a(d), + t.add(d), + d + ); + } + static [Symbol.hasInstance](e) { + return ( + (null !== e && + "object" == typeof e && + Object.getPrototypeOf(e) === h.prototype) || + t.has(e) + ); + } + }; + })( + je, + ge, + Zt, + Le, + Ce, + ((t) => () => { + if (null === t) return !1; + try { + new t({ + length: 1, + sampleRate: 44100, + }); + } catch { + return !1; + } + return !0; + })(Le), + Be, + Ue, + ), + Qe = ((t) => (e, s) => { + const n = t(e, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + gain: 0, + }); + s.connect(n).connect(e.destination); + const i = () => { + (s.removeEventListener("ended", i), + s.disconnect(n), + n.disconnect()); + }; + s.addEventListener("ended", i); + })(Bt), + Ze = ((t, e, s) => async (n, i, o) => { + const r = e(n); + await Promise.all( + Array.from(r.activeInputs).map(async ([e, n]) => { + const r = t(e), + a = await r.render(e, i); + s(e) || a.connect(o, n); + }), + ); + })(be, L, st), + Xe = ( + (t) => (e, s, n) => + t(s, e, n) + )(Ze), + Ye = ((t, e, s, n, i, o, r, a, c, h, l) => (c, u) => { + const p = c.createBufferSource(); + return ( + qt(p, u), + Ft(p, u, "playbackRate"), + Rt(p, u, "buffer"), + Rt(p, u, "loop"), + Rt(p, u, "loopEnd"), + Rt(p, u, "loopStart"), + e(s, () => s(c)) || + ((t) => { + t.start = ((e) => { + let s = !1; + return (n = 0, i = 0, o) => { + if (s) throw At(); + (e.call(t, n, i, o), (s = !0)); + }; + })(t.start); + })(p), + e(n, () => n(c)) || + ((t) => { + t.start = ( + (e) => + (s = 0, n = 0, i) => { + const o = t.buffer, + r = null === o ? n : Math.min(o.duration, n); + null !== o && r > o.duration - 0.5 / t.context.sampleRate + ? e.call(t, s, 0, 0) + : e.call(t, s, r, i); + } + )(t.start); + })(p), + e(i, () => i(c)) || h(p, c), + e(o, () => o(c)) || Vt(p), + e(r, () => r(c)) || l(p, c), + e(a, () => a(c)) || Nt(p), + t(c, p), + p + ); + })( + Qe, + ge, + (t) => { + const e = t.createBufferSource(); + e.start(); + try { + e.start(); + } catch { + return !0; + } + return !1; + }, + (t) => { + const e = t.createBufferSource(), + s = t.createBuffer(1, 1, 44100); + e.buffer = s; + try { + e.start(0, 1); + } catch { + return !1; + } + return !0; + }, + (t) => { + const e = t.createBufferSource(); + e.start(); + try { + e.stop(); + } catch { + return !1; + } + return !0; + }, + oe, + re, + ae, + 0, + ((t) => (e, s) => { + const n = s.createBuffer(1, 1, 44100); + (null === e.buffer && (e.buffer = n), + t( + e, + "buffer", + (t) => () => { + const s = t.call(e); + return s === n ? null : s; + }, + (t) => (s) => t.call(e, null === s ? n : s), + )); + })(ne), + le, + ), + $e = ((t, e) => (s, n, i) => (t(n).replay(i), e(n, s, i)))( + ((t) => (e) => { + const s = t(e); + if (null === s.renderer) + throw new Error( + "Missing the renderer of the given AudioParam in the audio graph.", + ); + return s.renderer; + })(L), + Ze, + ), + He = ((t, e, s, n, i) => () => { + const o = new WeakMap(); + let r = null, + a = null; + return { + set start(t) { + r = t; + }, + set stop(t) { + a = t; + }, + render(c, h) { + const l = o.get(h); + return void 0 !== l + ? Promise.resolve(l) + : (async (c, h) => { + let l = s(c); + const u = M(l, h); + if (!u) { + const t = { + buffer: l.buffer, + channelCount: l.channelCount, + channelCountMode: l.channelCountMode, + channelInterpretation: l.channelInterpretation, + loop: l.loop, + loopEnd: l.loopEnd, + loopStart: l.loopStart, + playbackRate: l.playbackRate.value, + }; + ((l = e(h, t)), + null !== r && l.start(...r), + null !== a && l.stop(a)); + } + return ( + o.set(h, l), + u + ? await t(h, c.playbackRate, l.playbackRate) + : await n(h, c.playbackRate, l.playbackRate), + await i(c, h, l), + l + ); + })(c, h); + }, + }; + })(Xe, Ye, tt, $e, Te), + Je = ( + (t, e, s, n, i, r, a, c, h, l, u, p, d) => + (n, f, _, m = null, g = null) => { + const v = _.value, + y = new o.AutomationEventList(v), + x = f + ? ((t) => ({ + replay(e) { + for (const s of t) + if ("exponentialRampToValue" === s.type) { + const { endTime: t, value: n } = s; + e.exponentialRampToValueAtTime(n, t); + } else if ("linearRampToValue" === s.type) { + const { endTime: t, value: n } = s; + e.linearRampToValueAtTime(n, t); + } else if ("setTarget" === s.type) { + const { + startTime: t, + target: n, + timeConstant: i, + } = s; + e.setTargetAtTime(n, t, i); + } else if ("setValue" === s.type) { + const { startTime: t, value: n } = s; + e.setValueAtTime(n, t); + } else { + if ("setValueCurve" !== s.type) + throw new Error( + "Can't apply an unknown automation.", + ); + { + const { + duration: t, + startTime: n, + values: i, + } = s; + e.setValueCurveAtTime(i, n, t); + } + } + }, + }))(y) + : null, + w = { + get defaultValue() { + return v; + }, + get maxValue() { + return null === m ? _.maxValue : m; + }, + get minValue() { + return null === g ? _.minValue : g; + }, + get value() { + return _.value; + }, + set value(t) { + ((_.value = t), w.setValueAtTime(t, n.context.currentTime)); + }, + cancelAndHoldAtTime(t) { + if ("function" == typeof _.cancelAndHoldAtTime) + (null === x && y.flush(n.context.currentTime), + y.add(i(t)), + _.cancelAndHoldAtTime(t)); + else { + const e = Array.from(y).pop(); + (null === x && y.flush(n.context.currentTime), + y.add(i(t))); + const s = Array.from(y).pop(); + (_.cancelScheduledValues(t), + e !== s && + void 0 !== s && + ("exponentialRampToValue" === s.type + ? _.exponentialRampToValueAtTime(s.value, s.endTime) + : "linearRampToValue" === s.type + ? _.linearRampToValueAtTime(s.value, s.endTime) + : "setValue" === s.type + ? _.setValueAtTime(s.value, s.startTime) + : "setValueCurve" === s.type && + _.setValueCurveAtTime( + s.values, + s.startTime, + s.duration, + ))); + } + return w; + }, + cancelScheduledValues: (t) => ( + null === x && y.flush(n.context.currentTime), + y.add(r(t)), + _.cancelScheduledValues(t), + w + ), + exponentialRampToValueAtTime(t, e) { + if (0 === t) throw new RangeError(); + if (!Number.isFinite(e) || e < 0) throw new RangeError(); + const s = n.context.currentTime; + return ( + null === x && y.flush(s), + 0 === Array.from(y).length && + (y.add(l(v, s)), _.setValueAtTime(v, s)), + y.add(a(t, e)), + _.exponentialRampToValueAtTime(t, e), + w + ); + }, + linearRampToValueAtTime(t, e) { + const s = n.context.currentTime; + return ( + null === x && y.flush(s), + 0 === Array.from(y).length && + (y.add(l(v, s)), _.setValueAtTime(v, s)), + y.add(c(t, e)), + _.linearRampToValueAtTime(t, e), + w + ); + }, + setTargetAtTime: (t, e, s) => ( + null === x && y.flush(n.context.currentTime), + y.add(h(t, e, s)), + _.setTargetAtTime(t, e, s), + w + ), + setValueAtTime: (t, e) => ( + null === x && y.flush(n.context.currentTime), + y.add(l(t, e)), + _.setValueAtTime(t, e), + w + ), + setValueCurveAtTime(t, e, s) { + const i = + t instanceof Float32Array ? t : new Float32Array(t); + if (null !== p && "webkitAudioContext" === p.name) { + const t = e + s, + o = n.context.sampleRate, + r = Math.ceil(e * o), + a = Math.floor(t * o), + c = a - r, + h = new Float32Array(c); + for (let t = 0; t < c; t += 1) { + const n = ((i.length - 1) / s) * ((r + t) / o - e), + a = Math.floor(n), + c = Math.ceil(n); + h[t] = + a === c + ? i[a] + : (1 - (n - a)) * i[a] + (1 - (c - n)) * i[c]; + } + (null === x && y.flush(n.context.currentTime), + y.add(u(h, e, s)), + _.setValueCurveAtTime(h, e, s)); + const l = a / o; + (l < t && d(w, h[h.length - 1], l), + d(w, i[i.length - 1], t)); + } else + (null === x && y.flush(n.context.currentTime), + y.add(u(i, e, s)), + _.setValueCurveAtTime(i, e, s)); + return w; + }, + }; + return (s.set(w, _), e.set(w, n), t(w, x), w); + } + )( + ((Ke = h), + (t, e) => { + Ke.set(t, { + activeInputs: new Set(), + passiveInputs: new WeakMap(), + renderer: e, + }); + }), + De, + l, + 0, + o.createCancelAndHoldAutomationEvent, + o.createCancelScheduledValuesAutomationEvent, + o.createExponentialRampToValueAutomationEvent, + o.createLinearRampToValueAutomationEvent, + o.createSetTargetAutomationEvent, + o.createSetValueAutomationEvent, + o.createSetValueCurveAutomationEvent, + Ee, + ie, + ); + var Ke; + const ts = ((t, e, s, n, i, o, r, a) => + class extends t { + constructor(t, n) { + const a = o(t), + c = { ...P, ...n }, + h = i(a, c), + l = r(a), + u = l ? e() : null; + (super(t, !1, h, u), + (this._audioBufferSourceNodeRenderer = u), + (this._isBufferNullified = !1), + (this._isBufferSet = null !== c.buffer), + (this._nativeAudioBufferSourceNode = h), + (this._onended = null), + (this._playbackRate = s(this, l, h.playbackRate, V, F))); + } + get buffer() { + return this._isBufferNullified + ? null + : this._nativeAudioBufferSourceNode.buffer; + } + set buffer(t) { + if ( + ((this._nativeAudioBufferSourceNode.buffer = t), null !== t) + ) { + if (this._isBufferSet) throw n(); + this._isBufferSet = !0; + } + } + get loop() { + return this._nativeAudioBufferSourceNode.loop; + } + set loop(t) { + this._nativeAudioBufferSourceNode.loop = t; + } + get loopEnd() { + return this._nativeAudioBufferSourceNode.loopEnd; + } + set loopEnd(t) { + this._nativeAudioBufferSourceNode.loopEnd = t; + } + get loopStart() { + return this._nativeAudioBufferSourceNode.loopStart; + } + set loopStart(t) { + this._nativeAudioBufferSourceNode.loopStart = t; + } + get onended() { + return this._onended; + } + set onended(t) { + const e = "function" == typeof t ? a(this, t) : null; + this._nativeAudioBufferSourceNode.onended = e; + const s = this._nativeAudioBufferSourceNode.onended; + this._onended = null !== s && s === e ? t : s; + } + get playbackRate() { + return this._playbackRate; + } + start(t = 0, e = 0, s) { + if ( + (this._nativeAudioBufferSourceNode.start(t, e, s), + null !== this._audioBufferSourceNodeRenderer && + (this._audioBufferSourceNodeRenderer.start = + void 0 === s ? [t, e] : [t, e, s]), + "closed" !== this.context.state) + ) { + k(this); + const t = () => { + (this._nativeAudioBufferSourceNode.removeEventListener( + "ended", + t, + ), + N(this) && C(this)); + }; + this._nativeAudioBufferSourceNode.addEventListener( + "ended", + t, + ); + } + } + stop(t = 0) { + (this._nativeAudioBufferSourceNode.stop(t), + null !== this._audioBufferSourceNodeRenderer && + (this._audioBufferSourceNodeRenderer.stop = t)); + } + })(Ve, He, Je, At, Ye, ke, Oe, ue), + es = ((t, e, s, n, i, o, r, a) => + class extends t { + constructor(t, e) { + const s = o(t), + n = r(s), + c = i(s, e, n); + (super( + t, + !1, + c, + n + ? ((t) => { + const e = new WeakMap(); + return { + render(s, n) { + const i = e.get(n); + return void 0 !== i + ? Promise.resolve(i) + : (async (s, n) => { + const i = n.destination; + return (e.set(n, i), await t(s, n, i), i); + })(s, n); + }, + }; + })(a) + : null, + ), + (this._isNodeOfNativeOfflineAudioContext = n), + (this._nativeAudioDestinationNode = c)); + } + get channelCount() { + return this._nativeAudioDestinationNode.channelCount; + } + set channelCount(t) { + if (this._isNodeOfNativeOfflineAudioContext) throw n(); + if (t > this._nativeAudioDestinationNode.maxChannelCount) + throw s(); + this._nativeAudioDestinationNode.channelCount = t; + } + get channelCountMode() { + return this._nativeAudioDestinationNode.channelCountMode; + } + set channelCountMode(t) { + if (this._isNodeOfNativeOfflineAudioContext) throw n(); + this._nativeAudioDestinationNode.channelCountMode = t; + } + get maxChannelCount() { + return this._nativeAudioDestinationNode.maxChannelCount; + } + })( + Ve, + 0, + R, + At, + ((t, e) => (s, n, i) => { + const o = s.destination; + if (o.channelCount !== n) + try { + o.channelCount = n; + } catch {} + (i && + "explicit" !== o.channelCountMode && + (o.channelCountMode = "explicit"), + 0 === o.maxChannelCount && + Object.defineProperty(o, "maxChannelCount", { + value: n, + })); + const r = t(s, { + channelCount: n, + channelCountMode: o.channelCountMode, + channelInterpretation: o.channelInterpretation, + gain: 1, + }); + return ( + e( + r, + "channelCount", + (t) => () => t.call(r), + (t) => (e) => { + t.call(r, e); + try { + o.channelCount = e; + } catch (t) { + if (e > o.maxChannelCount) throw t; + } + }, + ), + e( + r, + "channelCountMode", + (t) => () => t.call(r), + (t) => (e) => { + (t.call(r, e), (o.channelCountMode = e)); + }, + ), + e( + r, + "channelInterpretation", + (t) => () => t.call(r), + (t) => (e) => { + (t.call(r, e), (o.channelInterpretation = e)); + }, + ), + Object.defineProperty(r, "maxChannelCount", { + get: () => o.maxChannelCount, + }), + r.connect(o), + r + ); + })(Bt, ne), + ke, + Oe, + Te, + ), + ss = ((t, e, s, n, i) => () => { + const o = new WeakMap(); + return { + render(r, a) { + const c = o.get(a); + return void 0 !== c + ? Promise.resolve(c) + : (async (r, a) => { + let c = s(r); + const h = M(c, a); + if (!h) { + const t = { + Q: c.Q.value, + channelCount: c.channelCount, + channelCountMode: c.channelCountMode, + channelInterpretation: c.channelInterpretation, + detune: c.detune.value, + frequency: c.frequency.value, + gain: c.gain.value, + type: c.type, + }; + c = e(a, t); + } + return ( + o.set(a, c), + h + ? (await t(a, r.Q, c.Q), + await t(a, r.detune, c.detune), + await t(a, r.frequency, c.frequency), + await t(a, r.gain, c.gain)) + : (await n(a, r.Q, c.Q), + await n(a, r.detune, c.detune), + await n(a, r.frequency, c.frequency), + await n(a, r.gain, c.gain)), + await i(r, a, c), + c + ); + })(r, a); + }, + }; + })(Xe, jt, tt, $e, Te), + ns = ( + (t) => (e, s) => + t.set(e, s) + )(_e), + is = ((t, e, s, n, i, o, r, a) => + class extends t { + constructor(t, n) { + const c = o(t), + h = { ...mt, ...n }, + l = i(c, h), + u = r(c); + (super(t, !1, l, u ? s() : null), + (this._Q = e(this, u, l.Q, V, F)), + (this._detune = e( + this, + u, + l.detune, + 1200 * Math.log2(V), + -1200 * Math.log2(V), + )), + (this._frequency = e( + this, + u, + l.frequency, + t.sampleRate / 2, + 0, + )), + (this._gain = e(this, u, l.gain, 40 * Math.log10(V), F)), + (this._nativeBiquadFilterNode = l), + a(this, 1)); + } + get detune() { + return this._detune; + } + get frequency() { + return this._frequency; + } + get gain() { + return this._gain; + } + get Q() { + return this._Q; + } + get type() { + return this._nativeBiquadFilterNode.type; + } + set type(t) { + this._nativeBiquadFilterNode.type = t; + } + getFrequencyResponse(t, e, s) { + try { + this._nativeBiquadFilterNode.getFrequencyResponse(t, e, s); + } catch (t) { + if (11 === t.code) throw n(); + throw t; + } + if (t.length !== e.length || e.length !== s.length) throw n(); + } + })(Ve, Je, ss, Ct, jt, ke, Oe, ns), + os = ((t, e) => (s, n, i) => { + const o = new Set(); + return ( + (s.connect = ( + (i) => + (r, a = 0, c = 0) => { + const h = 0 === o.size; + if (e(r)) + return ( + i.call(s, r, a, c), + t( + o, + [r, a, c], + (t) => t[0] === r && t[1] === a && t[2] === c, + !0, + ), + h && n(), + r + ); + (i.call(s, r, a), + t(o, [r, a], (t) => t[0] === r && t[1] === a, !0), + h && n()); + } + )(s.connect)), + (s.disconnect = ((t) => (n, r, a) => { + const c = o.size > 0; + if (void 0 === n) (t.apply(s), o.clear()); + else if ("number" == typeof n) { + t.call(s, n); + for (const t of o) t[1] === n && o.delete(t); + } else { + e(n) ? t.call(s, n, r, a) : t.call(s, n, r); + for (const t of o) + t[0] !== n || + (void 0 !== r && t[1] !== r) || + (void 0 !== a && t[2] !== a) || + o.delete(t); + } + const h = 0 === o.size; + c && h && i(); + })(s.disconnect)), + s + ); + })(G, qe), + rs = ((t, e) => (s, n) => { + ((n.channelCount = 1), + (n.channelCountMode = "explicit"), + Object.defineProperty(n, "channelCount", { + get: () => 1, + set: () => { + throw t(); + }, + }), + Object.defineProperty(n, "channelCountMode", { + get: () => "explicit", + set: () => { + throw t(); + }, + })); + const i = s.createBufferSource(); + e( + n, + () => { + const t = n.numberOfInputs; + for (let e = 0; e < t; e += 1) i.connect(n, 0, e); + }, + () => i.disconnect(n), + ); + })(At, os), + as = ((t, e) => (s, n) => { + const i = s.createChannelMerger(n.numberOfInputs); + return ( + null !== t && "webkitAudioContext" === t.name && e(s, i), + qt(i, n), + i + ); + })(Ee, rs), + cs = ((t, e, s) => () => { + const n = new WeakMap(); + return { + render(i, o) { + const r = n.get(o); + return void 0 !== r + ? Promise.resolve(r) + : (async (i, o) => { + let r = e(i); + if (!M(r, o)) { + const e = { + channelCount: r.channelCount, + channelCountMode: r.channelCountMode, + channelInterpretation: r.channelInterpretation, + numberOfInputs: r.numberOfInputs, + }; + r = t(o, e); + } + return (n.set(o, r), await s(i, o, r), r); + })(i, o); + }, + }; + })(as, tt, Te), + hs = ((t, e, s, n, i) => + class extends t { + constructor(t, o) { + const r = n(t), + a = { ...gt, ...o }; + super(t, !1, s(r, a), i(r) ? e() : null); + } + })(Ve, cs, as, ke, Oe), + ls = ((t, e, s) => () => { + const n = new WeakMap(); + return { + render(i, o) { + const r = n.get(o); + return void 0 !== r + ? Promise.resolve(r) + : (async (i, o) => { + let r = e(i); + if (!M(r, o)) { + const e = { + channelCount: r.channelCount, + channelCountMode: r.channelCountMode, + channelInterpretation: r.channelInterpretation, + numberOfOutputs: r.numberOfOutputs, + }; + r = t(o, e); + } + return (n.set(o, r), await s(i, o, r), r); + })(i, o); + }, + }; + })(Lt, tt, Te), + us = ((t, e, s, n, i) => + class extends t { + constructor(t, o) { + const r = n(t), + a = ((t) => ({ ...t, channelCount: t.numberOfOutputs }))({ + ...vt, + ...o, + }); + super(t, !1, s(r, a), i(r) ? e() : null); + } + })(Ve, ls, Lt, ke, Oe), + ps = ( + (t, e, s, n) => + (i, { offset: o, ...r }) => { + const a = i.createBuffer(1, 2, 44100), + c = e(i, { + buffer: null, + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + loop: !1, + loopEnd: 0, + loopStart: 0, + playbackRate: 1, + }), + h = s(i, { ...r, gain: o }), + l = a.getChannelData(0); + ((l[0] = 1), (l[1] = 1), (c.buffer = a), (c.loop = !0)); + const u = { + get bufferSize() {}, + get channelCount() { + return h.channelCount; + }, + set channelCount(t) { + h.channelCount = t; + }, + get channelCountMode() { + return h.channelCountMode; + }, + set channelCountMode(t) { + h.channelCountMode = t; + }, + get channelInterpretation() { + return h.channelInterpretation; + }, + set channelInterpretation(t) { + h.channelInterpretation = t; + }, + get context() { + return h.context; + }, + get inputs() { + return []; + }, + get numberOfInputs() { + return c.numberOfInputs; + }, + get numberOfOutputs() { + return h.numberOfOutputs; + }, + get offset() { + return h.gain; + }, + get onended() { + return c.onended; + }, + set onended(t) { + c.onended = t; + }, + addEventListener: (...t) => + c.addEventListener(t[0], t[1], t[2]), + dispatchEvent: (...t) => c.dispatchEvent(t[0]), + removeEventListener: (...t) => + c.removeEventListener(t[0], t[1], t[2]), + start(t = 0) { + c.start.call(c, t); + }, + stop(t = 0) { + c.stop.call(c, t); + }, + }; + return ( + t(i, c), + n( + zt(u, h), + () => c.connect(h), + () => c.disconnect(h), + ) + ); + } + )(Qe, Ye, Bt, os), + ds = ((t, e, s, n, i) => (o, r) => { + if (void 0 === o.createConstantSource) return s(o, r); + const a = o.createConstantSource(); + return ( + qt(a, r), + Ft(a, r, "offset"), + e(n, () => n(o)) || Vt(a), + e(i, () => i(o)) || Nt(a), + t(o, a), + a + ); + })(Qe, ge, ps, oe, ae), + fs = ((t, e, s, n, i) => () => { + const o = new WeakMap(); + let r = null, + a = null; + return { + set start(t) { + r = t; + }, + set stop(t) { + a = t; + }, + render(c, h) { + const l = o.get(h); + return void 0 !== l + ? Promise.resolve(l) + : (async (c, h) => { + let l = s(c); + const u = M(l, h); + if (!u) { + const t = { + channelCount: l.channelCount, + channelCountMode: l.channelCountMode, + channelInterpretation: l.channelInterpretation, + offset: l.offset.value, + }; + ((l = e(h, t)), + null !== r && l.start(r), + null !== a && l.stop(a)); + } + return ( + o.set(h, l), + u + ? await t(h, c.offset, l.offset) + : await n(h, c.offset, l.offset), + await i(c, h, l), + l + ); + })(c, h); + }, + }; + })(Xe, ds, tt, $e, Te), + _s = ((t, e, s, n, i, o, r) => + class extends t { + constructor(t, r) { + const a = i(t), + c = { ...yt, ...r }, + h = n(a, c), + l = o(a), + u = l ? s() : null; + (super(t, !1, h, u), + (this._constantSourceNodeRenderer = u), + (this._nativeConstantSourceNode = h), + (this._offset = e(this, l, h.offset, V, F)), + (this._onended = null)); + } + get offset() { + return this._offset; + } + get onended() { + return this._onended; + } + set onended(t) { + const e = "function" == typeof t ? r(this, t) : null; + this._nativeConstantSourceNode.onended = e; + const s = this._nativeConstantSourceNode.onended; + this._onended = null !== s && s === e ? t : s; + } + start(t = 0) { + if ( + (this._nativeConstantSourceNode.start(t), + null !== this._constantSourceNodeRenderer && + (this._constantSourceNodeRenderer.start = t), + "closed" !== this.context.state) + ) { + k(this); + const t = () => { + (this._nativeConstantSourceNode.removeEventListener( + "ended", + t, + ), + N(this) && C(this)); + }; + this._nativeConstantSourceNode.addEventListener("ended", t); + } + } + stop(t = 0) { + (this._nativeConstantSourceNode.stop(t), + null !== this._constantSourceNodeRenderer && + (this._constantSourceNodeRenderer.stop = t)); + } + })(Ve, Je, fs, ds, ke, Oe, ue), + ms = ((t, e) => (s, n) => { + const i = s.createConvolver(); + if ( + (qt(i, n), + n.disableNormalization === i.normalize && + (i.normalize = !n.disableNormalization), + Rt(i, n, "buffer"), + n.channelCount > 2) + ) + throw t(); + if ( + (e( + i, + "channelCount", + (t) => () => t.call(i), + (e) => (s) => { + if (s > 2) throw t(); + return e.call(i, s); + }, + ), + "max" === n.channelCountMode) + ) + throw t(); + return ( + e( + i, + "channelCountMode", + (t) => () => t.call(i), + (e) => (s) => { + if ("max" === s) throw t(); + return e.call(i, s); + }, + ), + i + ); + })(Zt, ne), + gs = ((t, e, s) => () => { + const n = new WeakMap(); + return { + render(i, o) { + const r = n.get(o); + return void 0 !== r + ? Promise.resolve(r) + : (async (i, o) => { + let r = e(i); + if (!M(r, o)) { + const e = { + buffer: r.buffer, + channelCount: r.channelCount, + channelCountMode: r.channelCountMode, + channelInterpretation: r.channelInterpretation, + disableNormalization: !r.normalize, + }; + r = t(o, e); + } + return ( + n.set(o, r), + X(r) ? await s(i, o, r.inputs[0]) : await s(i, o, r), + r + ); + })(i, o); + }, + }; + })(ms, tt, Te), + vs = ((t, e, s, n, i, o) => + class extends t { + constructor(t, r) { + const a = n(t), + c = { ...xt, ...r }, + h = s(a, c); + (super(t, !1, h, i(a) ? e() : null), + (this._isBufferNullified = !1), + (this._nativeConvolverNode = h), + null !== c.buffer && o(this, c.buffer.duration)); + } + get buffer() { + return this._isBufferNullified + ? null + : this._nativeConvolverNode.buffer; + } + set buffer(t) { + if ( + ((this._nativeConvolverNode.buffer = t), + null === t && null !== this._nativeConvolverNode.buffer) + ) { + const t = this._nativeConvolverNode.context; + ((this._nativeConvolverNode.buffer = t.createBuffer( + 1, + 1, + t.sampleRate, + )), + (this._isBufferNullified = !0), + o(this, 0)); + } else + ((this._isBufferNullified = !1), + o( + this, + null === this._nativeConvolverNode.buffer + ? 0 + : this._nativeConvolverNode.buffer.duration, + )); + } + get normalize() { + return this._nativeConvolverNode.normalize; + } + set normalize(t) { + this._nativeConvolverNode.normalize = t; + } + })(Ve, gs, ms, ke, Oe, ns), + ys = ((t, e, s, n, i) => (o) => { + const r = new WeakMap(); + return { + render(a, c) { + const h = r.get(c); + return void 0 !== h + ? Promise.resolve(h) + : (async (a, c) => { + let h = s(a); + const l = M(h, c); + if (!l) { + const t = { + channelCount: h.channelCount, + channelCountMode: h.channelCountMode, + channelInterpretation: h.channelInterpretation, + delayTime: h.delayTime.value, + maxDelayTime: o, + }; + h = e(c, t); + } + return ( + r.set(c, h), + l + ? await t(c, a.delayTime, h.delayTime) + : await n(c, a.delayTime, h.delayTime), + await i(a, c, h), + h + ); + })(a, c); + }, + }; + })(Xe, Wt, tt, $e, Te), + xs = ((t, e, s, n, i, o, r) => + class extends t { + constructor(t, a) { + const c = i(t), + h = { ...bt, ...a }, + l = n(c, h), + u = o(c); + (super(t, !1, l, u ? s(h.maxDelayTime) : null), + (this._delayTime = e(this, u, l.delayTime)), + r(this, h.maxDelayTime)); + } + get delayTime() { + return this._delayTime; + } + })(Ve, Je, ys, Wt, ke, Oe, ns), + ws = ((t) => (e, s) => { + const n = e.createDynamicsCompressor(); + if ((qt(n, s), s.channelCount > 2)) throw t(); + if ("max" === s.channelCountMode) throw t(); + return ( + Ft(n, s, "attack"), + Ft(n, s, "knee"), + Ft(n, s, "ratio"), + Ft(n, s, "release"), + Ft(n, s, "threshold"), + n + ); + })(Zt), + bs = ((t, e, s, n, i) => () => { + const o = new WeakMap(); + return { + render(r, a) { + const c = o.get(a); + return void 0 !== c + ? Promise.resolve(c) + : (async (r, a) => { + let c = s(r); + const h = M(c, a); + if (!h) { + const t = { + attack: c.attack.value, + channelCount: c.channelCount, + channelCountMode: c.channelCountMode, + channelInterpretation: c.channelInterpretation, + knee: c.knee.value, + ratio: c.ratio.value, + release: c.release.value, + threshold: c.threshold.value, + }; + c = e(a, t); + } + return ( + o.set(a, c), + h + ? (await t(a, r.attack, c.attack), + await t(a, r.knee, c.knee), + await t(a, r.ratio, c.ratio), + await t(a, r.release, c.release), + await t(a, r.threshold, c.threshold)) + : (await n(a, r.attack, c.attack), + await n(a, r.knee, c.knee), + await n(a, r.ratio, c.ratio), + await n(a, r.release, c.release), + await n(a, r.threshold, c.threshold)), + await i(r, a, c), + c + ); + })(r, a); + }, + }; + })(Xe, ws, tt, $e, Te), + Ts = ((t, e, s, n, i, o, r, a) => + class extends t { + constructor(t, i) { + const c = o(t), + h = { ...St, ...i }, + l = n(c, h), + u = r(c); + (super(t, !1, l, u ? s() : null), + (this._attack = e(this, u, l.attack)), + (this._knee = e(this, u, l.knee)), + (this._nativeDynamicsCompressorNode = l), + (this._ratio = e(this, u, l.ratio)), + (this._release = e(this, u, l.release)), + (this._threshold = e(this, u, l.threshold)), + a(this, 0.006)); + } + get attack() { + return this._attack; + } + get channelCount() { + return this._nativeDynamicsCompressorNode.channelCount; + } + set channelCount(t) { + const e = this._nativeDynamicsCompressorNode.channelCount; + if ( + ((this._nativeDynamicsCompressorNode.channelCount = t), t > 2) + ) + throw ( + (this._nativeDynamicsCompressorNode.channelCount = e), + i() + ); + } + get channelCountMode() { + return this._nativeDynamicsCompressorNode.channelCountMode; + } + set channelCountMode(t) { + const e = this._nativeDynamicsCompressorNode.channelCountMode; + if ( + ((this._nativeDynamicsCompressorNode.channelCountMode = t), + "max" === t) + ) + throw ( + (this._nativeDynamicsCompressorNode.channelCountMode = e), + i() + ); + } + get knee() { + return this._knee; + } + get ratio() { + return this._ratio; + } + get reduction() { + return "number" == + typeof this._nativeDynamicsCompressorNode.reduction.value + ? this._nativeDynamicsCompressorNode.reduction.value + : this._nativeDynamicsCompressorNode.reduction; + } + get release() { + return this._release; + } + get threshold() { + return this._threshold; + } + })(Ve, Je, bs, ws, Zt, ke, Oe, ns), + Ss = ((t, e, s, n, i) => () => { + const o = new WeakMap(); + return { + render(r, a) { + const c = o.get(a); + return void 0 !== c + ? Promise.resolve(c) + : (async (r, a) => { + let c = s(r); + const h = M(c, a); + if (!h) { + const t = { + channelCount: c.channelCount, + channelCountMode: c.channelCountMode, + channelInterpretation: c.channelInterpretation, + gain: c.gain.value, + }; + c = e(a, t); + } + return ( + o.set(a, c), + h + ? await t(a, r.gain, c.gain) + : await n(a, r.gain, c.gain), + await i(r, a, c), + c + ); + })(r, a); + }, + }; + })(Xe, Bt, tt, $e, Te), + ks = ((t, e, s, n, i, o) => + class extends t { + constructor(t, r) { + const a = i(t), + c = { ...kt, ...r }, + h = n(a, c), + l = o(a); + (super(t, !1, h, l ? s() : null), + (this._gain = e(this, l, h.gain, V, F))); + } + get gain() { + return this._gain; + } + })(Ve, Je, Ss, Bt, ke, Oe), + As = ( + (t, e, s, n) => + ( + i, + o, + { + channelCount: r, + channelCountMode: a, + channelInterpretation: c, + feedback: h, + feedforward: l, + }, + ) => { + const u = Pt(o, i.sampleRate), + p = h instanceof Float64Array ? h : new Float64Array(h), + d = l instanceof Float64Array ? l : new Float64Array(l), + f = p.length, + _ = d.length, + m = Math.min(f, _); + if (0 === f || f > 20) throw n(); + if (0 === p[0]) throw e(); + if (0 === _ || _ > 20) throw n(); + if (0 === d[0]) throw e(); + if (1 !== p[0]) { + for (let t = 0; t < _; t += 1) d[t] /= p[0]; + for (let t = 1; t < f; t += 1) p[t] /= p[0]; + } + const g = s(i, u, r, r); + ((g.channelCount = r), + (g.channelCountMode = a), + (g.channelInterpretation = c)); + const v = [], + y = [], + x = []; + for (let t = 0; t < r; t += 1) { + v.push(0); + const t = new Float32Array(32), + e = new Float32Array(32); + (t.fill(0), e.fill(0), y.push(t), x.push(e)); + } + g.onaudioprocess = (t) => { + const e = t.inputBuffer, + s = t.outputBuffer, + n = e.numberOfChannels; + for (let t = 0; t < n; t += 1) { + const n = e.getChannelData(t), + i = s.getChannelData(t); + v[t] = Dt(p, f, d, _, m, y[t], x[t], v[t], 32, n, i); + } + }; + const w = i.sampleRate / 2; + return zt( + { + get bufferSize() { + return u; + }, + get channelCount() { + return g.channelCount; + }, + set channelCount(t) { + g.channelCount = t; + }, + get channelCountMode() { + return g.channelCountMode; + }, + set channelCountMode(t) { + g.channelCountMode = t; + }, + get channelInterpretation() { + return g.channelInterpretation; + }, + set channelInterpretation(t) { + g.channelInterpretation = t; + }, + get context() { + return g.context; + }, + get inputs() { + return [g]; + }, + get numberOfInputs() { + return g.numberOfInputs; + }, + get numberOfOutputs() { + return g.numberOfOutputs; + }, + addEventListener: (...t) => + g.addEventListener(t[0], t[1], t[2]), + dispatchEvent: (...t) => g.dispatchEvent(t[0]), + getFrequencyResponse(e, s, n) { + if (e.length !== s.length || s.length !== n.length) + throw t(); + const i = e.length; + for (let t = 0; t < i; t += 1) { + const i = -Math.PI * (e[t] / w), + o = [Math.cos(i), Math.sin(i)], + r = Ut(Gt(d, o), Gt(p, o)); + ((s[t] = Math.sqrt(r[0] * r[0] + r[1] * r[1])), + (n[t] = Math.atan2(r[1], r[0]))); + } + }, + removeEventListener: (...t) => + g.removeEventListener(t[0], t[1], t[2]), + }, + g, + ); + } + )(Ct, At, Qt, Zt), + Cs = ((t, e, s, n) => (i) => + t(Et, () => Et(i)) + ? Promise.resolve(t(n, n)).then((t) => { + if (!t) { + const t = s(i, 512, 0, 1); + ((i.oncomplete = () => { + ((t.onaudioprocess = null), t.disconnect()); + }), + (t.onaudioprocess = () => i.currentTime), + t.connect(i.destination)); + } + return i.startRendering(); + }) + : new Promise((t) => { + const s = e(i, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + gain: 0, + }); + ((i.oncomplete = (e) => { + (s.disconnect(), t(e.renderedBuffer)); + }), + s.connect(i.destination), + i.startRendering()); + }))( + ge, + Bt, + Qt, + ((t, e) => () => { + if (null === e) return Promise.resolve(!1); + const s = new e(1, 1, 44100), + n = t(s, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + gain: 0, + }); + return new Promise((t) => { + ((s.oncomplete = () => { + (n.disconnect(), t(0 !== s.currentTime)); + }), + s.startRendering()); + }); + })(Bt, Ce), + ), + Os = ((t, e, s, n, i) => (o, r) => { + const a = new WeakMap(); + let c = null; + return { + render(h, l) { + const u = a.get(l); + return void 0 !== u + ? Promise.resolve(u) + : (async (h, l) => { + let u = null, + p = e(h); + const d = M(p, l); + if ( + (void 0 === l.createIIRFilter + ? (u = t(l, { + buffer: null, + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + loop: !1, + loopEnd: 0, + loopStart: 0, + playbackRate: 1, + })) + : d || (p = l.createIIRFilter(r, o)), + a.set(l, null === u ? p : u), + null !== u) + ) { + if (null === c) { + if (null === s) + throw new Error( + "Missing the native OfflineAudioContext constructor.", + ); + const t = new s( + h.context.destination.channelCount, + h.context.length, + l.sampleRate, + ); + c = (async () => ( + await n(h, t, t.destination), + ((t, e, s, n) => { + const i = + s instanceof Float64Array + ? s + : new Float64Array(s), + o = + n instanceof Float64Array + ? n + : new Float64Array(n), + r = i.length, + a = o.length, + c = Math.min(r, a); + if (1 !== i[0]) { + for (let t = 0; t < r; t += 1) o[t] /= i[0]; + for (let t = 1; t < a; t += 1) i[t] /= i[0]; + } + const h = new Float32Array(32), + l = new Float32Array(32), + u = e.createBuffer( + t.numberOfChannels, + t.length, + t.sampleRate, + ), + p = t.numberOfChannels; + for (let e = 0; e < p; e += 1) { + const s = t.getChannelData(e), + n = u.getChannelData(e); + (h.fill(0), + l.fill(0), + Dt(i, r, o, a, c, h, l, 0, 32, s, n)); + } + return u; + })(await i(t), l, o, r) + ))(); + } + const t = await c; + return ((u.buffer = t), u.start(0), u); + } + return (await n(h, l, p), p); + })(h, l); + }, + }; + })(Ye, tt, Ce, Te, Cs), + Ds = ((t) => (e, s, n) => { + if (void 0 === e.createIIRFilter) return t(e, s, n); + const i = e.createIIRFilter(n.feedforward, n.feedback); + return (qt(i, n), i); + })(As), + Ms = ((t, e, s, n, i, o) => + class extends t { + constructor(t, r) { + const a = n(t), + c = i(a), + h = { ...Ot, ...r }, + l = e(a, c ? null : t.baseLatency, h); + (super(t, !1, l, c ? s(h.feedback, h.feedforward) : null), + ((t) => { + var e; + t.getFrequencyResponse = + ((e = t.getFrequencyResponse), + (s, n, i) => { + if (s.length !== n.length || n.length !== i.length) + throw Ct(); + return e.call(t, s, n, i); + }); + })(l), + (this._nativeIIRFilterNode = l), + o(this, 1)); + } + getFrequencyResponse(t, e, s) { + return this._nativeIIRFilterNode.getFrequencyResponse(t, e, s); + } + })(Ve, Ds, Os, ke, Oe, ns), + Es = ((t, e, s, n, i, o, r, a) => (c, h) => { + const l = h.listener, + { + forwardX: u, + forwardY: p, + forwardZ: d, + positionX: f, + positionY: _, + positionZ: m, + upX: g, + upY: v, + upZ: y, + } = void 0 === l.forwardX + ? (() => { + const u = new Float32Array(1), + p = e(h, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: 9, + }), + d = r(h); + let f = !1, + _ = [0, 0, -1, 0, 1, 0], + m = [0, 0, 0]; + const g = () => { + if (f) return; + f = !0; + const t = n(h, 256, 9, 0); + ((t.onaudioprocess = ({ inputBuffer: t }) => { + const e = [ + o(t, u, 0), + o(t, u, 1), + o(t, u, 2), + o(t, u, 3), + o(t, u, 4), + o(t, u, 5), + ]; + e.some((t, e) => t !== _[e]) && + (l.setOrientation(...e), (_ = e)); + const s = [o(t, u, 6), o(t, u, 7), o(t, u, 8)]; + s.some((t, e) => t !== m[e]) && + (l.setPosition(...s), (m = s)); + }), + p.connect(t)); + }, + v = (t) => (e) => { + e !== _[t] && ((_[t] = e), l.setOrientation(..._)); + }, + y = (t) => (e) => { + e !== m[t] && ((m[t] = e), l.setPosition(...m)); + }, + x = (e, n, o) => { + const r = s(h, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + offset: n, + }); + (r.connect(p, 0, e), + r.start(), + Object.defineProperty(r.offset, "defaultValue", { + get: () => n, + })); + const l = t( + { + context: c, + }, + d, + r.offset, + V, + F, + ); + var u, f, _, m, v, y, x; + return ( + a( + l, + "value", + (t) => () => t.call(l), + (t) => (e) => { + try { + t.call(l, e); + } catch (t) { + if (9 !== t.code) throw t; + } + (g(), d && o(e)); + }, + ), + (l.cancelAndHoldAtTime = + ((u = l.cancelAndHoldAtTime), + d + ? () => { + throw i(); + } + : (...t) => { + const e = u.apply(l, t); + return (g(), e); + })), + (l.cancelScheduledValues = + ((f = l.cancelScheduledValues), + d + ? () => { + throw i(); + } + : (...t) => { + const e = f.apply(l, t); + return (g(), e); + })), + (l.exponentialRampToValueAtTime = + ((_ = l.exponentialRampToValueAtTime), + d + ? () => { + throw i(); + } + : (...t) => { + const e = _.apply(l, t); + return (g(), e); + })), + (l.linearRampToValueAtTime = + ((m = l.linearRampToValueAtTime), + d + ? () => { + throw i(); + } + : (...t) => { + const e = m.apply(l, t); + return (g(), e); + })), + (l.setTargetAtTime = + ((v = l.setTargetAtTime), + d + ? () => { + throw i(); + } + : (...t) => { + const e = v.apply(l, t); + return (g(), e); + })), + (l.setValueAtTime = + ((y = l.setValueAtTime), + d + ? () => { + throw i(); + } + : (...t) => { + const e = y.apply(l, t); + return (g(), e); + })), + (l.setValueCurveAtTime = + ((x = l.setValueCurveAtTime), + d + ? () => { + throw i(); + } + : (...t) => { + const e = x.apply(l, t); + return (g(), e); + })), + l + ); + }; + return { + forwardX: x(0, 0, v(0)), + forwardY: x(1, 0, v(1)), + forwardZ: x(2, -1, v(2)), + positionX: x(6, 0, y(0)), + positionY: x(7, 0, y(1)), + positionZ: x(8, 0, y(2)), + upX: x(3, 0, v(3)), + upY: x(4, 1, v(4)), + upZ: x(5, 0, v(5)), + }; + })() + : l; + return { + get forwardX() { + return u; + }, + get forwardY() { + return p; + }, + get forwardZ() { + return d; + }, + get positionX() { + return f; + }, + get positionY() { + return _; + }, + get positionZ() { + return m; + }, + get upX() { + return g; + }, + get upY() { + return v; + }, + get upZ() { + return y; + }, + }; + })(Je, as, ds, Qt, Zt, ee, Oe, ne), + Rs = new WeakMap(), + qs = ((t, e, s, n, i, o) => + class extends s { + constructor(s, o) { + (super(s), + (this._nativeContext = s), + u.set(this, s), + n(s) && i.set(s, new Set()), + (this._destination = new t(this, o)), + (this._listener = e(this, s)), + (this._onstatechange = null)); + } + get currentTime() { + return this._nativeContext.currentTime; + } + get destination() { + return this._destination; + } + get listener() { + return this._listener; + } + get onstatechange() { + return this._onstatechange; + } + set onstatechange(t) { + const e = "function" == typeof t ? o(this, t) : null; + this._nativeContext.onstatechange = e; + const s = this._nativeContext.onstatechange; + this._onstatechange = null !== s && s === e ? t : s; + } + get sampleRate() { + return this._nativeContext.sampleRate; + } + get state() { + return this._nativeContext.state; + } + })(es, Es, Me, Oe, Rs, ue), + Is = ((t, e, s, n, i, o) => (r, a) => { + const c = r.createOscillator(); + return ( + qt(c, a), + Ft(c, a, "detune"), + Ft(c, a, "frequency"), + void 0 !== a.periodicWave + ? c.setPeriodicWave(a.periodicWave) + : Rt(c, a, "type"), + e(s, () => s(r)) || Vt(c), + e(n, () => n(r)) || o(c, r), + e(i, () => i(r)) || Nt(c), + t(r, c), + c + ); + })(Qe, ge, oe, re, ae, le), + Fs = ((t, e, s, n, i) => () => { + const o = new WeakMap(); + let r = null, + a = null, + c = null; + return { + set periodicWave(t) { + r = t; + }, + set start(t) { + a = t; + }, + set stop(t) { + c = t; + }, + render(h, l) { + const u = o.get(l); + return void 0 !== u + ? Promise.resolve(u) + : (async (h, l) => { + let u = s(h); + const p = M(u, l); + if (!p) { + const t = { + channelCount: u.channelCount, + channelCountMode: u.channelCountMode, + channelInterpretation: u.channelInterpretation, + detune: u.detune.value, + frequency: u.frequency.value, + periodicWave: null === r ? void 0 : r, + type: u.type, + }; + ((u = e(l, t)), + null !== a && u.start(a), + null !== c && u.stop(c)); + } + return ( + o.set(l, u), + p + ? (await t(l, h.detune, u.detune), + await t(l, h.frequency, u.frequency)) + : (await n(l, h.detune, u.detune), + await n(l, h.frequency, u.frequency)), + await i(h, l, u), + u + ); + })(h, l); + }, + }; + })(Xe, Is, tt, $e, Te), + Vs = ((t, e, s, n, i, o, r) => + class extends t { + constructor(t, r) { + const a = i(t), + c = { ...Yt, ...r }, + h = s(a, c), + l = o(a), + u = l ? n() : null, + p = t.sampleRate / 2; + (super(t, !1, h, u), + (this._detune = e(this, l, h.detune, 153600, -153600)), + (this._frequency = e(this, l, h.frequency, p, -p)), + (this._nativeOscillatorNode = h), + (this._onended = null), + (this._oscillatorNodeRenderer = u), + null !== this._oscillatorNodeRenderer && + void 0 !== c.periodicWave && + (this._oscillatorNodeRenderer.periodicWave = + c.periodicWave)); + } + get detune() { + return this._detune; + } + get frequency() { + return this._frequency; + } + get onended() { + return this._onended; + } + set onended(t) { + const e = "function" == typeof t ? r(this, t) : null; + this._nativeOscillatorNode.onended = e; + const s = this._nativeOscillatorNode.onended; + this._onended = null !== s && s === e ? t : s; + } + get type() { + return this._nativeOscillatorNode.type; + } + set type(t) { + ((this._nativeOscillatorNode.type = t), + null !== this._oscillatorNodeRenderer && + (this._oscillatorNodeRenderer.periodicWave = null)); + } + setPeriodicWave(t) { + (this._nativeOscillatorNode.setPeriodicWave(t), + null !== this._oscillatorNodeRenderer && + (this._oscillatorNodeRenderer.periodicWave = t)); + } + start(t = 0) { + if ( + (this._nativeOscillatorNode.start(t), + null !== this._oscillatorNodeRenderer && + (this._oscillatorNodeRenderer.start = t), + "closed" !== this.context.state) + ) { + k(this); + const t = () => { + (this._nativeOscillatorNode.removeEventListener("ended", t), + N(this) && C(this)); + }; + this._nativeOscillatorNode.addEventListener("ended", t); + } + } + stop(t = 0) { + (this._nativeOscillatorNode.stop(t), + null !== this._oscillatorNodeRenderer && + (this._oscillatorNodeRenderer.stop = t)); + } + })(Ve, Je, Is, Fs, ke, Oe, ue), + Ns = ((t) => (e, s) => { + const n = t(e, { + buffer: null, + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + loop: !1, + loopEnd: 0, + loopStart: 0, + playbackRate: 1, + }), + i = e.createBuffer(1, 2, 44100); + return ( + (n.buffer = i), + (n.loop = !0), + n.connect(s), + n.start(), + () => { + (n.stop(), n.disconnect(s)); + } + ); + })(Ye), + Ps = ( + (t, e, s, n, i) => + (o, { curve: r, oversample: a, ...c }) => { + const h = o.createWaveShaper(), + l = o.createWaveShaper(); + (qt(h, c), qt(l, c)); + const u = s(o, { ...c, gain: 1 }), + p = s(o, { ...c, gain: -1 }), + d = s(o, { ...c, gain: 1 }), + f = s(o, { ...c, gain: -1 }); + let _ = null, + m = !1, + g = null; + const v = { + get bufferSize() {}, + get channelCount() { + return h.channelCount; + }, + set channelCount(t) { + ((u.channelCount = t), + (p.channelCount = t), + (h.channelCount = t), + (d.channelCount = t), + (l.channelCount = t), + (f.channelCount = t)); + }, + get channelCountMode() { + return h.channelCountMode; + }, + set channelCountMode(t) { + ((u.channelCountMode = t), + (p.channelCountMode = t), + (h.channelCountMode = t), + (d.channelCountMode = t), + (l.channelCountMode = t), + (f.channelCountMode = t)); + }, + get channelInterpretation() { + return h.channelInterpretation; + }, + set channelInterpretation(t) { + ((u.channelInterpretation = t), + (p.channelInterpretation = t), + (h.channelInterpretation = t), + (d.channelInterpretation = t), + (l.channelInterpretation = t), + (f.channelInterpretation = t)); + }, + get context() { + return h.context; + }, + get curve() { + return g; + }, + set curve(s) { + if (null !== s && s.length < 2) throw e(); + if (null === s) ((h.curve = s), (l.curve = s)); + else { + const t = s.length, + e = new Float32Array(t + 2 - (t % 2)), + n = new Float32Array(t + 2 - (t % 2)); + ((e[0] = s[0]), (n[0] = -s[t - 1])); + const i = Math.ceil((t + 1) / 2), + o = (t + 1) / 2 - 1; + for (let r = 1; r < i; r += 1) { + const a = (r / i) * o, + c = Math.floor(a), + h = Math.ceil(a); + ((e[r] = + c === h + ? s[c] + : (1 - (a - c)) * s[c] + (1 - (h - a)) * s[h]), + (n[r] = + c === h + ? -s[t - 1 - c] + : -(1 - (a - c)) * s[t - 1 - c] - + (1 - (h - a)) * s[t - 1 - h])); + } + ((e[i] = t % 2 == 1 ? s[i - 1] : (s[i - 2] + s[i - 1]) / 2), + (h.curve = e), + (l.curve = n)); + } + ((g = s), + m && + (n(g) && null === _ + ? (_ = t(o, u)) + : null !== _ && (_(), (_ = null)))); + }, + get inputs() { + return [u]; + }, + get numberOfInputs() { + return h.numberOfInputs; + }, + get numberOfOutputs() { + return h.numberOfOutputs; + }, + get oversample() { + return h.oversample; + }, + set oversample(t) { + ((h.oversample = t), (l.oversample = t)); + }, + addEventListener: (...t) => + u.addEventListener(t[0], t[1], t[2]), + dispatchEvent: (...t) => u.dispatchEvent(t[0]), + removeEventListener: (...t) => + u.removeEventListener(t[0], t[1], t[2]), + }; + return ( + null !== r && + (v.curve = + r instanceof Float32Array ? r : new Float32Array(r)), + a !== v.oversample && (v.oversample = a), + i( + zt(v, d), + () => { + (u.connect(h).connect(d), + u.connect(p).connect(l).connect(f).connect(d), + (m = !0), + n(g) && (_ = t(o, u))); + }, + () => { + (u.disconnect(h), + h.disconnect(d), + u.disconnect(p), + p.disconnect(l), + l.disconnect(f), + f.disconnect(d), + (m = !1), + null !== _ && (_(), (_ = null))); + }, + ) + ); + } + )(Ns, At, Bt, se, os), + js = ((t, e, s, n, i, o, r) => (a, c) => { + const h = a.createWaveShaper(); + if ( + null !== o && + "webkitAudioContext" === o.name && + void 0 === a.createGain().gain.automationRate + ) + return s(a, c); + qt(h, c); + const l = + null === c.curve || c.curve instanceof Float32Array + ? c.curve + : new Float32Array(c.curve); + if (null !== l && l.length < 2) throw e(); + (Rt( + h, + { + curve: l, + }, + "curve", + ), + Rt(h, c, "oversample")); + let u = null, + p = !1; + return ( + r( + h, + "curve", + (t) => () => t.call(h), + (e) => (s) => ( + e.call(h, s), + p && + (n(s) && null === u + ? (u = t(a, h)) + : n(s) || null === u || (u(), (u = null))), + s + ), + ), + i( + h, + () => { + ((p = !0), n(h.curve) && (u = t(a, h))); + }, + () => { + ((p = !1), null !== u && (u(), (u = null))); + }, + ) + ); + })(Ns, At, Ps, se, os, Ee, ne), + Ls = ( + (t, e, s, n, i, o, r, a, c, h) => + ( + l, + { + coneInnerAngle: u, + coneOuterAngle: p, + coneOuterGain: d, + distanceModel: f, + maxDistance: _, + orientationX: m, + orientationY: g, + orientationZ: v, + panningModel: y, + positionX: x, + positionY: w, + positionZ: b, + refDistance: T, + rolloffFactor: S, + ...k + }, + ) => { + const A = l.createPanner(); + if (k.channelCount > 2) throw r(); + if ("max" === k.channelCountMode) throw r(); + qt(A, k); + const C = { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + }, + O = s(l, { + ...C, + channelInterpretation: "speakers", + numberOfInputs: 6, + }), + D = n(l, { ...k, gain: 1 }), + M = n(l, { ...C, gain: 1 }), + E = n(l, { ...C, gain: 0 }), + R = n(l, { ...C, gain: 0 }), + q = n(l, { ...C, gain: 0 }), + I = n(l, { ...C, gain: 0 }), + F = n(l, { ...C, gain: 0 }), + V = i(l, 256, 6, 1), + N = o(l, { + ...C, + curve: new Float32Array([1, 1]), + oversample: "none", + }); + let P = [m, g, v], + j = [x, w, b]; + const L = new Float32Array(1); + ((V.onaudioprocess = ({ inputBuffer: t }) => { + const e = [c(t, L, 0), c(t, L, 1), c(t, L, 2)]; + e.some((t, e) => t !== P[e]) && + (A.setOrientation(...e), (P = e)); + const s = [c(t, L, 3), c(t, L, 4), c(t, L, 5)]; + s.some((t, e) => t !== j[e]) && (A.setPosition(...s), (j = s)); + }), + Object.defineProperty(E.gain, "defaultValue", { + get: () => 0, + }), + Object.defineProperty(R.gain, "defaultValue", { + get: () => 0, + }), + Object.defineProperty(q.gain, "defaultValue", { + get: () => 0, + }), + Object.defineProperty(I.gain, "defaultValue", { + get: () => 0, + }), + Object.defineProperty(F.gain, "defaultValue", { + get: () => 0, + })); + const z = { + get bufferSize() {}, + get channelCount() { + return A.channelCount; + }, + set channelCount(t) { + if (t > 2) throw r(); + ((D.channelCount = t), (A.channelCount = t)); + }, + get channelCountMode() { + return A.channelCountMode; + }, + set channelCountMode(t) { + if ("max" === t) throw r(); + ((D.channelCountMode = t), (A.channelCountMode = t)); + }, + get channelInterpretation() { + return A.channelInterpretation; + }, + set channelInterpretation(t) { + ((D.channelInterpretation = t), + (A.channelInterpretation = t)); + }, + get coneInnerAngle() { + return A.coneInnerAngle; + }, + set coneInnerAngle(t) { + A.coneInnerAngle = t; + }, + get coneOuterAngle() { + return A.coneOuterAngle; + }, + set coneOuterAngle(t) { + A.coneOuterAngle = t; + }, + get coneOuterGain() { + return A.coneOuterGain; + }, + set coneOuterGain(t) { + if (t < 0 || t > 1) throw e(); + A.coneOuterGain = t; + }, + get context() { + return A.context; + }, + get distanceModel() { + return A.distanceModel; + }, + set distanceModel(t) { + A.distanceModel = t; + }, + get inputs() { + return [D]; + }, + get maxDistance() { + return A.maxDistance; + }, + set maxDistance(t) { + if (t < 0) throw new RangeError(); + A.maxDistance = t; + }, + get numberOfInputs() { + return A.numberOfInputs; + }, + get numberOfOutputs() { + return A.numberOfOutputs; + }, + get orientationX() { + return M.gain; + }, + get orientationY() { + return E.gain; + }, + get orientationZ() { + return R.gain; + }, + get panningModel() { + return A.panningModel; + }, + set panningModel(t) { + A.panningModel = t; + }, + get positionX() { + return q.gain; + }, + get positionY() { + return I.gain; + }, + get positionZ() { + return F.gain; + }, + get refDistance() { + return A.refDistance; + }, + set refDistance(t) { + if (t < 0) throw new RangeError(); + A.refDistance = t; + }, + get rolloffFactor() { + return A.rolloffFactor; + }, + set rolloffFactor(t) { + if (t < 0) throw new RangeError(); + A.rolloffFactor = t; + }, + addEventListener: (...t) => + D.addEventListener(t[0], t[1], t[2]), + dispatchEvent: (...t) => D.dispatchEvent(t[0]), + removeEventListener: (...t) => + D.removeEventListener(t[0], t[1], t[2]), + }; + return ( + u !== z.coneInnerAngle && (z.coneInnerAngle = u), + p !== z.coneOuterAngle && (z.coneOuterAngle = p), + d !== z.coneOuterGain && (z.coneOuterGain = d), + f !== z.distanceModel && (z.distanceModel = f), + _ !== z.maxDistance && (z.maxDistance = _), + m !== z.orientationX.value && (z.orientationX.value = m), + g !== z.orientationY.value && (z.orientationY.value = g), + v !== z.orientationZ.value && (z.orientationZ.value = v), + y !== z.panningModel && (z.panningModel = y), + x !== z.positionX.value && (z.positionX.value = x), + w !== z.positionY.value && (z.positionY.value = w), + b !== z.positionZ.value && (z.positionZ.value = b), + T !== z.refDistance && (z.refDistance = T), + S !== z.rolloffFactor && (z.rolloffFactor = S), + (1 === P[0] && 0 === P[1] && 0 === P[2]) || + A.setOrientation(...P), + (0 === j[0] && 0 === j[1] && 0 === j[2]) || A.setPosition(...j), + h( + zt(z, A), + () => { + (D.connect(A), + t(D, N, 0, 0), + N.connect(M).connect(O, 0, 0), + N.connect(E).connect(O, 0, 1), + N.connect(R).connect(O, 0, 2), + N.connect(q).connect(O, 0, 3), + N.connect(I).connect(O, 0, 4), + N.connect(F).connect(O, 0, 5), + O.connect(V).connect(l.destination)); + }, + () => { + (D.disconnect(A), + a(D, N, 0, 0), + N.disconnect(M), + M.disconnect(O), + N.disconnect(E), + E.disconnect(O), + N.disconnect(R), + R.disconnect(O), + N.disconnect(q), + q.disconnect(O), + N.disconnect(I), + I.disconnect(O), + N.disconnect(F), + F.disconnect(O), + O.disconnect(V), + V.disconnect(l.destination)); + }, + ) + ); + } + )(Y, At, as, Bt, Qt, js, Zt, K, ee, os), + zs = ((t) => (e, s) => { + const n = e.createPanner(); + return void 0 === n.orientationX + ? t(e, s) + : (qt(n, s), + Ft(n, s, "orientationX"), + Ft(n, s, "orientationY"), + Ft(n, s, "orientationZ"), + Ft(n, s, "positionX"), + Ft(n, s, "positionY"), + Ft(n, s, "positionZ"), + Rt(n, s, "coneInnerAngle"), + Rt(n, s, "coneOuterAngle"), + Rt(n, s, "coneOuterGain"), + Rt(n, s, "distanceModel"), + Rt(n, s, "maxDistance"), + Rt(n, s, "panningModel"), + Rt(n, s, "refDistance"), + Rt(n, s, "rolloffFactor"), + n); + })(Ls), + Ws = ((t, e, s, n, i, o, r, a, c, h) => () => { + const l = new WeakMap(); + let u = null; + return { + render(p, d) { + const f = l.get(d); + return void 0 !== f + ? Promise.resolve(f) + : (async (p, d) => { + let f = null, + _ = o(p); + const m = { + channelCount: _.channelCount, + channelCountMode: _.channelCountMode, + channelInterpretation: _.channelInterpretation, + }, + g = { + ...m, + coneInnerAngle: _.coneInnerAngle, + coneOuterAngle: _.coneOuterAngle, + coneOuterGain: _.coneOuterGain, + distanceModel: _.distanceModel, + maxDistance: _.maxDistance, + panningModel: _.panningModel, + refDistance: _.refDistance, + rolloffFactor: _.rolloffFactor, + }, + v = M(_, d); + if ("bufferSize" in _) f = n(d, { ...m, gain: 1 }); + else if (!v) { + const t = { + ...g, + orientationX: _.orientationX.value, + orientationY: _.orientationY.value, + orientationZ: _.orientationZ.value, + positionX: _.positionX.value, + positionY: _.positionY.value, + positionZ: _.positionZ.value, + }; + _ = i(d, t); + } + if ((l.set(d, null === f ? _ : f), null !== f)) { + if (null === u) { + if (null === r) + throw new Error( + "Missing the native OfflineAudioContext constructor.", + ); + const t = new r(6, p.context.length, d.sampleRate), + n = e(t, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: 6, + }); + (n.connect(t.destination), + (u = (async () => { + const e = await Promise.all( + [ + p.orientationX, + p.orientationY, + p.orientationZ, + p.positionX, + p.positionY, + p.positionZ, + ].map(async (e, n) => { + const i = s(t, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + offset: 0 === n ? 1 : 0, + }); + return (await a(t, e, i.offset), i); + }), + ); + for (let t = 0; t < 6; t += 1) + (e[t].connect(n, 0, t), e[t].start(0)); + return h(t); + })())); + } + const t = await u, + o = n(d, { ...m, gain: 1 }); + await c(p, d, o); + const l = []; + for (let e = 0; e < t.numberOfChannels; e += 1) + l.push(t.getChannelData(e)); + let _ = [l[0][0], l[1][0], l[2][0]], + v = [l[3][0], l[4][0], l[5][0]], + y = n(d, { ...m, gain: 1 }), + x = i(d, { + ...g, + orientationX: _[0], + orientationY: _[1], + orientationZ: _[2], + positionX: v[0], + positionY: v[1], + positionZ: v[2], + }); + (o.connect(y).connect(x.inputs[0]), x.connect(f)); + for (let e = 128; e < t.length; e += 128) { + const t = [l[0][e], l[1][e], l[2][e]], + s = [l[3][e], l[4][e], l[5][e]]; + if ( + t.some((t, e) => t !== _[e]) || + s.some((t, e) => t !== v[e]) + ) { + ((_ = t), (v = s)); + const r = e / d.sampleRate; + (y.gain.setValueAtTime(0, r), + (y = n(d, { ...m, gain: 0 })), + (x = i(d, { + ...g, + orientationX: _[0], + orientationY: _[1], + orientationZ: _[2], + positionX: v[0], + positionY: v[1], + positionZ: v[2], + })), + y.gain.setValueAtTime(1, r), + o.connect(y).connect(x.inputs[0]), + x.connect(f)); + } + } + return f; + } + return ( + v + ? (await t(d, p.orientationX, _.orientationX), + await t(d, p.orientationY, _.orientationY), + await t(d, p.orientationZ, _.orientationZ), + await t(d, p.positionX, _.positionX), + await t(d, p.positionY, _.positionY), + await t(d, p.positionZ, _.positionZ)) + : (await a(d, p.orientationX, _.orientationX), + await a(d, p.orientationY, _.orientationY), + await a(d, p.orientationZ, _.orientationZ), + await a(d, p.positionX, _.positionX), + await a(d, p.positionY, _.positionY), + await a(d, p.positionZ, _.positionZ)), + X(_) ? await c(p, d, _.inputs[0]) : await c(p, d, _), + _ + ); + })(p, d); + }, + }; + })(Xe, as, ds, Bt, zs, tt, Ce, $e, Te, Cs), + Bs = ((t, e, s, n, i, o, r) => + class extends t { + constructor(t, a) { + const c = i(t), + h = { ...$t, ...a }, + l = s(c, h), + u = o(c); + (super(t, !1, l, u ? n() : null), + (this._nativePannerNode = l), + (this._orientationX = e(this, u, l.orientationX, V, F)), + (this._orientationY = e(this, u, l.orientationY, V, F)), + (this._orientationZ = e(this, u, l.orientationZ, V, F)), + (this._positionX = e(this, u, l.positionX, V, F)), + (this._positionY = e(this, u, l.positionY, V, F)), + (this._positionZ = e(this, u, l.positionZ, V, F)), + r(this, 1)); + } + get coneInnerAngle() { + return this._nativePannerNode.coneInnerAngle; + } + set coneInnerAngle(t) { + this._nativePannerNode.coneInnerAngle = t; + } + get coneOuterAngle() { + return this._nativePannerNode.coneOuterAngle; + } + set coneOuterAngle(t) { + this._nativePannerNode.coneOuterAngle = t; + } + get coneOuterGain() { + return this._nativePannerNode.coneOuterGain; + } + set coneOuterGain(t) { + this._nativePannerNode.coneOuterGain = t; + } + get distanceModel() { + return this._nativePannerNode.distanceModel; + } + set distanceModel(t) { + this._nativePannerNode.distanceModel = t; + } + get maxDistance() { + return this._nativePannerNode.maxDistance; + } + set maxDistance(t) { + this._nativePannerNode.maxDistance = t; + } + get orientationX() { + return this._orientationX; + } + get orientationY() { + return this._orientationY; + } + get orientationZ() { + return this._orientationZ; + } + get panningModel() { + return this._nativePannerNode.panningModel; + } + set panningModel(t) { + this._nativePannerNode.panningModel = t; + } + get positionX() { + return this._positionX; + } + get positionY() { + return this._positionY; + } + get positionZ() { + return this._positionZ; + } + get refDistance() { + return this._nativePannerNode.refDistance; + } + set refDistance(t) { + this._nativePannerNode.refDistance = t; + } + get rolloffFactor() { + return this._nativePannerNode.rolloffFactor; + } + set rolloffFactor(t) { + this._nativePannerNode.rolloffFactor = t; + } + })(Ve, Je, zs, Ws, ke, Oe, ns), + Us = ( + (t) => + (e, { disableNormalization: s, imag: n, real: i }) => { + const o = n instanceof Float32Array ? n : new Float32Array(n), + r = i instanceof Float32Array ? i : new Float32Array(i), + a = e.createPeriodicWave(r, o, { + disableNormalization: s, + }); + if (Array.from(n).length < 2) throw t(); + return a; + } + )(R), + Gs = ((t, e, s) => + class n { + constructor(n, i) { + const o = e(n), + r = ((t) => { + const { imag: e, real: s } = t; + return void 0 === e + ? void 0 === s + ? { ...t, imag: [0, 0], real: [0, 0] } + : { ...t, imag: Array.from(s, () => 0), real: s } + : void 0 === s + ? { ...t, imag: e, real: Array.from(e, () => 0) } + : { ...t, imag: e, real: s }; + })({ ...Ht, ...i }), + a = t(o, r); + return (s.add(a), a); + } + static [Symbol.hasInstance](t) { + return ( + (null !== t && + "object" == typeof t && + Object.getPrototypeOf(t) === n.prototype) || + s.has(t) + ); + } + })(Us, ke, new WeakSet()), + Qs = ((t, e, s, n, i, o) => { + const r = 16385, + a = new Float32Array([1, 1]), + c = Math.PI / 2, + h = { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + }, + l = { ...h, oversample: "none" }, + u = (t, o, u, p, d) => { + if (1 === o) + return ((t, e, i, o) => { + const u = new Float32Array(r), + p = new Float32Array(r); + for (let t = 0; t < r; t += 1) { + const e = (t / 16384) * c; + ((u[t] = Math.cos(e)), (p[t] = Math.sin(e))); + } + const d = s(t, { ...h, gain: 0 }), + f = n(t, { ...l, curve: u }), + _ = n(t, { ...l, curve: a }), + m = s(t, { ...h, gain: 0 }), + g = n(t, { ...l, curve: p }); + return { + connectGraph() { + (e.connect(d), + e.connect(void 0 === _.inputs ? _ : _.inputs[0]), + e.connect(m), + _.connect(i), + i.connect(void 0 === f.inputs ? f : f.inputs[0]), + i.connect(void 0 === g.inputs ? g : g.inputs[0]), + f.connect(d.gain), + g.connect(m.gain), + d.connect(o, 0, 0), + m.connect(o, 0, 1)); + }, + disconnectGraph() { + (e.disconnect(d), + e.disconnect(void 0 === _.inputs ? _ : _.inputs[0]), + e.disconnect(m), + _.disconnect(i), + i.disconnect(void 0 === f.inputs ? f : f.inputs[0]), + i.disconnect(void 0 === g.inputs ? g : g.inputs[0]), + f.disconnect(d.gain), + g.disconnect(m.gain), + d.disconnect(o, 0, 0), + m.disconnect(o, 0, 1)); + }, + }; + })(t, u, p, d); + if (2 === o) + return ((t, i, o, u) => { + const p = new Float32Array(r), + d = new Float32Array(r), + f = new Float32Array(r), + _ = new Float32Array(r), + m = Math.floor(8192.5); + for (let t = 0; t < r; t += 1) + if (t > m) { + const e = ((t - m) / (16384 - m)) * c; + ((p[t] = Math.cos(e)), + (d[t] = Math.sin(e)), + (f[t] = 0), + (_[t] = 1)); + } else { + const e = (t / (16384 - m)) * c; + ((p[t] = 1), + (d[t] = 0), + (f[t] = Math.cos(e)), + (_[t] = Math.sin(e))); + } + const g = e(t, { + channelCount: 2, + channelCountMode: "explicit", + channelInterpretation: "discrete", + numberOfOutputs: 2, + }), + v = s(t, { ...h, gain: 0 }), + y = n(t, { ...l, curve: p }), + x = s(t, { ...h, gain: 0 }), + w = n(t, { ...l, curve: d }), + b = n(t, { ...l, curve: a }), + T = s(t, { ...h, gain: 0 }), + S = n(t, { ...l, curve: f }), + k = s(t, { ...h, gain: 0 }), + A = n(t, { ...l, curve: _ }); + return { + connectGraph() { + (i.connect(g), + i.connect(void 0 === b.inputs ? b : b.inputs[0]), + g.connect(v, 0), + g.connect(x, 0), + g.connect(T, 1), + g.connect(k, 1), + b.connect(o), + o.connect(void 0 === y.inputs ? y : y.inputs[0]), + o.connect(void 0 === w.inputs ? w : w.inputs[0]), + o.connect(void 0 === S.inputs ? S : S.inputs[0]), + o.connect(void 0 === A.inputs ? A : A.inputs[0]), + y.connect(v.gain), + w.connect(x.gain), + S.connect(T.gain), + A.connect(k.gain), + v.connect(u, 0, 0), + T.connect(u, 0, 0), + x.connect(u, 0, 1), + k.connect(u, 0, 1)); + }, + disconnectGraph() { + (i.disconnect(g), + i.disconnect(void 0 === b.inputs ? b : b.inputs[0]), + g.disconnect(v, 0), + g.disconnect(x, 0), + g.disconnect(T, 1), + g.disconnect(k, 1), + b.disconnect(o), + o.disconnect(void 0 === y.inputs ? y : y.inputs[0]), + o.disconnect(void 0 === w.inputs ? w : w.inputs[0]), + o.disconnect(void 0 === S.inputs ? S : S.inputs[0]), + o.disconnect(void 0 === A.inputs ? A : A.inputs[0]), + y.disconnect(v.gain), + w.disconnect(x.gain), + S.disconnect(T.gain), + A.disconnect(k.gain), + v.disconnect(u, 0, 0), + T.disconnect(u, 0, 0), + x.disconnect(u, 0, 1), + k.disconnect(u, 0, 1)); + }, + }; + })(t, u, p, d); + throw i(); + }; + return ( + e, + { channelCount: n, channelCountMode: r, pan: a, ...c }, + ) => { + if ("max" === r) throw i(); + const h = t(e, { + ...c, + channelCount: 1, + channelCountMode: r, + numberOfInputs: 2, + }), + l = s(e, { + ...c, + channelCount: n, + channelCountMode: r, + gain: 1, + }), + p = s(e, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + gain: a, + }); + let { connectGraph: d, disconnectGraph: f } = u(e, n, l, p, h); + (Object.defineProperty(p.gain, "defaultValue", { + get: () => 0, + }), + Object.defineProperty(p.gain, "maxValue", { + get: () => 1, + }), + Object.defineProperty(p.gain, "minValue", { + get: () => -1, + })); + const _ = { + get bufferSize() {}, + get channelCount() { + return l.channelCount; + }, + set channelCount(t) { + (l.channelCount !== t && + (m && f(), + ({ connectGraph: d, disconnectGraph: f } = u( + e, + t, + l, + p, + h, + )), + m && d()), + (l.channelCount = t)); + }, + get channelCountMode() { + return l.channelCountMode; + }, + set channelCountMode(t) { + if ("clamped-max" === t || "max" === t) throw i(); + l.channelCountMode = t; + }, + get channelInterpretation() { + return l.channelInterpretation; + }, + set channelInterpretation(t) { + l.channelInterpretation = t; + }, + get context() { + return l.context; + }, + get inputs() { + return [l]; + }, + get numberOfInputs() { + return l.numberOfInputs; + }, + get numberOfOutputs() { + return l.numberOfOutputs; + }, + get pan() { + return p.gain; + }, + addEventListener: (...t) => + l.addEventListener(t[0], t[1], t[2]), + dispatchEvent: (...t) => l.dispatchEvent(t[0]), + removeEventListener: (...t) => + l.removeEventListener(t[0], t[1], t[2]), + }; + let m = !1; + return o( + zt(_, h), + () => { + (d(), (m = !0)); + }, + () => { + (f(), (m = !1)); + }, + ); + }; + })(as, Lt, Bt, js, Zt, os), + Zs = ((t, e) => (s, n) => { + const i = n.channelCountMode; + if ("clamped-max" === i) throw e(); + if (void 0 === s.createStereoPanner) return t(s, n); + const o = s.createStereoPanner(); + return ( + qt(o, n), + Ft(o, n, "pan"), + Object.defineProperty(o, "channelCountMode", { + get: () => i, + set: (t) => { + if (t !== i) throw e(); + }, + }), + o + ); + })(Qs, Zt), + Xs = ((t, e, s, n, i) => () => { + const o = new WeakMap(); + return { + render(r, a) { + const c = o.get(a); + return void 0 !== c + ? Promise.resolve(c) + : (async (r, a) => { + let c = s(r); + const h = M(c, a); + if (!h) { + const t = { + channelCount: c.channelCount, + channelCountMode: c.channelCountMode, + channelInterpretation: c.channelInterpretation, + pan: c.pan.value, + }; + c = e(a, t); + } + return ( + o.set(a, c), + h ? await t(a, r.pan, c.pan) : await n(a, r.pan, c.pan), + X(c) ? await i(r, a, c.inputs[0]) : await i(r, a, c), + c + ); + })(r, a); + }, + }; + })(Xe, Zs, tt, $e, Te), + Ys = ((t, e, s, n, i, o) => + class extends t { + constructor(t, r) { + const a = i(t), + c = { ...Jt, ...r }, + h = s(a, c), + l = o(a); + (super(t, !1, h, l ? n() : null), + (this._pan = e(this, l, h.pan))); + } + get pan() { + return this._pan; + } + })(Ve, Je, Zs, Xs, ke, Oe), + $s = ((t, e, s) => () => { + const n = new WeakMap(); + return { + render(i, o) { + const r = n.get(o); + return void 0 !== r + ? Promise.resolve(r) + : (async (i, o) => { + let r = e(i); + if (!M(r, o)) { + const e = { + channelCount: r.channelCount, + channelCountMode: r.channelCountMode, + channelInterpretation: r.channelInterpretation, + curve: r.curve, + oversample: r.oversample, + }; + r = t(o, e); + } + return ( + n.set(o, r), + X(r) ? await s(i, o, r.inputs[0]) : await s(i, o, r), + r + ); + })(i, o); + }, + }; + })(js, tt, Te), + Hs = ((t, e, s, n, i, o, r) => + class extends t { + constructor(t, e) { + const a = i(t), + c = { ...te, ...e }, + h = s(a, c); + (super(t, !0, h, o(a) ? n() : null), + (this._isCurveNullified = !1), + (this._nativeWaveShaperNode = h), + r(this, 1)); + } + get curve() { + return this._isCurveNullified + ? null + : this._nativeWaveShaperNode.curve; + } + set curve(t) { + if (null === t) + ((this._isCurveNullified = !0), + (this._nativeWaveShaperNode.curve = new Float32Array([ + 0, 0, + ]))); + else { + if (t.length < 2) throw e(); + ((this._isCurveNullified = !1), + (this._nativeWaveShaperNode.curve = t)); + } + } + get oversample() { + return this._nativeWaveShaperNode.oversample; + } + set oversample(t) { + this._nativeWaveShaperNode.oversample = t; + } + })(Ve, At, js, $s, ke, Oe, ns), + Js = ((t) => null !== t && t.isSecureContext)(xe), + Ks = ((t) => (e, s, n) => { + Object.defineProperties(t, { + currentFrame: { + configurable: !0, + get: () => Math.round(e * s), + }, + currentTime: { + configurable: !0, + get: () => e, + }, + }); + try { + return n(); + } finally { + null !== t && (delete t.currentFrame, delete t.currentTime); + } + })(xe), + tn = new WeakMap(), + en = ((t, e) => (s) => { + let n = t.get(s); + if (void 0 !== n) return n; + if (null === e) + throw new Error( + "Missing the native OfflineAudioContext constructor.", + ); + return ((n = new e(1, 1, 44100)), t.set(s, n), n); + })(tn, Ce), + sn = Js + ? ((t, e, s, n, i, o, r, a, c, h, l, u, p) => { + let d = 0; + return ( + _, + m, + g = { + credentials: "omit", + }, + ) => { + const w = l.get(_); + if (void 0 !== w && w.has(m)) return Promise.resolve(); + const b = h.get(_); + if (void 0 !== b) { + const t = b.get(m); + if (void 0 !== t) return t; + } + const T = o(_), + S = + void 0 === T.audioWorklet + ? i(m) + .then(([t, e]) => { + const [n, i] = v(t, e); + return s( + `${n};((a,b)=>{(a[b]=a[b]||[]).push((AudioWorkletProcessor,global,registerProcessor,sampleRate,self,window)=>{${i}\n})})(window,'_AWGS')`, + ); + }) + .then(() => { + const t = p._AWGS.pop(); + if (void 0 === t) throw new SyntaxError(); + n(T.currentTime, T.sampleRate, () => + t( + class {}, + void 0, + (t, s) => { + if ("" === t.trim()) throw e(); + const n = f.get(T); + if (void 0 !== n) { + if (n.has(t)) throw e(); + (x(s), + y(s.parameterDescriptors), + n.set(t, s)); + } else + (x(s), + y(s.parameterDescriptors), + f.set(T, new Map([[t, s]]))); + }, + T.sampleRate, + void 0, + void 0, + ), + ); + }) + : Promise.all([i(m), Promise.resolve(t(u, u))]).then( + ([[t, e], s]) => { + const n = d + 1; + d = n; + const [i, o] = v(t, e), + h = new Blob( + [ + `${i};((AudioWorkletProcessor,registerProcessor)=>{${o}\n})(${s ? "AudioWorkletProcessor" : "class extends AudioWorkletProcessor {__b=new WeakSet();constructor(){super();(p=>p.postMessage=(q=>(m,t)=>q.call(p,m,t?t.filter(u=>!this.__b.has(u)):t))(p.postMessage))(this.port)}}"},(n,p)=>registerProcessor(n,class extends p{${s ? "" : "__c = (a) => a.forEach(e=>this.__b.add(e.buffer));"}process(i,o,p){${s ? "" : "i.forEach(this.__c);o.forEach(this.__c);this.__c(Object.values(p));"}return super.process(i.map(j=>j.some(k=>k.length===0)?[]:j),o,p)}}));registerProcessor('__sac${n}',class extends AudioWorkletProcessor{process(){return !1}})`, + ], + { + type: "application/javascript; charset=utf-8", + }, + ), + l = URL.createObjectURL(h); + return T.audioWorklet + .addModule(l, g) + .then(() => { + if (a(T)) return T; + const t = r(T); + return t.audioWorklet + .addModule(l, g) + .then(() => t); + }) + .then((t) => { + if (null === c) throw new SyntaxError(); + try { + new c(t, `__sac${n}`); + } catch { + throw new SyntaxError(); + } + }) + .finally(() => URL.revokeObjectURL(l)); + }, + ); + return ( + void 0 === b ? h.set(_, new Map([[m, S]])) : b.set(m, S), + S.then(() => { + const t = l.get(_); + void 0 === t ? l.set(_, new Set([m])) : t.add(m); + }).finally(() => { + const t = h.get(_); + void 0 !== t && t.delete(m); + }), + S + ); + }; + })( + ge, + Zt, + ( + (t) => (e) => + new Promise((s, n) => { + if (null === t) return void n(new SyntaxError()); + const i = t.document.head; + if (null === i) n(new SyntaxError()); + else { + const o = t.document.createElement("script"), + r = new Blob([e], { + type: "application/javascript", + }), + a = URL.createObjectURL(r), + c = t.onerror, + h = () => { + ((t.onerror = c), URL.revokeObjectURL(a)); + }; + ((t.onerror = (e, s, i, o, r) => + s === a || + (s === t.location.href && 1 === i && 1 === o) + ? (h(), n(r), !1) + : null !== c + ? c(e, s, i, o, r) + : void 0), + (o.onerror = () => { + (h(), n(new SyntaxError())); + }), + (o.onload = () => { + (h(), s()); + }), + (o.src = a), + (o.type = "module"), + i.appendChild(o)); + } + }) + )(xe), + Ks, + async (t) => { + try { + const e = await fetch(t); + if (e.ok) return [await e.text(), e.url]; + } catch {} + throw new DOMException("", "AbortError"); + }, + ke, + en, + Oe, + Fe, + new WeakMap(), + new WeakMap(), + ((t, e) => async () => { + if (null === t) return !0; + if (null === e) return !1; + const s = new Blob( + [ + 'class A extends AudioWorkletProcessor{process(i){this.port.postMessage(i,[i[0][0].buffer])}}registerProcessor("a",A)', + ], + { + type: "application/javascript; charset=utf-8", + }, + ), + n = new e(1, 128, 44100), + i = URL.createObjectURL(s); + let o = !1, + r = !1; + try { + await n.audioWorklet.addModule(i); + const e = new t(n, "a", { + numberOfOutputs: 0, + }), + s = n.createOscillator(); + ((e.port.onmessage = () => (o = !0)), + (e.onprocessorerror = () => (r = !0)), + s.connect(e), + s.start(0), + await n.startRendering(), + await new Promise((t) => setTimeout(t))); + } catch { + } finally { + URL.revokeObjectURL(i); + } + return o && !r; + })(Fe, Ce), + xe, + ) + : void 0, + nn = ( + (t, e) => (s) => + t(s) || e(s) + )(Re, Oe), + on = ((t, e, s, n, i, o, r, a, c, h, l) => (s, n) => { + const u = r(s) ? s : o(s); + if (i.has(n)) { + const t = new DOMException("", "DataCloneError"); + return Promise.reject(t); + } + try { + i.add(n); + } catch {} + return e(c, () => c(u)) + ? u + .decodeAudioData(n) + .then( + (s) => ( + wt(n).catch(() => {}), + e(a, () => a(s)) || l(s), + t.add(s), + s + ), + ) + : new Promise((e, s) => { + const i = async () => { + try { + await wt(n); + } catch {} + }, + o = (t) => { + (s(t), i()); + }; + try { + u.decodeAudioData( + n, + (s) => { + ("function" != typeof s.copyFromChannel && (h(s), q(s)), + t.add(s), + i().then(() => e(s))); + }, + (t) => { + o( + null === t + ? new DOMException("", "EncodingError") + : t, + ); + }, + ); + } catch (t) { + o(t); + } + }); + })(je, ge, 0, 0, new WeakSet(), ke, nn, E, Et, Be, Ue), + rn = ((t, e, s, n, i, o, r, a, c, h, l, u, p, d, f, _, m, g, v, y) => + class extends f { + constructor(e, s) { + (super(e, s), + (this._nativeContext = e), + (this._audioWorklet = + void 0 === t + ? void 0 + : { + addModule: (e, s) => t(this, e, s), + })); + } + get audioWorklet() { + return this._audioWorklet; + } + createAnalyser() { + return new e(this); + } + createBiquadFilter() { + return new i(this); + } + createBuffer(t, e, n) { + return new s({ + length: e, + numberOfChannels: t, + sampleRate: n, + }); + } + createBufferSource() { + return new n(this); + } + createChannelMerger(t = 6) { + return new o(this, { + numberOfInputs: t, + }); + } + createChannelSplitter(t = 6) { + return new r(this, { + numberOfOutputs: t, + }); + } + createConstantSource() { + return new a(this); + } + createConvolver() { + return new c(this); + } + createDelay(t = 1) { + return new l(this, { + maxDelayTime: t, + }); + } + createDynamicsCompressor() { + return new u(this); + } + createGain() { + return new p(this); + } + createIIRFilter(t, e) { + return new d(this, { + feedback: e, + feedforward: t, + }); + } + createOscillator() { + return new _(this); + } + createPanner() { + return new m(this); + } + createPeriodicWave( + t, + e, + s = { + disableNormalization: !1, + }, + ) { + return new g(this, { ...s, imag: e, real: t }); + } + createStereoPanner() { + return new v(this); + } + createWaveShaper() { + return new y(this); + } + decodeAudioData(t, e, s) { + return h(this._nativeContext, t).then( + (t) => ("function" == typeof e && e(t), t), + (t) => { + throw ("function" == typeof s && s(t), t); + }, + ); + } + })( + sn, + Pe, + Ge, + ts, + is, + hs, + us, + _s, + vs, + on, + xs, + Ts, + ks, + Ms, + qs, + Vs, + Bs, + Gs, + Ys, + Hs, + ), + an = ((t, e, s, n) => + class extends t { + constructor(t, e) { + const i = s(t), + o = ((t, e) => t.createMediaElementSource(e.mediaElement))( + i, + e, + ); + if (n(i)) throw TypeError(); + (super(t, !0, o, null), + (this._nativeMediaElementAudioSourceNode = o)); + } + get mediaElement() { + return this._nativeMediaElementAudioSourceNode.mediaElement; + } + })(Ve, 0, ke, Oe), + cn = ((t, e, s, n) => + class extends t { + constructor(t, e) { + const i = s(t); + if (n(i)) throw new TypeError(); + const o = ((t, e) => { + const s = t.createMediaStreamDestination(); + return ( + qt(s, e), + 1 === s.numberOfOutputs && + Object.defineProperty(s, "numberOfOutputs", { + get: () => 0, + }), + s + ); + })(i, { ...Mt, ...e }); + (super(t, !1, o, null), + (this._nativeMediaStreamAudioDestinationNode = o)); + } + get stream() { + return this._nativeMediaStreamAudioDestinationNode.stream; + } + })(Ve, 0, ke, Oe), + hn = ((t, e, s, n) => + class extends t { + constructor(t, e) { + const i = s(t), + o = ((t, { mediaStream: e }) => { + const s = e.getAudioTracks(); + s.sort((t, e) => (t.id < e.id ? -1 : t.id > e.id ? 1 : 0)); + const n = s.slice(0, 1), + i = t.createMediaStreamSource(new MediaStream(n)); + return ( + Object.defineProperty(i, "mediaStream", { + value: e, + }), + i + ); + })(i, e); + if (n(i)) throw new TypeError(); + (super(t, !0, o, null), + (this._nativeMediaStreamAudioSourceNode = o)); + } + get mediaStream() { + return this._nativeMediaStreamAudioSourceNode.mediaStream; + } + })(Ve, 0, ke, Oe), + ln = ( + (t, e) => + (s, { mediaStreamTrack: n }) => { + if ("function" == typeof s.createMediaStreamTrackSource) + return s.createMediaStreamTrackSource(n); + const i = new MediaStream([n]), + o = s.createMediaStreamSource(i); + if ("audio" !== n.kind) throw t(); + if (e(s)) throw new TypeError(); + return o; + } + )(At, Oe), + un = ((t, e, s) => + class extends t { + constructor(t, n) { + const i = s(t); + super(t, !0, e(i, n), null); + } + })(Ve, ln, ke), + pn = ((t, e, s, n, i, o, r, a, c) => + class extends t { + constructor(t = {}) { + if (null === c) + throw new Error( + "Missing the native AudioContext constructor.", + ); + let e; + try { + e = new c(t); + } catch (t) { + if ( + 12 === t.code && + "sampleRate is not in range" === t.message + ) + throw s(); + throw t; + } + if (null === e) throw n(); + if ( + !((t) => + void 0 === t || + "number" == typeof t || + ("string" == typeof t && + ("balanced" === t || + "interactive" === t || + "playback" === t)))(t.latencyHint) + ) + throw new TypeError( + `The provided value '${t.latencyHint}' is not a valid enum value of type AudioContextLatencyCategory.`, + ); + if (void 0 !== t.sampleRate && e.sampleRate !== t.sampleRate) + throw s(); + super(e, 2); + const { latencyHint: i } = t, + { sampleRate: o } = e; + if ( + ((this._baseLatency = + "number" == typeof e.baseLatency + ? e.baseLatency + : "balanced" === i + ? 512 / o + : "interactive" === i || void 0 === i + ? 256 / o + : "playback" === i + ? 1024 / o + : (128 * + Math.max( + 2, + Math.min(128, Math.round((i * o) / 128)), + )) / + o), + (this._nativeAudioContext = e), + "webkitAudioContext" === c.name + ? ((this._nativeGainNode = e.createGain()), + (this._nativeOscillatorNode = e.createOscillator()), + (this._nativeGainNode.gain.value = 1e-37), + this._nativeOscillatorNode + .connect(this._nativeGainNode) + .connect(e.destination), + this._nativeOscillatorNode.start()) + : ((this._nativeGainNode = null), + (this._nativeOscillatorNode = null)), + (this._state = null), + "running" === e.state) + ) { + this._state = "suspended"; + const t = () => { + ("suspended" === this._state && (this._state = null), + e.removeEventListener("statechange", t)); + }; + e.addEventListener("statechange", t); + } + } + get baseLatency() { + return this._baseLatency; + } + get state() { + return null !== this._state + ? this._state + : this._nativeAudioContext.state; + } + close() { + return "closed" === this.state + ? this._nativeAudioContext.close().then(() => { + throw e(); + }) + : ("suspended" === this._state && (this._state = null), + this._nativeAudioContext.close().then(() => { + (null !== this._nativeGainNode && + null !== this._nativeOscillatorNode && + (this._nativeOscillatorNode.stop(), + this._nativeGainNode.disconnect(), + this._nativeOscillatorNode.disconnect()), + W(this)); + })); + } + createMediaElementSource(t) { + return new i(this, { + mediaElement: t, + }); + } + createMediaStreamDestination() { + return new o(this); + } + createMediaStreamSource(t) { + return new r(this, { + mediaStream: t, + }); + } + createMediaStreamTrackSource(t) { + return new a(this, { + mediaStreamTrack: t, + }); + } + resume() { + return "suspended" === this._state + ? new Promise((t, e) => { + const s = () => { + (this._nativeAudioContext.removeEventListener( + "statechange", + s, + ), + "running" === this._nativeAudioContext.state + ? t() + : this.resume().then(t, e)); + }; + this._nativeAudioContext.addEventListener( + "statechange", + s, + ); + }) + : this._nativeAudioContext.resume().catch((t) => { + if (void 0 === t || 15 === t.code) throw e(); + throw t; + }); + } + suspend() { + return this._nativeAudioContext.suspend().catch((t) => { + if (void 0 === t) throw e(); + throw t; + }); + } + })(rn, At, Zt, Kt, an, cn, hn, un, Ee), + dn = ((t) => (e) => { + const s = t.get(e); + if (void 0 === s) + throw new Error("The context has no set of AudioWorkletNodes."); + return s; + })(Rs), + fn = ((t) => (e, s) => { + t(e).add(s); + })(dn), + _n = ( + (t) => + (e, s, n = 0, i = 0) => { + const o = e[n]; + if (void 0 === o) throw t(); + return rt(s) ? o.connect(s, 0, i) : o.connect(s, 0); + } + )(R), + mn = ((t) => (e, s) => { + t(e).delete(s); + })(dn), + gn = ( + (t) => + (e, s = void 0, n = void 0, i = 0) => + void 0 === s + ? e.forEach((t) => t.disconnect()) + : "number" == typeof s + ? Tt(t, e, s).disconnect() + : rt(s) + ? void 0 === n + ? e.forEach((t) => t.disconnect(s)) + : void 0 === i + ? Tt(t, e, n).disconnect(s, 0) + : Tt(t, e, n).disconnect(s, 0, i) + : void 0 === n + ? e.forEach((t) => t.disconnect(s)) + : Tt(t, e, n).disconnect(s, 0) + )(R), + vn = new WeakMap(), + yn = ( + (t, e) => (s) => + e(t, s) + )(vn, w), + xn = ((t, e, s, n, i, o, r, a, c, h, l, u, p) => (d, f, m, g) => { + if (0 === g.numberOfInputs && 0 === g.numberOfOutputs) throw c(); + const v = Array.isArray(g.outputChannelCount) + ? g.outputChannelCount + : Array.from(g.outputChannelCount); + if (v.some((t) => t < 1)) throw c(); + if (v.length !== g.numberOfOutputs) throw e(); + if ("explicit" !== g.channelCountMode) throw c(); + const y = g.channelCount * g.numberOfInputs, + x = v.reduce((t, e) => t + e, 0), + w = + void 0 === m.parameterDescriptors + ? 0 + : m.parameterDescriptors.length; + if (y + w > 6 || x > 6) throw c(); + const b = new MessageChannel(), + T = [], + S = []; + for (let t = 0; t < g.numberOfInputs; t += 1) + (T.push( + r(d, { + channelCount: g.channelCount, + channelCountMode: g.channelCountMode, + channelInterpretation: g.channelInterpretation, + gain: 1, + }), + ), + S.push( + i(d, { + channelCount: g.channelCount, + channelCountMode: "explicit", + channelInterpretation: "discrete", + numberOfOutputs: g.channelCount, + }), + )); + const k = []; + if (void 0 !== m.parameterDescriptors) + for (const { + defaultValue: t, + maxValue: e, + minValue: s, + name: n, + } of m.parameterDescriptors) { + const i = o(d, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + offset: + void 0 !== g.parameterData[n] + ? g.parameterData[n] + : void 0 === t + ? 0 + : t, + }); + (Object.defineProperties(i.offset, { + defaultValue: { + get: () => (void 0 === t ? 0 : t), + }, + maxValue: { + get: () => (void 0 === e ? V : e), + }, + minValue: { + get: () => (void 0 === s ? F : s), + }, + }), + k.push(i)); + } + const A = n(d, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: Math.max(1, y + w), + }), + C = Pt(f, d.sampleRate), + O = a(d, C, y + w, Math.max(1, x)), + D = i(d, { + channelCount: Math.max(1, x), + channelCountMode: "explicit", + channelInterpretation: "discrete", + numberOfOutputs: Math.max(1, x), + }), + M = []; + for (let t = 0; t < g.numberOfOutputs; t += 1) + M.push( + n(d, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: v[t], + }), + ); + for (let t = 0; t < g.numberOfInputs; t += 1) { + T[t].connect(S[t]); + for (let e = 0; e < g.channelCount; e += 1) + S[t].connect(A, e, t * g.channelCount + e); + } + const E = new lt( + void 0 === m.parameterDescriptors + ? [] + : m.parameterDescriptors.map(({ name: t }, e) => { + const s = k[e]; + return (s.connect(A, 0, y + e), s.start(0), [t, s.offset]); + }), + ); + A.connect(O); + let R = g.channelInterpretation, + q = null; + const I = 0 === g.numberOfOutputs ? [O] : M, + N = { + get bufferSize() { + return C; + }, + get channelCount() { + return g.channelCount; + }, + set channelCount(t) { + throw s(); + }, + get channelCountMode() { + return g.channelCountMode; + }, + set channelCountMode(t) { + throw s(); + }, + get channelInterpretation() { + return R; + }, + set channelInterpretation(t) { + for (const e of T) e.channelInterpretation = t; + R = t; + }, + get context() { + return O.context; + }, + get inputs() { + return T; + }, + get numberOfInputs() { + return g.numberOfInputs; + }, + get numberOfOutputs() { + return g.numberOfOutputs; + }, + get onprocessorerror() { + return q; + }, + set onprocessorerror(t) { + ("function" == typeof q && + N.removeEventListener("processorerror", q), + (q = "function" == typeof t ? t : null), + "function" == typeof q && + N.addEventListener("processorerror", q)); + }, + get parameters() { + return E; + }, + get port() { + return b.port2; + }, + addEventListener: (...t) => + O.addEventListener(t[0], t[1], t[2]), + connect: t.bind(null, I), + disconnect: h.bind(null, I), + dispatchEvent: (...t) => O.dispatchEvent(t[0]), + removeEventListener: (...t) => + O.removeEventListener(t[0], t[1], t[2]), + }, + P = new Map(); + var j, L; + ((b.port1.addEventListener = + ((j = b.port1.addEventListener), + (...t) => { + if ("message" === t[0]) { + const e = + "function" == typeof t[1] + ? t[1] + : "object" == typeof t[1] && + null !== t[1] && + "function" == typeof t[1].handleEvent + ? t[1].handleEvent + : null; + if (null !== e) { + const s = P.get(t[1]); + void 0 !== s + ? (t[1] = s) + : ((t[1] = (t) => { + l(d.currentTime, d.sampleRate, () => e(t)); + }), + P.set(e, t[1])); + } + } + return j.call(b.port1, t[0], t[1], t[2]); + })), + (b.port1.removeEventListener = + ((L = b.port1.removeEventListener), + (...t) => { + if ("message" === t[0]) { + const e = P.get(t[1]); + void 0 !== e && (P.delete(t[1]), (t[1] = e)); + } + return L.call(b.port1, t[0], t[1], t[2]); + }))); + let z = null; + (Object.defineProperty(b.port1, "onmessage", { + get: () => z, + set: (t) => { + ("function" == typeof z && + b.port1.removeEventListener("message", z), + (z = "function" == typeof t ? t : null), + "function" == typeof z && + (b.port1.addEventListener("message", z), b.port1.start())); + }, + }), + (m.prototype.port = b.port1)); + let W = null; + const B = ((t, e, s, n) => { + let i = _.get(t); + void 0 === i && ((i = new WeakMap()), _.set(t, i)); + const o = (async (t, e) => { + const s = await ((t) => + new Promise((e, s) => { + const { port1: n, port2: i } = new MessageChannel(); + ((n.onmessage = ({ data: t }) => { + (n.close(), i.close(), e(t)); + }), + (n.onmessageerror = ({ data: t }) => { + (n.close(), i.close(), s(t)); + }), + i.postMessage(t)); + }))(e); + return new t(s); + })(s, n); + return (i.set(e, o), o); + })(d, N, m, g); + B.then((t) => (W = t)); + const U = ft(g.numberOfInputs, g.channelCount), + G = ft(g.numberOfOutputs, v), + Q = + void 0 === m.parameterDescriptors + ? [] + : m.parameterDescriptors.reduce( + (t, { name: e }) => ({ + ...t, + [e]: new Float32Array(128), + }), + {}, + ); + let Z = !0; + const X = () => { + g.numberOfOutputs > 0 && O.disconnect(D); + for (let t = 0, e = 0; t < g.numberOfOutputs; t += 1) { + const s = M[t]; + for (let n = 0; n < v[t]; n += 1) D.disconnect(s, e + n, n); + e += v[t]; + } + }, + Y = new Map(); + O.onaudioprocess = ({ inputBuffer: t, outputBuffer: e }) => { + if (null !== W) { + const s = u(N); + for (let n = 0; n < C; n += 128) { + for (let e = 0; e < g.numberOfInputs; e += 1) + for (let s = 0; s < g.channelCount; s += 1) + pt(t, U[e], s, s, n); + void 0 !== m.parameterDescriptors && + m.parameterDescriptors.forEach(({ name: e }, s) => { + pt(t, Q, e, y + s, n); + }); + for (let t = 0; t < g.numberOfInputs; t += 1) + for (let e = 0; e < v[t]; e += 1) + 0 === G[t][e].byteLength && + (G[t][e] = new Float32Array(128)); + try { + const t = U.map((t, e) => { + if (s[e].size > 0) return (Y.set(e, C / 128), t); + const n = Y.get(e); + return void 0 === n + ? [] + : (t.every((t) => t.every((t) => 0 === t)) && + (1 === n ? Y.delete(e) : Y.set(e, n - 1)), + t); + }), + i = l( + d.currentTime + n / d.sampleRate, + d.sampleRate, + () => W.process(t, G, Q), + ); + Z = i; + for (let t = 0, s = 0; t < g.numberOfOutputs; t += 1) { + for (let i = 0; i < v[t]; i += 1) + dt(e, G[t], i, s + i, n); + s += v[t]; + } + } catch (t) { + ((Z = !1), + N.dispatchEvent( + new ErrorEvent("processorerror", { + colno: t.colno, + filename: t.filename, + lineno: t.lineno, + message: t.message, + }), + )); + } + if (!Z) { + for (let t = 0; t < g.numberOfInputs; t += 1) { + T[t].disconnect(S[t]); + for (let e = 0; e < g.channelCount; e += 1) + S[n].disconnect(A, e, t * g.channelCount + e); + } + if (void 0 !== m.parameterDescriptors) { + const t = m.parameterDescriptors.length; + for (let e = 0; e < t; e += 1) { + const t = k[e]; + (t.disconnect(A, 0, y + e), t.stop()); + } + } + (A.disconnect(O), (O.onaudioprocess = null), $ ? X() : K()); + break; + } + } + } + }; + let $ = !1; + const H = r(d, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + gain: 0, + }), + J = () => O.connect(H).connect(d.destination), + K = () => { + (O.disconnect(H), H.disconnect()); + }; + return ( + J(), + p( + N, + () => { + if (Z) { + (K(), g.numberOfOutputs > 0 && O.connect(D)); + for (let t = 0, e = 0; t < g.numberOfOutputs; t += 1) { + const s = M[t]; + for (let n = 0; n < v[t]; n += 1) D.connect(s, e + n, n); + e += v[t]; + } + } + $ = !0; + }, + () => { + (Z && (J(), X()), ($ = !1)); + }, + ) + ); + })(_n, R, At, as, Lt, ds, Bt, Qt, Zt, gn, Ks, yn, os), + wn = ((t, e, s, n, i) => (o, r, a, c, h, l) => { + if (null !== a) + try { + const e = new a(o, c, l), + n = new Map(); + let r = null; + if ( + (Object.defineProperties(e, { + channelCount: { + get: () => l.channelCount, + set: () => { + throw t(); + }, + }, + channelCountMode: { + get: () => "explicit", + set: () => { + throw t(); + }, + }, + onprocessorerror: { + get: () => r, + set: (t) => { + ("function" == typeof r && + e.removeEventListener("processorerror", r), + (r = "function" == typeof t ? t : null), + "function" == typeof r && + e.addEventListener("processorerror", r)); + }, + }, + }), + (e.addEventListener = + ((p = e.addEventListener), + (...t) => { + if ("processorerror" === t[0]) { + const e = + "function" == typeof t[1] + ? t[1] + : "object" == typeof t[1] && + null !== t[1] && + "function" == typeof t[1].handleEvent + ? t[1].handleEvent + : null; + if (null !== e) { + const s = n.get(t[1]); + void 0 !== s + ? (t[1] = s) + : ((t[1] = (s) => { + "error" === s.type + ? (Object.defineProperties(s, { + type: { + value: "processorerror", + }, + }), + e(s)) + : e(new ErrorEvent(t[0], { ...s })); + }), + n.set(e, t[1])); + } + } + return (p.call(e, "error", t[1], t[2]), p.call(e, ...t)); + })), + (e.removeEventListener = + ((u = e.removeEventListener), + (...t) => { + if ("processorerror" === t[0]) { + const e = n.get(t[1]); + void 0 !== e && (n.delete(t[1]), (t[1] = e)); + } + return ( + u.call(e, "error", t[1], t[2]), + u.call(e, t[0], t[1], t[2]) + ); + })), + 0 !== l.numberOfOutputs) + ) { + const t = s(o, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + gain: 0, + }); + return ( + e.connect(t).connect(o.destination), + i( + e, + () => t.disconnect(), + () => t.connect(o.destination), + ) + ); + } + return e; + } catch (t) { + if (11 === t.code) throw n(); + throw t; + } + var u, p; + if (void 0 === h) throw n(); + return ( + ((t) => { + const { port1: e } = new MessageChannel(); + try { + e.postMessage(t); + } finally { + e.close(); + } + })(l), + e(o, r, h, l) + ); + })(At, xn, Bt, Zt, os), + bn = ( + (t, e, s, n, i, o, r, a, c, h, l, u, p, d, f, _) => (m, g, v) => { + const y = new WeakMap(); + let x = null; + return { + render(w, b) { + a(b, w); + const T = y.get(b); + return void 0 !== T + ? Promise.resolve(T) + : (async (a, w) => { + let b = l(a), + T = null; + const S = M(b, w), + k = Array.isArray(g.outputChannelCount) + ? g.outputChannelCount + : Array.from(g.outputChannelCount); + if (null === u) { + const t = k.reduce((t, e) => t + e, 0), + s = i(w, { + channelCount: Math.max(1, t), + channelCountMode: "explicit", + channelInterpretation: "discrete", + numberOfOutputs: Math.max(1, t), + }), + o = []; + for (let t = 0; t < a.numberOfOutputs; t += 1) + o.push( + n(w, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: k[t], + }), + ); + const h = r(w, { + channelCount: g.channelCount, + channelCountMode: g.channelCountMode, + channelInterpretation: g.channelInterpretation, + gain: 1, + }); + ((h.connect = e.bind(null, o)), + (h.disconnect = c.bind(null, o)), + (T = [s, o, h])); + } else S || (b = new u(w, m)); + if ((y.set(w, null === T ? b : T[2]), null !== T)) { + if (null === x) { + if (void 0 === v) + throw new Error( + "Missing the processor constructor.", + ); + if (null === p) + throw new Error( + "Missing the native OfflineAudioContext constructor.", + ); + const t = a.channelCount * a.numberOfInputs, + e = + void 0 === v.parameterDescriptors + ? 0 + : v.parameterDescriptors.length, + s = t + e, + c = async () => { + const c = new p( + s, + 128 * Math.ceil(a.context.length / 128), + w.sampleRate, + ), + h = [], + l = []; + for (let t = 0; t < g.numberOfInputs; t += 1) + (h.push( + r(c, { + channelCount: g.channelCount, + channelCountMode: g.channelCountMode, + channelInterpretation: + g.channelInterpretation, + gain: 1, + }), + ), + l.push( + i(c, { + channelCount: g.channelCount, + channelCountMode: "explicit", + channelInterpretation: "discrete", + numberOfOutputs: g.channelCount, + }), + )); + const u = await Promise.all( + Array.from(a.parameters.values()).map( + async (t) => { + const e = o(c, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "discrete", + offset: t.value, + }); + return (await d(c, t, e.offset), e); + }, + ), + ), + m = n(c, { + channelCount: 1, + channelCountMode: "explicit", + channelInterpretation: "speakers", + numberOfInputs: Math.max(1, t + e), + }); + for (let t = 0; t < g.numberOfInputs; t += 1) { + h[t].connect(l[t]); + for (let e = 0; e < g.channelCount; e += 1) + l[t].connect(m, e, t * g.channelCount + e); + } + for (const [e, s] of u.entries()) + (s.connect(m, 0, t + e), s.start(0)); + return ( + m.connect(c.destination), + await Promise.all(h.map((t) => f(a, c, t))), + _(c) + ); + }; + x = _t( + a, + 0 === s ? null : await c(), + w, + g, + k, + v, + h, + ); + } + const t = await x, + e = s(w, { + buffer: null, + channelCount: 2, + channelCountMode: "max", + channelInterpretation: "speakers", + loop: !1, + loopEnd: 0, + loopStart: 0, + playbackRate: 1, + }), + [c, l, u] = T; + (null !== t && ((e.buffer = t), e.start(0)), + e.connect(c)); + for ( + let t = 0, e = 0; + t < a.numberOfOutputs; + t += 1 + ) { + const s = l[t]; + for (let n = 0; n < k[t]; n += 1) + c.connect(s, e + n, n); + e += k[t]; + } + return u; + } + if (S) + for (const [e, s] of a.parameters.entries()) + await t(w, s, b.parameters.get(e)); + else + for (const [t, e] of a.parameters.entries()) + await d(w, e, b.parameters.get(t)); + return (await f(a, w, b), b); + })(w, b); + }, + }; + } + )(Xe, _n, Ye, as, Lt, ds, Bt, mn, gn, Ks, tt, Fe, Ce, $e, Te, Cs), + Tn = ( + (t) => (e) => + t.get(e) + )(tn), + Sn = ((t) => (e, s) => { + t.set(e, s); + })(vn), + kn = Js + ? ((t, e, s, n, i, o, r, a, c, h, l, u, p, d) => + class extends e { + constructor(e, l, p) { + var d; + const _ = a(e), + m = c(_), + g = ((t) => ({ + ...t, + outputChannelCount: + void 0 !== t.outputChannelCount + ? t.outputChannelCount + : 1 === t.numberOfInputs && 1 === t.numberOfOutputs + ? [t.channelCount] + : Array.from( + { + length: t.numberOfOutputs, + }, + () => 1, + ), + }))({ ...ut, ...p }); + ((t) => { + const { port1: e, port2: s } = new MessageChannel(); + try { + e.postMessage(t); + } finally { + (e.close(), s.close()); + } + })(g); + const v = f.get(_), + y = null == v ? void 0 : v.get(l), + x = + m || "closed" !== _.state + ? _ + : null !== (d = r(_)) && void 0 !== d + ? d + : _, + w = i(x, m ? null : e.baseLatency, h, l, y, g); + super(e, !0, w, m ? n(l, g, y) : null); + const b = []; + (w.parameters.forEach((t, e) => { + const n = s(this, m, t); + b.push([e, n]); + }), + (this._nativeAudioWorkletNode = w), + (this._onprocessorerror = null), + (this._parameters = new lt(b)), + m && t(_, this)); + const { activeInputs: T } = o(this); + u(w, T); + } + get onprocessorerror() { + return this._onprocessorerror; + } + set onprocessorerror(t) { + const e = "function" == typeof t ? d(this, t) : null; + this._nativeAudioWorkletNode.onprocessorerror = e; + const s = this._nativeAudioWorkletNode.onprocessorerror; + this._onprocessorerror = null !== s && s === e ? t : s; + } + get parameters() { + return null === this._parameters + ? this._nativeAudioWorkletNode.parameters + : this._parameters; + } + get port() { + return this._nativeAudioWorkletNode.port; + } + })(fn, Ve, Je, bn, wn, j, Tn, ke, Oe, Fe, 0, Sn, 0, ue) + : void 0, + An = ((t, e) => (s, n, i) => { + if (null === e) + throw new Error( + "Missing the native OfflineAudioContext constructor.", + ); + try { + return new e(s, n, i); + } catch (e) { + if ("SyntaxError" === e.name) throw t(); + throw e; + } + })(Zt, Ce), + Cn = ( + (t, e, s, n, i, o, r, a) => (c, h) => + s(c) + .render(c, h) + .then(() => + Promise.all(Array.from(n(h)).map((t) => s(t).render(t, h))), + ) + .then(() => i(h)) + .then( + (s) => ( + "function" != typeof s.copyFromChannel + ? (r(s), q(s)) + : e(o, () => o(s)) || a(s), + t.add(s), + s + ), + ) + )(je, ge, be, dn, Cs, E, Be, Ue), + On = ((t, e, s, n, i) => + class extends t { + constructor(t, s, i) { + let o; + if ("number" == typeof t && void 0 !== s && void 0 !== i) + o = { + length: s, + numberOfChannels: t, + sampleRate: i, + }; + else { + if ("object" != typeof t) + throw new Error("The given parameters are not valid."); + o = t; + } + const { + length: r, + numberOfChannels: a, + sampleRate: c, + } = { ...Xt, ...o }, + h = n(a, r, c); + (e(Et, () => Et(h)) || + h.addEventListener( + "statechange", + (() => { + let t = 0; + const e = (s) => { + "running" === this._state && + (t > 0 + ? (h.removeEventListener("statechange", e), + s.stopImmediatePropagation(), + this._waitForThePromiseToSettle(s)) + : (t += 1)); + }; + return e; + })(), + ), + super(h, a), + (this._length = r), + (this._nativeOfflineAudioContext = h), + (this._state = null)); + } + get length() { + return void 0 === this._nativeOfflineAudioContext.length + ? this._length + : this._nativeOfflineAudioContext.length; + } + get state() { + return null === this._state + ? this._nativeOfflineAudioContext.state + : this._state; + } + startRendering() { + return "running" === this._state + ? Promise.reject(s()) + : ((this._state = "running"), + i( + this.destination, + this._nativeOfflineAudioContext, + ).finally(() => { + ((this._state = null), W(this)); + })); + } + _waitForThePromiseToSettle(t) { + null === this._state + ? this._nativeOfflineAudioContext.dispatchEvent(t) + : setTimeout(() => this._waitForThePromiseToSettle(t)); + } + })(rn, ge, At, An, Cn), + Dn = ((t, e) => (s) => { + const n = t.get(s); + return e(n) || e(s); + })(u, Re), + Mn = ( + (t, e) => (s) => + t.has(s) || e(s) + )(c, qe), + En = ( + (t, e) => (s) => + t.has(s) || e(s) + )(l, Ie), + Rn = ((t, e) => (s) => { + const n = t.get(s); + return e(n) || e(s); + })(u, Oe), + qn = () => + (async (t, e, s, n, i, o, r, a, c, h, l, u, p, d, f, _) => + !!( + t(e, e) && + t(s, s) && + t(i, i) && + t(o, o) && + t(a, a) && + t(c, c) && + t(h, h) && + t(l, l) && + t(u, u) && + t(p, p) && + t(d, d) + ) && + (await Promise.all([t(n, n), t(r, r), t(f, f), t(_, _)])).every( + (t) => t, + ))( + ge, + ((t) => () => { + if (null === t) return !1; + const e = new t(1, 1, 44100).createBuffer(1, 1, 44100); + if (void 0 === e.copyToChannel) return !0; + const s = new Float32Array(2); + try { + e.copyFromChannel(s, 0, 0); + } catch { + return !1; + } + return !0; + })(Ce), + ((t) => () => { + if (null === t) return !1; + if (void 0 !== t.prototype && void 0 !== t.prototype.close) + return !0; + const e = new t(), + s = void 0 !== e.close; + try { + e.close(); + } catch {} + return s; + })(Ee), + ((t) => () => { + if (null === t) return Promise.resolve(!1); + const e = new t(1, 1, 44100); + return new Promise((t) => { + let s = !0; + const n = (n) => { + s && + ((s = !1), e.startRendering(), t(n instanceof TypeError)); + }; + let i; + try { + i = e.decodeAudioData(null, () => {}, n); + } catch (t) { + n(t); + } + void 0 !== i && i.catch(n); + }); + })(Ce), + ((t) => () => { + if (null === t) return !1; + let e; + try { + e = new t({ + latencyHint: "balanced", + }); + } catch { + return !1; + } + return (e.close(), !0); + })(Ee), + ((t) => () => { + if (null === t) return !1; + const e = new t(1, 1, 44100).createGain(), + s = e.connect(e) === e; + return (e.disconnect(e), s); + })(Ce), + ((t, e) => async () => { + if (null === t) return !0; + if (null === e) return !1; + const s = new Blob( + [ + 'let c,p;class A extends AudioWorkletProcessor{constructor(){super();this.port.onmessage=(e)=>{p=e.data;p.onmessage=()=>{p.postMessage(c);p.close()};this.port.postMessage(0)}}process(){c=1}}registerProcessor("a",A)', + ], + { + type: "application/javascript; charset=utf-8", + }, + ), + n = new MessageChannel(), + i = new e(1, 128, 44100), + o = URL.createObjectURL(s); + let r = !1; + try { + await i.audioWorklet.addModule(o); + const e = new t(i, "a", { + numberOfOutputs: 0, + }), + s = i.createOscillator(); + (await new Promise((t) => { + ((e.port.onmessage = () => t()), + e.port.postMessage(n.port2, [n.port2])); + }), + (e.port.onmessage = () => (r = !0)), + s.connect(e), + s.start(0), + await i.startRendering(), + (r = await new Promise((t) => { + ((n.port1.onmessage = ({ data: e }) => t(1 === e)), + n.port1.postMessage(0)); + }))); + } catch { + } finally { + (n.port1.close(), URL.revokeObjectURL(o)); + } + return r; + })(Fe, Ce), + ((t) => () => { + if (null === t) return !1; + const e = new t(1, 1, 44100).createChannelMerger(); + if ("max" === e.channelCountMode) return !0; + try { + e.channelCount = 2; + } catch { + return !0; + } + return !1; + })(Ce), + ((t) => () => { + if (null === t) return !1; + const e = new t(1, 1, 44100); + return ( + void 0 === e.createConstantSource || + e.createConstantSource().offset.maxValue !== + Number.POSITIVE_INFINITY + ); + })(Ce), + ((t) => () => { + if (null === t) return !1; + const e = new t(1, 1, 44100), + s = e.createConvolver(); + s.buffer = e.createBuffer(1, 1, e.sampleRate); + try { + s.buffer = e.createBuffer(1, 1, e.sampleRate); + } catch { + return !1; + } + return !0; + })(Ce), + ((t) => () => { + if (null === t) return !1; + const e = new t(1, 1, 44100).createConvolver(); + try { + e.channelCount = 1; + } catch { + return !1; + } + return !0; + })(Ce), + ce, + ( + (t) => () => + null !== t && t.hasOwnProperty("isSecureContext") + )(xe), + ((t) => () => { + if (null === t) return !1; + const e = new t(); + try { + return (e.createMediaStreamSource(new MediaStream()), !1); + } catch (t) { + return !0; + } finally { + e.close(); + } + })(Ee), + ((t) => () => { + if (null === t) return Promise.resolve(!1); + const e = new t(1, 1, 44100); + if (void 0 === e.createStereoPanner) return Promise.resolve(!0); + if (void 0 === e.createConstantSource) + return Promise.resolve(!0); + const s = e.createConstantSource(), + n = e.createStereoPanner(); + return ( + (s.channelCount = 1), + (s.offset.value = 1), + (n.channelCount = 1), + s.start(), + s.connect(n).connect(e.destination), + e.startRendering().then((t) => 1 !== t.getChannelData(0)[0]) + ); + })(Ce), + he, + ); + + function In(t) { + return void 0 === t; + } + + function Fn(t) { + return void 0 !== t; + } + + function Vn(t) { + return "function" == typeof t; + } + + function Nn(t) { + return "number" == typeof t; + } + + function Pn(t) { + return ( + "[object Object]" === Object.prototype.toString.call(t) && + t.constructor === Object + ); + } + + function jn(t) { + return "boolean" == typeof t; + } + + function Ln(t) { + return Array.isArray(t); + } + + function zn(t) { + return "string" == typeof t; + } + + function Wn(t) { + return zn(t) && /^([a-g]{1}(?:b|#|x|bb)?)(-?[0-9]+)/i.test(t); + } + + function Bn(t, e) { + if (!t) throw new Error(e); + } + + function Un(t, e, s = 1 / 0) { + if (!(e <= t && t <= s)) + throw new RangeError( + `Value must be within [${e}, ${s}], got: ${t}`, + ); + } + + function Gn(t) { + t.isOffline || + "running" === t.state || + Kn( + 'The AudioContext is "suspended". Invoke Tone.start() from a user action to start the audio.', + ); + } + let Qn = !1, + Zn = !1; + + function Xn(t) { + Qn = t; + } + + function Yn(t) { + In(t) && + Qn && + !Zn && + ((Zn = !0), + Kn( + "Events scheduled inside of scheduled callbacks should use the passed in scheduling time. See https://github.com/Tonejs/Tone.js/wiki/Accurate-Timing", + )); + } + let $n = console; + + function Hn(t) { + $n = t; + } + + function Jn(...t) { + $n.log(...t); + } + + function Kn(...t) { + $n.warn(...t); + } + const ti = "object" == typeof self ? self : null, + ei = + ti && + (ti.hasOwnProperty("AudioContext") || + ti.hasOwnProperty("webkitAudioContext")); + + function si(t, e, s, n) { + var i, + o = arguments.length, + r = + o < 3 + ? e + : null === n + ? (n = Object.getOwnPropertyDescriptor(e, s)) + : n; + if ( + "object" == typeof Reflect && + "function" == typeof Reflect.decorate + ) + r = Reflect.decorate(t, e, s, n); + else + for (var a = t.length - 1; a >= 0; a--) + (i = t[a]) && + (r = (o < 3 ? i(r) : o > 3 ? i(e, s, r) : i(e, s)) || r); + return (o > 3 && r && Object.defineProperty(e, s, r), r); + } + + function ni(t, e, s, n) { + return new (s || (s = Promise))(function (i, o) { + function r(t) { + try { + c(n.next(t)); + } catch (t) { + o(t); + } + } + + function a(t) { + try { + c(n.throw(t)); + } catch (t) { + o(t); + } + } + + function c(t) { + var e; + t.done + ? i(t.value) + : ((e = t.value), + e instanceof s + ? e + : new s(function (t) { + t(e); + })).then(r, a); + } + c((n = n.apply(t, e || [])).next()); + }); + } + (Object.create, + Object.create, + "function" == typeof SuppressedError && SuppressedError); + class ii { + constructor(t, e, s, n) { + ((this._callback = t), + (this._type = e), + (this._minimumUpdateInterval = Math.max( + 128 / (n || 44100), + 0.001, + )), + (this.updateInterval = s), + this._createClock()); + } + _createWorker() { + const t = new Blob( + [ + `\n\t\t\t// the initial timeout time\n\t\t\tlet timeoutTime = ${(1e3 * this._updateInterval).toFixed(1)};\n\t\t\t// onmessage callback\n\t\t\tself.onmessage = function(msg){\n\t\t\t\ttimeoutTime = parseInt(msg.data);\n\t\t\t};\n\t\t\t// the tick function which posts a message\n\t\t\t// and schedules a new tick\n\t\t\tfunction tick(){\n\t\t\t\tsetTimeout(tick, timeoutTime);\n\t\t\t\tself.postMessage('tick');\n\t\t\t}\n\t\t\t// call tick initially\n\t\t\ttick();\n\t\t\t`, + ], + { + type: "text/javascript", + }, + ), + e = URL.createObjectURL(t), + s = new Worker(e); + ((s.onmessage = this._callback.bind(this)), (this._worker = s)); + } + _createTimeout() { + this._timeout = setTimeout(() => { + (this._createTimeout(), this._callback()); + }, 1e3 * this._updateInterval); + } + _createClock() { + if ("worker" === this._type) + try { + this._createWorker(); + } catch (t) { + ((this._type = "timeout"), this._createClock()); + } + else "timeout" === this._type && this._createTimeout(); + } + _disposeClock() { + (this._timeout && clearTimeout(this._timeout), + this._worker && + (this._worker.terminate(), (this._worker.onmessage = null))); + } + get updateInterval() { + return this._updateInterval; + } + set updateInterval(t) { + var e; + ((this._updateInterval = Math.max(t, this._minimumUpdateInterval)), + "worker" === this._type && + (null === (e = this._worker) || + void 0 === e || + e.postMessage(1e3 * this._updateInterval))); + } + get type() { + return this._type; + } + set type(t) { + (this._disposeClock(), (this._type = t), this._createClock()); + } + dispose() { + this._disposeClock(); + } + } + + function oi(t) { + return En(t); + } + + function ri(t) { + return Mn(t); + } + + function ai(t) { + return Rn(t); + } + + function ci(t) { + return Dn(t); + } + + function hi(t, e) { + return ( + "value" === t || + oi(e) || + ri(e) || + (function (t) { + return t instanceof Ge; + })(e) + ); + } + + function li(t, ...e) { + if (!e.length) return t; + const s = e.shift(); + if (Pn(t) && Pn(s)) + for (const e in s) + hi(e, s[e]) + ? (t[e] = s[e]) + : Pn(s[e]) + ? (t[e] || + Object.assign(t, { + [e]: {}, + }), + li(t[e], s[e])) + : Object.assign(t, { + [e]: s[e], + }); + return li(t, ...e); + } + + function ui(t, e, s = [], n) { + const i = {}, + o = Array.from(e); + if ( + (Pn(o[0]) && + n && + !Reflect.has(o[0], n) && + (Object.keys(o[0]).some((e) => Reflect.has(t, e)) || + (li(i, { + [n]: o[0], + }), + s.splice(s.indexOf(n), 1), + o.shift())), + 1 === o.length && Pn(o[0])) + ) + li(i, o[0]); + else for (let t = 0; t < s.length; t++) Fn(o[t]) && (i[s[t]] = o[t]); + return li(t, i); + } + + function pi(t, e) { + return In(t) ? e : t; + } + + function di(t, e) { + return ( + e.forEach((e) => { + Reflect.has(t, e) && delete t[e]; + }), + t + ); + } + class fi { + constructor() { + ((this.debug = !1), (this._wasDisposed = !1)); + } + static getDefaults() { + return {}; + } + log(...t) { + (this.debug || (ti && this.toString() === ti.TONE_DEBUG_CLASS)) && + Jn(this, ...t); + } + dispose() { + return ((this._wasDisposed = !0), this); + } + get disposed() { + return this._wasDisposed; + } + toString() { + return this.name; + } + } + fi.version = i; + const _i = 1e-6; + + function mi(t, e) { + return t > e + _i; + } + + function gi(t, e) { + return mi(t, e) || yi(t, e); + } + + function vi(t, e) { + return t + _i < e; + } + + function yi(t, e) { + return Math.abs(t - e) < _i; + } + + function xi(t, e, s) { + return Math.max(Math.min(t, s), e); + } + class wi extends fi { + constructor() { + (super(), (this.name = "Timeline"), (this._timeline = [])); + const t = ui(wi.getDefaults(), arguments, ["memory"]); + ((this.memory = t.memory), (this.increasing = t.increasing)); + } + static getDefaults() { + return { + memory: 1 / 0, + increasing: !1, + }; + } + get length() { + return this._timeline.length; + } + add(t) { + if ( + (Bn( + Reflect.has(t, "time"), + "Timeline: events must have a time attribute", + ), + (t.time = t.time.valueOf()), + this.increasing && this.length) + ) { + const e = this._timeline[this.length - 1]; + (Bn( + gi(t.time, e.time), + "The time must be greater than or equal to the last scheduled time", + ), + this._timeline.push(t)); + } else { + const e = this._search(t.time); + this._timeline.splice(e + 1, 0, t); + } + if (this.length > this.memory) { + const t = this.length - this.memory; + this._timeline.splice(0, t); + } + return this; + } + remove(t) { + const e = this._timeline.indexOf(t); + return (-1 !== e && this._timeline.splice(e, 1), this); + } + get(t, e = "time") { + const s = this._search(t, e); + return -1 !== s ? this._timeline[s] : null; + } + peek() { + return this._timeline[0]; + } + shift() { + return this._timeline.shift(); + } + getAfter(t, e = "time") { + const s = this._search(t, e); + return s + 1 < this._timeline.length ? this._timeline[s + 1] : null; + } + getBefore(t) { + const e = this._timeline.length; + if (e > 0 && this._timeline[e - 1].time < t) + return this._timeline[e - 1]; + const s = this._search(t); + return s - 1 >= 0 ? this._timeline[s - 1] : null; + } + cancel(t) { + if (this._timeline.length > 1) { + let e = this._search(t); + if (e >= 0) + if (yi(this._timeline[e].time, t)) { + for (let s = e; s >= 0 && yi(this._timeline[s].time, t); s--) + e = s; + this._timeline = this._timeline.slice(0, e); + } else this._timeline = this._timeline.slice(0, e + 1); + else this._timeline = []; + } else + 1 === this._timeline.length && + gi(this._timeline[0].time, t) && + (this._timeline = []); + return this; + } + cancelBefore(t) { + const e = this._search(t); + return ( + e >= 0 && (this._timeline = this._timeline.slice(e + 1)), + this + ); + } + previousEvent(t) { + const e = this._timeline.indexOf(t); + return e > 0 ? this._timeline[e - 1] : null; + } + _search(t, e = "time") { + if (0 === this._timeline.length) return -1; + let s = 0; + const n = this._timeline.length; + let i = n; + if (n > 0 && this._timeline[n - 1][e] <= t) return n - 1; + for (; s < i; ) { + let n = Math.floor(s + (i - s) / 2); + const o = this._timeline[n], + r = this._timeline[n + 1]; + if (yi(o[e], t)) { + for ( + let s = n; + s < this._timeline.length && yi(this._timeline[s][e], t); + s++ + ) + n = s; + return n; + } + if (vi(o[e], t) && mi(r[e], t)) return n; + mi(o[e], t) ? (i = n) : (s = n + 1); + } + return -1; + } + _iterate(t, e = 0, s = this._timeline.length - 1) { + this._timeline.slice(e, s + 1).forEach(t); + } + forEach(t) { + return (this._iterate(t), this); + } + forEachBefore(t, e) { + const s = this._search(t); + return (-1 !== s && this._iterate(e, 0, s), this); + } + forEachAfter(t, e) { + const s = this._search(t); + return (this._iterate(e, s + 1), this); + } + forEachBetween(t, e, s) { + let n = this._search(t), + i = this._search(e); + return ( + -1 !== n && -1 !== i + ? (this._timeline[n].time !== t && (n += 1), + this._timeline[i].time === e && (i -= 1), + this._iterate(s, n, i)) + : -1 === n && this._iterate(s, 0, i), + this + ); + } + forEachFrom(t, e) { + let s = this._search(t); + for (; s >= 0 && this._timeline[s].time >= t; ) s--; + return (this._iterate(e, s + 1), this); + } + forEachAtTime(t, e) { + const s = this._search(t); + if (-1 !== s && yi(this._timeline[s].time, t)) { + let n = s; + for (let e = s; e >= 0 && yi(this._timeline[e].time, t); e--) + n = e; + this._iterate( + (t) => { + e(t); + }, + n, + s, + ); + } + return this; + } + dispose() { + return (super.dispose(), (this._timeline = []), this); + } + } + const bi = []; + + function Ti(t) { + bi.push(t); + } + const Si = []; + + function ki(t) { + Si.push(t); + } + class Ai extends fi { + constructor() { + (super(...arguments), (this.name = "Emitter")); + } + on(t, e) { + return ( + t.split(/\W+/).forEach((t) => { + (In(this._events) && (this._events = {}), + this._events.hasOwnProperty(t) || (this._events[t] = []), + this._events[t].push(e)); + }), + this + ); + } + once(t, e) { + const s = (...n) => { + (e(...n), this.off(t, s)); + }; + return (this.on(t, s), this); + } + off(t, e) { + return ( + t.split(/\W+/).forEach((t) => { + if ( + (In(this._events) && (this._events = {}), + this._events.hasOwnProperty(t)) + ) + if (In(e)) this._events[t] = []; + else { + const s = this._events[t]; + for (let t = s.length - 1; t >= 0; t--) + s[t] === e && s.splice(t, 1); + } + }), + this + ); + } + emit(t, ...e) { + if (this._events && this._events.hasOwnProperty(t)) { + const s = this._events[t].slice(0); + for (let t = 0, n = s.length; t < n; t++) s[t].apply(this, e); + } + return this; + } + static mixin(t) { + ["on", "once", "off", "emit"].forEach((e) => { + const s = Object.getOwnPropertyDescriptor(Ai.prototype, e); + Object.defineProperty(t.prototype, e, s); + }); + } + dispose() { + return (super.dispose(), (this._events = void 0), this); + } + } + class Ci extends Ai { + constructor() { + (super(...arguments), (this.isOffline = !1)); + } + toJSON() { + return {}; + } + } + class Oi extends Ci { + constructor() { + var t, e; + (super(), + (this.name = "Context"), + (this._constants = new Map()), + (this._timeouts = new wi()), + (this._timeoutIds = 0), + (this._initialized = !1), + (this._closeStarted = !1), + (this.isOffline = !1), + (this._workletPromise = null)); + const s = ui(Oi.getDefaults(), arguments, ["context"]); + (s.context + ? ((this._context = s.context), + (this._latencyHint = + (null === (t = arguments[0]) || void 0 === t + ? void 0 + : t.latencyHint) || "")) + : ((this._context = (function (t) { + return new pn(t); + })({ + latencyHint: s.latencyHint, + })), + (this._latencyHint = s.latencyHint)), + (this._ticker = new ii( + this.emit.bind(this, "tick"), + s.clockSource, + s.updateInterval, + this._context.sampleRate, + )), + this.on("tick", this._timeoutLoop.bind(this)), + (this._context.onstatechange = () => { + this.emit("statechange", this.state); + }), + (this[ + ( + null === (e = arguments[0]) || void 0 === e + ? void 0 + : e.hasOwnProperty("updateInterval") + ) + ? "_lookAhead" + : "lookAhead" + ] = s.lookAhead)); + } + static getDefaults() { + return { + clockSource: "worker", + latencyHint: "interactive", + lookAhead: 0.1, + updateInterval: 0.05, + }; + } + initialize() { + var t; + return ( + this._initialized || + ((t = this), bi.forEach((e) => e(t)), (this._initialized = !0)), + this + ); + } + createAnalyser() { + return this._context.createAnalyser(); + } + createOscillator() { + return this._context.createOscillator(); + } + createBufferSource() { + return this._context.createBufferSource(); + } + createBiquadFilter() { + return this._context.createBiquadFilter(); + } + createBuffer(t, e, s) { + return this._context.createBuffer(t, e, s); + } + createChannelMerger(t) { + return this._context.createChannelMerger(t); + } + createChannelSplitter(t) { + return this._context.createChannelSplitter(t); + } + createConstantSource() { + return this._context.createConstantSource(); + } + createConvolver() { + return this._context.createConvolver(); + } + createDelay(t) { + return this._context.createDelay(t); + } + createDynamicsCompressor() { + return this._context.createDynamicsCompressor(); + } + createGain() { + return this._context.createGain(); + } + createIIRFilter(t, e) { + return this._context.createIIRFilter(t, e); + } + createPanner() { + return this._context.createPanner(); + } + createPeriodicWave(t, e, s) { + return this._context.createPeriodicWave(t, e, s); + } + createStereoPanner() { + return this._context.createStereoPanner(); + } + createWaveShaper() { + return this._context.createWaveShaper(); + } + createMediaStreamSource(t) { + return ( + Bn(ci(this._context), "Not available if OfflineAudioContext"), + this._context.createMediaStreamSource(t) + ); + } + createMediaElementSource(t) { + return ( + Bn(ci(this._context), "Not available if OfflineAudioContext"), + this._context.createMediaElementSource(t) + ); + } + createMediaStreamDestination() { + return ( + Bn(ci(this._context), "Not available if OfflineAudioContext"), + this._context.createMediaStreamDestination() + ); + } + decodeAudioData(t) { + return this._context.decodeAudioData(t); + } + get currentTime() { + return this._context.currentTime; + } + get state() { + return this._context.state; + } + get sampleRate() { + return this._context.sampleRate; + } + get listener() { + return (this.initialize(), this._listener); + } + set listener(t) { + (Bn( + !this._initialized, + "The listener cannot be set after initialization.", + ), + (this._listener = t)); + } + get transport() { + return (this.initialize(), this._transport); + } + set transport(t) { + (Bn( + !this._initialized, + "The transport cannot be set after initialization.", + ), + (this._transport = t)); + } + get draw() { + return (this.initialize(), this._draw); + } + set draw(t) { + (Bn(!this._initialized, "Draw cannot be set after initialization."), + (this._draw = t)); + } + get destination() { + return (this.initialize(), this._destination); + } + set destination(t) { + (Bn( + !this._initialized, + "The destination cannot be set after initialization.", + ), + (this._destination = t)); + } + createAudioWorkletNode(t, e) { + return (function (t, e, s) { + return ( + Bn( + Fn(kn), + "AudioWorkletNode only works in a secure context (https or localhost)", + ), + new (t instanceof (null == ti ? void 0 : ti.BaseAudioContext) + ? null == ti + ? void 0 + : ti.AudioWorkletNode + : kn)(t, e, s) + ); + })(this.rawContext, t, e); + } + addAudioWorkletModule(t) { + return ni(this, void 0, void 0, function* () { + (Bn( + Fn(this.rawContext.audioWorklet), + "AudioWorkletNode is only available in a secure context (https or localhost)", + ), + this._workletPromise || + (this._workletPromise = + this.rawContext.audioWorklet.addModule(t)), + yield this._workletPromise); + }); + } + workletsAreReady() { + return ni(this, void 0, void 0, function* () { + (yield this._workletPromise) + ? this._workletPromise + : Promise.resolve(); + }); + } + get updateInterval() { + return this._ticker.updateInterval; + } + set updateInterval(t) { + this._ticker.updateInterval = t; + } + get clockSource() { + return this._ticker.type; + } + set clockSource(t) { + this._ticker.type = t; + } + get lookAhead() { + return this._lookAhead; + } + set lookAhead(t) { + ((this._lookAhead = t), (this.updateInterval = t ? t / 2 : 0.01)); + } + get latencyHint() { + return this._latencyHint; + } + get rawContext() { + return this._context; + } + now() { + return this._context.currentTime + this._lookAhead; + } + immediate() { + return this._context.currentTime; + } + resume() { + return ci(this._context) + ? this._context.resume() + : Promise.resolve(); + } + close() { + return ni(this, void 0, void 0, function* () { + var t; + (ci(this._context) && + "closed" !== this.state && + !this._closeStarted && + ((this._closeStarted = !0), yield this._context.close()), + this._initialized && ((t = this), Si.forEach((e) => e(t)))); + }); + } + getConstant(t) { + if (this._constants.has(t)) return this._constants.get(t); + { + const e = this._context.createBuffer( + 1, + 128, + this._context.sampleRate, + ), + s = e.getChannelData(0); + for (let e = 0; e < s.length; e++) s[e] = t; + const n = this._context.createBufferSource(); + return ( + (n.channelCount = 1), + (n.channelCountMode = "explicit"), + (n.buffer = e), + (n.loop = !0), + n.start(0), + this._constants.set(t, n), + n + ); + } + } + dispose() { + return ( + super.dispose(), + this._ticker.dispose(), + this._timeouts.dispose(), + Object.keys(this._constants).map((t) => + this._constants[t].disconnect(), + ), + this.close(), + this + ); + } + _timeoutLoop() { + const t = this.now(); + this._timeouts.forEachBefore(t, (t) => { + (t.callback(), this._timeouts.remove(t)); + }); + } + setTimeout(t, e) { + this._timeoutIds++; + const s = this.now(); + return ( + this._timeouts.add({ + callback: t, + id: this._timeoutIds, + time: s + e, + }), + this._timeoutIds + ); + } + clearTimeout(t) { + return ( + this._timeouts.forEach((e) => { + e.id === t && this._timeouts.remove(e); + }), + this + ); + } + clearInterval(t) { + return this.clearTimeout(t); + } + setInterval(t, e) { + const s = ++this._timeoutIds, + n = () => { + const i = this.now(); + this._timeouts.add({ + callback: () => { + (t(), n()); + }, + id: s, + time: i + e, + }); + }; + return (n(), s); + } + } + + function Di(t, e) { + Ln(e) + ? e.forEach((e) => Di(t, e)) + : Object.defineProperty(t, e, { + enumerable: !0, + writable: !1, + }); + } + + function Mi(t, e) { + Ln(e) + ? e.forEach((e) => Mi(t, e)) + : Object.defineProperty(t, e, { + writable: !0, + }); + } + const Ei = () => {}; + class Ri extends fi { + constructor() { + (super(), (this.name = "ToneAudioBuffer"), (this.onload = Ei)); + const t = ui(Ri.getDefaults(), arguments, [ + "url", + "onload", + "onerror", + ]); + ((this.reverse = t.reverse), + (this.onload = t.onload), + zn(t.url) + ? this.load(t.url).catch(t.onerror) + : t.url && this.set(t.url)); + } + static getDefaults() { + return { + onerror: Ei, + onload: Ei, + reverse: !1, + }; + } + get sampleRate() { + return this._buffer ? this._buffer.sampleRate : Vi().sampleRate; + } + set(t) { + return ( + t instanceof Ri + ? t.loaded + ? (this._buffer = t.get()) + : (t.onload = () => { + (this.set(t), this.onload(this)); + }) + : (this._buffer = t), + this._reversed && this._reverse(), + this + ); + } + get() { + return this._buffer; + } + load(t) { + return ni(this, void 0, void 0, function* () { + const e = Ri.load(t).then((t) => { + (this.set(t), this.onload(this)); + }); + Ri.downloads.push(e); + try { + yield e; + } finally { + const t = Ri.downloads.indexOf(e); + Ri.downloads.splice(t, 1); + } + return this; + }); + } + dispose() { + return (super.dispose(), (this._buffer = void 0), this); + } + fromArray(t) { + const e = Ln(t) && t[0].length > 0, + s = e ? t.length : 1, + n = e ? t[0].length : t.length, + i = Vi(), + o = i.createBuffer(s, n, i.sampleRate), + r = e || 1 !== s ? t : [t]; + for (let t = 0; t < s; t++) o.copyToChannel(r[t], t); + return ((this._buffer = o), this); + } + toMono(t) { + if (Nn(t)) this.fromArray(this.toArray(t)); + else { + let t = new Float32Array(this.length); + const e = this.numberOfChannels; + for (let s = 0; s < e; s++) { + const e = this.toArray(s); + for (let s = 0; s < e.length; s++) t[s] += e[s]; + } + ((t = t.map((t) => t / e)), this.fromArray(t)); + } + return this; + } + toArray(t) { + if (Nn(t)) return this.getChannelData(t); + if (1 === this.numberOfChannels) return this.toArray(0); + { + const t = []; + for (let e = 0; e < this.numberOfChannels; e++) + t[e] = this.getChannelData(e); + return t; + } + } + getChannelData(t) { + return this._buffer + ? this._buffer.getChannelData(t) + : new Float32Array(0); + } + slice(t, e = this.duration) { + Bn(this.loaded, "Buffer is not loaded"); + const s = Math.floor(t * this.sampleRate), + n = Math.floor(e * this.sampleRate); + Bn(s < n, "The start time must be less than the end time"); + const i = n - s, + o = Vi().createBuffer(this.numberOfChannels, i, this.sampleRate); + for (let t = 0; t < this.numberOfChannels; t++) + o.copyToChannel(this.getChannelData(t).subarray(s, n), t); + return new Ri(o); + } + _reverse() { + if (this.loaded) + for (let t = 0; t < this.numberOfChannels; t++) + this.getChannelData(t).reverse(); + return this; + } + get loaded() { + return this.length > 0; + } + get duration() { + return this._buffer ? this._buffer.duration : 0; + } + get length() { + return this._buffer ? this._buffer.length : 0; + } + get numberOfChannels() { + return this._buffer ? this._buffer.numberOfChannels : 0; + } + get reverse() { + return this._reversed; + } + set reverse(t) { + this._reversed !== t && ((this._reversed = t), this._reverse()); + } + static fromArray(t) { + return new Ri().fromArray(t); + } + static fromUrl(t) { + return ni(this, void 0, void 0, function* () { + const e = new Ri(); + return yield e.load(t); + }); + } + static load(t) { + return ni(this, void 0, void 0, function* () { + const e = + "" === Ri.baseUrl || Ri.baseUrl.endsWith("/") + ? Ri.baseUrl + : Ri.baseUrl + "/", + s = yield fetch(e + t); + if (!s.ok) throw new Error(`could not load url: ${t}`); + const n = yield s.arrayBuffer(); + return yield Vi().decodeAudioData(n); + }); + } + static supportsType(t) { + const e = t.split("."), + s = e[e.length - 1]; + return ( + "" !== document.createElement("audio").canPlayType("audio/" + s) + ); + } + static loaded() { + return ni(this, void 0, void 0, function* () { + for (yield Promise.resolve(); Ri.downloads.length; ) + yield Ri.downloads[0]; + }); + } + } + ((Ri.baseUrl = ""), (Ri.downloads = [])); + class qi extends Oi { + constructor() { + var t, e, s; + (super({ + clockSource: "offline", + context: ai(arguments[0]) + ? arguments[0] + : ((t = arguments[0]), + (e = arguments[1] * arguments[2]), + (s = arguments[2]), + new On(t, e, s)), + lookAhead: 0, + updateInterval: ai(arguments[0]) + ? 128 / arguments[0].sampleRate + : 128 / arguments[2], + }), + (this.name = "OfflineContext"), + (this._currentTime = 0), + (this.isOffline = !0), + (this._duration = ai(arguments[0]) + ? arguments[0].length / arguments[0].sampleRate + : arguments[1])); + } + now() { + return this._currentTime; + } + get currentTime() { + return this._currentTime; + } + _renderClock(t) { + return ni(this, void 0, void 0, function* () { + let e = 0; + for (; this._duration - this._currentTime >= 0; ) { + (this.emit("tick"), + (this._currentTime += 128 / this.sampleRate), + e++); + const s = Math.floor(this.sampleRate / 128); + t && e % s == 0 && (yield new Promise((t) => setTimeout(t, 1))); + } + }); + } + render() { + return ni(this, arguments, void 0, function* (t = !0) { + (yield this.workletsAreReady(), yield this._renderClock(t)); + const e = yield this._context.startRendering(); + return new Ri(e); + }); + } + close() { + return Promise.resolve(); + } + } + const Ii = new (class extends Ci { + constructor() { + (super(...arguments), + (this.lookAhead = 0), + (this.latencyHint = 0), + (this.isOffline = !1)); + } + createAnalyser() { + return {}; + } + createOscillator() { + return {}; + } + createBufferSource() { + return {}; + } + createBiquadFilter() { + return {}; + } + createBuffer(t, e, s) { + return {}; + } + createChannelMerger(t) { + return {}; + } + createChannelSplitter(t) { + return {}; + } + createConstantSource() { + return {}; + } + createConvolver() { + return {}; + } + createDelay(t) { + return {}; + } + createDynamicsCompressor() { + return {}; + } + createGain() { + return {}; + } + createIIRFilter(t, e) { + return {}; + } + createPanner() { + return {}; + } + createPeriodicWave(t, e, s) { + return {}; + } + createStereoPanner() { + return {}; + } + createWaveShaper() { + return {}; + } + createMediaStreamSource(t) { + return {}; + } + createMediaElementSource(t) { + return {}; + } + createMediaStreamDestination() { + return {}; + } + decodeAudioData(t) { + return Promise.resolve({}); + } + createAudioWorkletNode(t, e) { + return {}; + } + get rawContext() { + return {}; + } + addAudioWorkletModule(t) { + return ni(this, void 0, void 0, function* () { + return Promise.resolve(); + }); + } + resume() { + return Promise.resolve(); + } + setTimeout(t, e) { + return 0; + } + clearTimeout(t) { + return this; + } + setInterval(t, e) { + return 0; + } + clearInterval(t) { + return this; + } + getConstant(t) { + return {}; + } + get currentTime() { + return 0; + } + get state() { + return {}; + } + get sampleRate() { + return 0; + } + get listener() { + return {}; + } + get transport() { + return {}; + } + get draw() { + return {}; + } + set draw(t) {} + get destination() { + return {}; + } + set destination(t) {} + now() { + return 0; + } + immediate() { + return 0; + } + })(); + let Fi = Ii; + + function Vi() { + return (Fi === Ii && ei && Ni(new Oi()), Fi); + } + + function Ni(t, e = !1) { + (e && Fi.dispose(), (Fi = ci(t) ? new Oi(t) : ai(t) ? new qi(t) : t)); + } + + function Pi() { + return Fi.resume(); + } + if (ti && !ti.TONE_SILENCE_LOGGING) { + let t = "v"; + "dev" === i && (t = ""); + const e = ` * Tone.js ${t}${i} * `; + console.log(`%c${e}`, "background: #000; color: #fff"); + } + + function ji(t) { + return Math.pow(10, t / 20); + } + + function Li(t) { + return (Math.log(t) / Math.LN10) * 20; + } + + function zi(t) { + return Math.pow(2, t / 12); + } + let Wi = 440; + + function Bi(t) { + return Math.round(Ui(t)); + } + + function Ui(t) { + return 69 + 12 * Math.log2(t / Wi); + } + + function Gi(t) { + return Wi * Math.pow(2, (t - 69) / 12); + } + class Qi extends fi { + constructor(t, e, s) { + (super(), + (this.defaultUnits = "s"), + (this._val = e), + (this._units = s), + (this.context = t), + (this._expressions = this._getExpressions())); + } + _getExpressions() { + return { + hz: { + method: (t) => this._frequencyToUnits(parseFloat(t)), + regexp: /^(\d+(?:\.\d+)?)hz$/i, + }, + i: { + method: (t) => this._ticksToUnits(parseInt(t, 10)), + regexp: /^(\d+)i$/i, + }, + m: { + method: (t) => + this._beatsToUnits( + parseInt(t, 10) * this._getTimeSignature(), + ), + regexp: /^(\d+)m$/i, + }, + n: { + method: (t, e) => { + const s = parseInt(t, 10), + n = "." === e ? 1.5 : 1; + return 1 === s + ? this._beatsToUnits(this._getTimeSignature()) * n + : this._beatsToUnits(4 / s) * n; + }, + regexp: /^(\d+)n(\.?)$/i, + }, + number: { + method: (t) => + this._expressions[this.defaultUnits].method.call(this, t), + regexp: /^(\d+(?:\.\d+)?)$/, + }, + s: { + method: (t) => this._secondsToUnits(parseFloat(t)), + regexp: /^(\d+(?:\.\d+)?)s$/, + }, + samples: { + method: (t) => parseInt(t, 10) / this.context.sampleRate, + regexp: /^(\d+)samples$/, + }, + t: { + method: (t) => { + const e = parseInt(t, 10); + return this._beatsToUnits(8 / (3 * Math.floor(e))); + }, + regexp: /^(\d+)t$/i, + }, + tr: { + method: (t, e, s) => { + let n = 0; + return ( + t && + "0" !== t && + (n += this._beatsToUnits( + this._getTimeSignature() * parseFloat(t), + )), + e && "0" !== e && (n += this._beatsToUnits(parseFloat(e))), + s && + "0" !== s && + (n += this._beatsToUnits(parseFloat(s) / 4)), + n + ); + }, + regexp: /^(\d+(?:\.\d+)?):(\d+(?:\.\d+)?):?(\d+(?:\.\d+)?)?$/, + }, + }; + } + valueOf() { + if ( + (this._val instanceof Qi && this.fromType(this._val), + In(this._val)) + ) + return this._noArg(); + if (zn(this._val) && In(this._units)) { + for (const t in this._expressions) + if (this._expressions[t].regexp.test(this._val.trim())) { + this._units = t; + break; + } + } else if (Pn(this._val)) { + let t = 0; + for (const e in this._val) + if (Fn(this._val[e])) { + const s = this._val[e]; + t += new this.constructor(this.context, e).valueOf() * s; + } + return t; + } + if (Fn(this._units)) { + const t = this._expressions[this._units], + e = this._val.toString().trim().match(t.regexp); + return e + ? t.method.apply(this, e.slice(1)) + : t.method.call(this, this._val); + } + return zn(this._val) ? parseFloat(this._val) : this._val; + } + _frequencyToUnits(t) { + return 1 / t; + } + _beatsToUnits(t) { + return (60 / this._getBpm()) * t; + } + _secondsToUnits(t) { + return t; + } + _ticksToUnits(t) { + return (t * this._beatsToUnits(1)) / this._getPPQ(); + } + _noArg() { + return this._now(); + } + _getBpm() { + return this.context.transport.bpm.value; + } + _getTimeSignature() { + return this.context.transport.timeSignature; + } + _getPPQ() { + return this.context.transport.PPQ; + } + fromType(t) { + switch (((this._units = void 0), this.defaultUnits)) { + case "s": + this._val = t.toSeconds(); + break; + case "i": + this._val = t.toTicks(); + break; + case "hz": + this._val = t.toFrequency(); + break; + case "midi": + this._val = t.toMidi(); + } + return this; + } + toFrequency() { + return 1 / this.toSeconds(); + } + toSamples() { + return this.toSeconds() * this.context.sampleRate; + } + toMilliseconds() { + return 1e3 * this.toSeconds(); + } + } + class Zi extends Qi { + constructor() { + (super(...arguments), (this.name = "TimeClass")); + } + _getExpressions() { + return Object.assign(super._getExpressions(), { + now: { + method: (t) => + this._now() + new this.constructor(this.context, t).valueOf(), + regexp: /^\+(.+)/, + }, + quantize: { + method: (t) => { + const e = new Zi(this.context, t).valueOf(); + return this._secondsToUnits( + this.context.transport.nextSubdivision(e), + ); + }, + regexp: /^@(.+)/, + }, + }); + } + quantize(t, e = 1) { + const s = new this.constructor(this.context, t).valueOf(), + n = this.valueOf(); + return n + (Math.round(n / s) * s - n) * e; + } + toNotation() { + const t = this.toSeconds(), + e = ["1m"]; + for (let t = 1; t < 9; t++) { + const s = Math.pow(2, t); + (e.push(s + "n."), e.push(s + "n"), e.push(s + "t")); + } + e.push("0"); + let s = e[0], + n = new Zi(this.context, e[0]).toSeconds(); + return ( + e.forEach((e) => { + const i = new Zi(this.context, e).toSeconds(); + Math.abs(i - t) < Math.abs(n - t) && ((s = e), (n = i)); + }), + s + ); + } + toBarsBeatsSixteenths() { + const t = this._beatsToUnits(1); + let e = this.valueOf() / t; + e = parseFloat(e.toFixed(4)); + const s = Math.floor(e / this._getTimeSignature()); + let n = (e % 1) * 4; + e = Math.floor(e) % this._getTimeSignature(); + const i = n.toString(); + return ( + i.length > 3 && (n = parseFloat(parseFloat(i).toFixed(3))), + [s, e, n].join(":") + ); + } + toTicks() { + const t = this._beatsToUnits(1); + return (this.valueOf() / t) * this._getPPQ(); + } + toSeconds() { + return this.valueOf(); + } + toMidi() { + return Bi(this.toFrequency()); + } + _now() { + return this.context.now(); + } + } + + function Xi(t, e) { + return new Zi(Vi(), t, e); + } + class Yi extends Zi { + constructor() { + (super(...arguments), + (this.name = "Frequency"), + (this.defaultUnits = "hz")); + } + static get A4() { + return Wi; + } + static set A4(t) { + !(function (t) { + Wi = t; + })(t); + } + _getExpressions() { + return Object.assign({}, super._getExpressions(), { + midi: { + regexp: /^(\d+(?:\.\d+)?midi)/, + method(t) { + return "midi" === this.defaultUnits ? t : Yi.mtof(t); + }, + }, + note: { + regexp: /^([a-g]{1}(?:b|#|##|x|bb|###|#x|x#|bbb)?)(-?[0-9]+)/i, + method(t, e) { + const s = $i[t.toLowerCase()] + 12 * (parseInt(e, 10) + 1); + return "midi" === this.defaultUnits ? s : Yi.mtof(s); + }, + }, + tr: { + regexp: /^(\d+(?:\.\d+)?):(\d+(?:\.\d+)?):?(\d+(?:\.\d+)?)?/, + method(t, e, s) { + let n = 1; + return ( + t && + "0" !== t && + (n *= this._beatsToUnits( + this._getTimeSignature() * parseFloat(t), + )), + e && "0" !== e && (n *= this._beatsToUnits(parseFloat(e))), + s && + "0" !== s && + (n *= this._beatsToUnits(parseFloat(s) / 4)), + n + ); + }, + }, + }); + } + transpose(t) { + return new Yi(this.context, this.valueOf() * zi(t)); + } + harmonize(t) { + return t.map((t) => this.transpose(t)); + } + toMidi() { + return Bi(this.valueOf()); + } + toNote() { + const t = this.toFrequency(), + e = Math.log2(t / Yi.A4); + let s = Math.round(12 * e) + 57; + const n = Math.floor(s / 12); + return (n < 0 && (s += -12 * n), Hi[s % 12] + n.toString()); + } + toSeconds() { + return 1 / super.toSeconds(); + } + toTicks() { + const t = this._beatsToUnits(1), + e = this.valueOf() / t; + return Math.floor(e * this._getPPQ()); + } + _noArg() { + return 0; + } + _frequencyToUnits(t) { + return t; + } + _ticksToUnits(t) { + return 1 / ((60 * t) / (this._getBpm() * this._getPPQ())); + } + _beatsToUnits(t) { + return 1 / super._beatsToUnits(t); + } + _secondsToUnits(t) { + return 1 / t; + } + static mtof(t) { + return Gi(t); + } + static ftom(t) { + return Bi(t); + } + } + const $i = { + cbbb: -3, + cbb: -2, + cb: -1, + c: 0, + "c#": 1, + cx: 2, + "c##": 2, + "c###": 3, + "cx#": 3, + "c#x": 3, + dbbb: -1, + dbb: 0, + db: 1, + d: 2, + "d#": 3, + dx: 4, + "d##": 4, + "d###": 5, + "dx#": 5, + "d#x": 5, + ebbb: 1, + ebb: 2, + eb: 3, + e: 4, + "e#": 5, + ex: 6, + "e##": 6, + "e###": 7, + "ex#": 7, + "e#x": 7, + fbbb: 2, + fbb: 3, + fb: 4, + f: 5, + "f#": 6, + fx: 7, + "f##": 7, + "f###": 8, + "fx#": 8, + "f#x": 8, + gbbb: 4, + gbb: 5, + gb: 6, + g: 7, + "g#": 8, + gx: 9, + "g##": 9, + "g###": 10, + "gx#": 10, + "g#x": 10, + abbb: 6, + abb: 7, + ab: 8, + a: 9, + "a#": 10, + ax: 11, + "a##": 11, + "a###": 12, + "ax#": 12, + "a#x": 12, + bbbb: 8, + bbb: 9, + bb: 10, + b: 11, + "b#": 12, + bx: 13, + "b##": 13, + "b###": 14, + "bx#": 14, + "b#x": 14, + }, + Hi = [ + "C", + "C#", + "D", + "D#", + "E", + "F", + "F#", + "G", + "G#", + "A", + "A#", + "B", + ]; + + function Ji(t, e) { + return new Yi(Vi(), t, e); + } + class Ki extends Zi { + constructor() { + (super(...arguments), (this.name = "TransportTime")); + } + _now() { + return this.context.transport.seconds; + } + } + + function to(t, e) { + return new Ki(Vi(), t, e); + } + class eo extends fi { + constructor() { + super(); + const t = ui(eo.getDefaults(), arguments, ["context"]); + this.defaultContext + ? (this.context = this.defaultContext) + : (this.context = t.context); + } + static getDefaults() { + return { + context: Vi(), + }; + } + now() { + return this.context.currentTime + this.context.lookAhead; + } + immediate() { + return this.context.currentTime; + } + get sampleTime() { + return 1 / this.context.sampleRate; + } + get blockTime() { + return 128 / this.context.sampleRate; + } + toSeconds(t) { + return (Yn(t), new Zi(this.context, t).toSeconds()); + } + toFrequency(t) { + return new Yi(this.context, t).toFrequency(); + } + toTicks(t) { + return new Ki(this.context, t).toTicks(); + } + _getPartialProperties(t) { + const e = this.get(); + return ( + Object.keys(e).forEach((s) => { + In(t[s]) && delete e[s]; + }), + e + ); + } + get() { + const t = this.constructor.getDefaults(); + return ( + Object.keys(t).forEach((e) => { + if (Reflect.has(this, e)) { + const s = this[e]; + Fn(s) && Fn(s.value) && Fn(s.setValueAtTime) + ? (t[e] = s.value) + : s instanceof eo + ? (t[e] = s._getPartialProperties(t[e])) + : Ln(s) || Nn(s) || zn(s) || jn(s) + ? (t[e] = s) + : delete t[e]; + } + }), + t + ); + } + set(t) { + return ( + Object.keys(t).forEach((e) => { + Reflect.has(this, e) && + Fn(this[e]) && + (this[e] && Fn(this[e].value) && Fn(this[e].setValueAtTime) + ? this[e].value !== t[e] && (this[e].value = t[e]) + : this[e] instanceof eo + ? this[e].set(t[e]) + : (this[e] = t[e])); + }), + this + ); + } + } + class so extends wi { + constructor(t = "stopped") { + (super(), + (this.name = "StateTimeline"), + (this._initial = t), + this.setStateAtTime(this._initial, 0)); + } + getValueAtTime(t) { + const e = this.get(t); + return null !== e ? e.state : this._initial; + } + setStateAtTime(t, e, s) { + return ( + Un(e, 0), + this.add( + Object.assign({}, s, { + state: t, + time: e, + }), + ), + this + ); + } + getLastState(t, e) { + for (let s = this._search(e); s >= 0; s--) { + const e = this._timeline[s]; + if (e.state === t) return e; + } + } + getNextState(t, e) { + const s = this._search(e); + if (-1 !== s) + for (let e = s; e < this._timeline.length; e++) { + const s = this._timeline[e]; + if (s.state === t) return s; + } + } + } + class no extends eo { + constructor() { + const t = ui(no.getDefaults(), arguments, [ + "param", + "units", + "convert", + ]); + for ( + super(t), + this.name = "Param", + this.overridden = !1, + this._minOutput = 1e-7, + Bn( + Fn(t.param) && (oi(t.param) || t.param instanceof no), + "param must be an AudioParam", + ); + !oi(t.param); + + ) + t.param = t.param._param; + ((this._swappable = !!Fn(t.swappable) && t.swappable), + this._swappable + ? ((this.input = this.context.createGain()), + (this._param = t.param), + this.input.connect(this._param)) + : (this._param = this.input = t.param), + (this._events = new wi(1e3)), + (this._initialValue = this._param.defaultValue), + (this.units = t.units), + (this.convert = t.convert), + (this._minValue = t.minValue), + (this._maxValue = t.maxValue), + Fn(t.value) && + t.value !== this._toType(this._initialValue) && + this.setValueAtTime(t.value, 0)); + } + static getDefaults() { + return Object.assign(eo.getDefaults(), { + convert: !0, + units: "number", + }); + } + get value() { + const t = this.now(); + return this.getValueAtTime(t); + } + set value(t) { + (this.cancelScheduledValues(this.now()), + this.setValueAtTime(t, this.now())); + } + get minValue() { + return Fn(this._minValue) + ? this._minValue + : "time" === this.units || + "frequency" === this.units || + "normalRange" === this.units || + "positive" === this.units || + "transportTime" === this.units || + "ticks" === this.units || + "bpm" === this.units || + "hertz" === this.units || + "samples" === this.units + ? 0 + : "audioRange" === this.units + ? -1 + : "decibels" === this.units + ? -1 / 0 + : this._param.minValue; + } + get maxValue() { + return Fn(this._maxValue) + ? this._maxValue + : "normalRange" === this.units || "audioRange" === this.units + ? 1 + : this._param.maxValue; + } + _is(t, e) { + return this.units === e; + } + _assertRange(t) { + return ( + Fn(this.maxValue) && + Fn(this.minValue) && + Un( + t, + this._fromType(this.minValue), + this._fromType(this.maxValue), + ), + t + ); + } + _fromType(t) { + return this.convert && !this.overridden + ? this._is(t, "time") + ? this.toSeconds(t) + : this._is(t, "decibels") + ? ji(t) + : this._is(t, "frequency") + ? this.toFrequency(t) + : t + : this.overridden + ? 0 + : t; + } + _toType(t) { + return this.convert && "decibels" === this.units ? Li(t) : t; + } + setValueAtTime(t, e) { + const s = this.toSeconds(e), + n = this._fromType(t); + return ( + Bn( + isFinite(n) && isFinite(s), + `Invalid argument(s) to setValueAtTime: ${JSON.stringify(t)}, ${JSON.stringify(e)}`, + ), + this._assertRange(n), + this.log(this.units, "setValueAtTime", t, s), + this._events.add({ + time: s, + type: "setValueAtTime", + value: n, + }), + this._param.setValueAtTime(n, s), + this + ); + } + getValueAtTime(t) { + const e = Math.max(this.toSeconds(t), 0), + s = this._events.getAfter(e), + n = this._events.get(e); + let i = this._initialValue; + if (null === n) i = this._initialValue; + else if ( + "setTargetAtTime" !== n.type || + (null !== s && "setValueAtTime" !== s.type) + ) + if (null === s) i = n.value; + else if ( + "linearRampToValueAtTime" === s.type || + "exponentialRampToValueAtTime" === s.type + ) { + let t = n.value; + if ("setTargetAtTime" === n.type) { + const e = this._events.getBefore(n.time); + t = null === e ? this._initialValue : e.value; + } + i = + "linearRampToValueAtTime" === s.type + ? this._linearInterpolate(n.time, t, s.time, s.value, e) + : this._exponentialInterpolate( + n.time, + t, + s.time, + s.value, + e, + ); + } else i = n.value; + else { + const t = this._events.getBefore(n.time); + let s; + ((s = null === t ? this._initialValue : t.value), + "setTargetAtTime" === n.type && + (i = this._exponentialApproach( + n.time, + s, + n.value, + n.constant, + e, + ))); + } + return this._toType(i); + } + setRampPoint(t) { + t = this.toSeconds(t); + let e = this.getValueAtTime(t); + return ( + this.cancelAndHoldAtTime(t), + 0 === this._fromType(e) && (e = this._toType(this._minOutput)), + this.setValueAtTime(e, t), + this + ); + } + linearRampToValueAtTime(t, e) { + const s = this._fromType(t), + n = this.toSeconds(e); + return ( + Bn( + isFinite(s) && isFinite(n), + `Invalid argument(s) to linearRampToValueAtTime: ${JSON.stringify(t)}, ${JSON.stringify(e)}`, + ), + this._assertRange(s), + this._events.add({ + time: n, + type: "linearRampToValueAtTime", + value: s, + }), + this.log(this.units, "linearRampToValueAtTime", t, n), + this._param.linearRampToValueAtTime(s, n), + this + ); + } + exponentialRampToValueAtTime(t, e) { + let s = this._fromType(t); + ((s = yi(s, 0) ? this._minOutput : s), this._assertRange(s)); + const n = this.toSeconds(e); + return ( + Bn( + isFinite(s) && isFinite(n), + `Invalid argument(s) to exponentialRampToValueAtTime: ${JSON.stringify(t)}, ${JSON.stringify(e)}`, + ), + this._events.add({ + time: n, + type: "exponentialRampToValueAtTime", + value: s, + }), + this.log(this.units, "exponentialRampToValueAtTime", t, n), + this._param.exponentialRampToValueAtTime(s, n), + this + ); + } + exponentialRampTo(t, e, s) { + return ( + (s = this.toSeconds(s)), + this.setRampPoint(s), + this.exponentialRampToValueAtTime(t, s + this.toSeconds(e)), + this + ); + } + linearRampTo(t, e, s) { + return ( + (s = this.toSeconds(s)), + this.setRampPoint(s), + this.linearRampToValueAtTime(t, s + this.toSeconds(e)), + this + ); + } + targetRampTo(t, e, s) { + return ( + (s = this.toSeconds(s)), + this.setRampPoint(s), + this.exponentialApproachValueAtTime(t, s, e), + this + ); + } + exponentialApproachValueAtTime(t, e, s) { + ((e = this.toSeconds(e)), (s = this.toSeconds(s))); + const n = Math.log(s + 1) / Math.log(200); + return ( + this.setTargetAtTime(t, e, n), + this.cancelAndHoldAtTime(e + 0.9 * s), + this.linearRampToValueAtTime(t, e + s), + this + ); + } + setTargetAtTime(t, e, s) { + const n = this._fromType(t); + Bn( + isFinite(s) && s > 0, + "timeConstant must be a number greater than 0", + ); + const i = this.toSeconds(e); + return ( + this._assertRange(n), + Bn( + isFinite(n) && isFinite(i), + `Invalid argument(s) to setTargetAtTime: ${JSON.stringify(t)}, ${JSON.stringify(e)}`, + ), + this._events.add({ + constant: s, + time: i, + type: "setTargetAtTime", + value: n, + }), + this.log(this.units, "setTargetAtTime", t, i, s), + this._param.setTargetAtTime(n, i, s), + this + ); + } + setValueCurveAtTime(t, e, s, n = 1) { + ((s = this.toSeconds(s)), (e = this.toSeconds(e))); + const i = this._fromType(t[0]) * n; + this.setValueAtTime(this._toType(i), e); + const o = s / (t.length - 1); + for (let s = 1; s < t.length; s++) { + const i = this._fromType(t[s]) * n; + this.linearRampToValueAtTime(this._toType(i), e + s * o); + } + return this; + } + cancelScheduledValues(t) { + const e = this.toSeconds(t); + return ( + Bn( + isFinite(e), + `Invalid argument to cancelScheduledValues: ${JSON.stringify(t)}`, + ), + this._events.cancel(e), + this._param.cancelScheduledValues(e), + this.log(this.units, "cancelScheduledValues", e), + this + ); + } + cancelAndHoldAtTime(t) { + const e = this.toSeconds(t), + s = this._fromType(this.getValueAtTime(e)); + (Bn( + isFinite(e), + `Invalid argument to cancelAndHoldAtTime: ${JSON.stringify(t)}`, + ), + this.log(this.units, "cancelAndHoldAtTime", e, "value=" + s)); + const n = this._events.get(e), + i = this._events.getAfter(e); + return ( + n && yi(n.time, e) + ? i + ? (this._param.cancelScheduledValues(i.time), + this._events.cancel(i.time)) + : (this._param.cancelAndHoldAtTime(e), + this._events.cancel(e + this.sampleTime)) + : i && + (this._param.cancelScheduledValues(i.time), + this._events.cancel(i.time), + "linearRampToValueAtTime" === i.type + ? this.linearRampToValueAtTime(this._toType(s), e) + : "exponentialRampToValueAtTime" === i.type && + this.exponentialRampToValueAtTime(this._toType(s), e)), + this._events.add({ + time: e, + type: "setValueAtTime", + value: s, + }), + this._param.setValueAtTime(s, e), + this + ); + } + rampTo(t, e = 0.1, s) { + return ( + "frequency" === this.units || + "bpm" === this.units || + "decibels" === this.units + ? this.exponentialRampTo(t, e, s) + : this.linearRampTo(t, e, s), + this + ); + } + apply(t) { + const e = this.context.currentTime; + t.setValueAtTime(this.getValueAtTime(e), e); + const s = this._events.get(e); + if (s && "setTargetAtTime" === s.type) { + const n = this._events.getAfter(s.time), + i = n ? n.time : e + 2, + o = (i - e) / 10; + for (let s = e; s < i; s += o) + t.linearRampToValueAtTime(this.getValueAtTime(s), s); + } + return ( + this._events.forEachAfter(this.context.currentTime, (e) => { + "cancelScheduledValues" === e.type + ? t.cancelScheduledValues(e.time) + : "setTargetAtTime" === e.type + ? t.setTargetAtTime(e.value, e.time, e.constant) + : t[e.type](e.value, e.time); + }), + this + ); + } + setParam(t) { + Bn( + this._swappable, + "The Param must be assigned as 'swappable' in the constructor", + ); + const e = this.input; + return ( + e.disconnect(this._param), + this.apply(t), + (this._param = t), + e.connect(this._param), + this + ); + } + dispose() { + return (super.dispose(), this._events.dispose(), this); + } + get defaultValue() { + return this._toType(this._param.defaultValue); + } + _exponentialApproach(t, e, s, n, i) { + return s + (e - s) * Math.exp(-(i - t) / n); + } + _linearInterpolate(t, e, s, n, i) { + return e + ((i - t) / (s - t)) * (n - e); + } + _exponentialInterpolate(t, e, s, n, i) { + return e * Math.pow(n / e, (i - t) / (s - t)); + } + } + class io extends eo { + constructor() { + (super(...arguments), (this._internalChannels = [])); + } + get numberOfInputs() { + return Fn(this.input) + ? oi(this.input) || this.input instanceof no + ? 1 + : this.input.numberOfInputs + : 0; + } + get numberOfOutputs() { + return Fn(this.output) ? this.output.numberOfOutputs : 0; + } + _isAudioNode(t) { + return Fn(t) && (t instanceof io || ri(t)); + } + _getInternalNodes() { + const t = this._internalChannels.slice(0); + return ( + this._isAudioNode(this.input) && t.push(this.input), + this._isAudioNode(this.output) && + this.input !== this.output && + t.push(this.output), + t + ); + } + _setChannelProperties(t) { + this._getInternalNodes().forEach((e) => { + ((e.channelCount = t.channelCount), + (e.channelCountMode = t.channelCountMode), + (e.channelInterpretation = t.channelInterpretation)); + }); + } + _getChannelProperties() { + const t = this._getInternalNodes(); + Bn(t.length > 0, "ToneAudioNode does not have any internal nodes"); + const e = t[0]; + return { + channelCount: e.channelCount, + channelCountMode: e.channelCountMode, + channelInterpretation: e.channelInterpretation, + }; + } + get channelCount() { + return this._getChannelProperties().channelCount; + } + set channelCount(t) { + const e = this._getChannelProperties(); + this._setChannelProperties( + Object.assign(e, { + channelCount: t, + }), + ); + } + get channelCountMode() { + return this._getChannelProperties().channelCountMode; + } + set channelCountMode(t) { + const e = this._getChannelProperties(); + this._setChannelProperties( + Object.assign(e, { + channelCountMode: t, + }), + ); + } + get channelInterpretation() { + return this._getChannelProperties().channelInterpretation; + } + set channelInterpretation(t) { + const e = this._getChannelProperties(); + this._setChannelProperties( + Object.assign(e, { + channelInterpretation: t, + }), + ); + } + connect(t, e = 0, s = 0) { + return (ro(this, t, e, s), this); + } + toDestination() { + return (this.connect(this.context.destination), this); + } + toMaster() { + return ( + Kn("toMaster() has been renamed toDestination()"), + this.toDestination() + ); + } + disconnect(t, e = 0, s = 0) { + return (ao(this, t, e, s), this); + } + chain(...t) { + return (oo(this, ...t), this); + } + fan(...t) { + return (t.forEach((t) => this.connect(t)), this); + } + dispose() { + return ( + super.dispose(), + Fn(this.input) && + (this.input instanceof io + ? this.input.dispose() + : ri(this.input) && this.input.disconnect()), + Fn(this.output) && + (this.output instanceof io + ? this.output.dispose() + : ri(this.output) && this.output.disconnect()), + (this._internalChannels = []), + this + ); + } + } + + function oo(...t) { + const e = t.shift(); + t.reduce( + (t, e) => (t instanceof io ? t.connect(e) : ri(t) && ro(t, e), e), + e, + ); + } + + function ro(t, e, s = 0, n = 0) { + for ( + Bn(Fn(t), "Cannot connect from undefined node"), + Bn(Fn(e), "Cannot connect to undefined node"), + (e instanceof io || ri(e)) && + Bn( + e.numberOfInputs > 0, + "Cannot connect to node with no inputs", + ), + Bn( + t.numberOfOutputs > 0, + "Cannot connect from node with no outputs", + ); + e instanceof io || e instanceof no; + + ) + Fn(e.input) && (e = e.input); + for (; t instanceof io; ) Fn(t.output) && (t = t.output); + oi(e) ? t.connect(e, s) : t.connect(e, s, n); + } + + function ao(t, e, s = 0, n = 0) { + if (Fn(e)) for (; e instanceof io; ) e = e.input; + for (; !ri(t); ) Fn(t.output) && (t = t.output); + oi(e) + ? t.disconnect(e, s) + : ri(e) + ? t.disconnect(e, s, n) + : t.disconnect(); + } + + function co(...t) { + const e = t.pop(); + Fn(e) && t.forEach((t) => ro(t, e)); + } + class ho extends io { + constructor() { + const t = ui(ho.getDefaults(), arguments, ["gain", "units"]); + (super(t), + (this.name = "Gain"), + (this._gainNode = this.context.createGain()), + (this.input = this._gainNode), + (this.output = this._gainNode), + (this.gain = new no({ + context: this.context, + convert: t.convert, + param: this._gainNode.gain, + units: t.units, + value: t.gain, + minValue: t.minValue, + maxValue: t.maxValue, + })), + Di(this, "gain")); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + convert: !0, + gain: 1, + units: "gain", + }); + } + dispose() { + return ( + super.dispose(), + this._gainNode.disconnect(), + this.gain.dispose(), + this + ); + } + } + class lo extends io { + constructor(t) { + (super(t), + (this.onended = Ei), + (this._startTime = -1), + (this._stopTime = -1), + (this._timeout = -1), + (this.output = new ho({ + context: this.context, + gain: 0, + })), + (this._gainNode = this.output), + (this.getStateAtTime = function (t) { + const e = this.toSeconds(t); + return -1 !== this._startTime && + e >= this._startTime && + (-1 === this._stopTime || e <= this._stopTime) + ? "started" + : "stopped"; + }), + (this._fadeIn = t.fadeIn), + (this._fadeOut = t.fadeOut), + (this._curve = t.curve), + (this.onended = t.onended)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + curve: "linear", + fadeIn: 0, + fadeOut: 0, + onended: Ei, + }); + } + _startGain(t, e = 1) { + Bn( + -1 === this._startTime, + "Source cannot be started more than once", + ); + const s = this.toSeconds(this._fadeIn); + return ( + (this._startTime = t + s), + (this._startTime = Math.max( + this._startTime, + this.context.currentTime, + )), + s > 0 + ? (this._gainNode.gain.setValueAtTime(0, t), + "linear" === this._curve + ? this._gainNode.gain.linearRampToValueAtTime(e, t + s) + : this._gainNode.gain.exponentialApproachValueAtTime( + e, + t, + s, + )) + : this._gainNode.gain.setValueAtTime(e, t), + this + ); + } + stop(t) { + return ( + this.log("stop", t), + this._stopGain(this.toSeconds(t)), + this + ); + } + _stopGain(t) { + (Bn(-1 !== this._startTime, "'start' must be called before 'stop'"), + this.cancelStop()); + const e = this.toSeconds(this._fadeOut); + return ( + (this._stopTime = this.toSeconds(t) + e), + (this._stopTime = Math.max(this._stopTime, this.now())), + e > 0 + ? "linear" === this._curve + ? this._gainNode.gain.linearRampTo(0, e, t) + : this._gainNode.gain.targetRampTo(0, e, t) + : (this._gainNode.gain.cancelAndHoldAtTime(t), + this._gainNode.gain.setValueAtTime(0, t)), + this.context.clearTimeout(this._timeout), + (this._timeout = this.context.setTimeout(() => { + const t = "exponential" === this._curve ? 2 * e : 0; + (this._stopSource(this.now() + t), this._onended()); + }, this._stopTime - this.context.currentTime)), + this + ); + } + _onended() { + if ( + this.onended !== Ei && + (this.onended(this), (this.onended = Ei), !this.context.isOffline) + ) { + const t = () => this.dispose(); + "undefined" != typeof requestIdleCallback + ? requestIdleCallback(t) + : setTimeout(t, 10); + } + } + get state() { + return this.getStateAtTime(this.now()); + } + cancelStop() { + return ( + this.log("cancelStop"), + Bn(-1 !== this._startTime, "Source is not started"), + this._gainNode.gain.cancelScheduledValues( + this._startTime + this.sampleTime, + ), + this.context.clearTimeout(this._timeout), + (this._stopTime = -1), + this + ); + } + dispose() { + return ( + super.dispose(), + this._gainNode.dispose(), + (this.onended = Ei), + this + ); + } + } + class uo extends lo { + constructor() { + const t = ui(uo.getDefaults(), arguments, ["offset"]); + (super(t), + (this.name = "ToneConstantSource"), + (this._source = this.context.createConstantSource()), + ro(this._source, this._gainNode), + (this.offset = new no({ + context: this.context, + convert: t.convert, + param: this._source.offset, + units: t.units, + value: t.offset, + minValue: t.minValue, + maxValue: t.maxValue, + }))); + } + static getDefaults() { + return Object.assign(lo.getDefaults(), { + convert: !0, + offset: 1, + units: "number", + }); + } + start(t) { + const e = this.toSeconds(t); + return ( + this.log("start", e), + this._startGain(e), + this._source.start(e), + this + ); + } + _stopSource(t) { + this._source.stop(t); + } + dispose() { + return ( + super.dispose(), + "started" === this.state && this.stop(), + this._source.disconnect(), + this.offset.dispose(), + this + ); + } + } + class po extends io { + constructor() { + const t = ui(po.getDefaults(), arguments, ["value", "units"]); + (super(t), + (this.name = "Signal"), + (this.override = !0), + (this.output = this._constantSource = + new uo({ + context: this.context, + convert: t.convert, + offset: t.value, + units: t.units, + minValue: t.minValue, + maxValue: t.maxValue, + })), + this._constantSource.start(0), + (this.input = this._param = this._constantSource.offset)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + convert: !0, + units: "number", + value: 0, + }); + } + connect(t, e = 0, s = 0) { + return (fo(this, t, e, s), this); + } + dispose() { + return ( + super.dispose(), + this._param.dispose(), + this._constantSource.dispose(), + this + ); + } + setValueAtTime(t, e) { + return (this._param.setValueAtTime(t, e), this); + } + getValueAtTime(t) { + return this._param.getValueAtTime(t); + } + setRampPoint(t) { + return (this._param.setRampPoint(t), this); + } + linearRampToValueAtTime(t, e) { + return (this._param.linearRampToValueAtTime(t, e), this); + } + exponentialRampToValueAtTime(t, e) { + return (this._param.exponentialRampToValueAtTime(t, e), this); + } + exponentialRampTo(t, e, s) { + return (this._param.exponentialRampTo(t, e, s), this); + } + linearRampTo(t, e, s) { + return (this._param.linearRampTo(t, e, s), this); + } + targetRampTo(t, e, s) { + return (this._param.targetRampTo(t, e, s), this); + } + exponentialApproachValueAtTime(t, e, s) { + return (this._param.exponentialApproachValueAtTime(t, e, s), this); + } + setTargetAtTime(t, e, s) { + return (this._param.setTargetAtTime(t, e, s), this); + } + setValueCurveAtTime(t, e, s, n) { + return (this._param.setValueCurveAtTime(t, e, s, n), this); + } + cancelScheduledValues(t) { + return (this._param.cancelScheduledValues(t), this); + } + cancelAndHoldAtTime(t) { + return (this._param.cancelAndHoldAtTime(t), this); + } + rampTo(t, e, s) { + return (this._param.rampTo(t, e, s), this); + } + get value() { + return this._param.value; + } + set value(t) { + this._param.value = t; + } + get convert() { + return this._param.convert; + } + set convert(t) { + this._param.convert = t; + } + get units() { + return this._param.units; + } + get overridden() { + return this._param.overridden; + } + set overridden(t) { + this._param.overridden = t; + } + get maxValue() { + return this._param.maxValue; + } + get minValue() { + return this._param.minValue; + } + apply(t) { + return (this._param.apply(t), this); + } + } + + function fo(t, e, s, n) { + ((e instanceof no || oi(e) || (e instanceof po && e.override)) && + (e.cancelScheduledValues(0), + e.setValueAtTime(0, 0), + e instanceof po && (e.overridden = !0)), + ro(t, e, s, n)); + } + class _o extends no { + constructor() { + const t = ui(_o.getDefaults(), arguments, ["value"]); + (super(t), + (this.name = "TickParam"), + (this._events = new wi(1 / 0)), + (this._multiplier = 1), + (this._multiplier = t.multiplier), + this._events.cancel(0), + this._events.add({ + ticks: 0, + time: 0, + type: "setValueAtTime", + value: this._fromType(t.value), + }), + this.setValueAtTime(t.value, 0)); + } + static getDefaults() { + return Object.assign(no.getDefaults(), { + multiplier: 1, + units: "hertz", + value: 1, + }); + } + setTargetAtTime(t, e, s) { + ((e = this.toSeconds(e)), this.setRampPoint(e)); + const n = this._fromType(t), + i = this._events.get(e), + o = Math.round(Math.max(1 / s, 1)); + for (let t = 0; t <= o; t++) { + const o = s * t + e, + r = this._exponentialApproach(i.time, i.value, n, s, o); + this.linearRampToValueAtTime(this._toType(r), o); + } + return this; + } + setValueAtTime(t, e) { + const s = this.toSeconds(e); + super.setValueAtTime(t, e); + const n = this._events.get(s), + i = this._events.previousEvent(n), + o = this._getTicksUntilEvent(i, s); + return ((n.ticks = Math.max(o, 0)), this); + } + linearRampToValueAtTime(t, e) { + const s = this.toSeconds(e); + super.linearRampToValueAtTime(t, e); + const n = this._events.get(s), + i = this._events.previousEvent(n), + o = this._getTicksUntilEvent(i, s); + return ((n.ticks = Math.max(o, 0)), this); + } + exponentialRampToValueAtTime(t, e) { + e = this.toSeconds(e); + const s = this._fromType(t), + n = this._events.get(e), + i = Math.round(Math.max(10 * (e - n.time), 1)), + o = (e - n.time) / i; + for (let t = 0; t <= i; t++) { + const i = o * t + n.time, + r = this._exponentialInterpolate(n.time, n.value, e, s, i); + this.linearRampToValueAtTime(this._toType(r), i); + } + return this; + } + _getTicksUntilEvent(t, e) { + if (null === t) + t = { + ticks: 0, + time: 0, + type: "setValueAtTime", + value: 0, + }; + else if (In(t.ticks)) { + const e = this._events.previousEvent(t); + t.ticks = this._getTicksUntilEvent(e, t.time); + } + const s = this._fromType(this.getValueAtTime(t.time)); + let n = this._fromType(this.getValueAtTime(e)); + const i = this._events.get(e); + return ( + i && + i.time === e && + "setValueAtTime" === i.type && + (n = this._fromType(this.getValueAtTime(e - this.sampleTime))), + 0.5 * (e - t.time) * (s + n) + t.ticks + ); + } + getTicksAtTime(t) { + const e = this.toSeconds(t), + s = this._events.get(e); + return Math.max(this._getTicksUntilEvent(s, e), 0); + } + getDurationOfTicks(t, e) { + const s = this.toSeconds(e), + n = this.getTicksAtTime(e); + return this.getTimeOfTick(n + t) - s; + } + getTimeOfTick(t) { + const e = this._events.get(t, "ticks"), + s = this._events.getAfter(t, "ticks"); + if (e && e.ticks === t) return e.time; + if ( + e && + s && + "linearRampToValueAtTime" === s.type && + e.value !== s.value + ) { + const n = this._fromType(this.getValueAtTime(e.time)), + i = + (this._fromType(this.getValueAtTime(s.time)) - n) / + (s.time - e.time), + o = Math.sqrt(Math.pow(n, 2) - 2 * i * (e.ticks - t)), + r = (-n + o) / i; + return (r > 0 ? r : (-n - o) / i) + e.time; + } + return e + ? 0 === e.value + ? 1 / 0 + : e.time + (t - e.ticks) / e.value + : t / this._initialValue; + } + ticksToTime(t, e) { + return this.getDurationOfTicks(t, e); + } + timeToTicks(t, e) { + const s = this.toSeconds(e), + n = this.toSeconds(t), + i = this.getTicksAtTime(s); + return this.getTicksAtTime(s + n) - i; + } + _fromType(t) { + return "bpm" === this.units && this.multiplier + ? 1 / (60 / t / this.multiplier) + : super._fromType(t); + } + _toType(t) { + return "bpm" === this.units && this.multiplier + ? (t / this.multiplier) * 60 + : super._toType(t); + } + get multiplier() { + return this._multiplier; + } + set multiplier(t) { + const e = this.value; + ((this._multiplier = t), + this.cancelScheduledValues(0), + this.setValueAtTime(e, 0)); + } + } + class mo extends po { + constructor() { + const t = ui(mo.getDefaults(), arguments, ["value"]); + (super(t), + (this.name = "TickSignal"), + (this.input = this._param = + new _o({ + context: this.context, + convert: t.convert, + multiplier: t.multiplier, + param: this._constantSource.offset, + units: t.units, + value: t.value, + }))); + } + static getDefaults() { + return Object.assign(po.getDefaults(), { + multiplier: 1, + units: "hertz", + value: 1, + }); + } + ticksToTime(t, e) { + return this._param.ticksToTime(t, e); + } + timeToTicks(t, e) { + return this._param.timeToTicks(t, e); + } + getTimeOfTick(t) { + return this._param.getTimeOfTick(t); + } + getDurationOfTicks(t, e) { + return this._param.getDurationOfTicks(t, e); + } + getTicksAtTime(t) { + return this._param.getTicksAtTime(t); + } + get multiplier() { + return this._param.multiplier; + } + set multiplier(t) { + this._param.multiplier = t; + } + dispose() { + return (super.dispose(), this._param.dispose(), this); + } + } + class go extends eo { + constructor() { + const t = ui(go.getDefaults(), arguments, ["frequency"]); + (super(t), + (this.name = "TickSource"), + (this._state = new so()), + (this._tickOffset = new wi()), + (this._ticksAtTime = new wi()), + (this._secondsAtTime = new wi()), + (this.frequency = new mo({ + context: this.context, + units: t.units, + value: t.frequency, + })), + Di(this, "frequency"), + this._state.setStateAtTime("stopped", 0), + this.setTicksAtTime(0, 0)); + } + static getDefaults() { + return Object.assign( + { + frequency: 1, + units: "hertz", + }, + eo.getDefaults(), + ); + } + get state() { + return this.getStateAtTime(this.now()); + } + start(t, e) { + const s = this.toSeconds(t); + return ( + "started" !== this._state.getValueAtTime(s) && + (this._state.setStateAtTime("started", s), + Fn(e) && this.setTicksAtTime(e, s), + this._ticksAtTime.cancel(s), + this._secondsAtTime.cancel(s)), + this + ); + } + stop(t) { + const e = this.toSeconds(t); + if ("stopped" === this._state.getValueAtTime(e)) { + const t = this._state.get(e); + t && + t.time > 0 && + (this._tickOffset.cancel(t.time), this._state.cancel(t.time)); + } + return ( + this._state.cancel(e), + this._state.setStateAtTime("stopped", e), + this.setTicksAtTime(0, e), + this._ticksAtTime.cancel(e), + this._secondsAtTime.cancel(e), + this + ); + } + pause(t) { + const e = this.toSeconds(t); + return ( + "started" === this._state.getValueAtTime(e) && + (this._state.setStateAtTime("paused", e), + this._ticksAtTime.cancel(e), + this._secondsAtTime.cancel(e)), + this + ); + } + cancel(t) { + return ( + (t = this.toSeconds(t)), + this._state.cancel(t), + this._tickOffset.cancel(t), + this._ticksAtTime.cancel(t), + this._secondsAtTime.cancel(t), + this + ); + } + getTicksAtTime(t) { + const e = this.toSeconds(t), + s = this._state.getLastState("stopped", e), + n = this._ticksAtTime.get(e), + i = { + state: "paused", + time: e, + }; + this._state.add(i); + let o = n || s, + r = n ? n.ticks : 0, + a = null; + return ( + this._state.forEachBetween(o.time, e + this.sampleTime, (t) => { + let e = o.time; + const s = this._tickOffset.get(t.time); + (s && s.time >= o.time && ((r = s.ticks), (e = s.time)), + "started" === o.state && + "started" !== t.state && + ((r += + this.frequency.getTicksAtTime(t.time) - + this.frequency.getTicksAtTime(e)), + t.time !== i.time && + (a = { + state: t.state, + time: t.time, + ticks: r, + })), + (o = t)); + }), + this._state.remove(i), + a && this._ticksAtTime.add(a), + r + ); + } + get ticks() { + return this.getTicksAtTime(this.now()); + } + set ticks(t) { + this.setTicksAtTime(t, this.now()); + } + get seconds() { + return this.getSecondsAtTime(this.now()); + } + set seconds(t) { + const e = this.now(), + s = this.frequency.timeToTicks(t, e); + this.setTicksAtTime(s, e); + } + getSecondsAtTime(t) { + t = this.toSeconds(t); + const e = this._state.getLastState("stopped", t), + s = { + state: "paused", + time: t, + }; + this._state.add(s); + const n = this._secondsAtTime.get(t); + let i = n || e, + o = n ? n.seconds : 0, + r = null; + return ( + this._state.forEachBetween(i.time, t + this.sampleTime, (t) => { + let e = i.time; + const n = this._tickOffset.get(t.time); + (n && n.time >= i.time && ((o = n.seconds), (e = n.time)), + "started" === i.state && + "started" !== t.state && + ((o += t.time - e), + t.time !== s.time && + (r = { + state: t.state, + time: t.time, + seconds: o, + })), + (i = t)); + }), + this._state.remove(s), + r && this._secondsAtTime.add(r), + o + ); + } + setTicksAtTime(t, e) { + return ( + (e = this.toSeconds(e)), + this._tickOffset.cancel(e), + this._tickOffset.add({ + seconds: this.frequency.getDurationOfTicks(t, e), + ticks: t, + time: e, + }), + this._ticksAtTime.cancel(e), + this._secondsAtTime.cancel(e), + this + ); + } + getStateAtTime(t) { + return ((t = this.toSeconds(t)), this._state.getValueAtTime(t)); + } + getTimeOfTick(t, e = this.now()) { + const s = this._tickOffset.get(e), + n = this._state.get(e), + i = Math.max(s.time, n.time), + o = this.frequency.getTicksAtTime(i) + t - s.ticks; + return this.frequency.getTimeOfTick(o); + } + forEachTickBetween(t, e, s) { + let n = this._state.get(t); + this._state.forEachBetween(t, e, (e) => { + (n && + "started" === n.state && + "started" !== e.state && + this.forEachTickBetween( + Math.max(n.time, t), + e.time - this.sampleTime, + s, + ), + (n = e)); + }); + let i = null; + if (n && "started" === n.state) { + const o = Math.max(n.time, t), + r = this.frequency.getTicksAtTime(o), + a = r - this.frequency.getTicksAtTime(n.time); + let c = Math.ceil(a) - a; + c = yi(c, 1) ? 0 : c; + let h = this.frequency.getTimeOfTick(r + c); + for (; h < e; ) { + try { + s(h, Math.round(this.getTicksAtTime(h))); + } catch (t) { + i = t; + break; + } + h += this.frequency.getDurationOfTicks(1, h); + } + } + if (i) throw i; + return this; + } + dispose() { + return ( + super.dispose(), + this._state.dispose(), + this._tickOffset.dispose(), + this._ticksAtTime.dispose(), + this._secondsAtTime.dispose(), + this.frequency.dispose(), + this + ); + } + } + class vo extends eo { + constructor() { + const t = ui(vo.getDefaults(), arguments, [ + "callback", + "frequency", + ]); + (super(t), + (this.name = "Clock"), + (this.callback = Ei), + (this._lastUpdate = 0), + (this._state = new so("stopped")), + (this._boundLoop = this._loop.bind(this)), + (this.callback = t.callback), + (this._tickSource = new go({ + context: this.context, + frequency: t.frequency, + units: t.units, + })), + (this._lastUpdate = 0), + (this.frequency = this._tickSource.frequency), + Di(this, "frequency"), + this._state.setStateAtTime("stopped", 0), + this.context.on("tick", this._boundLoop)); + } + static getDefaults() { + return Object.assign(eo.getDefaults(), { + callback: Ei, + frequency: 1, + units: "hertz", + }); + } + get state() { + return this._state.getValueAtTime(this.now()); + } + start(t, e) { + Gn(this.context); + const s = this.toSeconds(t); + return ( + this.log("start", s), + "started" !== this._state.getValueAtTime(s) && + (this._state.setStateAtTime("started", s), + this._tickSource.start(s, e), + s < this._lastUpdate && this.emit("start", s, e)), + this + ); + } + stop(t) { + const e = this.toSeconds(t); + return ( + this.log("stop", e), + this._state.cancel(e), + this._state.setStateAtTime("stopped", e), + this._tickSource.stop(e), + e < this._lastUpdate && this.emit("stop", e), + this + ); + } + pause(t) { + const e = this.toSeconds(t); + return ( + "started" === this._state.getValueAtTime(e) && + (this._state.setStateAtTime("paused", e), + this._tickSource.pause(e), + e < this._lastUpdate && this.emit("pause", e)), + this + ); + } + get ticks() { + return Math.ceil(this.getTicksAtTime(this.now())); + } + set ticks(t) { + this._tickSource.ticks = t; + } + get seconds() { + return this._tickSource.seconds; + } + set seconds(t) { + this._tickSource.seconds = t; + } + getSecondsAtTime(t) { + return this._tickSource.getSecondsAtTime(t); + } + setTicksAtTime(t, e) { + return (this._tickSource.setTicksAtTime(t, e), this); + } + getTimeOfTick(t, e = this.now()) { + return this._tickSource.getTimeOfTick(t, e); + } + getTicksAtTime(t) { + return this._tickSource.getTicksAtTime(t); + } + nextTickTime(t, e) { + const s = this.toSeconds(e), + n = this.getTicksAtTime(s); + return this._tickSource.getTimeOfTick(n + t, s); + } + _loop() { + const t = this._lastUpdate, + e = this.now(); + ((this._lastUpdate = e), + this.log("loop", t, e), + t !== e && + (this._state.forEachBetween(t, e, (t) => { + switch (t.state) { + case "started": + const e = this._tickSource.getTicksAtTime(t.time); + this.emit("start", t.time, e); + break; + case "stopped": + 0 !== t.time && this.emit("stop", t.time); + break; + case "paused": + this.emit("pause", t.time); + } + }), + this._tickSource.forEachTickBetween(t, e, (t, e) => { + this.callback(t, e); + }))); + } + getStateAtTime(t) { + const e = this.toSeconds(t); + return this._state.getValueAtTime(e); + } + dispose() { + return ( + super.dispose(), + this.context.off("tick", this._boundLoop), + this._tickSource.dispose(), + this._state.dispose(), + this + ); + } + } + Ai.mixin(vo); + class yo extends io { + constructor() { + const t = ui(yo.getDefaults(), arguments, [ + "delayTime", + "maxDelay", + ]); + (super(t), (this.name = "Delay")); + const e = this.toSeconds(t.maxDelay); + ((this._maxDelay = Math.max(e, this.toSeconds(t.delayTime))), + (this._delayNode = + this.input = + this.output = + this.context.createDelay(e)), + (this.delayTime = new no({ + context: this.context, + param: this._delayNode.delayTime, + units: "time", + value: t.delayTime, + minValue: 0, + maxValue: this.maxDelay, + })), + Di(this, "delayTime")); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + delayTime: 0, + maxDelay: 1, + }); + } + get maxDelay() { + return this._maxDelay; + } + dispose() { + return ( + super.dispose(), + this._delayNode.disconnect(), + this.delayTime.dispose(), + this + ); + } + } + class xo extends io { + constructor() { + const t = ui(xo.getDefaults(), arguments, ["volume"]); + (super(t), + (this.name = "Volume"), + (this.input = this.output = + new ho({ + context: this.context, + gain: t.volume, + units: "decibels", + })), + (this.volume = this.output.gain), + Di(this, "volume"), + (this._unmutedVolume = t.volume), + (this.mute = t.mute)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + mute: !1, + volume: 0, + }); + } + get mute() { + return this.volume.value === -1 / 0; + } + set mute(t) { + !this.mute && t + ? ((this._unmutedVolume = this.volume.value), + (this.volume.value = -1 / 0)) + : this.mute && !t && (this.volume.value = this._unmutedVolume); + } + dispose() { + return ( + super.dispose(), + this.input.dispose(), + this.volume.dispose(), + this + ); + } + } + class wo extends io { + constructor() { + const t = ui(wo.getDefaults(), arguments); + (super(t), + (this.name = "Destination"), + (this.input = new xo({ + context: this.context, + })), + (this.output = new ho({ + context: this.context, + })), + (this.volume = this.input.volume), + oo(this.input, this.output, this.context.rawContext.destination), + (this.mute = t.mute), + (this._internalChannels = [ + this.input, + this.context.rawContext.destination, + this.output, + ])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + mute: !1, + volume: 0, + }); + } + get mute() { + return this.input.mute; + } + set mute(t) { + this.input.mute = t; + } + chain(...t) { + return ( + this.input.disconnect(), + t.unshift(this.input), + t.push(this.output), + oo(...t), + this + ); + } + get maxChannelCount() { + return this.context.rawContext.destination.maxChannelCount; + } + dispose() { + return (super.dispose(), this.volume.dispose(), this); + } + } + (Ti((t) => { + t.destination = new wo({ + context: t, + }); + }), + ki((t) => { + t.destination.dispose(); + })); + class bo extends io { + constructor() { + (super(...arguments), + (this.name = "Listener"), + (this.positionX = new no({ + context: this.context, + param: this.context.rawContext.listener.positionX, + })), + (this.positionY = new no({ + context: this.context, + param: this.context.rawContext.listener.positionY, + })), + (this.positionZ = new no({ + context: this.context, + param: this.context.rawContext.listener.positionZ, + })), + (this.forwardX = new no({ + context: this.context, + param: this.context.rawContext.listener.forwardX, + })), + (this.forwardY = new no({ + context: this.context, + param: this.context.rawContext.listener.forwardY, + })), + (this.forwardZ = new no({ + context: this.context, + param: this.context.rawContext.listener.forwardZ, + })), + (this.upX = new no({ + context: this.context, + param: this.context.rawContext.listener.upX, + })), + (this.upY = new no({ + context: this.context, + param: this.context.rawContext.listener.upY, + })), + (this.upZ = new no({ + context: this.context, + param: this.context.rawContext.listener.upZ, + }))); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + positionX: 0, + positionY: 0, + positionZ: 0, + forwardX: 0, + forwardY: 0, + forwardZ: -1, + upX: 0, + upY: 1, + upZ: 0, + }); + } + dispose() { + return ( + super.dispose(), + this.positionX.dispose(), + this.positionY.dispose(), + this.positionZ.dispose(), + this.forwardX.dispose(), + this.forwardY.dispose(), + this.forwardZ.dispose(), + this.upX.dispose(), + this.upY.dispose(), + this.upZ.dispose(), + this + ); + } + } + + function To(t, e) { + return ni( + this, + arguments, + void 0, + function* (t, e, s = 2, n = Vi().sampleRate) { + const i = Vi(), + o = new qi(s, e, n); + (Ni(o), yield t(o)); + const r = o.render(); + Ni(i); + const a = yield r; + return new Ri(a); + }, + ); + } + (Ti((t) => { + t.listener = new bo({ + context: t, + }); + }), + ki((t) => { + t.listener.dispose(); + })); + class So extends fi { + constructor() { + (super(), + (this.name = "ToneAudioBuffers"), + (this._buffers = new Map()), + (this._loadingCount = 0)); + const t = ui( + So.getDefaults(), + arguments, + ["urls", "onload", "baseUrl"], + "urls", + ); + ((this.baseUrl = t.baseUrl), + Object.keys(t.urls).forEach((e) => { + this._loadingCount++; + const s = t.urls[e]; + this.add( + e, + s, + this._bufferLoaded.bind(this, t.onload), + t.onerror, + ); + })); + } + static getDefaults() { + return { + baseUrl: "", + onerror: Ei, + onload: Ei, + urls: {}, + }; + } + has(t) { + return this._buffers.has(t.toString()); + } + get(t) { + return ( + Bn(this.has(t), `ToneAudioBuffers has no buffer named: ${t}`), + this._buffers.get(t.toString()) + ); + } + _bufferLoaded(t) { + (this._loadingCount--, 0 === this._loadingCount && t && t()); + } + get loaded() { + return Array.from(this._buffers).every(([t, e]) => e.loaded); + } + add(t, e, s = Ei, n = Ei) { + return ( + zn(e) + ? (this.baseUrl && + "data:audio/" === e.trim().substring(0, 11).toLowerCase() && + (this.baseUrl = ""), + this._buffers.set( + t.toString(), + new Ri(this.baseUrl + e, s, n), + )) + : this._buffers.set(t.toString(), new Ri(e, s, n)), + this + ); + } + dispose() { + return ( + super.dispose(), + this._buffers.forEach((t) => t.dispose()), + this._buffers.clear(), + this + ); + } + } + class ko extends Yi { + constructor() { + (super(...arguments), + (this.name = "MidiClass"), + (this.defaultUnits = "midi")); + } + _frequencyToUnits(t) { + return Bi(super._frequencyToUnits(t)); + } + _ticksToUnits(t) { + return Bi(super._ticksToUnits(t)); + } + _beatsToUnits(t) { + return Bi(super._beatsToUnits(t)); + } + _secondsToUnits(t) { + return Bi(super._secondsToUnits(t)); + } + toMidi() { + return this.valueOf(); + } + toFrequency() { + return Gi(this.toMidi()); + } + transpose(t) { + return new ko(this.context, this.toMidi() + t); + } + } + + function Ao(t, e) { + return new ko(Vi(), t, e); + } + class Co extends Ki { + constructor() { + (super(...arguments), + (this.name = "Ticks"), + (this.defaultUnits = "i")); + } + _now() { + return this.context.transport.ticks; + } + _beatsToUnits(t) { + return this._getPPQ() * t; + } + _secondsToUnits(t) { + return Math.floor((t / (60 / this._getBpm())) * this._getPPQ()); + } + _ticksToUnits(t) { + return t; + } + toTicks() { + return this.valueOf(); + } + toSeconds() { + return (this.valueOf() / this._getPPQ()) * (60 / this._getBpm()); + } + } + + function Oo(t, e) { + return new Co(Vi(), t, e); + } + class Do extends eo { + constructor() { + (super(...arguments), + (this.name = "Draw"), + (this.expiration = 0.25), + (this.anticipation = 0.008), + (this._events = new wi()), + (this._boundDrawLoop = this._drawLoop.bind(this)), + (this._animationFrame = -1)); + } + schedule(t, e) { + return ( + this._events.add({ + callback: t, + time: this.toSeconds(e), + }), + 1 === this._events.length && + (this._animationFrame = requestAnimationFrame( + this._boundDrawLoop, + )), + this + ); + } + cancel(t) { + return (this._events.cancel(this.toSeconds(t)), this); + } + _drawLoop() { + const t = this.context.currentTime; + (this._events.forEachBefore(t + this.anticipation, (e) => { + (t - e.time <= this.expiration && e.callback(), + this._events.remove(e)); + }), + this._events.length > 0 && + (this._animationFrame = requestAnimationFrame( + this._boundDrawLoop, + ))); + } + dispose() { + return ( + super.dispose(), + this._events.dispose(), + cancelAnimationFrame(this._animationFrame), + this + ); + } + } + (Ti((t) => { + t.draw = new Do({ + context: t, + }); + }), + ki((t) => { + t.draw.dispose(); + })); + class Mo extends fi { + constructor() { + (super(...arguments), + (this.name = "IntervalTimeline"), + (this._root = null), + (this._length = 0)); + } + add(t) { + (Bn(Fn(t.time), "Events must have a time property"), + Bn(Fn(t.duration), "Events must have a duration parameter"), + (t.time = t.time.valueOf())); + let e = new Eo(t.time, t.time + t.duration, t); + for ( + null === this._root ? (this._root = e) : this._root.insert(e), + this._length++; + null !== e; + + ) + (e.updateHeight(), + e.updateMax(), + this._rebalance(e), + (e = e.parent)); + return this; + } + remove(t) { + if (null !== this._root) { + const e = []; + this._root.search(t.time, e); + for (const s of e) + if (s.event === t) { + (this._removeNode(s), this._length--); + break; + } + } + return this; + } + get length() { + return this._length; + } + cancel(t) { + return (this.forEachFrom(t, (t) => this.remove(t)), this); + } + _setRoot(t) { + ((this._root = t), + null !== this._root && (this._root.parent = null)); + } + _replaceNodeInParent(t, e) { + null !== t.parent + ? (t.isLeftChild() ? (t.parent.left = e) : (t.parent.right = e), + this._rebalance(t.parent)) + : this._setRoot(e); + } + _removeNode(t) { + if (null === t.left && null === t.right) + this._replaceNodeInParent(t, null); + else if (null === t.right) this._replaceNodeInParent(t, t.left); + else if (null === t.left) this._replaceNodeInParent(t, t.right); + else { + let e, + s = null; + if (t.getBalance() > 0) + if (null === t.left.right) + ((e = t.left), (e.right = t.right), (s = e)); + else { + for (e = t.left.right; null !== e.right; ) e = e.right; + e.parent && + ((e.parent.right = e.left), + (s = e.parent), + (e.left = t.left), + (e.right = t.right)); + } + else if (null === t.right.left) + ((e = t.right), (e.left = t.left), (s = e)); + else { + for (e = t.right.left; null !== e.left; ) e = e.left; + e.parent && + ((e.parent.left = e.right), + (s = e.parent), + (e.left = t.left), + (e.right = t.right)); + } + (null !== t.parent + ? t.isLeftChild() + ? (t.parent.left = e) + : (t.parent.right = e) + : this._setRoot(e), + s && this._rebalance(s)); + } + t.dispose(); + } + _rotateLeft(t) { + const e = t.parent, + s = t.isLeftChild(), + n = t.right; + (n && ((t.right = n.left), (n.left = t)), + null !== e + ? s + ? (e.left = n) + : (e.right = n) + : this._setRoot(n)); + } + _rotateRight(t) { + const e = t.parent, + s = t.isLeftChild(), + n = t.left; + (n && ((t.left = n.right), (n.right = t)), + null !== e + ? s + ? (e.left = n) + : (e.right = n) + : this._setRoot(n)); + } + _rebalance(t) { + const e = t.getBalance(); + e > 1 && t.left + ? t.left.getBalance() < 0 + ? this._rotateLeft(t.left) + : this._rotateRight(t) + : e < -1 && + t.right && + (t.right.getBalance() > 0 + ? this._rotateRight(t.right) + : this._rotateLeft(t)); + } + get(t) { + if (null !== this._root) { + const e = []; + if ((this._root.search(t, e), e.length > 0)) { + let t = e[0]; + for (let s = 1; s < e.length; s++) + e[s].low > t.low && (t = e[s]); + return t.event; + } + } + return null; + } + forEach(t) { + if (null !== this._root) { + const e = []; + (this._root.traverse((t) => e.push(t)), + e.forEach((e) => { + e.event && t(e.event); + })); + } + return this; + } + forEachAtTime(t, e) { + if (null !== this._root) { + const s = []; + (this._root.search(t, s), + s.forEach((t) => { + t.event && e(t.event); + })); + } + return this; + } + forEachFrom(t, e) { + if (null !== this._root) { + const s = []; + (this._root.searchAfter(t, s), + s.forEach((t) => { + t.event && e(t.event); + })); + } + return this; + } + dispose() { + return ( + super.dispose(), + null !== this._root && this._root.traverse((t) => t.dispose()), + (this._root = null), + this + ); + } + } + class Eo { + constructor(t, e, s) { + ((this._left = null), + (this._right = null), + (this.parent = null), + (this.height = 0), + (this.event = s), + (this.low = t), + (this.high = e), + (this.max = this.high)); + } + insert(t) { + t.low <= this.low + ? null === this.left + ? (this.left = t) + : this.left.insert(t) + : null === this.right + ? (this.right = t) + : this.right.insert(t); + } + search(t, e) { + t > this.max || + (null !== this.left && this.left.search(t, e), + this.low <= t && this.high > t && e.push(this), + this.low > t || (null !== this.right && this.right.search(t, e))); + } + searchAfter(t, e) { + (this.low >= t && + (e.push(this), null !== this.left && this.left.searchAfter(t, e)), + null !== this.right && this.right.searchAfter(t, e)); + } + traverse(t) { + (t(this), + null !== this.left && this.left.traverse(t), + null !== this.right && this.right.traverse(t)); + } + updateHeight() { + null !== this.left && null !== this.right + ? (this.height = + Math.max(this.left.height, this.right.height) + 1) + : null !== this.right + ? (this.height = this.right.height + 1) + : null !== this.left + ? (this.height = this.left.height + 1) + : (this.height = 0); + } + updateMax() { + ((this.max = this.high), + null !== this.left && + (this.max = Math.max(this.max, this.left.max)), + null !== this.right && + (this.max = Math.max(this.max, this.right.max))); + } + getBalance() { + let t = 0; + return ( + null !== this.left && null !== this.right + ? (t = this.left.height - this.right.height) + : null !== this.left + ? (t = this.left.height + 1) + : null !== this.right && (t = -(this.right.height + 1)), + t + ); + } + isLeftChild() { + return null !== this.parent && this.parent.left === this; + } + get left() { + return this._left; + } + set left(t) { + ((this._left = t), + null !== t && (t.parent = this), + this.updateHeight(), + this.updateMax()); + } + get right() { + return this._right; + } + set right(t) { + ((this._right = t), + null !== t && (t.parent = this), + this.updateHeight(), + this.updateMax()); + } + dispose() { + ((this.parent = null), + (this._left = null), + (this._right = null), + (this.event = null)); + } + } + class Ro extends fi { + constructor(t) { + (super(), + (this.name = "TimelineValue"), + (this._timeline = new wi({ + memory: 10, + })), + (this._initialValue = t)); + } + set(t, e) { + return ( + this._timeline.add({ + value: t, + time: e, + }), + this + ); + } + get(t) { + const e = this._timeline.get(t); + return e ? e.value : this._initialValue; + } + } + class qo extends io { + constructor() { + super(ui(qo.getDefaults(), arguments, ["context"])); + } + connect(t, e = 0, s = 0) { + return (fo(this, t, e, s), this); + } + } + class Io extends qo { + constructor() { + const t = ui(Io.getDefaults(), arguments, ["mapping", "length"]); + (super(t), + (this.name = "WaveShaper"), + (this._shaper = this.context.createWaveShaper()), + (this.input = this._shaper), + (this.output = this._shaper), + Ln(t.mapping) || t.mapping instanceof Float32Array + ? (this.curve = Float32Array.from(t.mapping)) + : Vn(t.mapping) && this.setMap(t.mapping, t.length)); + } + static getDefaults() { + return Object.assign(po.getDefaults(), { + length: 1024, + }); + } + setMap(t, e = 1024) { + const s = new Float32Array(e); + for (let n = 0, i = e; n < i; n++) { + const e = (n / (i - 1)) * 2 - 1; + s[n] = t(e, n); + } + return ((this.curve = s), this); + } + get curve() { + return this._shaper.curve; + } + set curve(t) { + this._shaper.curve = t; + } + get oversample() { + return this._shaper.oversample; + } + set oversample(t) { + (Bn( + ["none", "2x", "4x"].some((e) => e.includes(t)), + "oversampling must be either 'none', '2x', or '4x'", + ), + (this._shaper.oversample = t)); + } + dispose() { + return (super.dispose(), this._shaper.disconnect(), this); + } + } + class Fo extends qo { + constructor() { + const t = ui(Fo.getDefaults(), arguments, ["value"]); + (super(t), + (this.name = "Pow"), + (this._exponentScaler = + this.input = + this.output = + new Io({ + context: this.context, + mapping: this._expFunc(t.value), + length: 8192, + })), + (this._exponent = t.value)); + } + static getDefaults() { + return Object.assign(qo.getDefaults(), { + value: 1, + }); + } + _expFunc(t) { + return (e) => Math.pow(Math.abs(e), t); + } + get value() { + return this._exponent; + } + set value(t) { + ((this._exponent = t), + this._exponentScaler.setMap(this._expFunc(this._exponent))); + } + dispose() { + return (super.dispose(), this._exponentScaler.dispose(), this); + } + } + class Vo { + constructor(t, e) { + ((this.id = Vo._eventId++), (this._remainderTime = 0)); + const s = Object.assign(Vo.getDefaults(), e); + ((this.transport = t), + (this.callback = s.callback), + (this._once = s.once), + (this.time = Math.floor(s.time)), + (this._remainderTime = s.time - this.time)); + } + static getDefaults() { + return { + callback: Ei, + once: !1, + time: 0, + }; + } + get floatTime() { + return this.time + this._remainderTime; + } + invoke(t) { + if (this.callback) { + const e = this.transport.bpm.getDurationOfTicks(1, t); + (this.callback(t + this._remainderTime * e), + this._once && this.transport.clear(this.id)); + } + } + dispose() { + return ((this.callback = void 0), this); + } + } + Vo._eventId = 0; + class No extends Vo { + constructor(t, e) { + (super(t, e), + (this._currentId = -1), + (this._nextId = -1), + (this._nextTick = this.time), + (this._boundRestart = this._restart.bind(this))); + const s = Object.assign(No.getDefaults(), e); + ((this.duration = s.duration), + (this._interval = s.interval), + (this._nextTick = s.time), + this.transport.on("start", this._boundRestart), + this.transport.on("loopStart", this._boundRestart), + this.transport.on("ticks", this._boundRestart), + (this.context = this.transport.context), + this._restart()); + } + static getDefaults() { + return Object.assign({}, Vo.getDefaults(), { + duration: 1 / 0, + interval: 1, + once: !1, + }); + } + invoke(t) { + (this._createEvents(t), super.invoke(t)); + } + _createEvent() { + return vi(this._nextTick, this.floatTime + this.duration) + ? this.transport.scheduleOnce( + this.invoke.bind(this), + new Co(this.context, this._nextTick).toSeconds(), + ) + : -1; + } + _createEvents(t) { + vi( + this._nextTick + this._interval, + this.floatTime + this.duration, + ) && + ((this._nextTick += this._interval), + (this._currentId = this._nextId), + (this._nextId = this.transport.scheduleOnce( + this.invoke.bind(this), + new Co(this.context, this._nextTick).toSeconds(), + ))); + } + _restart(t) { + (this.transport.clear(this._currentId), + this.transport.clear(this._nextId), + (this._nextTick = this.floatTime)); + const e = this.transport.getTicksAtTime(t); + (mi(e, this.time) && + (this._nextTick = + this.floatTime + + Math.ceil((e - this.floatTime) / this._interval) * + this._interval), + (this._currentId = this._createEvent()), + (this._nextTick += this._interval), + (this._nextId = this._createEvent())); + } + dispose() { + return ( + super.dispose(), + this.transport.clear(this._currentId), + this.transport.clear(this._nextId), + this.transport.off("start", this._boundRestart), + this.transport.off("loopStart", this._boundRestart), + this.transport.off("ticks", this._boundRestart), + this + ); + } + } + class Po extends eo { + constructor() { + const t = ui(Po.getDefaults(), arguments); + (super(t), + (this.name = "Transport"), + (this._loop = new Ro(!1)), + (this._loopStart = 0), + (this._loopEnd = 0), + (this._scheduledEvents = {}), + (this._timeline = new wi()), + (this._repeatedEvents = new Mo()), + (this._syncedSignals = []), + (this._swingAmount = 0), + (this._ppq = t.ppq), + (this._clock = new vo({ + callback: this._processTick.bind(this), + context: this.context, + frequency: 0, + units: "bpm", + })), + this._bindClockEvents(), + (this.bpm = this._clock.frequency), + (this._clock.frequency.multiplier = t.ppq), + this.bpm.setValueAtTime(t.bpm, 0), + Di(this, "bpm"), + (this._timeSignature = t.timeSignature), + (this._swingTicks = t.ppq / 2)); + } + static getDefaults() { + return Object.assign(eo.getDefaults(), { + bpm: 120, + loopEnd: "4m", + loopStart: 0, + ppq: 192, + swing: 0, + swingSubdivision: "8n", + timeSignature: 4, + }); + } + _processTick(t, e) { + if ( + (this._loop.get(t) && + e >= this._loopEnd && + (this.emit("loopEnd", t), + this._clock.setTicksAtTime(this._loopStart, t), + (e = this._loopStart), + this.emit("loopStart", t, this._clock.getSecondsAtTime(t)), + this.emit("loop", t)), + this._swingAmount > 0 && + e % this._ppq != 0 && + e % (2 * this._swingTicks) != 0) + ) { + const s = (e % (2 * this._swingTicks)) / (2 * this._swingTicks), + n = Math.sin(s * Math.PI) * this._swingAmount; + t += + new Co(this.context, (2 * this._swingTicks) / 3).toSeconds() * + n; + } + (Xn(!0), + this._timeline.forEachAtTime(e, (e) => e.invoke(t)), + Xn(!1)); + } + schedule(t, e) { + const s = new Vo(this, { + callback: t, + time: new Ki(this.context, e).toTicks(), + }); + return this._addEvent(s, this._timeline); + } + scheduleRepeat(t, e, s, n = 1 / 0) { + const i = new No(this, { + callback: t, + duration: new Zi(this.context, n).toTicks(), + interval: new Zi(this.context, e).toTicks(), + time: new Ki(this.context, s).toTicks(), + }); + return this._addEvent(i, this._repeatedEvents); + } + scheduleOnce(t, e) { + const s = new Vo(this, { + callback: t, + once: !0, + time: new Ki(this.context, e).toTicks(), + }); + return this._addEvent(s, this._timeline); + } + clear(t) { + if (this._scheduledEvents.hasOwnProperty(t)) { + const e = this._scheduledEvents[t.toString()]; + (e.timeline.remove(e.event), + e.event.dispose(), + delete this._scheduledEvents[t.toString()]); + } + return this; + } + _addEvent(t, e) { + return ( + (this._scheduledEvents[t.id.toString()] = { + event: t, + timeline: e, + }), + e.add(t), + t.id + ); + } + cancel(t = 0) { + const e = this.toTicks(t); + return ( + this._timeline.forEachFrom(e, (t) => this.clear(t.id)), + this._repeatedEvents.forEachFrom(e, (t) => this.clear(t.id)), + this + ); + } + _bindClockEvents() { + (this._clock.on("start", (t, e) => { + ((e = new Co(this.context, e).toSeconds()), + this.emit("start", t, e)); + }), + this._clock.on("stop", (t) => { + this.emit("stop", t); + }), + this._clock.on("pause", (t) => { + this.emit("pause", t); + })); + } + get state() { + return this._clock.getStateAtTime(this.now()); + } + start(t, e) { + let s; + return ( + this.context.resume(), + Fn(e) && (s = this.toTicks(e)), + this._clock.start(t, s), + this + ); + } + stop(t) { + return (this._clock.stop(t), this); + } + pause(t) { + return (this._clock.pause(t), this); + } + toggle(t) { + return ( + (t = this.toSeconds(t)), + "started" !== this._clock.getStateAtTime(t) + ? this.start(t) + : this.stop(t), + this + ); + } + get timeSignature() { + return this._timeSignature; + } + set timeSignature(t) { + (Ln(t) && (t = (t[0] / t[1]) * 4), (this._timeSignature = t)); + } + get loopStart() { + return new Zi(this.context, this._loopStart, "i").toSeconds(); + } + set loopStart(t) { + this._loopStart = this.toTicks(t); + } + get loopEnd() { + return new Zi(this.context, this._loopEnd, "i").toSeconds(); + } + set loopEnd(t) { + this._loopEnd = this.toTicks(t); + } + get loop() { + return this._loop.get(this.now()); + } + set loop(t) { + this._loop.set(t, this.now()); + } + setLoopPoints(t, e) { + return ((this.loopStart = t), (this.loopEnd = e), this); + } + get swing() { + return this._swingAmount; + } + set swing(t) { + this._swingAmount = t; + } + get swingSubdivision() { + return new Co(this.context, this._swingTicks).toNotation(); + } + set swingSubdivision(t) { + this._swingTicks = this.toTicks(t); + } + get position() { + const t = this.now(), + e = this._clock.getTicksAtTime(t); + return new Co(this.context, e).toBarsBeatsSixteenths(); + } + set position(t) { + const e = this.toTicks(t); + this.ticks = e; + } + get seconds() { + return this._clock.seconds; + } + set seconds(t) { + const e = this.now(), + s = this._clock.frequency.timeToTicks(t, e); + this.ticks = s; + } + get progress() { + if (this.loop) { + const t = this.now(); + return ( + (this._clock.getTicksAtTime(t) - this._loopStart) / + (this._loopEnd - this._loopStart) + ); + } + return 0; + } + get ticks() { + return this._clock.ticks; + } + set ticks(t) { + if (this._clock.ticks !== t) { + const e = this.now(); + if ("started" === this.state) { + const s = this._clock.getTicksAtTime(e), + n = + e + + this._clock.frequency.getDurationOfTicks( + Math.ceil(s) - s, + e, + ); + (this.emit("stop", n), + this._clock.setTicksAtTime(t, n), + this.emit("start", n, this._clock.getSecondsAtTime(n))); + } else (this.emit("ticks", e), this._clock.setTicksAtTime(t, e)); + } + } + getTicksAtTime(t) { + return this._clock.getTicksAtTime(t); + } + getSecondsAtTime(t) { + return this._clock.getSecondsAtTime(t); + } + get PPQ() { + return this._clock.frequency.multiplier; + } + set PPQ(t) { + this._clock.frequency.multiplier = t; + } + nextSubdivision(t) { + if (((t = this.toTicks(t)), "started" !== this.state)) return 0; + { + const e = this.now(), + s = t - (this.getTicksAtTime(e) % t); + return this._clock.nextTickTime(s, e); + } + } + syncSignal(t, e) { + const s = this.now(); + let n = this.bpm, + i = 1 / (60 / n.getValueAtTime(s) / this.PPQ), + o = []; + if ("time" === t.units) { + const t = 1 / 64 / i, + e = new ho(t), + s = new Fo(-1), + r = new ho(t); + (n.chain(e, s, r), (n = r), (i = 1 / i), (o = [e, s, r])); + } + e || (e = 0 !== t.getValueAtTime(s) ? t.getValueAtTime(s) / i : 0); + const r = new ho(e); + return ( + n.connect(r), + r.connect(t._param), + o.push(r), + this._syncedSignals.push({ + initial: t.value, + nodes: o, + signal: t, + }), + (t.value = 0), + this + ); + } + unsyncSignal(t) { + for (let e = this._syncedSignals.length - 1; e >= 0; e--) { + const s = this._syncedSignals[e]; + s.signal === t && + (s.nodes.forEach((t) => t.dispose()), + (s.signal.value = s.initial), + this._syncedSignals.splice(e, 1)); + } + return this; + } + dispose() { + return ( + super.dispose(), + this._clock.dispose(), + Mi(this, "bpm"), + this._timeline.dispose(), + this._repeatedEvents.dispose(), + this + ); + } + } + (Ai.mixin(Po), + Ti((t) => { + t.transport = new Po({ + context: t, + }); + }), + ki((t) => { + t.transport.dispose(); + })); + class jo extends io { + constructor(t) { + (super(t), + (this.input = void 0), + (this._state = new so("stopped")), + (this._synced = !1), + (this._scheduled = []), + (this._syncedStart = Ei), + (this._syncedStop = Ei), + (this._state.memory = 100), + (this._state.increasing = !0), + (this._volume = this.output = + new xo({ + context: this.context, + mute: t.mute, + volume: t.volume, + })), + (this.volume = this._volume.volume), + Di(this, "volume"), + (this.onstop = t.onstop)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + mute: !1, + onstop: Ei, + volume: 0, + }); + } + get state() { + return this._synced + ? "started" === this.context.transport.state + ? this._state.getValueAtTime(this.context.transport.seconds) + : "stopped" + : this._state.getValueAtTime(this.now()); + } + get mute() { + return this._volume.mute; + } + set mute(t) { + this._volume.mute = t; + } + _clampToCurrentTime(t) { + return this._synced ? t : Math.max(t, this.context.currentTime); + } + start(t, e, s) { + let n = + In(t) && this._synced + ? this.context.transport.seconds + : this.toSeconds(t); + if ( + ((n = this._clampToCurrentTime(n)), + this._synced || "started" !== this._state.getValueAtTime(n)) + ) + if ( + (this.log("start", n), + this._state.setStateAtTime("started", n), + this._synced) + ) { + const t = this._state.get(n); + t && + ((t.offset = this.toSeconds(pi(e, 0))), + (t.duration = s ? this.toSeconds(s) : void 0)); + const i = this.context.transport.schedule((t) => { + this._start(t, e, s); + }, n); + (this._scheduled.push(i), + "started" === this.context.transport.state && + this.context.transport.getSecondsAtTime(this.immediate()) > + n && + this._syncedStart( + this.now(), + this.context.transport.seconds, + )); + } else (Gn(this.context), this._start(n, e, s)); + else + (Bn( + mi(n, this._state.get(n).time), + "Start time must be strictly greater than previous start time", + ), + this._state.cancel(n), + this._state.setStateAtTime("started", n), + this.log("restart", n), + this.restart(n, e, s)); + return this; + } + stop(t) { + let e = + In(t) && this._synced + ? this.context.transport.seconds + : this.toSeconds(t); + if ( + ((e = this._clampToCurrentTime(e)), + "started" === this._state.getValueAtTime(e) || + Fn(this._state.getNextState("started", e))) + ) { + if ((this.log("stop", e), this._synced)) { + const t = this.context.transport.schedule( + this._stop.bind(this), + e, + ); + this._scheduled.push(t); + } else this._stop(e); + (this._state.cancel(e), this._state.setStateAtTime("stopped", e)); + } + return this; + } + restart(t, e, s) { + return ( + (t = this.toSeconds(t)), + "started" === this._state.getValueAtTime(t) && + (this._state.cancel(t), this._restart(t, e, s)), + this + ); + } + sync() { + return ( + this._synced || + ((this._synced = !0), + (this._syncedStart = (t, e) => { + if (mi(e, 0)) { + const s = this._state.get(e); + if (s && "started" === s.state && s.time !== e) { + const n = e - this.toSeconds(s.time); + let i; + (s.duration && (i = this.toSeconds(s.duration) - n), + this._start(t, this.toSeconds(s.offset) + n, i)); + } + } + }), + (this._syncedStop = (t) => { + const e = this.context.transport.getSecondsAtTime( + Math.max(t - this.sampleTime, 0), + ); + "started" === this._state.getValueAtTime(e) && this._stop(t); + }), + this.context.transport.on("start", this._syncedStart), + this.context.transport.on("loopStart", this._syncedStart), + this.context.transport.on("stop", this._syncedStop), + this.context.transport.on("pause", this._syncedStop), + this.context.transport.on("loopEnd", this._syncedStop)), + this + ); + } + unsync() { + return ( + this._synced && + (this.context.transport.off("stop", this._syncedStop), + this.context.transport.off("pause", this._syncedStop), + this.context.transport.off("loopEnd", this._syncedStop), + this.context.transport.off("start", this._syncedStart), + this.context.transport.off("loopStart", this._syncedStart)), + (this._synced = !1), + this._scheduled.forEach((t) => this.context.transport.clear(t)), + (this._scheduled = []), + this._state.cancel(0), + this._stop(0), + this + ); + } + dispose() { + return ( + super.dispose(), + (this.onstop = Ei), + this.unsync(), + this._volume.dispose(), + this._state.dispose(), + this + ); + } + } + class Lo extends lo { + constructor() { + const t = ui(Lo.getDefaults(), arguments, ["url", "onload"]); + (super(t), + (this.name = "ToneBufferSource"), + (this._source = this.context.createBufferSource()), + (this._internalChannels = [this._source]), + (this._sourceStarted = !1), + (this._sourceStopped = !1), + ro(this._source, this._gainNode), + (this._source.onended = () => this._stopSource()), + (this.playbackRate = new no({ + context: this.context, + param: this._source.playbackRate, + units: "positive", + value: t.playbackRate, + })), + (this.loop = t.loop), + (this.loopStart = t.loopStart), + (this.loopEnd = t.loopEnd), + (this._buffer = new Ri(t.url, t.onload, t.onerror)), + this._internalChannels.push(this._source)); + } + static getDefaults() { + return Object.assign(lo.getDefaults(), { + url: new Ri(), + loop: !1, + loopEnd: 0, + loopStart: 0, + onload: Ei, + onerror: Ei, + playbackRate: 1, + }); + } + get fadeIn() { + return this._fadeIn; + } + set fadeIn(t) { + this._fadeIn = t; + } + get fadeOut() { + return this._fadeOut; + } + set fadeOut(t) { + this._fadeOut = t; + } + get curve() { + return this._curve; + } + set curve(t) { + this._curve = t; + } + start(t, e, s, n = 1) { + Bn(this.buffer.loaded, "buffer is either not set or not loaded"); + const i = this.toSeconds(t); + (this._startGain(i, n), + (e = this.loop ? pi(e, this.loopStart) : pi(e, 0))); + let o = Math.max(this.toSeconds(e), 0); + if (this.loop) { + const t = this.toSeconds(this.loopEnd) || this.buffer.duration, + e = this.toSeconds(this.loopStart), + s = t - e; + (gi(o, t) && (o = ((o - e) % s) + e), + yi(o, this.buffer.duration) && (o = 0)); + } + if ( + ((this._source.buffer = this.buffer.get()), + (this._source.loopEnd = + this.toSeconds(this.loopEnd) || this.buffer.duration), + vi(o, this.buffer.duration) && + ((this._sourceStarted = !0), this._source.start(i, o)), + Fn(s)) + ) { + let t = this.toSeconds(s); + ((t = Math.max(t, 0)), this.stop(i + t)); + } + return this; + } + _stopSource(t) { + !this._sourceStopped && + this._sourceStarted && + ((this._sourceStopped = !0), + this._source.stop(this.toSeconds(t)), + this._onended()); + } + get loopStart() { + return this._source.loopStart; + } + set loopStart(t) { + this._source.loopStart = this.toSeconds(t); + } + get loopEnd() { + return this._source.loopEnd; + } + set loopEnd(t) { + this._source.loopEnd = this.toSeconds(t); + } + get buffer() { + return this._buffer; + } + set buffer(t) { + this._buffer.set(t); + } + get loop() { + return this._source.loop; + } + set loop(t) { + ((this._source.loop = t), this._sourceStarted && this.cancelStop()); + } + dispose() { + return ( + super.dispose(), + (this._source.onended = null), + this._source.disconnect(), + this._buffer.dispose(), + this.playbackRate.dispose(), + this + ); + } + } + class zo extends jo { + constructor() { + const t = ui(zo.getDefaults(), arguments, ["type"]); + (super(t), + (this.name = "Noise"), + (this._source = null), + (this._playbackRate = t.playbackRate), + (this.type = t.type), + (this._fadeIn = t.fadeIn), + (this._fadeOut = t.fadeOut)); + } + static getDefaults() { + return Object.assign(jo.getDefaults(), { + fadeIn: 0, + fadeOut: 0, + playbackRate: 1, + type: "white", + }); + } + get type() { + return this._type; + } + set type(t) { + if ( + (Bn(t in Uo, "Noise: invalid type: " + t), + this._type !== t && ((this._type = t), "started" === this.state)) + ) { + const t = this.now(); + (this._stop(t), this._start(t)); + } + } + get playbackRate() { + return this._playbackRate; + } + set playbackRate(t) { + ((this._playbackRate = t), + this._source && (this._source.playbackRate.value = t)); + } + _start(t) { + const e = Uo[this._type]; + ((this._source = new Lo({ + url: e, + context: this.context, + fadeIn: this._fadeIn, + fadeOut: this._fadeOut, + loop: !0, + onended: () => this.onstop(this), + playbackRate: this._playbackRate, + }).connect(this.output)), + this._source.start( + this.toSeconds(t), + Math.random() * (e.duration - 0.001), + )); + } + _stop(t) { + this._source && + (this._source.stop(this.toSeconds(t)), (this._source = null)); + } + get fadeIn() { + return this._fadeIn; + } + set fadeIn(t) { + ((this._fadeIn = t), + this._source && (this._source.fadeIn = this._fadeIn)); + } + get fadeOut() { + return this._fadeOut; + } + set fadeOut(t) { + ((this._fadeOut = t), + this._source && (this._source.fadeOut = this._fadeOut)); + } + _restart(t) { + (this._stop(t), this._start(t)); + } + dispose() { + return ( + super.dispose(), + this._source && this._source.disconnect(), + this + ); + } + } + const Wo = 220500, + Bo = { + brown: null, + pink: null, + white: null, + }, + Uo = { + get brown() { + if (!Bo.brown) { + const t = []; + for (let e = 0; e < 2; e++) { + const s = new Float32Array(Wo); + t[e] = s; + let n = 0; + for (let t = 0; t < Wo; t++) { + const e = 2 * Math.random() - 1; + ((s[t] = (n + 0.02 * e) / 1.02), (n = s[t]), (s[t] *= 3.5)); + } + } + Bo.brown = new Ri().fromArray(t); + } + return Bo.brown; + }, + get pink() { + if (!Bo.pink) { + const t = []; + for (let e = 0; e < 2; e++) { + const s = new Float32Array(Wo); + let n, i, o, r, a, c, h; + ((t[e] = s), (n = i = o = r = a = c = h = 0)); + for (let t = 0; t < Wo; t++) { + const e = 2 * Math.random() - 1; + ((n = 0.99886 * n + 0.0555179 * e), + (i = 0.99332 * i + 0.0750759 * e), + (o = 0.969 * o + 0.153852 * e), + (r = 0.8665 * r + 0.3104856 * e), + (a = 0.55 * a + 0.5329522 * e), + (c = -0.7616 * c - 0.016898 * e), + (s[t] = n + i + o + r + a + c + h + 0.5362 * e), + (s[t] *= 0.11), + (h = 0.115926 * e)); + } + } + Bo.pink = new Ri().fromArray(t); + } + return Bo.pink; + }, + get white() { + if (!Bo.white) { + const t = []; + for (let e = 0; e < 2; e++) { + const s = new Float32Array(Wo); + t[e] = s; + for (let t = 0; t < Wo; t++) s[t] = 2 * Math.random() - 1; + } + Bo.white = new Ri().fromArray(t); + } + return Bo.white; + }, + }; + class Go extends io { + constructor() { + const t = ui(Go.getDefaults(), arguments, ["volume"]); + (super(t), + (this.name = "UserMedia"), + (this._volume = this.output = + new xo({ + context: this.context, + volume: t.volume, + })), + (this.volume = this._volume.volume), + Di(this, "volume"), + (this.mute = t.mute)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + mute: !1, + volume: 0, + }); + } + open(t) { + return ni(this, void 0, void 0, function* () { + (Bn(Go.supported, "UserMedia is not supported"), + "started" === this.state && this.close()); + const e = yield Go.enumerateDevices(); + Nn(t) + ? (this._device = e[t]) + : ((this._device = e.find( + (e) => e.label === t || e.deviceId === t, + )), + !this._device && e.length > 0 && (this._device = e[0]), + Bn(Fn(this._device), `No matching device ${t}`)); + const s = { + audio: { + echoCancellation: !1, + sampleRate: this.context.sampleRate, + noiseSuppression: !1, + mozNoiseSuppression: !1, + }, + }; + this._device && (s.audio.deviceId = this._device.deviceId); + const n = yield navigator.mediaDevices.getUserMedia(s); + if (!this._stream) { + this._stream = n; + const t = this.context.createMediaStreamSource(n); + (ro(t, this.output), (this._mediaStream = t)); + } + return this; + }); + } + close() { + return ( + this._stream && + this._mediaStream && + (this._stream.getAudioTracks().forEach((t) => { + t.stop(); + }), + (this._stream = void 0), + this._mediaStream.disconnect(), + (this._mediaStream = void 0)), + (this._device = void 0), + this + ); + } + static enumerateDevices() { + return ni(this, void 0, void 0, function* () { + return (yield navigator.mediaDevices.enumerateDevices()).filter( + (t) => "audioinput" === t.kind, + ); + }); + } + get state() { + return this._stream && this._stream.active ? "started" : "stopped"; + } + get deviceId() { + return this._device ? this._device.deviceId : void 0; + } + get groupId() { + return this._device ? this._device.groupId : void 0; + } + get label() { + return this._device ? this._device.label : void 0; + } + get mute() { + return this._volume.mute; + } + set mute(t) { + this._volume.mute = t; + } + dispose() { + return ( + super.dispose(), + this.close(), + this._volume.dispose(), + this.volume.dispose(), + this + ); + } + static get supported() { + return ( + Fn(navigator.mediaDevices) && + Fn(navigator.mediaDevices.getUserMedia) + ); + } + } + + function Qo(t, e) { + return ni(this, void 0, void 0, function* () { + const s = e / t.context.sampleRate, + n = new qi(1, s, t.context.sampleRate); + return ( + new t.constructor( + Object.assign(t.get(), { + frequency: 2 / s, + detune: 0, + context: n, + }), + ) + .toDestination() + .start(0), + (yield n.render()).getChannelData(0) + ); + }); + } + class Zo extends lo { + constructor() { + const t = ui(Zo.getDefaults(), arguments, ["frequency", "type"]); + (super(t), + (this.name = "ToneOscillatorNode"), + (this._oscillator = this.context.createOscillator()), + (this._internalChannels = [this._oscillator]), + ro(this._oscillator, this._gainNode), + (this.type = t.type), + (this.frequency = new no({ + context: this.context, + param: this._oscillator.frequency, + units: "frequency", + value: t.frequency, + })), + (this.detune = new no({ + context: this.context, + param: this._oscillator.detune, + units: "cents", + value: t.detune, + })), + Di(this, ["frequency", "detune"])); + } + static getDefaults() { + return Object.assign(lo.getDefaults(), { + detune: 0, + frequency: 440, + type: "sine", + }); + } + start(t) { + const e = this.toSeconds(t); + return ( + this.log("start", e), + this._startGain(e), + this._oscillator.start(e), + this + ); + } + _stopSource(t) { + this._oscillator.stop(t); + } + setPeriodicWave(t) { + return (this._oscillator.setPeriodicWave(t), this); + } + get type() { + return this._oscillator.type; + } + set type(t) { + this._oscillator.type = t; + } + dispose() { + return ( + super.dispose(), + "started" === this.state && this.stop(), + this._oscillator.disconnect(), + this.frequency.dispose(), + this.detune.dispose(), + this + ); + } + } + class Xo extends jo { + constructor() { + const t = ui(Xo.getDefaults(), arguments, ["frequency", "type"]); + (super(t), + (this.name = "Oscillator"), + (this._oscillator = null), + (this.frequency = new po({ + context: this.context, + units: "frequency", + value: t.frequency, + })), + Di(this, "frequency"), + (this.detune = new po({ + context: this.context, + units: "cents", + value: t.detune, + })), + Di(this, "detune"), + (this._partials = t.partials), + (this._partialCount = t.partialCount), + (this._type = t.type), + t.partialCount && + "custom" !== t.type && + (this._type = this.baseType + t.partialCount.toString()), + (this.phase = t.phase)); + } + static getDefaults() { + return Object.assign(jo.getDefaults(), { + detune: 0, + frequency: 440, + partialCount: 0, + partials: [], + phase: 0, + type: "sine", + }); + } + _start(t) { + const e = this.toSeconds(t), + s = new Zo({ + context: this.context, + onended: () => this.onstop(this), + }); + ((this._oscillator = s), + this._wave + ? this._oscillator.setPeriodicWave(this._wave) + : (this._oscillator.type = this._type), + this._oscillator.connect(this.output), + this.frequency.connect(this._oscillator.frequency), + this.detune.connect(this._oscillator.detune), + this._oscillator.start(e)); + } + _stop(t) { + const e = this.toSeconds(t); + this._oscillator && this._oscillator.stop(e); + } + _restart(t) { + const e = this.toSeconds(t); + return ( + this.log("restart", e), + this._oscillator && this._oscillator.cancelStop(), + this._state.cancel(e), + this + ); + } + syncFrequency() { + return (this.context.transport.syncSignal(this.frequency), this); + } + unsyncFrequency() { + return (this.context.transport.unsyncSignal(this.frequency), this); + } + _getCachedPeriodicWave() { + if ("custom" === this._type) + return Xo._periodicWaveCache.find((t) => { + return ( + t.phase === this._phase && + ((e = t.partials), + (s = this._partials), + e.length === s.length && e.every((t, e) => s[e] === t)) + ); + var e, s; + }); + { + const t = Xo._periodicWaveCache.find( + (t) => t.type === this._type && t.phase === this._phase, + ); + return ( + (this._partialCount = t ? t.partialCount : this._partialCount), + t + ); + } + } + get type() { + return this._type; + } + set type(t) { + this._type = t; + const e = + -1 !== ["sine", "square", "sawtooth", "triangle"].indexOf(t); + if (0 === this._phase && e) + ((this._wave = void 0), + (this._partialCount = 0), + null !== this._oscillator && (this._oscillator.type = t)); + else { + const e = this._getCachedPeriodicWave(); + if (Fn(e)) { + const { partials: t, wave: s } = e; + ((this._wave = s), + (this._partials = t), + null !== this._oscillator && + this._oscillator.setPeriodicWave(this._wave)); + } else { + const [e, s] = this._getRealImaginary(t, this._phase), + n = this.context.createPeriodicWave(e, s); + ((this._wave = n), + null !== this._oscillator && + this._oscillator.setPeriodicWave(this._wave), + Xo._periodicWaveCache.push({ + imag: s, + partialCount: this._partialCount, + partials: this._partials, + phase: this._phase, + real: e, + type: this._type, + wave: this._wave, + }), + Xo._periodicWaveCache.length > 100 && + Xo._periodicWaveCache.shift()); + } + } + } + get baseType() { + return this._type.replace(this.partialCount.toString(), ""); + } + set baseType(t) { + this.partialCount && "custom" !== this._type && "custom" !== t + ? (this.type = t + this.partialCount) + : (this.type = t); + } + get partialCount() { + return this._partialCount; + } + set partialCount(t) { + Un(t, 0); + let e = this._type; + const s = /^(sine|triangle|square|sawtooth)(\d+)$/.exec(this._type); + if ((s && (e = s[1]), "custom" !== this._type)) + this.type = 0 === t ? e : e + t.toString(); + else { + const e = new Float32Array(t); + (this._partials.forEach((t, s) => (e[s] = t)), + (this._partials = Array.from(e)), + (this.type = this._type)); + } + } + _getRealImaginary(t, e) { + let s = 2048; + const n = new Float32Array(s), + i = new Float32Array(s); + let o = 1; + if ("custom" === t) { + if ( + ((o = this._partials.length + 1), + (this._partialCount = this._partials.length), + (s = o), + 0 === this._partials.length) + ) + return [n, i]; + } else { + const e = /^(sine|triangle|square|sawtooth)(\d+)$/.exec(t); + (e + ? ((o = parseInt(e[2], 10) + 1), + (this._partialCount = parseInt(e[2], 10)), + (t = e[1]), + (o = Math.max(o, 2)), + (s = o)) + : (this._partialCount = 0), + (this._partials = [])); + } + for (let r = 1; r < s; ++r) { + const s = 2 / (r * Math.PI); + let a; + switch (t) { + case "sine": + ((a = r <= o ? 1 : 0), (this._partials[r - 1] = a)); + break; + case "square": + ((a = 1 & r ? 2 * s : 0), (this._partials[r - 1] = a)); + break; + case "sawtooth": + ((a = s * (1 & r ? 1 : -1)), (this._partials[r - 1] = a)); + break; + case "triangle": + ((a = 1 & r ? s * s * 2 * (((r - 1) >> 1) & 1 ? -1 : 1) : 0), + (this._partials[r - 1] = a)); + break; + case "custom": + a = this._partials[r - 1]; + break; + default: + throw new TypeError("Oscillator: invalid type: " + t); + } + 0 !== a + ? ((n[r] = -a * Math.sin(e * r)), (i[r] = a * Math.cos(e * r))) + : ((n[r] = 0), (i[r] = 0)); + } + return [n, i]; + } + _inverseFFT(t, e, s) { + let n = 0; + const i = t.length; + for (let o = 0; o < i; o++) + n += t[o] * Math.cos(o * s) + e[o] * Math.sin(o * s); + return n; + } + getInitialValue() { + const [t, e] = this._getRealImaginary(this._type, 0); + let s = 0; + const n = 2 * Math.PI; + for (let i = 0; i < 32; i++) + s = Math.max(this._inverseFFT(t, e, (i / 32) * n), s); + return xi(-this._inverseFFT(t, e, this._phase) / s, -1, 1); + } + get partials() { + return this._partials.slice(0, this.partialCount); + } + set partials(t) { + ((this._partials = t), + (this._partialCount = this._partials.length), + t.length && (this.type = "custom")); + } + get phase() { + return this._phase * (180 / Math.PI); + } + set phase(t) { + ((this._phase = (t * Math.PI) / 180), (this.type = this._type)); + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + return Qo(this, t); + }); + } + dispose() { + return ( + super.dispose(), + null !== this._oscillator && this._oscillator.dispose(), + (this._wave = void 0), + this.frequency.dispose(), + this.detune.dispose(), + this + ); + } + } + Xo._periodicWaveCache = []; + class Yo extends qo { + constructor() { + (super(...arguments), + (this.name = "AudioToGain"), + (this._norm = new Io({ + context: this.context, + mapping: (t) => (t + 1) / 2, + })), + (this.input = this._norm), + (this.output = this._norm)); + } + dispose() { + return (super.dispose(), this._norm.dispose(), this); + } + } + class $o extends po { + constructor() { + const t = ui($o.getDefaults(), arguments, ["value"]); + (super(t), + (this.name = "Multiply"), + (this.override = !1), + (this._mult = + this.input = + this.output = + new ho({ + context: this.context, + minValue: t.minValue, + maxValue: t.maxValue, + })), + (this.factor = this._param = this._mult.gain), + this.factor.setValueAtTime(t.value, 0)); + } + static getDefaults() { + return Object.assign(po.getDefaults(), { + value: 0, + }); + } + dispose() { + return (super.dispose(), this._mult.dispose(), this); + } + } + class Ho extends jo { + constructor() { + const t = ui(Ho.getDefaults(), arguments, [ + "frequency", + "type", + "modulationType", + ]); + (super(t), + (this.name = "AMOscillator"), + (this._modulationScale = new Yo({ + context: this.context, + })), + (this._modulationNode = new ho({ + context: this.context, + })), + (this._carrier = new Xo({ + context: this.context, + detune: t.detune, + frequency: t.frequency, + onstop: () => this.onstop(this), + phase: t.phase, + type: t.type, + })), + (this.frequency = this._carrier.frequency), + (this.detune = this._carrier.detune), + (this._modulator = new Xo({ + context: this.context, + phase: t.phase, + type: t.modulationType, + })), + (this.harmonicity = new $o({ + context: this.context, + units: "positive", + value: t.harmonicity, + })), + this.frequency.chain(this.harmonicity, this._modulator.frequency), + this._modulator.chain( + this._modulationScale, + this._modulationNode.gain, + ), + this._carrier.chain(this._modulationNode, this.output), + Di(this, ["frequency", "detune", "harmonicity"])); + } + static getDefaults() { + return Object.assign(Xo.getDefaults(), { + harmonicity: 1, + modulationType: "square", + }); + } + _start(t) { + (this._modulator.start(t), this._carrier.start(t)); + } + _stop(t) { + (this._modulator.stop(t), this._carrier.stop(t)); + } + _restart(t) { + (this._modulator.restart(t), this._carrier.restart(t)); + } + get type() { + return this._carrier.type; + } + set type(t) { + this._carrier.type = t; + } + get baseType() { + return this._carrier.baseType; + } + set baseType(t) { + this._carrier.baseType = t; + } + get partialCount() { + return this._carrier.partialCount; + } + set partialCount(t) { + this._carrier.partialCount = t; + } + get modulationType() { + return this._modulator.type; + } + set modulationType(t) { + this._modulator.type = t; + } + get phase() { + return this._carrier.phase; + } + set phase(t) { + ((this._carrier.phase = t), (this._modulator.phase = t)); + } + get partials() { + return this._carrier.partials; + } + set partials(t) { + this._carrier.partials = t; + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + return Qo(this, t); + }); + } + dispose() { + return ( + super.dispose(), + this.frequency.dispose(), + this.detune.dispose(), + this.harmonicity.dispose(), + this._carrier.dispose(), + this._modulator.dispose(), + this._modulationNode.dispose(), + this._modulationScale.dispose(), + this + ); + } + } + class Jo extends jo { + constructor() { + const t = ui(Jo.getDefaults(), arguments, [ + "frequency", + "type", + "modulationType", + ]); + (super(t), + (this.name = "FMOscillator"), + (this._modulationNode = new ho({ + context: this.context, + gain: 0, + })), + (this._carrier = new Xo({ + context: this.context, + detune: t.detune, + frequency: 0, + onstop: () => this.onstop(this), + phase: t.phase, + type: t.type, + })), + (this.detune = this._carrier.detune), + (this.frequency = new po({ + context: this.context, + units: "frequency", + value: t.frequency, + })), + (this._modulator = new Xo({ + context: this.context, + phase: t.phase, + type: t.modulationType, + })), + (this.harmonicity = new $o({ + context: this.context, + units: "positive", + value: t.harmonicity, + })), + (this.modulationIndex = new $o({ + context: this.context, + units: "positive", + value: t.modulationIndex, + })), + this.frequency.connect(this._carrier.frequency), + this.frequency.chain(this.harmonicity, this._modulator.frequency), + this.frequency.chain(this.modulationIndex, this._modulationNode), + this._modulator.connect(this._modulationNode.gain), + this._modulationNode.connect(this._carrier.frequency), + this._carrier.connect(this.output), + this.detune.connect(this._modulator.detune), + Di(this, [ + "modulationIndex", + "frequency", + "detune", + "harmonicity", + ])); + } + static getDefaults() { + return Object.assign(Xo.getDefaults(), { + harmonicity: 1, + modulationIndex: 2, + modulationType: "square", + }); + } + _start(t) { + (this._modulator.start(t), this._carrier.start(t)); + } + _stop(t) { + (this._modulator.stop(t), this._carrier.stop(t)); + } + _restart(t) { + return (this._modulator.restart(t), this._carrier.restart(t), this); + } + get type() { + return this._carrier.type; + } + set type(t) { + this._carrier.type = t; + } + get baseType() { + return this._carrier.baseType; + } + set baseType(t) { + this._carrier.baseType = t; + } + get partialCount() { + return this._carrier.partialCount; + } + set partialCount(t) { + this._carrier.partialCount = t; + } + get modulationType() { + return this._modulator.type; + } + set modulationType(t) { + this._modulator.type = t; + } + get phase() { + return this._carrier.phase; + } + set phase(t) { + ((this._carrier.phase = t), (this._modulator.phase = t)); + } + get partials() { + return this._carrier.partials; + } + set partials(t) { + this._carrier.partials = t; + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + return Qo(this, t); + }); + } + dispose() { + return ( + super.dispose(), + this.frequency.dispose(), + this.harmonicity.dispose(), + this._carrier.dispose(), + this._modulator.dispose(), + this._modulationNode.dispose(), + this.modulationIndex.dispose(), + this + ); + } + } + class Ko extends jo { + constructor() { + const t = ui(Ko.getDefaults(), arguments, ["frequency", "width"]); + (super(t), + (this.name = "PulseOscillator"), + (this._widthGate = new ho({ + context: this.context, + gain: 0, + })), + (this._thresh = new Io({ + context: this.context, + mapping: (t) => (t <= 0 ? -1 : 1), + })), + (this.width = new po({ + context: this.context, + units: "audioRange", + value: t.width, + })), + (this._triangle = new Xo({ + context: this.context, + detune: t.detune, + frequency: t.frequency, + onstop: () => this.onstop(this), + phase: t.phase, + type: "triangle", + })), + (this.frequency = this._triangle.frequency), + (this.detune = this._triangle.detune), + this._triangle.chain(this._thresh, this.output), + this.width.chain(this._widthGate, this._thresh), + Di(this, ["width", "frequency", "detune"])); + } + static getDefaults() { + return Object.assign(jo.getDefaults(), { + detune: 0, + frequency: 440, + phase: 0, + type: "pulse", + width: 0.2, + }); + } + _start(t) { + ((t = this.toSeconds(t)), + this._triangle.start(t), + this._widthGate.gain.setValueAtTime(1, t)); + } + _stop(t) { + ((t = this.toSeconds(t)), + this._triangle.stop(t), + this._widthGate.gain.cancelScheduledValues(t), + this._widthGate.gain.setValueAtTime(0, t)); + } + _restart(t) { + (this._triangle.restart(t), + this._widthGate.gain.cancelScheduledValues(t), + this._widthGate.gain.setValueAtTime(1, t)); + } + get phase() { + return this._triangle.phase; + } + set phase(t) { + this._triangle.phase = t; + } + get type() { + return "pulse"; + } + get baseType() { + return "pulse"; + } + get partials() { + return []; + } + get partialCount() { + return 0; + } + set carrierType(t) { + this._triangle.type = t; + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + return Qo(this, t); + }); + } + dispose() { + return ( + super.dispose(), + this._triangle.dispose(), + this.width.dispose(), + this._widthGate.dispose(), + this._thresh.dispose(), + this + ); + } + } + class tr extends jo { + constructor() { + const t = ui(tr.getDefaults(), arguments, [ + "frequency", + "type", + "spread", + ]); + (super(t), + (this.name = "FatOscillator"), + (this._oscillators = []), + (this.frequency = new po({ + context: this.context, + units: "frequency", + value: t.frequency, + })), + (this.detune = new po({ + context: this.context, + units: "cents", + value: t.detune, + })), + (this._spread = t.spread), + (this._type = t.type), + (this._phase = t.phase), + (this._partials = t.partials), + (this._partialCount = t.partialCount), + (this.count = t.count), + Di(this, ["frequency", "detune"])); + } + static getDefaults() { + return Object.assign(Xo.getDefaults(), { + count: 3, + spread: 20, + type: "sawtooth", + }); + } + _start(t) { + ((t = this.toSeconds(t)), this._forEach((e) => e.start(t))); + } + _stop(t) { + ((t = this.toSeconds(t)), this._forEach((e) => e.stop(t))); + } + _restart(t) { + this._forEach((e) => e.restart(t)); + } + _forEach(t) { + for (let e = 0; e < this._oscillators.length; e++) + t(this._oscillators[e], e); + } + get type() { + return this._type; + } + set type(t) { + ((this._type = t), this._forEach((e) => (e.type = t))); + } + get spread() { + return this._spread; + } + set spread(t) { + if (((this._spread = t), this._oscillators.length > 1)) { + const e = -t / 2, + s = t / (this._oscillators.length - 1); + this._forEach((t, n) => (t.detune.value = e + s * n)); + } + } + get count() { + return this._oscillators.length; + } + set count(t) { + if ((Un(t, 1), this._oscillators.length !== t)) { + (this._forEach((t) => t.dispose()), (this._oscillators = [])); + for (let e = 0; e < t; e++) { + const s = new Xo({ + context: this.context, + volume: -6 - 1.1 * t, + type: this._type, + phase: this._phase + (e / t) * 360, + partialCount: this._partialCount, + onstop: 0 === e ? () => this.onstop(this) : Ei, + }); + ("custom" === this.type && (s.partials = this._partials), + this.frequency.connect(s.frequency), + this.detune.connect(s.detune), + (s.detune.overridden = !1), + s.connect(this.output), + (this._oscillators[e] = s)); + } + ((this.spread = this._spread), + "started" === this.state && this._forEach((t) => t.start())); + } + } + get phase() { + return this._phase; + } + set phase(t) { + ((this._phase = t), + this._forEach( + (t, e) => (t.phase = this._phase + (e / this.count) * 360), + )); + } + get baseType() { + return this._oscillators[0].baseType; + } + set baseType(t) { + (this._forEach((e) => (e.baseType = t)), + (this._type = this._oscillators[0].type)); + } + get partials() { + return this._oscillators[0].partials; + } + set partials(t) { + ((this._partials = t), + (this._partialCount = this._partials.length), + t.length && + ((this._type = "custom"), + this._forEach((e) => (e.partials = t)))); + } + get partialCount() { + return this._oscillators[0].partialCount; + } + set partialCount(t) { + ((this._partialCount = t), + this._forEach((e) => (e.partialCount = t)), + (this._type = this._oscillators[0].type)); + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + return Qo(this, t); + }); + } + dispose() { + return ( + super.dispose(), + this.frequency.dispose(), + this.detune.dispose(), + this._forEach((t) => t.dispose()), + this + ); + } + } + class er extends jo { + constructor() { + const t = ui(er.getDefaults(), arguments, [ + "frequency", + "modulationFrequency", + ]); + (super(t), + (this.name = "PWMOscillator"), + (this.sourceType = "pwm"), + (this._scale = new $o({ + context: this.context, + value: 2, + })), + (this._pulse = new Ko({ + context: this.context, + frequency: t.modulationFrequency, + })), + (this._pulse.carrierType = "sine"), + (this.modulationFrequency = this._pulse.frequency), + (this._modulator = new Xo({ + context: this.context, + detune: t.detune, + frequency: t.frequency, + onstop: () => this.onstop(this), + phase: t.phase, + })), + (this.frequency = this._modulator.frequency), + (this.detune = this._modulator.detune), + this._modulator.chain(this._scale, this._pulse.width), + this._pulse.connect(this.output), + Di(this, ["modulationFrequency", "frequency", "detune"])); + } + static getDefaults() { + return Object.assign(jo.getDefaults(), { + detune: 0, + frequency: 440, + modulationFrequency: 0.4, + phase: 0, + type: "pwm", + }); + } + _start(t) { + ((t = this.toSeconds(t)), + this._modulator.start(t), + this._pulse.start(t)); + } + _stop(t) { + ((t = this.toSeconds(t)), + this._modulator.stop(t), + this._pulse.stop(t)); + } + _restart(t) { + (this._modulator.restart(t), this._pulse.restart(t)); + } + get type() { + return "pwm"; + } + get baseType() { + return "pwm"; + } + get partials() { + return []; + } + get partialCount() { + return 0; + } + get phase() { + return this._modulator.phase; + } + set phase(t) { + this._modulator.phase = t; + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + return Qo(this, t); + }); + } + dispose() { + return ( + super.dispose(), + this._pulse.dispose(), + this._scale.dispose(), + this._modulator.dispose(), + this + ); + } + } + const sr = { + am: Ho, + fat: tr, + fm: Jo, + oscillator: Xo, + pulse: Ko, + pwm: er, + }; + class nr extends jo { + constructor() { + const t = ui(nr.getDefaults(), arguments, ["frequency", "type"]); + (super(t), + (this.name = "OmniOscillator"), + (this.frequency = new po({ + context: this.context, + units: "frequency", + value: t.frequency, + })), + (this.detune = new po({ + context: this.context, + units: "cents", + value: t.detune, + })), + Di(this, ["frequency", "detune"]), + this.set(t)); + } + static getDefaults() { + return Object.assign( + Xo.getDefaults(), + Jo.getDefaults(), + Ho.getDefaults(), + tr.getDefaults(), + Ko.getDefaults(), + er.getDefaults(), + ); + } + _start(t) { + this._oscillator.start(t); + } + _stop(t) { + this._oscillator.stop(t); + } + _restart(t) { + return (this._oscillator.restart(t), this); + } + get type() { + let t = ""; + return ( + ["am", "fm", "fat"].some((t) => this._sourceType === t) && + (t = this._sourceType), + t + this._oscillator.type + ); + } + set type(t) { + "fm" === t.substr(0, 2) + ? (this._createNewOscillator("fm"), + (this._oscillator = this._oscillator), + (this._oscillator.type = t.substr(2))) + : "am" === t.substr(0, 2) + ? (this._createNewOscillator("am"), + (this._oscillator = this._oscillator), + (this._oscillator.type = t.substr(2))) + : "fat" === t.substr(0, 3) + ? (this._createNewOscillator("fat"), + (this._oscillator = this._oscillator), + (this._oscillator.type = t.substr(3))) + : "pwm" === t + ? (this._createNewOscillator("pwm"), + (this._oscillator = this._oscillator)) + : "pulse" === t + ? this._createNewOscillator("pulse") + : (this._createNewOscillator("oscillator"), + (this._oscillator = this._oscillator), + (this._oscillator.type = t)); + } + get partials() { + return this._oscillator.partials; + } + set partials(t) { + this._getOscType(this._oscillator, "pulse") || + this._getOscType(this._oscillator, "pwm") || + (this._oscillator.partials = t); + } + get partialCount() { + return this._oscillator.partialCount; + } + set partialCount(t) { + this._getOscType(this._oscillator, "pulse") || + this._getOscType(this._oscillator, "pwm") || + (this._oscillator.partialCount = t); + } + set(t) { + return ( + Reflect.has(t, "type") && t.type && (this.type = t.type), + super.set(t), + this + ); + } + _createNewOscillator(t) { + if (t !== this._sourceType) { + this._sourceType = t; + const e = sr[t], + s = this.now(); + if (this._oscillator) { + const t = this._oscillator; + (t.stop(s), + this.context.setTimeout(() => t.dispose(), this.blockTime)); + } + ((this._oscillator = new e({ + context: this.context, + })), + this.frequency.connect(this._oscillator.frequency), + this.detune.connect(this._oscillator.detune), + this._oscillator.connect(this.output), + (this._oscillator.onstop = () => this.onstop(this)), + "started" === this.state && this._oscillator.start(s)); + } + } + get phase() { + return this._oscillator.phase; + } + set phase(t) { + this._oscillator.phase = t; + } + get sourceType() { + return this._sourceType; + } + set sourceType(t) { + let e = "sine"; + ("pwm" !== this._oscillator.type && + "pulse" !== this._oscillator.type && + (e = this._oscillator.type), + "fm" === t + ? (this.type = "fm" + e) + : "am" === t + ? (this.type = "am" + e) + : "fat" === t + ? (this.type = "fat" + e) + : "oscillator" === t + ? (this.type = e) + : "pulse" === t + ? (this.type = "pulse") + : "pwm" === t && (this.type = "pwm")); + } + _getOscType(t, e) { + return t instanceof sr[e]; + } + get baseType() { + return this._oscillator.baseType; + } + set baseType(t) { + this._getOscType(this._oscillator, "pulse") || + this._getOscType(this._oscillator, "pwm") || + "pulse" === t || + "pwm" === t || + (this._oscillator.baseType = t); + } + get width() { + return this._getOscType(this._oscillator, "pulse") + ? this._oscillator.width + : void 0; + } + get count() { + return this._getOscType(this._oscillator, "fat") + ? this._oscillator.count + : void 0; + } + set count(t) { + this._getOscType(this._oscillator, "fat") && + Nn(t) && + (this._oscillator.count = t); + } + get spread() { + return this._getOscType(this._oscillator, "fat") + ? this._oscillator.spread + : void 0; + } + set spread(t) { + this._getOscType(this._oscillator, "fat") && + Nn(t) && + (this._oscillator.spread = t); + } + get modulationType() { + return this._getOscType(this._oscillator, "fm") || + this._getOscType(this._oscillator, "am") + ? this._oscillator.modulationType + : void 0; + } + set modulationType(t) { + (this._getOscType(this._oscillator, "fm") || + this._getOscType(this._oscillator, "am")) && + zn(t) && + (this._oscillator.modulationType = t); + } + get modulationIndex() { + return this._getOscType(this._oscillator, "fm") + ? this._oscillator.modulationIndex + : void 0; + } + get harmonicity() { + return this._getOscType(this._oscillator, "fm") || + this._getOscType(this._oscillator, "am") + ? this._oscillator.harmonicity + : void 0; + } + get modulationFrequency() { + return this._getOscType(this._oscillator, "pwm") + ? this._oscillator.modulationFrequency + : void 0; + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + return Qo(this, t); + }); + } + dispose() { + return ( + super.dispose(), + this.detune.dispose(), + this.frequency.dispose(), + this._oscillator.dispose(), + this + ); + } + } + class ir extends po { + constructor() { + (super(ui(ir.getDefaults(), arguments, ["value"])), + (this.override = !1), + (this.name = "Add"), + (this._sum = new ho({ + context: this.context, + })), + (this.input = this._sum), + (this.output = this._sum), + (this.addend = this._param), + oo(this._constantSource, this._sum)); + } + static getDefaults() { + return Object.assign(po.getDefaults(), { + value: 0, + }); + } + dispose() { + return (super.dispose(), this._sum.dispose(), this); + } + } + class or extends qo { + constructor() { + const t = ui(or.getDefaults(), arguments, ["min", "max"]); + (super(t), + (this.name = "Scale"), + (this._mult = this.input = + new $o({ + context: this.context, + value: t.max - t.min, + })), + (this._add = this.output = + new ir({ + context: this.context, + value: t.min, + })), + (this._min = t.min), + (this._max = t.max), + this.input.connect(this.output)); + } + static getDefaults() { + return Object.assign(qo.getDefaults(), { + max: 1, + min: 0, + }); + } + get min() { + return this._min; + } + set min(t) { + ((this._min = t), this._setRange()); + } + get max() { + return this._max; + } + set max(t) { + ((this._max = t), this._setRange()); + } + _setRange() { + ((this._add.value = this._min), + (this._mult.value = this._max - this._min)); + } + dispose() { + return ( + super.dispose(), + this._add.dispose(), + this._mult.dispose(), + this + ); + } + } + class rr extends qo { + constructor() { + (super(ui(rr.getDefaults(), arguments)), + (this.name = "Zero"), + (this._gain = new ho({ + context: this.context, + })), + (this.output = this._gain), + (this.input = void 0), + ro(this.context.getConstant(0), this._gain)); + } + dispose() { + return ( + super.dispose(), + ao(this.context.getConstant(0), this._gain), + this + ); + } + } + class ar extends io { + constructor() { + const t = ui(ar.getDefaults(), arguments, [ + "frequency", + "min", + "max", + ]); + (super(t), + (this.name = "LFO"), + (this._stoppedValue = 0), + (this._units = "number"), + (this.convert = !0), + (this._fromType = no.prototype._fromType), + (this._toType = no.prototype._toType), + (this._is = no.prototype._is), + (this._clampValue = no.prototype._clampValue), + (this._oscillator = new Xo(t)), + (this.frequency = this._oscillator.frequency), + (this._amplitudeGain = new ho({ + context: this.context, + gain: t.amplitude, + units: "normalRange", + })), + (this.amplitude = this._amplitudeGain.gain), + (this._stoppedSignal = new po({ + context: this.context, + units: "audioRange", + value: 0, + })), + (this._zeros = new rr({ + context: this.context, + })), + (this._a2g = new Yo({ + context: this.context, + })), + (this._scaler = this.output = + new or({ + context: this.context, + max: t.max, + min: t.min, + })), + (this.units = t.units), + (this.min = t.min), + (this.max = t.max), + this._oscillator.chain( + this._amplitudeGain, + this._a2g, + this._scaler, + ), + this._zeros.connect(this._a2g), + this._stoppedSignal.connect(this._a2g), + Di(this, ["amplitude", "frequency"]), + (this.phase = t.phase)); + } + static getDefaults() { + return Object.assign(Xo.getDefaults(), { + amplitude: 1, + frequency: "4n", + max: 1, + min: 0, + type: "sine", + units: "number", + }); + } + start(t) { + return ( + (t = this.toSeconds(t)), + this._stoppedSignal.setValueAtTime(0, t), + this._oscillator.start(t), + this + ); + } + stop(t) { + return ( + (t = this.toSeconds(t)), + this._stoppedSignal.setValueAtTime(this._stoppedValue, t), + this._oscillator.stop(t), + this + ); + } + sync() { + return ( + this._oscillator.sync(), + this._oscillator.syncFrequency(), + this + ); + } + unsync() { + return ( + this._oscillator.unsync(), + this._oscillator.unsyncFrequency(), + this + ); + } + _setStoppedValue() { + ((this._stoppedValue = this._oscillator.getInitialValue()), + (this._stoppedSignal.value = this._stoppedValue)); + } + get min() { + return this._toType(this._scaler.min); + } + set min(t) { + ((t = this._fromType(t)), (this._scaler.min = t)); + } + get max() { + return this._toType(this._scaler.max); + } + set max(t) { + ((t = this._fromType(t)), (this._scaler.max = t)); + } + get type() { + return this._oscillator.type; + } + set type(t) { + ((this._oscillator.type = t), this._setStoppedValue()); + } + get partials() { + return this._oscillator.partials; + } + set partials(t) { + ((this._oscillator.partials = t), this._setStoppedValue()); + } + get phase() { + return this._oscillator.phase; + } + set phase(t) { + ((this._oscillator.phase = t), this._setStoppedValue()); + } + get units() { + return this._units; + } + set units(t) { + const e = this.min, + s = this.max; + ((this._units = t), (this.min = e), (this.max = s)); + } + get state() { + return this._oscillator.state; + } + connect(t, e, s) { + return ( + (t instanceof no || t instanceof po) && + ((this.convert = t.convert), (this.units = t.units)), + fo(this, t, e, s), + this + ); + } + dispose() { + return ( + super.dispose(), + this._oscillator.dispose(), + this._stoppedSignal.dispose(), + this._zeros.dispose(), + this._scaler.dispose(), + this._a2g.dispose(), + this._amplitudeGain.dispose(), + this.amplitude.dispose(), + this + ); + } + } + + function cr(t, e = 1 / 0) { + const s = new WeakMap(); + return function (n, i) { + Reflect.defineProperty(n, i, { + configurable: !0, + enumerable: !0, + get: function () { + return s.get(this); + }, + set: function (n) { + (Un(n, t, e), s.set(this, n)); + }, + }); + }; + } + + function hr(t, e = 1 / 0) { + const s = new WeakMap(); + return function (n, i) { + Reflect.defineProperty(n, i, { + configurable: !0, + enumerable: !0, + get: function () { + return s.get(this); + }, + set: function (n) { + (Un(this.toSeconds(n), t, e), s.set(this, n)); + }, + }); + }; + } + class lr extends jo { + constructor() { + const t = ui(lr.getDefaults(), arguments, ["url", "onload"]); + (super(t), + (this.name = "Player"), + (this._activeSources = new Set()), + (this._buffer = new Ri({ + onload: this._onload.bind(this, t.onload), + onerror: t.onerror, + reverse: t.reverse, + url: t.url, + })), + (this.autostart = t.autostart), + (this._loop = t.loop), + (this._loopStart = t.loopStart), + (this._loopEnd = t.loopEnd), + (this._playbackRate = t.playbackRate), + (this.fadeIn = t.fadeIn), + (this.fadeOut = t.fadeOut)); + } + static getDefaults() { + return Object.assign(jo.getDefaults(), { + autostart: !1, + fadeIn: 0, + fadeOut: 0, + loop: !1, + loopEnd: 0, + loopStart: 0, + onload: Ei, + onerror: Ei, + playbackRate: 1, + reverse: !1, + }); + } + load(t) { + return ni(this, void 0, void 0, function* () { + return (yield this._buffer.load(t), this._onload(), this); + }); + } + _onload(t = Ei) { + (t(), this.autostart && this.start()); + } + _onSourceEnd(t) { + (this.onstop(this), + this._activeSources.delete(t), + 0 !== this._activeSources.size || + this._synced || + "started" !== this._state.getValueAtTime(this.now()) || + (this._state.cancel(this.now()), + this._state.setStateAtTime("stopped", this.now()))); + } + start(t, e, s) { + return (super.start(t, e, s), this); + } + _start(t, e, s) { + e = this._loop ? pi(e, this._loopStart) : pi(e, 0); + const n = this.toSeconds(e), + i = s; + s = pi(s, Math.max(this._buffer.duration - n, 0)); + let o = this.toSeconds(s); + ((o /= this._playbackRate), (t = this.toSeconds(t))); + const r = new Lo({ + url: this._buffer, + context: this.context, + fadeIn: this.fadeIn, + fadeOut: this.fadeOut, + loop: this._loop, + loopEnd: this._loopEnd, + loopStart: this._loopStart, + onended: this._onSourceEnd.bind(this), + playbackRate: this._playbackRate, + }).connect(this.output); + (this._loop || + this._synced || + (this._state.cancel(t + o), + this._state.setStateAtTime("stopped", t + o, { + implicitEnd: !0, + })), + this._activeSources.add(r), + this._loop && In(i) + ? r.start(t, n) + : r.start(t, n, o - this.toSeconds(this.fadeOut))); + } + _stop(t) { + const e = this.toSeconds(t); + this._activeSources.forEach((t) => t.stop(e)); + } + restart(t, e, s) { + return (super.restart(t, e, s), this); + } + _restart(t, e, s) { + var n; + (null === (n = [...this._activeSources].pop()) || + void 0 === n || + n.stop(t), + this._start(t, e, s)); + } + seek(t, e) { + const s = this.toSeconds(e); + if ("started" === this._state.getValueAtTime(s)) { + const e = this.toSeconds(t); + (this._stop(s), this._start(s, e)); + } + return this; + } + setLoopPoints(t, e) { + return ((this.loopStart = t), (this.loopEnd = e), this); + } + get loopStart() { + return this._loopStart; + } + set loopStart(t) { + ((this._loopStart = t), + this.buffer.loaded && + Un(this.toSeconds(t), 0, this.buffer.duration), + this._activeSources.forEach((e) => { + e.loopStart = t; + })); + } + get loopEnd() { + return this._loopEnd; + } + set loopEnd(t) { + ((this._loopEnd = t), + this.buffer.loaded && + Un(this.toSeconds(t), 0, this.buffer.duration), + this._activeSources.forEach((e) => { + e.loopEnd = t; + })); + } + get buffer() { + return this._buffer; + } + set buffer(t) { + this._buffer.set(t); + } + get loop() { + return this._loop; + } + set loop(t) { + if ( + this._loop !== t && + ((this._loop = t), + this._activeSources.forEach((e) => { + e.loop = t; + }), + t) + ) { + const t = this._state.getNextState("stopped", this.now()); + t && this._state.cancel(t.time); + } + } + get playbackRate() { + return this._playbackRate; + } + set playbackRate(t) { + this._playbackRate = t; + const e = this.now(), + s = this._state.getNextState("stopped", e); + (s && + s.implicitEnd && + (this._state.cancel(s.time), + this._activeSources.forEach((t) => t.cancelStop())), + this._activeSources.forEach((s) => { + s.playbackRate.setValueAtTime(t, e); + })); + } + get reverse() { + return this._buffer.reverse; + } + set reverse(t) { + this._buffer.reverse = t; + } + get loaded() { + return this._buffer.loaded; + } + dispose() { + return ( + super.dispose(), + this._activeSources.forEach((t) => t.dispose()), + this._activeSources.clear(), + this._buffer.dispose(), + this + ); + } + } + (si([hr(0)], lr.prototype, "fadeIn", void 0), + si([hr(0)], lr.prototype, "fadeOut", void 0)); + class ur extends io { + constructor() { + const t = ui( + ur.getDefaults(), + arguments, + ["urls", "onload"], + "urls", + ); + (super(t), + (this.name = "Players"), + (this.input = void 0), + (this._players = new Map()), + (this._volume = this.output = + new xo({ + context: this.context, + volume: t.volume, + })), + (this.volume = this._volume.volume), + Di(this, "volume"), + (this._buffers = new So({ + urls: t.urls, + onload: t.onload, + baseUrl: t.baseUrl, + onerror: t.onerror, + })), + (this.mute = t.mute), + (this._fadeIn = t.fadeIn), + (this._fadeOut = t.fadeOut)); + } + static getDefaults() { + return Object.assign(jo.getDefaults(), { + baseUrl: "", + fadeIn: 0, + fadeOut: 0, + mute: !1, + onload: Ei, + onerror: Ei, + urls: {}, + volume: 0, + }); + } + get mute() { + return this._volume.mute; + } + set mute(t) { + this._volume.mute = t; + } + get fadeIn() { + return this._fadeIn; + } + set fadeIn(t) { + ((this._fadeIn = t), + this._players.forEach((e) => { + e.fadeIn = t; + })); + } + get fadeOut() { + return this._fadeOut; + } + set fadeOut(t) { + ((this._fadeOut = t), + this._players.forEach((e) => { + e.fadeOut = t; + })); + } + get state() { + return Array.from(this._players).some( + ([t, e]) => "started" === e.state, + ) + ? "started" + : "stopped"; + } + has(t) { + return this._buffers.has(t); + } + player(t) { + if ( + (Bn( + this.has(t), + `No Player with the name ${t} exists on this object`, + ), + !this._players.has(t)) + ) { + const e = new lr({ + context: this.context, + fadeIn: this._fadeIn, + fadeOut: this._fadeOut, + url: this._buffers.get(t), + }).connect(this.output); + this._players.set(t, e); + } + return this._players.get(t); + } + get loaded() { + return this._buffers.loaded; + } + add(t, e, s) { + return ( + Bn( + !this._buffers.has(t), + "A buffer with that name already exists on this object", + ), + this._buffers.add(t, e, s), + this + ); + } + stopAll(t) { + return (this._players.forEach((e) => e.stop(t)), this); + } + dispose() { + return ( + super.dispose(), + this._volume.dispose(), + this.volume.dispose(), + this._players.forEach((t) => t.dispose()), + this._buffers.dispose(), + this + ); + } + } + class pr extends jo { + constructor() { + const t = ui(pr.getDefaults(), arguments, ["url", "onload"]); + (super(t), + (this.name = "GrainPlayer"), + (this._loopStart = 0), + (this._loopEnd = 0), + (this._activeSources = []), + (this.buffer = new Ri({ + onload: t.onload, + onerror: t.onerror, + reverse: t.reverse, + url: t.url, + })), + (this._clock = new vo({ + context: this.context, + callback: this._tick.bind(this), + frequency: 1 / t.grainSize, + })), + (this._playbackRate = t.playbackRate), + (this._grainSize = t.grainSize), + (this._overlap = t.overlap), + (this.detune = t.detune), + (this.overlap = t.overlap), + (this.loop = t.loop), + (this.playbackRate = t.playbackRate), + (this.grainSize = t.grainSize), + (this.loopStart = t.loopStart), + (this.loopEnd = t.loopEnd), + (this.reverse = t.reverse), + this._clock.on("stop", this._onstop.bind(this))); + } + static getDefaults() { + return Object.assign(jo.getDefaults(), { + onload: Ei, + onerror: Ei, + overlap: 0.1, + grainSize: 0.2, + playbackRate: 1, + detune: 0, + loop: !1, + loopStart: 0, + loopEnd: 0, + reverse: !1, + }); + } + _start(t, e, s) { + ((e = pi(e, 0)), (e = this.toSeconds(e)), (t = this.toSeconds(t))); + const n = 1 / this._clock.frequency.getValueAtTime(t); + (this._clock.start(t, e / n), + s && this.stop(t + this.toSeconds(s))); + } + restart(t, e, s) { + return (super.restart(t, e, s), this); + } + _restart(t, e, s) { + (this._stop(t), this._start(t, e, s)); + } + _stop(t) { + this._clock.stop(t); + } + _onstop(t) { + (this._activeSources.forEach((e) => { + ((e.fadeOut = 0), e.stop(t)); + }), + this.onstop(this)); + } + _tick(t) { + const e = this._clock.getTicksAtTime(t), + s = e * this._grainSize; + if ((this.log("offset", s), !this.loop && s > this.buffer.duration)) + return void this.stop(t); + const n = s < this._overlap ? 0 : this._overlap, + i = new Lo({ + context: this.context, + url: this.buffer, + fadeIn: n, + fadeOut: this._overlap, + loop: this.loop, + loopStart: this._loopStart, + loopEnd: this._loopEnd, + playbackRate: zi(this.detune / 100), + }).connect(this.output); + (i.start(t, this._grainSize * e), + i.stop(t + this._grainSize / this.playbackRate), + this._activeSources.push(i), + (i.onended = () => { + const t = this._activeSources.indexOf(i); + -1 !== t && this._activeSources.splice(t, 1); + })); + } + get playbackRate() { + return this._playbackRate; + } + set playbackRate(t) { + (Un(t, 0.001), + (this._playbackRate = t), + (this.grainSize = this._grainSize)); + } + get loopStart() { + return this._loopStart; + } + set loopStart(t) { + (this.buffer.loaded && + Un(this.toSeconds(t), 0, this.buffer.duration), + (this._loopStart = this.toSeconds(t))); + } + get loopEnd() { + return this._loopEnd; + } + set loopEnd(t) { + (this.buffer.loaded && + Un(this.toSeconds(t), 0, this.buffer.duration), + (this._loopEnd = this.toSeconds(t))); + } + get reverse() { + return this.buffer.reverse; + } + set reverse(t) { + this.buffer.reverse = t; + } + get grainSize() { + return this._grainSize; + } + set grainSize(t) { + ((this._grainSize = this.toSeconds(t)), + this._clock.frequency.setValueAtTime( + this._playbackRate / this._grainSize, + this.now(), + )); + } + get overlap() { + return this._overlap; + } + set overlap(t) { + const e = this.toSeconds(t); + (Un(e, 0), (this._overlap = e)); + } + get loaded() { + return this.buffer.loaded; + } + dispose() { + return ( + super.dispose(), + this.buffer.dispose(), + this._clock.dispose(), + this._activeSources.forEach((t) => t.dispose()), + this + ); + } + } + class dr extends qo { + constructor() { + (super(...arguments), + (this.name = "Abs"), + (this._abs = new Io({ + context: this.context, + mapping: (t) => (Math.abs(t) < 0.001 ? 0 : Math.abs(t)), + })), + (this.input = this._abs), + (this.output = this._abs)); + } + dispose() { + return (super.dispose(), this._abs.dispose(), this); + } + } + class fr extends qo { + constructor() { + (super(...arguments), + (this.name = "GainToAudio"), + (this._norm = new Io({ + context: this.context, + mapping: (t) => 2 * Math.abs(t) - 1, + })), + (this.input = this._norm), + (this.output = this._norm)); + } + dispose() { + return (super.dispose(), this._norm.dispose(), this); + } + } + class _r extends qo { + constructor() { + (super(...arguments), + (this.name = "Negate"), + (this._multiply = new $o({ + context: this.context, + value: -1, + })), + (this.input = this._multiply), + (this.output = this._multiply)); + } + dispose() { + return (super.dispose(), this._multiply.dispose(), this); + } + } + class mr extends po { + constructor() { + (super(ui(mr.getDefaults(), arguments, ["value"])), + (this.override = !1), + (this.name = "Subtract"), + (this._sum = new ho({ + context: this.context, + })), + (this.input = this._sum), + (this.output = this._sum), + (this._neg = new _r({ + context: this.context, + })), + (this.subtrahend = this._param), + oo(this._constantSource, this._neg, this._sum)); + } + static getDefaults() { + return Object.assign(po.getDefaults(), { + value: 0, + }); + } + dispose() { + return ( + super.dispose(), + this._neg.dispose(), + this._sum.dispose(), + this + ); + } + } + class gr extends qo { + constructor() { + (super(ui(gr.getDefaults(), arguments)), + (this.name = "GreaterThanZero"), + (this._thresh = this.output = + new Io({ + context: this.context, + length: 127, + mapping: (t) => (t <= 0 ? 0 : 1), + })), + (this._scale = this.input = + new $o({ + context: this.context, + value: 1e4, + })), + this._scale.connect(this._thresh)); + } + dispose() { + return ( + super.dispose(), + this._scale.dispose(), + this._thresh.dispose(), + this + ); + } + } + class vr extends po { + constructor() { + const t = ui(vr.getDefaults(), arguments, ["value"]); + (super(t), + (this.name = "GreaterThan"), + (this.override = !1), + (this._subtract = this.input = + new mr({ + context: this.context, + value: t.value, + })), + (this._gtz = this.output = + new gr({ + context: this.context, + })), + (this.comparator = this._param = this._subtract.subtrahend), + Di(this, "comparator"), + this._subtract.connect(this._gtz)); + } + static getDefaults() { + return Object.assign(po.getDefaults(), { + value: 0, + }); + } + dispose() { + return ( + super.dispose(), + this._gtz.dispose(), + this._subtract.dispose(), + this.comparator.dispose(), + this + ); + } + } + class yr extends or { + constructor() { + const t = ui(yr.getDefaults(), arguments, [ + "min", + "max", + "exponent", + ]); + (super(t), + (this.name = "ScaleExp"), + (this.input = this._exp = + new Fo({ + context: this.context, + value: t.exponent, + })), + this._exp.connect(this._mult)); + } + static getDefaults() { + return Object.assign(or.getDefaults(), { + exponent: 1, + }); + } + get exponent() { + return this._exp.value; + } + set exponent(t) { + this._exp.value = t; + } + dispose() { + return (super.dispose(), this._exp.dispose(), this); + } + } + class xr extends po { + constructor() { + const t = ui(po.getDefaults(), arguments, ["value", "units"]); + (super(t), + (this.name = "SyncedSignal"), + (this.override = !1), + (this._lastVal = t.value), + (this._synced = this.context.transport.scheduleRepeat( + this._onTick.bind(this), + "1i", + )), + (this._syncedCallback = this._anchorValue.bind(this)), + this.context.transport.on("start", this._syncedCallback), + this.context.transport.on("pause", this._syncedCallback), + this.context.transport.on("stop", this._syncedCallback), + this._constantSource.disconnect(), + this._constantSource.stop(0), + (this._constantSource = this.output = + new uo({ + context: this.context, + offset: t.value, + units: t.units, + }).start(0)), + this.setValueAtTime(t.value, 0)); + } + _onTick(t) { + const e = super.getValueAtTime(this.context.transport.seconds); + this._lastVal !== e && + ((this._lastVal = e), + this._constantSource.offset.setValueAtTime(e, t)); + } + _anchorValue(t) { + const e = super.getValueAtTime(this.context.transport.seconds); + ((this._lastVal = e), + this._constantSource.offset.cancelAndHoldAtTime(t), + this._constantSource.offset.setValueAtTime(e, t)); + } + getValueAtTime(t) { + const e = new Ki(this.context, t).toSeconds(); + return super.getValueAtTime(e); + } + setValueAtTime(t, e) { + const s = new Ki(this.context, e).toSeconds(); + return (super.setValueAtTime(t, s), this); + } + linearRampToValueAtTime(t, e) { + const s = new Ki(this.context, e).toSeconds(); + return (super.linearRampToValueAtTime(t, s), this); + } + exponentialRampToValueAtTime(t, e) { + const s = new Ki(this.context, e).toSeconds(); + return (super.exponentialRampToValueAtTime(t, s), this); + } + setTargetAtTime(t, e, s) { + const n = new Ki(this.context, e).toSeconds(); + return (super.setTargetAtTime(t, n, s), this); + } + cancelScheduledValues(t) { + const e = new Ki(this.context, t).toSeconds(); + return (super.cancelScheduledValues(e), this); + } + setValueCurveAtTime(t, e, s, n) { + const i = new Ki(this.context, e).toSeconds(); + return ( + (s = this.toSeconds(s)), + super.setValueCurveAtTime(t, i, s, n), + this + ); + } + cancelAndHoldAtTime(t) { + const e = new Ki(this.context, t).toSeconds(); + return (super.cancelAndHoldAtTime(e), this); + } + setRampPoint(t) { + const e = new Ki(this.context, t).toSeconds(); + return (super.setRampPoint(e), this); + } + exponentialRampTo(t, e, s) { + const n = new Ki(this.context, s).toSeconds(); + return (super.exponentialRampTo(t, e, n), this); + } + linearRampTo(t, e, s) { + const n = new Ki(this.context, s).toSeconds(); + return (super.linearRampTo(t, e, n), this); + } + targetRampTo(t, e, s) { + const n = new Ki(this.context, s).toSeconds(); + return (super.targetRampTo(t, e, n), this); + } + dispose() { + return ( + super.dispose(), + this.context.transport.clear(this._synced), + this.context.transport.off("start", this._syncedCallback), + this.context.transport.off("pause", this._syncedCallback), + this.context.transport.off("stop", this._syncedCallback), + this._constantSource.dispose(), + this + ); + } + } + class wr extends io { + constructor() { + const t = ui(wr.getDefaults(), arguments, [ + "attack", + "decay", + "sustain", + "release", + ]); + (super(t), + (this.name = "Envelope"), + (this._sig = new po({ + context: this.context, + value: 0, + })), + (this.output = this._sig), + (this.input = void 0), + (this.attack = t.attack), + (this.decay = t.decay), + (this.sustain = t.sustain), + (this.release = t.release), + (this.attackCurve = t.attackCurve), + (this.releaseCurve = t.releaseCurve), + (this.decayCurve = t.decayCurve)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + attack: 0.01, + attackCurve: "linear", + decay: 0.1, + decayCurve: "exponential", + release: 1, + releaseCurve: "exponential", + sustain: 0.5, + }); + } + get value() { + return this.getValueAtTime(this.now()); + } + _getCurve(t, e) { + if (zn(t)) return t; + { + let s; + for (s in br) if (br[s][e] === t) return s; + return t; + } + } + _setCurve(t, e, s) { + if (zn(s) && Reflect.has(br, s)) { + const n = br[s]; + Pn(n) ? "_decayCurve" !== t && (this[t] = n[e]) : (this[t] = n); + } else { + if (!Ln(s) || "_decayCurve" === t) + throw new Error("Envelope: invalid curve: " + s); + this[t] = s; + } + } + get attackCurve() { + return this._getCurve(this._attackCurve, "In"); + } + set attackCurve(t) { + this._setCurve("_attackCurve", "In", t); + } + get releaseCurve() { + return this._getCurve(this._releaseCurve, "Out"); + } + set releaseCurve(t) { + this._setCurve("_releaseCurve", "Out", t); + } + get decayCurve() { + return this._getCurve(this._decayCurve, "Out"); + } + set decayCurve(t) { + this._setCurve("_decayCurve", "Out", t); + } + triggerAttack(t, e = 1) { + (this.log("triggerAttack", t, e), (t = this.toSeconds(t))); + let s = this.toSeconds(this.attack); + const n = this.toSeconds(this.decay), + i = this.getValueAtTime(t); + if ((i > 0 && (s = (1 - i) / (1 / s)), s < this.sampleTime)) + (this._sig.cancelScheduledValues(t), + this._sig.setValueAtTime(e, t)); + else if ("linear" === this._attackCurve) + this._sig.linearRampTo(e, s, t); + else if ("exponential" === this._attackCurve) + this._sig.targetRampTo(e, s, t); + else { + this._sig.cancelAndHoldAtTime(t); + let n = this._attackCurve; + for (let t = 1; t < n.length; t++) + if (n[t - 1] <= i && i <= n[t]) { + ((n = this._attackCurve.slice(t)), (n[0] = i)); + break; + } + this._sig.setValueCurveAtTime(n, t, s, e); + } + if (n && this.sustain < 1) { + const i = e * this.sustain, + o = t + s; + (this.log("decay", o), + "linear" === this._decayCurve + ? this._sig.linearRampToValueAtTime(i, n + o) + : this._sig.exponentialApproachValueAtTime(i, o, n)); + } + return this; + } + triggerRelease(t) { + (this.log("triggerRelease", t), (t = this.toSeconds(t))); + const e = this.getValueAtTime(t); + if (e > 0) { + const s = this.toSeconds(this.release); + s < this.sampleTime + ? this._sig.setValueAtTime(0, t) + : "linear" === this._releaseCurve + ? this._sig.linearRampTo(0, s, t) + : "exponential" === this._releaseCurve + ? this._sig.targetRampTo(0, s, t) + : (Bn( + Ln(this._releaseCurve), + "releaseCurve must be either 'linear', 'exponential' or an array", + ), + this._sig.cancelAndHoldAtTime(t), + this._sig.setValueCurveAtTime( + this._releaseCurve, + t, + s, + e, + )); + } + return this; + } + getValueAtTime(t) { + return this._sig.getValueAtTime(t); + } + triggerAttackRelease(t, e, s = 1) { + return ( + (e = this.toSeconds(e)), + this.triggerAttack(e, s), + this.triggerRelease(e + this.toSeconds(t)), + this + ); + } + cancel(t) { + return (this._sig.cancelScheduledValues(this.toSeconds(t)), this); + } + connect(t, e = 0, s = 0) { + return (fo(this, t, e, s), this); + } + asArray() { + return ni(this, arguments, void 0, function* (t = 1024) { + const e = t / this.context.sampleRate, + s = new qi(1, e, this.context.sampleRate), + n = this.toSeconds(this.attack) + this.toSeconds(this.decay), + i = n + this.toSeconds(this.release), + o = 0.1 * i, + r = i + o, + a = new this.constructor( + Object.assign(this.get(), { + attack: (e * this.toSeconds(this.attack)) / r, + decay: (e * this.toSeconds(this.decay)) / r, + release: (e * this.toSeconds(this.release)) / r, + context: s, + }), + ); + return ( + a._sig.toDestination(), + a.triggerAttackRelease((e * (n + o)) / r, 0), + (yield s.render()).getChannelData(0) + ); + }); + } + dispose() { + return (super.dispose(), this._sig.dispose(), this); + } + } + (si([hr(0)], wr.prototype, "attack", void 0), + si([hr(0)], wr.prototype, "decay", void 0), + si([cr(0, 1)], wr.prototype, "sustain", void 0), + si([hr(0)], wr.prototype, "release", void 0)); + const br = (() => { + const t = 128; + let e, s; + const n = []; + for (e = 0; e < t; e++) n[e] = Math.sin((e / 127) * (Math.PI / 2)); + const i = []; + for (e = 0; e < 127; e++) { + s = e / 127; + const t = Math.sin(s * (2 * Math.PI) * 6.4 - Math.PI / 2) + 1; + i[e] = t / 10 + 0.83 * s; + } + i[127] = 1; + const o = []; + for (e = 0; e < t; e++) o[e] = Math.ceil((e / 127) * 5) / 5; + const r = []; + for (e = 0; e < t; e++) + ((s = e / 127), (r[e] = 0.5 * (1 - Math.cos(Math.PI * s)))); + const a = []; + for (e = 0; e < t; e++) { + s = e / 127; + const t = 4 * Math.pow(s, 3) + 0.2, + n = Math.cos(t * Math.PI * 2 * s); + a[e] = Math.abs(n * (1 - s)); + } + + function c(t) { + const e = new Array(t.length); + for (let s = 0; s < t.length; s++) e[s] = 1 - t[s]; + return e; + } + return { + bounce: { + In: c(a), + Out: a, + }, + cosine: { + In: n, + Out: ((h = n), h.slice(0).reverse()), + }, + exponential: "exponential", + linear: "linear", + ripple: { + In: i, + Out: c(i), + }, + sine: { + In: r, + Out: c(r), + }, + step: { + In: o, + Out: c(o), + }, + }; + var h; + })(); + class Tr extends io { + constructor() { + const t = ui(Tr.getDefaults(), arguments); + (super(t), + (this._scheduledEvents = []), + (this._synced = !1), + (this._original_triggerAttack = this.triggerAttack), + (this._original_triggerRelease = this.triggerRelease), + (this._syncedRelease = (t) => this._original_triggerRelease(t)), + (this._volume = this.output = + new xo({ + context: this.context, + volume: t.volume, + })), + (this.volume = this._volume.volume), + Di(this, "volume")); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + volume: 0, + }); + } + sync() { + return ( + this._syncState() && + (this._syncMethod("triggerAttack", 1), + this._syncMethod("triggerRelease", 0), + this.context.transport.on("stop", this._syncedRelease), + this.context.transport.on("pause", this._syncedRelease), + this.context.transport.on("loopEnd", this._syncedRelease)), + this + ); + } + _syncState() { + let t = !1; + return (this._synced || ((this._synced = !0), (t = !0)), t); + } + _syncMethod(t, e) { + const s = (this["_original_" + t] = this[t]); + this[t] = (...t) => { + const n = t[e], + i = this.context.transport.schedule((n) => { + ((t[e] = n), s.apply(this, t)); + }, n); + this._scheduledEvents.push(i); + }; + } + unsync() { + return ( + this._scheduledEvents.forEach((t) => + this.context.transport.clear(t), + ), + (this._scheduledEvents = []), + this._synced && + ((this._synced = !1), + (this.triggerAttack = this._original_triggerAttack), + (this.triggerRelease = this._original_triggerRelease), + this.context.transport.off("stop", this._syncedRelease), + this.context.transport.off("pause", this._syncedRelease), + this.context.transport.off("loopEnd", this._syncedRelease)), + this + ); + } + triggerAttackRelease(t, e, s, n) { + const i = this.toSeconds(s), + o = this.toSeconds(e); + return ( + this.triggerAttack(t, i, n), + this.triggerRelease(i + o), + this + ); + } + dispose() { + return ( + super.dispose(), + this._volume.dispose(), + this.unsync(), + (this._scheduledEvents = []), + this + ); + } + } + class Sr extends Tr { + constructor() { + const t = ui(Sr.getDefaults(), arguments); + (super(t), + (this.portamento = t.portamento), + (this.onsilence = t.onsilence)); + } + static getDefaults() { + return Object.assign(Tr.getDefaults(), { + detune: 0, + onsilence: Ei, + portamento: 0, + }); + } + triggerAttack(t, e, s = 1) { + this.log("triggerAttack", t, e, s); + const n = this.toSeconds(e); + return ( + this._triggerEnvelopeAttack(n, s), + this.setNote(t, n), + this + ); + } + triggerRelease(t) { + this.log("triggerRelease", t); + const e = this.toSeconds(t); + return (this._triggerEnvelopeRelease(e), this); + } + setNote(t, e) { + const s = this.toSeconds(e), + n = t instanceof Yi ? t.toFrequency() : t; + if (this.portamento > 0 && this.getLevelAtTime(s) > 0.05) { + const t = this.toSeconds(this.portamento); + this.frequency.exponentialRampTo(n, t, s); + } else this.frequency.setValueAtTime(n, s); + return this; + } + } + si([hr(0)], Sr.prototype, "portamento", void 0); + class kr extends wr { + constructor() { + (super( + ui(kr.getDefaults(), arguments, [ + "attack", + "decay", + "sustain", + "release", + ]), + ), + (this.name = "AmplitudeEnvelope"), + (this._gainNode = new ho({ + context: this.context, + gain: 0, + })), + (this.output = this._gainNode), + (this.input = this._gainNode), + this._sig.connect(this._gainNode.gain), + (this.output = this._gainNode), + (this.input = this._gainNode)); + } + dispose() { + return (super.dispose(), this._gainNode.dispose(), this); + } + } + class Ar extends Sr { + constructor() { + const t = ui(Ar.getDefaults(), arguments); + (super(t), + (this.name = "Synth"), + (this.oscillator = new nr( + Object.assign( + { + context: this.context, + detune: t.detune, + onstop: () => this.onsilence(this), + }, + t.oscillator, + ), + )), + (this.frequency = this.oscillator.frequency), + (this.detune = this.oscillator.detune), + (this.envelope = new kr( + Object.assign( + { + context: this.context, + }, + t.envelope, + ), + )), + this.oscillator.chain(this.envelope, this.output), + Di(this, ["oscillator", "frequency", "detune", "envelope"])); + } + static getDefaults() { + return Object.assign(Sr.getDefaults(), { + envelope: Object.assign( + di(wr.getDefaults(), Object.keys(io.getDefaults())), + { + attack: 0.005, + decay: 0.1, + release: 1, + sustain: 0.3, + }, + ), + oscillator: Object.assign( + di(nr.getDefaults(), [ + ...Object.keys(jo.getDefaults()), + "frequency", + "detune", + ]), + { + type: "triangle", + }, + ), + }); + } + _triggerEnvelopeAttack(t, e) { + if ( + (this.envelope.triggerAttack(t, e), + this.oscillator.start(t), + 0 === this.envelope.sustain) + ) { + const e = this.toSeconds(this.envelope.attack), + s = this.toSeconds(this.envelope.decay); + this.oscillator.stop(t + e + s); + } + } + _triggerEnvelopeRelease(t) { + (this.envelope.triggerRelease(t), + this.oscillator.stop(t + this.toSeconds(this.envelope.release))); + } + getLevelAtTime(t) { + return ((t = this.toSeconds(t)), this.envelope.getValueAtTime(t)); + } + dispose() { + return ( + super.dispose(), + this.oscillator.dispose(), + this.envelope.dispose(), + this + ); + } + } + class Cr extends Sr { + constructor() { + const t = ui(Cr.getDefaults(), arguments); + (super(t), + (this.name = "ModulationSynth"), + (this._carrier = new Ar({ + context: this.context, + oscillator: t.oscillator, + envelope: t.envelope, + onsilence: () => this.onsilence(this), + volume: -10, + })), + (this._modulator = new Ar({ + context: this.context, + oscillator: t.modulation, + envelope: t.modulationEnvelope, + volume: -10, + })), + (this.oscillator = this._carrier.oscillator), + (this.envelope = this._carrier.envelope), + (this.modulation = this._modulator.oscillator), + (this.modulationEnvelope = this._modulator.envelope), + (this.frequency = new po({ + context: this.context, + units: "frequency", + })), + (this.detune = new po({ + context: this.context, + value: t.detune, + units: "cents", + })), + (this.harmonicity = new $o({ + context: this.context, + value: t.harmonicity, + minValue: 0, + })), + (this._modulationNode = new ho({ + context: this.context, + gain: 0, + })), + Di(this, [ + "frequency", + "harmonicity", + "oscillator", + "envelope", + "modulation", + "modulationEnvelope", + "detune", + ])); + } + static getDefaults() { + return Object.assign(Sr.getDefaults(), { + harmonicity: 3, + oscillator: Object.assign( + di(nr.getDefaults(), [ + ...Object.keys(jo.getDefaults()), + "frequency", + "detune", + ]), + { + type: "sine", + }, + ), + envelope: Object.assign( + di(wr.getDefaults(), Object.keys(io.getDefaults())), + { + attack: 0.01, + decay: 0.01, + sustain: 1, + release: 0.5, + }, + ), + modulation: Object.assign( + di(nr.getDefaults(), [ + ...Object.keys(jo.getDefaults()), + "frequency", + "detune", + ]), + { + type: "square", + }, + ), + modulationEnvelope: Object.assign( + di(wr.getDefaults(), Object.keys(io.getDefaults())), + { + attack: 0.5, + decay: 0, + sustain: 1, + release: 0.5, + }, + ), + }); + } + _triggerEnvelopeAttack(t, e) { + (this._carrier._triggerEnvelopeAttack(t, e), + this._modulator._triggerEnvelopeAttack(t, e)); + } + _triggerEnvelopeRelease(t) { + return ( + this._carrier._triggerEnvelopeRelease(t), + this._modulator._triggerEnvelopeRelease(t), + this + ); + } + getLevelAtTime(t) { + return ((t = this.toSeconds(t)), this.envelope.getValueAtTime(t)); + } + dispose() { + return ( + super.dispose(), + this._carrier.dispose(), + this._modulator.dispose(), + this.frequency.dispose(), + this.detune.dispose(), + this.harmonicity.dispose(), + this._modulationNode.dispose(), + this + ); + } + } + class Or extends Cr { + constructor() { + (super(ui(Or.getDefaults(), arguments)), + (this.name = "AMSynth"), + (this._modulationScale = new Yo({ + context: this.context, + })), + this.frequency.connect(this._carrier.frequency), + this.frequency.chain(this.harmonicity, this._modulator.frequency), + this.detune.fan(this._carrier.detune, this._modulator.detune), + this._modulator.chain( + this._modulationScale, + this._modulationNode.gain, + ), + this._carrier.chain(this._modulationNode, this.output)); + } + dispose() { + return (super.dispose(), this._modulationScale.dispose(), this); + } + } + class Dr extends io { + constructor() { + const t = ui(Dr.getDefaults(), arguments, ["frequency", "type"]); + (super(t), + (this.name = "BiquadFilter"), + (this._filter = this.context.createBiquadFilter()), + (this.input = this.output = this._filter), + (this.Q = new no({ + context: this.context, + units: "number", + value: t.Q, + param: this._filter.Q, + })), + (this.frequency = new no({ + context: this.context, + units: "frequency", + value: t.frequency, + param: this._filter.frequency, + })), + (this.detune = new no({ + context: this.context, + units: "cents", + value: t.detune, + param: this._filter.detune, + })), + (this.gain = new no({ + context: this.context, + units: "decibels", + convert: !1, + value: t.gain, + param: this._filter.gain, + })), + (this.type = t.type)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + Q: 1, + type: "lowpass", + frequency: 350, + detune: 0, + gain: 0, + }); + } + get type() { + return this._filter.type; + } + set type(t) { + (Bn( + -1 !== + [ + "lowpass", + "highpass", + "bandpass", + "lowshelf", + "highshelf", + "notch", + "allpass", + "peaking", + ].indexOf(t), + `Invalid filter type: ${t}`, + ), + (this._filter.type = t)); + } + getFrequencyResponse(t = 128) { + const e = new Float32Array(t); + for (let s = 0; s < t; s++) { + const n = 19980 * Math.pow(s / t, 2) + 20; + e[s] = n; + } + const s = new Float32Array(t), + n = new Float32Array(t), + i = this.context.createBiquadFilter(); + return ( + (i.type = this.type), + (i.Q.value = this.Q.value), + (i.frequency.value = this.frequency.value), + (i.gain.value = this.gain.value), + i.getFrequencyResponse(e, s, n), + s + ); + } + dispose() { + return ( + super.dispose(), + this._filter.disconnect(), + this.Q.dispose(), + this.frequency.dispose(), + this.gain.dispose(), + this.detune.dispose(), + this + ); + } + } + class Mr extends io { + constructor() { + const t = ui(Mr.getDefaults(), arguments, [ + "frequency", + "type", + "rolloff", + ]); + (super(t), + (this.name = "Filter"), + (this.input = new ho({ + context: this.context, + })), + (this.output = new ho({ + context: this.context, + })), + (this._filters = []), + (this._filters = []), + (this.Q = new po({ + context: this.context, + units: "positive", + value: t.Q, + })), + (this.frequency = new po({ + context: this.context, + units: "frequency", + value: t.frequency, + })), + (this.detune = new po({ + context: this.context, + units: "cents", + value: t.detune, + })), + (this.gain = new po({ + context: this.context, + units: "decibels", + convert: !1, + value: t.gain, + })), + (this._type = t.type), + (this.rolloff = t.rolloff), + Di(this, ["detune", "frequency", "gain", "Q"])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + Q: 1, + detune: 0, + frequency: 350, + gain: 0, + rolloff: -12, + type: "lowpass", + }); + } + get type() { + return this._type; + } + set type(t) { + (Bn( + -1 !== + [ + "lowpass", + "highpass", + "bandpass", + "lowshelf", + "highshelf", + "notch", + "allpass", + "peaking", + ].indexOf(t), + `Invalid filter type: ${t}`, + ), + (this._type = t), + this._filters.forEach((e) => (e.type = t))); + } + get rolloff() { + return this._rolloff; + } + set rolloff(t) { + const e = Nn(t) ? t : parseInt(t, 10), + s = [-12, -24, -48, -96]; + let n = s.indexOf(e); + (Bn(-1 !== n, `rolloff can only be ${s.join(", ")}`), + (n += 1), + (this._rolloff = e), + this.input.disconnect(), + this._filters.forEach((t) => t.disconnect()), + (this._filters = new Array(n))); + for (let t = 0; t < n; t++) { + const e = new Dr({ + context: this.context, + }); + ((e.type = this._type), + this.frequency.connect(e.frequency), + this.detune.connect(e.detune), + this.Q.connect(e.Q), + this.gain.connect(e.gain), + (this._filters[t] = e)); + } + ((this._internalChannels = this._filters), + oo(this.input, ...this._internalChannels, this.output)); + } + getFrequencyResponse(t = 128) { + const e = new Dr({ + context: this.context, + frequency: this.frequency.value, + gain: this.gain.value, + Q: this.Q.value, + type: this._type, + detune: this.detune.value, + }), + s = new Float32Array(t).map(() => 1); + return ( + this._filters.forEach(() => { + e.getFrequencyResponse(t).forEach((t, e) => (s[e] *= t)); + }), + e.dispose(), + s + ); + } + dispose() { + return ( + super.dispose(), + this._filters.forEach((t) => { + t.dispose(); + }), + Mi(this, ["detune", "frequency", "gain", "Q"]), + this.frequency.dispose(), + this.Q.dispose(), + this.detune.dispose(), + this.gain.dispose(), + this + ); + } + } + class Er extends wr { + constructor() { + const t = ui(Er.getDefaults(), arguments, [ + "attack", + "decay", + "sustain", + "release", + ]); + (super(t), + (this.name = "FrequencyEnvelope"), + (this._octaves = t.octaves), + (this._baseFrequency = this.toFrequency(t.baseFrequency)), + (this._exponent = this.input = + new Fo({ + context: this.context, + value: t.exponent, + })), + (this._scale = this.output = + new or({ + context: this.context, + min: this._baseFrequency, + max: this._baseFrequency * Math.pow(2, this._octaves), + })), + this._sig.chain(this._exponent, this._scale)); + } + static getDefaults() { + return Object.assign(wr.getDefaults(), { + baseFrequency: 200, + exponent: 1, + octaves: 4, + }); + } + get baseFrequency() { + return this._baseFrequency; + } + set baseFrequency(t) { + const e = this.toFrequency(t); + (Un(e, 0), + (this._baseFrequency = e), + (this._scale.min = this._baseFrequency), + (this.octaves = this._octaves)); + } + get octaves() { + return this._octaves; + } + set octaves(t) { + ((this._octaves = t), + (this._scale.max = this._baseFrequency * Math.pow(2, t))); + } + get exponent() { + return this._exponent.value; + } + set exponent(t) { + this._exponent.value = t; + } + dispose() { + return ( + super.dispose(), + this._exponent.dispose(), + this._scale.dispose(), + this + ); + } + } + class Rr extends Sr { + constructor() { + const t = ui(Rr.getDefaults(), arguments); + (super(t), + (this.name = "MonoSynth"), + (this.oscillator = new nr( + Object.assign(t.oscillator, { + context: this.context, + detune: t.detune, + onstop: () => this.onsilence(this), + }), + )), + (this.frequency = this.oscillator.frequency), + (this.detune = this.oscillator.detune), + (this.filter = new Mr( + Object.assign(t.filter, { + context: this.context, + }), + )), + (this.filterEnvelope = new Er( + Object.assign(t.filterEnvelope, { + context: this.context, + }), + )), + (this.envelope = new kr( + Object.assign(t.envelope, { + context: this.context, + }), + )), + this.oscillator.chain(this.filter, this.envelope, this.output), + this.filterEnvelope.connect(this.filter.frequency), + Di(this, [ + "oscillator", + "frequency", + "detune", + "filter", + "filterEnvelope", + "envelope", + ])); + } + static getDefaults() { + return Object.assign(Sr.getDefaults(), { + envelope: Object.assign( + di(wr.getDefaults(), Object.keys(io.getDefaults())), + { + attack: 0.005, + decay: 0.1, + release: 1, + sustain: 0.9, + }, + ), + filter: Object.assign( + di(Mr.getDefaults(), Object.keys(io.getDefaults())), + { + Q: 1, + rolloff: -12, + type: "lowpass", + }, + ), + filterEnvelope: Object.assign( + di(Er.getDefaults(), Object.keys(io.getDefaults())), + { + attack: 0.6, + baseFrequency: 200, + decay: 0.2, + exponent: 2, + octaves: 3, + release: 2, + sustain: 0.5, + }, + ), + oscillator: Object.assign( + di(nr.getDefaults(), Object.keys(jo.getDefaults())), + { + type: "sawtooth", + }, + ), + }); + } + _triggerEnvelopeAttack(t, e = 1) { + if ( + (this.envelope.triggerAttack(t, e), + this.filterEnvelope.triggerAttack(t), + this.oscillator.start(t), + 0 === this.envelope.sustain) + ) { + const e = this.toSeconds(this.envelope.attack), + s = this.toSeconds(this.envelope.decay); + this.oscillator.stop(t + e + s); + } + } + _triggerEnvelopeRelease(t) { + (this.envelope.triggerRelease(t), + this.filterEnvelope.triggerRelease(t), + this.oscillator.stop(t + this.toSeconds(this.envelope.release))); + } + getLevelAtTime(t) { + return ((t = this.toSeconds(t)), this.envelope.getValueAtTime(t)); + } + dispose() { + return ( + super.dispose(), + this.oscillator.dispose(), + this.envelope.dispose(), + this.filterEnvelope.dispose(), + this.filter.dispose(), + this + ); + } + } + class qr extends Sr { + constructor() { + const t = ui(qr.getDefaults(), arguments); + (super(t), + (this.name = "DuoSynth"), + (this.voice0 = new Rr( + Object.assign(t.voice0, { + context: this.context, + onsilence: () => this.onsilence(this), + }), + )), + (this.voice1 = new Rr( + Object.assign(t.voice1, { + context: this.context, + }), + )), + (this.harmonicity = new $o({ + context: this.context, + units: "positive", + value: t.harmonicity, + })), + (this._vibrato = new ar({ + frequency: t.vibratoRate, + context: this.context, + min: -50, + max: 50, + })), + this._vibrato.start(), + (this.vibratoRate = this._vibrato.frequency), + (this._vibratoGain = new ho({ + context: this.context, + units: "normalRange", + gain: t.vibratoAmount, + })), + (this.vibratoAmount = this._vibratoGain.gain), + (this.frequency = new po({ + context: this.context, + units: "frequency", + value: 440, + })), + (this.detune = new po({ + context: this.context, + units: "cents", + value: t.detune, + })), + this.frequency.connect(this.voice0.frequency), + this.frequency.chain(this.harmonicity, this.voice1.frequency), + this._vibrato.connect(this._vibratoGain), + this._vibratoGain.fan(this.voice0.detune, this.voice1.detune), + this.detune.fan(this.voice0.detune, this.voice1.detune), + this.voice0.connect(this.output), + this.voice1.connect(this.output), + Di(this, [ + "voice0", + "voice1", + "frequency", + "vibratoAmount", + "vibratoRate", + ])); + } + getLevelAtTime(t) { + return ( + (t = this.toSeconds(t)), + this.voice0.envelope.getValueAtTime(t) + + this.voice1.envelope.getValueAtTime(t) + ); + } + static getDefaults() { + return li(Sr.getDefaults(), { + vibratoAmount: 0.5, + vibratoRate: 5, + harmonicity: 1.5, + voice0: li(di(Rr.getDefaults(), Object.keys(Sr.getDefaults())), { + filterEnvelope: { + attack: 0.01, + decay: 0, + sustain: 1, + release: 0.5, + }, + envelope: { + attack: 0.01, + decay: 0, + sustain: 1, + release: 0.5, + }, + }), + voice1: li(di(Rr.getDefaults(), Object.keys(Sr.getDefaults())), { + filterEnvelope: { + attack: 0.01, + decay: 0, + sustain: 1, + release: 0.5, + }, + envelope: { + attack: 0.01, + decay: 0, + sustain: 1, + release: 0.5, + }, + }), + }); + } + _triggerEnvelopeAttack(t, e) { + (this.voice0._triggerEnvelopeAttack(t, e), + this.voice1._triggerEnvelopeAttack(t, e)); + } + _triggerEnvelopeRelease(t) { + return ( + this.voice0._triggerEnvelopeRelease(t), + this.voice1._triggerEnvelopeRelease(t), + this + ); + } + dispose() { + return ( + super.dispose(), + this.voice0.dispose(), + this.voice1.dispose(), + this.frequency.dispose(), + this.detune.dispose(), + this._vibrato.dispose(), + this.vibratoRate.dispose(), + this._vibratoGain.dispose(), + this.harmonicity.dispose(), + this + ); + } + } + class Ir extends Cr { + constructor() { + const t = ui(Ir.getDefaults(), arguments); + (super(t), + (this.name = "FMSynth"), + (this.modulationIndex = new $o({ + context: this.context, + value: t.modulationIndex, + })), + this.frequency.connect(this._carrier.frequency), + this.frequency.chain(this.harmonicity, this._modulator.frequency), + this.frequency.chain(this.modulationIndex, this._modulationNode), + this.detune.fan(this._carrier.detune, this._modulator.detune), + this._modulator.connect(this._modulationNode.gain), + this._modulationNode.connect(this._carrier.frequency), + this._carrier.connect(this.output)); + } + static getDefaults() { + return Object.assign(Cr.getDefaults(), { + modulationIndex: 10, + }); + } + dispose() { + return (super.dispose(), this.modulationIndex.dispose(), this); + } + } + const Fr = [1, 1.483, 1.932, 2.546, 2.63, 3.897]; + class Vr extends Sr { + constructor() { + const t = ui(Vr.getDefaults(), arguments); + (super(t), + (this.name = "MetalSynth"), + (this._oscillators = []), + (this._freqMultipliers = []), + (this.detune = new po({ + context: this.context, + units: "cents", + value: t.detune, + })), + (this.frequency = new po({ + context: this.context, + units: "frequency", + })), + (this._amplitude = new ho({ + context: this.context, + gain: 0, + }).connect(this.output)), + (this._highpass = new Mr({ + Q: 0, + context: this.context, + type: "highpass", + }).connect(this._amplitude))); + for (let e = 0; e < Fr.length; e++) { + const s = new Jo({ + context: this.context, + harmonicity: t.harmonicity, + modulationIndex: t.modulationIndex, + modulationType: "square", + onstop: 0 === e ? () => this.onsilence(this) : Ei, + type: "square", + }); + (s.connect(this._highpass), (this._oscillators[e] = s)); + const n = new $o({ + context: this.context, + value: Fr[e], + }); + ((this._freqMultipliers[e] = n), + this.frequency.chain(n, s.frequency), + this.detune.connect(s.detune)); + } + ((this._filterFreqScaler = new or({ + context: this.context, + max: 7e3, + min: this.toFrequency(t.resonance), + })), + (this.envelope = new wr({ + attack: t.envelope.attack, + attackCurve: "linear", + context: this.context, + decay: t.envelope.decay, + release: t.envelope.release, + sustain: 0, + })), + this.envelope.chain( + this._filterFreqScaler, + this._highpass.frequency, + ), + this.envelope.connect(this._amplitude.gain), + (this._octaves = t.octaves), + (this.octaves = t.octaves)); + } + static getDefaults() { + return li(Sr.getDefaults(), { + envelope: Object.assign( + di(wr.getDefaults(), Object.keys(io.getDefaults())), + { + attack: 0.001, + decay: 1.4, + release: 0.2, + }, + ), + harmonicity: 5.1, + modulationIndex: 32, + octaves: 1.5, + resonance: 4e3, + }); + } + _triggerEnvelopeAttack(t, e = 1) { + return ( + this.envelope.triggerAttack(t, e), + this._oscillators.forEach((e) => e.start(t)), + 0 === this.envelope.sustain && + this._oscillators.forEach((e) => { + e.stop( + t + + this.toSeconds(this.envelope.attack) + + this.toSeconds(this.envelope.decay), + ); + }), + this + ); + } + _triggerEnvelopeRelease(t) { + return ( + this.envelope.triggerRelease(t), + this._oscillators.forEach((e) => + e.stop(t + this.toSeconds(this.envelope.release)), + ), + this + ); + } + getLevelAtTime(t) { + return ((t = this.toSeconds(t)), this.envelope.getValueAtTime(t)); + } + get modulationIndex() { + return this._oscillators[0].modulationIndex.value; + } + set modulationIndex(t) { + this._oscillators.forEach((e) => (e.modulationIndex.value = t)); + } + get harmonicity() { + return this._oscillators[0].harmonicity.value; + } + set harmonicity(t) { + this._oscillators.forEach((e) => (e.harmonicity.value = t)); + } + get resonance() { + return this._filterFreqScaler.min; + } + set resonance(t) { + ((this._filterFreqScaler.min = this.toFrequency(t)), + (this.octaves = this._octaves)); + } + get octaves() { + return this._octaves; + } + set octaves(t) { + ((this._octaves = t), + (this._filterFreqScaler.max = + this._filterFreqScaler.min * Math.pow(2, t))); + } + dispose() { + return ( + super.dispose(), + this._oscillators.forEach((t) => t.dispose()), + this._freqMultipliers.forEach((t) => t.dispose()), + this.frequency.dispose(), + this.detune.dispose(), + this._filterFreqScaler.dispose(), + this._amplitude.dispose(), + this.envelope.dispose(), + this._highpass.dispose(), + this + ); + } + } + class Nr extends Ar { + constructor() { + const t = ui(Nr.getDefaults(), arguments); + (super(t), + (this.name = "MembraneSynth"), + (this.portamento = 0), + (this.pitchDecay = t.pitchDecay), + (this.octaves = t.octaves), + Di(this, ["oscillator", "envelope"])); + } + static getDefaults() { + return li(Sr.getDefaults(), Ar.getDefaults(), { + envelope: { + attack: 0.001, + attackCurve: "exponential", + decay: 0.4, + release: 1.4, + sustain: 0.01, + }, + octaves: 10, + oscillator: { + type: "sine", + }, + pitchDecay: 0.05, + }); + } + setNote(t, e) { + const s = this.toSeconds(e), + n = this.toFrequency(t instanceof Yi ? t.toFrequency() : t), + i = n * this.octaves; + return ( + this.oscillator.frequency.setValueAtTime(i, s), + this.oscillator.frequency.exponentialRampToValueAtTime( + n, + s + this.toSeconds(this.pitchDecay), + ), + this + ); + } + dispose() { + return (super.dispose(), this); + } + } + (si([cr(0)], Nr.prototype, "octaves", void 0), + si([hr(0)], Nr.prototype, "pitchDecay", void 0)); + class Pr extends Tr { + constructor() { + const t = ui(Pr.getDefaults(), arguments); + (super(t), + (this.name = "NoiseSynth"), + (this.noise = new zo( + Object.assign( + { + context: this.context, + }, + t.noise, + ), + )), + (this.envelope = new kr( + Object.assign( + { + context: this.context, + }, + t.envelope, + ), + )), + this.noise.chain(this.envelope, this.output)); + } + static getDefaults() { + return Object.assign(Tr.getDefaults(), { + envelope: Object.assign( + di(wr.getDefaults(), Object.keys(io.getDefaults())), + { + decay: 0.1, + sustain: 0, + }, + ), + noise: Object.assign( + di(zo.getDefaults(), Object.keys(jo.getDefaults())), + { + type: "white", + }, + ), + }); + } + triggerAttack(t, e = 1) { + return ( + (t = this.toSeconds(t)), + this.envelope.triggerAttack(t, e), + this.noise.start(t), + 0 === this.envelope.sustain && + this.noise.stop( + t + + this.toSeconds(this.envelope.attack) + + this.toSeconds(this.envelope.decay), + ), + this + ); + } + triggerRelease(t) { + return ( + (t = this.toSeconds(t)), + this.envelope.triggerRelease(t), + this.noise.stop(t + this.toSeconds(this.envelope.release)), + this + ); + } + sync() { + return ( + this._syncState() && + (this._syncMethod("triggerAttack", 0), + this._syncMethod("triggerRelease", 0)), + this + ); + } + triggerAttackRelease(t, e, s = 1) { + return ( + (e = this.toSeconds(e)), + (t = this.toSeconds(t)), + this.triggerAttack(e, s), + this.triggerRelease(e + t), + this + ); + } + dispose() { + return ( + super.dispose(), + this.noise.dispose(), + this.envelope.dispose(), + this + ); + } + } + const jr = new Set(); + + function Lr(t) { + jr.add(t); + } + + function zr(t, e) { + const s = `registerProcessor("${t}", ${e})`; + jr.add(s); + } + class Wr extends io { + constructor(t) { + (super(t), + (this.name = "ToneAudioWorklet"), + (this.workletOptions = {}), + (this.onprocessorerror = Ei)); + const e = URL.createObjectURL( + new Blob([Array.from(jr).join("\n")], { + type: "text/javascript", + }), + ), + s = this._audioWorkletName(); + ((this._dummyGain = this.context.createGain()), + (this._dummyParam = this._dummyGain.gain), + this.context.addAudioWorkletModule(e).then(() => { + this.disposed || + ((this._worklet = this.context.createAudioWorkletNode( + s, + this.workletOptions, + )), + (this._worklet.onprocessorerror = + this.onprocessorerror.bind(this)), + this.onReady(this._worklet)); + })); + } + dispose() { + return ( + super.dispose(), + this._dummyGain.disconnect(), + this._worklet && + (this._worklet.port.postMessage("dispose"), + this._worklet.disconnect()), + this + ); + } + } + (Lr( + '\n\t/**\n\t * The base AudioWorkletProcessor for use in Tone.js. Works with the {@link ToneAudioWorklet}. \n\t */\n\tclass ToneAudioWorkletProcessor extends AudioWorkletProcessor {\n\n\t\tconstructor(options) {\n\t\t\t\n\t\t\tsuper(options);\n\t\t\t/**\n\t\t\t * If the processor was disposed or not. Keep alive until it\'s disposed.\n\t\t\t */\n\t\t\tthis.disposed = false;\n\t\t \t/** \n\t\t\t * The number of samples in the processing block\n\t\t\t */\n\t\t\tthis.blockSize = 128;\n\t\t\t/**\n\t\t\t * the sample rate\n\t\t\t */\n\t\t\tthis.sampleRate = sampleRate;\n\n\t\t\tthis.port.onmessage = (event) => {\n\t\t\t\t// when it receives a dispose \n\t\t\t\tif (event.data === "dispose") {\n\t\t\t\t\tthis.disposed = true;\n\t\t\t\t}\n\t\t\t};\n\t\t}\n\t}\n', + ), + Lr( + "\n\t/**\n\t * Abstract class for a single input/output processor. \n\t * has a 'generate' function which processes one sample at a time\n\t */\n\tclass SingleIOProcessor extends ToneAudioWorkletProcessor {\n\n\t\tconstructor(options) {\n\t\t\tsuper(Object.assign(options, {\n\t\t\t\tnumberOfInputs: 1,\n\t\t\t\tnumberOfOutputs: 1\n\t\t\t}));\n\t\t\t/**\n\t\t\t * Holds the name of the parameter and a single value of that\n\t\t\t * parameter at the current sample\n\t\t\t * @type { [name: string]: number }\n\t\t\t */\n\t\t\tthis.params = {}\n\t\t}\n\n\t\t/**\n\t\t * Generate an output sample from the input sample and parameters\n\t\t * @abstract\n\t\t * @param input number\n\t\t * @param channel number\n\t\t * @param parameters { [name: string]: number }\n\t\t * @returns number\n\t\t */\n\t\tgenerate(){}\n\n\t\t/**\n\t\t * Update the private params object with the \n\t\t * values of the parameters at the given index\n\t\t * @param parameters { [name: string]: Float32Array },\n\t\t * @param index number\n\t\t */\n\t\tupdateParams(parameters, index) {\n\t\t\tfor (const paramName in parameters) {\n\t\t\t\tconst param = parameters[paramName];\n\t\t\t\tif (param.length > 1) {\n\t\t\t\t\tthis.params[paramName] = parameters[paramName][index];\n\t\t\t\t} else {\n\t\t\t\t\tthis.params[paramName] = parameters[paramName][0];\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t/**\n\t\t * Process a single frame of the audio\n\t\t * @param inputs Float32Array[][]\n\t\t * @param outputs Float32Array[][]\n\t\t */\n\t\tprocess(inputs, outputs, parameters) {\n\t\t\tconst input = inputs[0];\n\t\t\tconst output = outputs[0];\n\t\t\t// get the parameter values\n\t\t\tconst channelCount = Math.max(input && input.length || 0, output.length);\n\t\t\tfor (let sample = 0; sample < this.blockSize; sample++) {\n\t\t\t\tthis.updateParams(parameters, sample);\n\t\t\t\tfor (let channel = 0; channel < channelCount; channel++) {\n\t\t\t\t\tconst inputSample = input && input.length ? input[channel][sample] : 0;\n\t\t\t\t\toutput[channel][sample] = this.generate(inputSample, channel, this.params);\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn !this.disposed;\n\t\t}\n\t};\n", + ), + Lr( + "\n\t/**\n\t * A multichannel buffer for use within an AudioWorkletProcessor as a delay line\n\t */\n\tclass DelayLine {\n\t\t\n\t\tconstructor(size, channels) {\n\t\t\tthis.buffer = [];\n\t\t\tthis.writeHead = []\n\t\t\tthis.size = size;\n\n\t\t\t// create the empty channels\n\t\t\tfor (let i = 0; i < channels; i++) {\n\t\t\t\tthis.buffer[i] = new Float32Array(this.size);\n\t\t\t\tthis.writeHead[i] = 0;\n\t\t\t}\n\t\t}\n\n\t\t/**\n\t\t * Push a value onto the end\n\t\t * @param channel number\n\t\t * @param value number\n\t\t */\n\t\tpush(channel, value) {\n\t\t\tthis.writeHead[channel] += 1;\n\t\t\tif (this.writeHead[channel] > this.size) {\n\t\t\t\tthis.writeHead[channel] = 0;\n\t\t\t}\n\t\t\tthis.buffer[channel][this.writeHead[channel]] = value;\n\t\t}\n\n\t\t/**\n\t\t * Get the recorded value of the channel given the delay\n\t\t * @param channel number\n\t\t * @param delay number delay samples\n\t\t */\n\t\tget(channel, delay) {\n\t\t\tlet readHead = this.writeHead[channel] - Math.floor(delay);\n\t\t\tif (readHead < 0) {\n\t\t\t\treadHead += this.size;\n\t\t\t}\n\t\t\treturn this.buffer[channel][readHead];\n\t\t}\n\t}\n", + )); + const Br = "feedback-comb-filter"; + zr( + Br, + '\n\tclass FeedbackCombFilterWorklet extends SingleIOProcessor {\n\n\t\tconstructor(options) {\n\t\t\tsuper(options);\n\t\t\tthis.delayLine = new DelayLine(this.sampleRate, options.channelCount || 2);\n\t\t}\n\n\t\tstatic get parameterDescriptors() {\n\t\t\treturn [{\n\t\t\t\tname: "delayTime",\n\t\t\t\tdefaultValue: 0.1,\n\t\t\t\tminValue: 0,\n\t\t\t\tmaxValue: 1,\n\t\t\t\tautomationRate: "k-rate"\n\t\t\t}, {\n\t\t\t\tname: "feedback",\n\t\t\t\tdefaultValue: 0.5,\n\t\t\t\tminValue: 0,\n\t\t\t\tmaxValue: 0.9999,\n\t\t\t\tautomationRate: "k-rate"\n\t\t\t}];\n\t\t}\n\n\t\tgenerate(input, channel, parameters) {\n\t\t\tconst delayedSample = this.delayLine.get(channel, parameters.delayTime * this.sampleRate);\n\t\t\tthis.delayLine.push(channel, input + delayedSample * parameters.feedback);\n\t\t\treturn delayedSample;\n\t\t}\n\t}\n', + ); + class Ur extends Wr { + constructor() { + const t = ui(Ur.getDefaults(), arguments, [ + "delayTime", + "resonance", + ]); + (super(t), + (this.name = "FeedbackCombFilter"), + (this.input = new ho({ + context: this.context, + })), + (this.output = new ho({ + context: this.context, + })), + (this.delayTime = new no({ + context: this.context, + value: t.delayTime, + units: "time", + minValue: 0, + maxValue: 1, + param: this._dummyParam, + swappable: !0, + })), + (this.resonance = new no({ + context: this.context, + value: t.resonance, + units: "normalRange", + param: this._dummyParam, + swappable: !0, + })), + Di(this, ["resonance", "delayTime"])); + } + _audioWorkletName() { + return Br; + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + delayTime: 0.1, + resonance: 0.5, + }); + } + onReady(t) { + oo(this.input, t, this.output); + const e = t.parameters.get("delayTime"); + this.delayTime.setParam(e); + const s = t.parameters.get("feedback"); + this.resonance.setParam(s); + } + dispose() { + return ( + super.dispose(), + this.input.dispose(), + this.output.dispose(), + this.delayTime.dispose(), + this.resonance.dispose(), + this + ); + } + } + class Gr extends io { + constructor() { + const t = ui(Gr.getDefaults(), arguments, ["frequency", "type"]); + (super(t), + (this.name = "OnePoleFilter"), + (this._frequency = t.frequency), + (this._type = t.type), + (this.input = new ho({ + context: this.context, + })), + (this.output = new ho({ + context: this.context, + })), + this._createFilter()); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + frequency: 880, + type: "lowpass", + }); + } + _createFilter() { + const t = this._filter, + e = this.toFrequency(this._frequency), + s = 1 / (2 * Math.PI * e); + if ("lowpass" === this._type) { + const t = 1 / (s * this.context.sampleRate), + e = t - 1; + this._filter = this.context.createIIRFilter([t, 0], [1, e]); + } else { + const t = 1 / (s * this.context.sampleRate) - 1; + this._filter = this.context.createIIRFilter([1, -1], [1, t]); + } + (this.input.chain(this._filter, this.output), + t && + this.context.setTimeout(() => { + this.disposed || (this.input.disconnect(t), t.disconnect()); + }, this.blockTime)); + } + get frequency() { + return this._frequency; + } + set frequency(t) { + ((this._frequency = t), this._createFilter()); + } + get type() { + return this._type; + } + set type(t) { + ((this._type = t), this._createFilter()); + } + getFrequencyResponse(t = 128) { + const e = new Float32Array(t); + for (let s = 0; s < t; s++) { + const n = 19980 * Math.pow(s / t, 2) + 20; + e[s] = n; + } + const s = new Float32Array(t), + n = new Float32Array(t); + return (this._filter.getFrequencyResponse(e, s, n), s); + } + dispose() { + return ( + super.dispose(), + this.input.dispose(), + this.output.dispose(), + this._filter.disconnect(), + this + ); + } + } + class Qr extends io { + constructor() { + const t = ui(Qr.getDefaults(), arguments, [ + "delayTime", + "resonance", + "dampening", + ]); + (super(t), + (this.name = "LowpassCombFilter"), + (this._combFilter = this.output = + new Ur({ + context: this.context, + delayTime: t.delayTime, + resonance: t.resonance, + })), + (this.delayTime = this._combFilter.delayTime), + (this.resonance = this._combFilter.resonance), + (this._lowpass = this.input = + new Gr({ + context: this.context, + frequency: t.dampening, + type: "lowpass", + })), + this._lowpass.connect(this._combFilter)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + dampening: 3e3, + delayTime: 0.1, + resonance: 0.5, + }); + } + get dampening() { + return this._lowpass.frequency; + } + set dampening(t) { + this._lowpass.frequency = t; + } + dispose() { + return ( + super.dispose(), + this._combFilter.dispose(), + this._lowpass.dispose(), + this + ); + } + } + class Zr extends Tr { + constructor() { + const t = ui(Zr.getDefaults(), arguments); + (super(t), + (this.name = "PluckSynth"), + (this._noise = new zo({ + context: this.context, + type: "pink", + })), + (this.attackNoise = t.attackNoise), + (this._lfcf = new Qr({ + context: this.context, + dampening: t.dampening, + resonance: t.resonance, + })), + (this.resonance = t.resonance), + (this.release = t.release), + this._noise.connect(this._lfcf), + this._lfcf.connect(this.output)); + } + static getDefaults() { + return li(Tr.getDefaults(), { + attackNoise: 1, + dampening: 4e3, + resonance: 0.7, + release: 1, + }); + } + get dampening() { + return this._lfcf.dampening; + } + set dampening(t) { + this._lfcf.dampening = t; + } + triggerAttack(t, e) { + const s = this.toFrequency(t); + e = this.toSeconds(e); + const n = 1 / s; + return ( + this._lfcf.delayTime.setValueAtTime(n, e), + this._noise.start(e), + this._noise.stop(e + n * this.attackNoise), + this._lfcf.resonance.cancelScheduledValues(e), + this._lfcf.resonance.setValueAtTime(this.resonance, e), + this + ); + } + triggerRelease(t) { + return ( + this._lfcf.resonance.linearRampTo(0, this.release, t), + this + ); + } + dispose() { + return ( + super.dispose(), + this._noise.dispose(), + this._lfcf.dispose(), + this + ); + } + } + class Xr extends Tr { + constructor() { + const t = ui(Xr.getDefaults(), arguments, ["voice", "options"]); + (super(t), + (this.name = "PolySynth"), + (this._availableVoices = []), + (this._activeVoices = []), + (this._voices = []), + (this._gcTimeout = -1), + (this._averageActiveVoices = 0), + (this._syncedRelease = (t) => this.releaseAll(t)), + Bn( + !Nn(t.voice), + "DEPRECATED: The polyphony count is no longer the first argument.", + )); + const e = t.voice.getDefaults(); + ((this.options = Object.assign(e, t.options)), + (this.voice = t.voice), + (this.maxPolyphony = t.maxPolyphony), + (this._dummyVoice = this._getNextAvailableVoice())); + const s = this._voices.indexOf(this._dummyVoice); + (this._voices.splice(s, 1), + (this._gcTimeout = this.context.setInterval( + this._collectGarbage.bind(this), + 1, + ))); + } + static getDefaults() { + return Object.assign(Tr.getDefaults(), { + maxPolyphony: 32, + options: {}, + voice: Ar, + }); + } + get activeVoices() { + return this._activeVoices.length; + } + _makeVoiceAvailable(t) { + this._availableVoices.push(t); + const e = this._activeVoices.findIndex((e) => e.voice === t); + this._activeVoices.splice(e, 1); + } + _getNextAvailableVoice() { + if (this._availableVoices.length) + return this._availableVoices.shift(); + if (this._voices.length < this.maxPolyphony) { + const t = new this.voice( + Object.assign(this.options, { + context: this.context, + onsilence: this._makeVoiceAvailable.bind(this), + }), + ); + return ( + Bn(t instanceof Sr, "Voice must extend Monophonic class"), + t.connect(this.output), + this._voices.push(t), + t + ); + } + Kn("Max polyphony exceeded. Note dropped."); + } + _collectGarbage() { + if ( + ((this._averageActiveVoices = Math.max( + 0.95 * this._averageActiveVoices, + this.activeVoices, + )), + this._availableVoices.length && + this._voices.length > Math.ceil(this._averageActiveVoices + 1)) + ) { + const t = this._availableVoices.shift(), + e = this._voices.indexOf(t); + (this._voices.splice(e, 1), + this.context.isOffline || t.dispose()); + } + } + _triggerAttack(t, e, s) { + t.forEach((t) => { + const n = new ko(this.context, t).toMidi(), + i = this._getNextAvailableVoice(); + i && + (i.triggerAttack(t, e, s), + this._activeVoices.push({ + midi: n, + voice: i, + released: !1, + }), + this.log("triggerAttack", t, e)); + }); + } + _triggerRelease(t, e) { + t.forEach((t) => { + const s = new ko(this.context, t).toMidi(), + n = this._activeVoices.find( + ({ midi: t, released: e }) => t === s && !e, + ); + n && + (n.voice.triggerRelease(e), + (n.released = !0), + this.log("triggerRelease", t, e)); + }); + } + _scheduleEvent(t, e, s, n) { + (Bn(!this.disposed, "Synth was already disposed"), + s <= this.now() + ? "attack" === t + ? this._triggerAttack(e, s, n) + : this._triggerRelease(e, s) + : this.context.setTimeout(() => { + this.disposed || this._scheduleEvent(t, e, s, n); + }, s - this.now())); + } + triggerAttack(t, e, s) { + Array.isArray(t) || (t = [t]); + const n = this.toSeconds(e); + return (this._scheduleEvent("attack", t, n, s), this); + } + triggerRelease(t, e) { + Array.isArray(t) || (t = [t]); + const s = this.toSeconds(e); + return (this._scheduleEvent("release", t, s), this); + } + triggerAttackRelease(t, e, s, n) { + const i = this.toSeconds(s); + if ((this.triggerAttack(t, i, n), Ln(e))) { + Bn( + Ln(t), + "If the duration is an array, the notes must also be an array", + ); + for (let s = 0; s < t.length; s++) { + const n = e[Math.min(s, e.length - 1)], + o = this.toSeconds(n); + (Bn(o > 0, "The duration must be greater than 0"), + this.triggerRelease(t[s], i + o)); + } + } else { + const s = this.toSeconds(e); + (Bn(s > 0, "The duration must be greater than 0"), + this.triggerRelease(t, i + s)); + } + return this; + } + sync() { + return ( + this._syncState() && + (this._syncMethod("triggerAttack", 1), + this._syncMethod("triggerRelease", 1), + this.context.transport.on("stop", this._syncedRelease), + this.context.transport.on("pause", this._syncedRelease), + this.context.transport.on("loopEnd", this._syncedRelease)), + this + ); + } + set(t) { + const e = di(t, ["onsilence", "context"]); + return ( + (this.options = li(this.options, e)), + this._voices.forEach((t) => t.set(e)), + this._dummyVoice.set(e), + this + ); + } + get() { + return this._dummyVoice.get(); + } + releaseAll(t) { + const e = this.toSeconds(t); + return ( + this._activeVoices.forEach(({ voice: t }) => { + t.triggerRelease(e); + }), + this + ); + } + dispose() { + return ( + super.dispose(), + this._dummyVoice.dispose(), + this._voices.forEach((t) => t.dispose()), + (this._activeVoices = []), + (this._availableVoices = []), + this.context.clearInterval(this._gcTimeout), + this + ); + } + } + class Yr extends Tr { + constructor() { + const t = ui( + Yr.getDefaults(), + arguments, + ["urls", "onload", "baseUrl"], + "urls", + ); + (super(t), + (this.name = "Sampler"), + (this._activeSources = new Map())); + const e = {}; + (Object.keys(t.urls).forEach((s) => { + const n = parseInt(s, 10); + if ( + (Bn( + Wn(s) || (Nn(n) && isFinite(n)), + `url key is neither a note or midi pitch: ${s}`, + ), + Wn(s)) + ) { + const n = new Yi(this.context, s).toMidi(); + e[n] = t.urls[s]; + } else Nn(n) && isFinite(n) && (e[n] = t.urls[n]); + }), + (this._buffers = new So({ + urls: e, + onload: t.onload, + baseUrl: t.baseUrl, + onerror: t.onerror, + })), + (this.attack = t.attack), + (this.release = t.release), + (this.curve = t.curve), + this._buffers.loaded && Promise.resolve().then(t.onload)); + } + static getDefaults() { + return Object.assign(Tr.getDefaults(), { + attack: 0, + baseUrl: "", + curve: "exponential", + onload: Ei, + onerror: Ei, + release: 0.1, + urls: {}, + }); + } + _findClosest(t) { + let e = 0; + for (; e < 96; ) { + if (this._buffers.has(t + e)) return -e; + if (this._buffers.has(t - e)) return e; + e++; + } + throw new Error(`No available buffers for note: ${t}`); + } + triggerAttack(t, e, s = 1) { + return ( + this.log("triggerAttack", t, e, s), + Array.isArray(t) || (t = [t]), + t.forEach((t) => { + const n = Ui(new Yi(this.context, t).toFrequency()), + i = Math.round(n), + o = n - i, + r = this._findClosest(i), + a = i - r, + c = this._buffers.get(a), + h = zi(r + o), + l = new Lo({ + url: c, + context: this.context, + curve: this.curve, + fadeIn: this.attack, + fadeOut: this.release, + playbackRate: h, + }).connect(this.output); + (l.start(e, 0, c.duration / h, s), + Ln(this._activeSources.get(i)) || + this._activeSources.set(i, []), + this._activeSources.get(i).push(l), + (l.onended = () => { + if (this._activeSources && this._activeSources.has(i)) { + const t = this._activeSources.get(i), + e = t.indexOf(l); + -1 !== e && t.splice(e, 1); + } + })); + }), + this + ); + } + triggerRelease(t, e) { + return ( + this.log("triggerRelease", t, e), + Array.isArray(t) || (t = [t]), + t.forEach((t) => { + const s = new Yi(this.context, t).toMidi(); + if ( + this._activeSources.has(s) && + this._activeSources.get(s).length + ) { + const t = this._activeSources.get(s); + ((e = this.toSeconds(e)), + t.forEach((t) => { + t.stop(e); + }), + this._activeSources.set(s, [])); + } + }), + this + ); + } + releaseAll(t) { + const e = this.toSeconds(t); + return ( + this._activeSources.forEach((t) => { + for (; t.length; ) t.shift().stop(e); + }), + this + ); + } + sync() { + return ( + this._syncState() && + (this._syncMethod("triggerAttack", 1), + this._syncMethod("triggerRelease", 1)), + this + ); + } + triggerAttackRelease(t, e, s, n = 1) { + const i = this.toSeconds(s); + return ( + this.triggerAttack(t, i, n), + Ln(e) + ? (Bn(Ln(t), "notes must be an array when duration is array"), + t.forEach((t, s) => { + const n = e[Math.min(s, e.length - 1)]; + this.triggerRelease(t, i + this.toSeconds(n)); + })) + : this.triggerRelease(t, i + this.toSeconds(e)), + this + ); + } + add(t, e, s) { + if ( + (Bn(Wn(t) || isFinite(t), `note must be a pitch or midi: ${t}`), + Wn(t)) + ) { + const n = new Yi(this.context, t).toMidi(); + this._buffers.add(n, e, s); + } else this._buffers.add(t, e, s); + return this; + } + get loaded() { + return this._buffers.loaded; + } + dispose() { + return ( + super.dispose(), + this._buffers.dispose(), + this._activeSources.forEach((t) => { + t.forEach((t) => t.dispose()); + }), + this._activeSources.clear(), + this + ); + } + } + (si([hr(0)], Yr.prototype, "attack", void 0), + si([hr(0)], Yr.prototype, "release", void 0)); + class $r extends eo { + constructor() { + const t = ui($r.getDefaults(), arguments, ["callback", "value"]); + (super(t), + (this.name = "ToneEvent"), + (this._state = new so("stopped")), + (this._startOffset = 0), + (this._loop = t.loop), + (this.callback = t.callback), + (this.value = t.value), + (this._loopStart = this.toTicks(t.loopStart)), + (this._loopEnd = this.toTicks(t.loopEnd)), + (this._playbackRate = t.playbackRate), + (this._probability = t.probability), + (this._humanize = t.humanize), + (this.mute = t.mute), + (this._playbackRate = t.playbackRate), + (this._state.increasing = !0), + this._rescheduleEvents()); + } + static getDefaults() { + return Object.assign(eo.getDefaults(), { + callback: Ei, + humanize: !1, + loop: !1, + loopEnd: "1m", + loopStart: 0, + mute: !1, + playbackRate: 1, + probability: 1, + value: null, + }); + } + _rescheduleEvents(t = -1) { + this._state.forEachFrom(t, (t) => { + let e; + if ("started" === t.state) { + -1 !== t.id && this.context.transport.clear(t.id); + const s = + t.time + Math.round(this.startOffset / this._playbackRate); + if (!0 === this._loop || (Nn(this._loop) && this._loop > 1)) { + ((e = 1 / 0), + Nn(this._loop) && + (e = this._loop * this._getLoopDuration())); + const n = this._state.getAfter(s); + (null !== n && (e = Math.min(e, n.time - s)), + e !== 1 / 0 && (e = new Co(this.context, e))); + const i = new Co(this.context, this._getLoopDuration()); + t.id = this.context.transport.scheduleRepeat( + this._tick.bind(this), + i, + new Co(this.context, s), + e, + ); + } else + t.id = this.context.transport.schedule( + this._tick.bind(this), + new Co(this.context, s), + ); + } + }); + } + get state() { + return this._state.getValueAtTime(this.context.transport.ticks); + } + get startOffset() { + return this._startOffset; + } + set startOffset(t) { + this._startOffset = t; + } + get probability() { + return this._probability; + } + set probability(t) { + this._probability = t; + } + get humanize() { + return this._humanize; + } + set humanize(t) { + this._humanize = t; + } + start(t) { + const e = this.toTicks(t); + return ( + "stopped" === this._state.getValueAtTime(e) && + (this._state.add({ + id: -1, + state: "started", + time: e, + }), + this._rescheduleEvents(e)), + this + ); + } + stop(t) { + this.cancel(t); + const e = this.toTicks(t); + if ("started" === this._state.getValueAtTime(e)) { + this._state.setStateAtTime("stopped", e, { + id: -1, + }); + const t = this._state.getBefore(e); + let s = e; + (null !== t && (s = t.time), this._rescheduleEvents(s)); + } + return this; + } + cancel(t) { + t = pi(t, -1 / 0); + const e = this.toTicks(t); + return ( + this._state.forEachFrom(e, (t) => { + this.context.transport.clear(t.id); + }), + this._state.cancel(e), + this + ); + } + _tick(t) { + const e = this.context.transport.getTicksAtTime(t); + if (!this.mute && "started" === this._state.getValueAtTime(e)) { + if (this.probability < 1 && Math.random() > this.probability) + return; + if (this.humanize) { + let e = 0.02; + (jn(this.humanize) || (e = this.toSeconds(this.humanize)), + (t += (2 * Math.random() - 1) * e)); + } + this.callback(t, this.value); + } + } + _getLoopDuration() { + return (this._loopEnd - this._loopStart) / this._playbackRate; + } + get loop() { + return this._loop; + } + set loop(t) { + ((this._loop = t), this._rescheduleEvents()); + } + get playbackRate() { + return this._playbackRate; + } + set playbackRate(t) { + ((this._playbackRate = t), this._rescheduleEvents()); + } + get loopEnd() { + return new Co(this.context, this._loopEnd).toSeconds(); + } + set loopEnd(t) { + ((this._loopEnd = this.toTicks(t)), + this._loop && this._rescheduleEvents()); + } + get loopStart() { + return new Co(this.context, this._loopStart).toSeconds(); + } + set loopStart(t) { + ((this._loopStart = this.toTicks(t)), + this._loop && this._rescheduleEvents()); + } + get progress() { + if (this._loop) { + const t = this.context.transport.ticks, + e = this._state.get(t); + if (null !== e && "started" === e.state) { + const s = this._getLoopDuration(); + return ((t - e.time) % s) / s; + } + return 0; + } + return 0; + } + dispose() { + return ( + super.dispose(), + this.cancel(), + this._state.dispose(), + this + ); + } + } + class Hr extends eo { + constructor() { + const t = ui(Hr.getDefaults(), arguments, ["callback", "interval"]); + (super(t), + (this.name = "Loop"), + (this._event = new $r({ + context: this.context, + callback: this._tick.bind(this), + loop: !0, + loopEnd: t.interval, + playbackRate: t.playbackRate, + probability: t.probability, + humanize: t.humanize, + })), + (this.callback = t.callback), + (this.iterations = t.iterations)); + } + static getDefaults() { + return Object.assign(eo.getDefaults(), { + interval: "4n", + callback: Ei, + playbackRate: 1, + iterations: 1 / 0, + probability: 1, + mute: !1, + humanize: !1, + }); + } + start(t) { + return (this._event.start(t), this); + } + stop(t) { + return (this._event.stop(t), this); + } + cancel(t) { + return (this._event.cancel(t), this); + } + _tick(t) { + this.callback(t); + } + get state() { + return this._event.state; + } + get progress() { + return this._event.progress; + } + get interval() { + return this._event.loopEnd; + } + set interval(t) { + this._event.loopEnd = t; + } + get playbackRate() { + return this._event.playbackRate; + } + set playbackRate(t) { + this._event.playbackRate = t; + } + get humanize() { + return this._event.humanize; + } + set humanize(t) { + this._event.humanize = t; + } + get probability() { + return this._event.probability; + } + set probability(t) { + this._event.probability = t; + } + get mute() { + return this._event.mute; + } + set mute(t) { + this._event.mute = t; + } + get iterations() { + return !0 === this._event.loop ? 1 / 0 : this._event.loop; + } + set iterations(t) { + this._event.loop = t === 1 / 0 || t; + } + dispose() { + return (super.dispose(), this._event.dispose(), this); + } + } + class Jr extends $r { + constructor() { + const t = ui(Jr.getDefaults(), arguments, ["callback", "events"]); + (super(t), + (this.name = "Part"), + (this._state = new so("stopped")), + (this._events = new Set()), + (this._state.increasing = !0), + t.events.forEach((t) => { + Ln(t) ? this.add(t[0], t[1]) : this.add(t); + })); + } + static getDefaults() { + return Object.assign($r.getDefaults(), { + events: [], + }); + } + start(t, e) { + const s = this.toTicks(t); + if ("started" !== this._state.getValueAtTime(s)) { + ((e = pi(e, this._loop ? this._loopStart : 0)), + (e = this._loop ? pi(e, this._loopStart) : pi(e, 0))); + const t = this.toTicks(e); + (this._state.add({ + id: -1, + offset: t, + state: "started", + time: s, + }), + this._forEach((e) => { + this._startNote(e, s, t); + })); + } + return this; + } + _startNote(t, e, s) { + ((e -= s), + this._loop + ? t.startOffset >= this._loopStart && + t.startOffset < this._loopEnd + ? (t.startOffset < s && (e += this._getLoopDuration()), + t.start(new Co(this.context, e))) + : t.startOffset < this._loopStart && + t.startOffset >= s && + ((t.loop = !1), t.start(new Co(this.context, e))) + : t.startOffset >= s && t.start(new Co(this.context, e))); + } + get startOffset() { + return this._startOffset; + } + set startOffset(t) { + ((this._startOffset = t), + this._forEach((t) => { + t.startOffset += this._startOffset; + })); + } + stop(t) { + const e = this.toTicks(t); + return ( + this._state.cancel(e), + this._state.setStateAtTime("stopped", e), + this._forEach((e) => { + e.stop(t); + }), + this + ); + } + at(t, e) { + const s = new Ki(this.context, t).toTicks(), + n = new Co(this.context, 1).toSeconds(), + i = this._events.values(); + let o = i.next(); + for (; !o.done; ) { + const t = o.value; + if (Math.abs(s - t.startOffset) < n) + return (Fn(e) && (t.value = e), t); + o = i.next(); + } + return Fn(e) ? (this.add(t, e), this.at(t)) : null; + } + add(t, e) { + t instanceof Object && Reflect.has(t, "time") && (t = (e = t).time); + const s = this.toTicks(t); + let n; + return ( + e instanceof $r + ? ((n = e), (n.callback = this._tick.bind(this))) + : (n = new $r({ + callback: this._tick.bind(this), + context: this.context, + value: e, + })), + (n.startOffset = s), + n.set({ + humanize: this.humanize, + loop: this.loop, + loopEnd: this.loopEnd, + loopStart: this.loopStart, + playbackRate: this.playbackRate, + probability: this.probability, + }), + this._events.add(n), + this._restartEvent(n), + this + ); + } + _restartEvent(t) { + this._state.forEach((e) => { + "started" === e.state + ? this._startNote(t, e.time, e.offset) + : t.stop(new Co(this.context, e.time)); + }); + } + remove(t, e) { + return ( + Pn(t) && t.hasOwnProperty("time") && (t = (e = t).time), + (t = this.toTicks(t)), + this._events.forEach((s) => { + s.startOffset === t && + (In(e) || (Fn(e) && s.value === e)) && + (this._events.delete(s), s.dispose()); + }), + this + ); + } + clear() { + return ( + this._forEach((t) => t.dispose()), + this._events.clear(), + this + ); + } + cancel(t) { + return ( + this._forEach((e) => e.cancel(t)), + this._state.cancel(this.toTicks(t)), + this + ); + } + _forEach(t) { + return ( + this._events && + this._events.forEach((e) => { + e instanceof Jr ? e._forEach(t) : t(e); + }), + this + ); + } + _setAll(t, e) { + this._forEach((s) => { + s[t] = e; + }); + } + _tick(t, e) { + this.mute || this.callback(t, e); + } + _testLoopBoundries(t) { + this._loop && + (t.startOffset < this._loopStart || t.startOffset >= this._loopEnd) + ? t.cancel(0) + : "stopped" === t.state && this._restartEvent(t); + } + get probability() { + return this._probability; + } + set probability(t) { + ((this._probability = t), this._setAll("probability", t)); + } + get humanize() { + return this._humanize; + } + set humanize(t) { + ((this._humanize = t), this._setAll("humanize", t)); + } + get loop() { + return this._loop; + } + set loop(t) { + ((this._loop = t), + this._forEach((e) => { + ((e.loopStart = this.loopStart), + (e.loopEnd = this.loopEnd), + (e.loop = t), + this._testLoopBoundries(e)); + })); + } + get loopEnd() { + return new Co(this.context, this._loopEnd).toSeconds(); + } + set loopEnd(t) { + ((this._loopEnd = this.toTicks(t)), + this._loop && + this._forEach((e) => { + ((e.loopEnd = t), this._testLoopBoundries(e)); + })); + } + get loopStart() { + return new Co(this.context, this._loopStart).toSeconds(); + } + set loopStart(t) { + ((this._loopStart = this.toTicks(t)), + this._loop && + this._forEach((t) => { + ((t.loopStart = this.loopStart), this._testLoopBoundries(t)); + })); + } + get playbackRate() { + return this._playbackRate; + } + set playbackRate(t) { + ((this._playbackRate = t), this._setAll("playbackRate", t)); + } + get length() { + return this._events.size; + } + dispose() { + return (super.dispose(), this.clear(), this); + } + } + + function* Kr(t) { + let e = 0; + for (; e < t; ) ((e = xi(e, 0, t - 1)), yield e, e++); + } + + function* ta(t) { + let e = t - 1; + for (; e >= 0; ) ((e = xi(e, 0, t - 1)), yield e, e--); + } + + function* ea(t, e) { + for (;;) yield* e(t); + } + + function* sa(t, e) { + let s = e ? 0 : t - 1; + for (;;) + ((s = xi(s, 0, t - 1)), + yield s, + e ? (s++, s >= t - 1 && (e = !1)) : (s--, s <= 0 && (e = !0))); + } + + function* na(t) { + let e = 0, + s = 0; + for (; e < t; ) + ((e = xi(e, 0, t - 1)), yield e, s++, (e += s % 2 ? 2 : -1)); + } + + function* ia(t) { + let e = t - 1, + s = 0; + for (; e >= 0; ) + ((e = xi(e, 0, t - 1)), yield e, s++, (e += s % 2 ? -2 : 1)); + } + + function* oa(t) { + const e = []; + for (let s = 0; s < t; s++) e.push(s); + for (; e.length > 0; ) { + const s = xi( + e.splice(Math.floor(e.length * Math.random()), 1)[0], + 0, + t - 1, + ); + yield s; + } + } + + function* ra(t, e = "up", s = 0) { + switch ( + (Bn(t >= 1, "The number of values must be at least one"), e) + ) { + case "up": + yield* ea(t, Kr); + case "down": + yield* ea(t, ta); + case "upDown": + yield* sa(t, !0); + case "downUp": + yield* sa(t, !1); + case "alternateUp": + yield* ea(t, na); + case "alternateDown": + yield* ea(t, ia); + case "random": + yield* (function* (t) { + for (;;) { + const e = Math.floor(Math.random() * t); + yield e; + } + })(t); + case "randomOnce": + yield* ea(t, oa); + case "randomWalk": + yield* (function* (t) { + let e = Math.floor(Math.random() * t); + for (;;) + (0 === e + ? e++ + : e === t - 1 || Math.random() < 0.5 + ? e-- + : e++, + yield e); + })(t); + } + } + class aa extends Hr { + constructor() { + const t = ui(aa.getDefaults(), arguments, [ + "callback", + "values", + "pattern", + ]); + (super(t), + (this.name = "Pattern"), + (this.callback = t.callback), + (this._values = t.values), + (this._pattern = ra(t.values.length, t.pattern)), + (this._type = t.pattern)); + } + static getDefaults() { + return Object.assign(Hr.getDefaults(), { + pattern: "up", + values: [], + callback: Ei, + }); + } + _tick(t) { + const e = this._pattern.next(); + ((this._index = e.value), + (this._value = this._values[e.value]), + this.callback(t, this._value)); + } + get values() { + return this._values; + } + set values(t) { + ((this._values = t), (this.pattern = this._type)); + } + get value() { + return this._value; + } + get index() { + return this._index; + } + get pattern() { + return this._type; + } + set pattern(t) { + ((this._type = t), + (this._pattern = ra(this._values.length, this._type))); + } + } + class ca extends $r { + constructor() { + const t = ui(ca.getDefaults(), arguments, [ + "callback", + "events", + "subdivision", + ]); + (super(t), + (this.name = "Sequence"), + (this._part = new Jr({ + callback: this._seqCallback.bind(this), + context: this.context, + })), + (this._events = []), + (this._eventsArray = []), + (this._subdivision = this.toTicks(t.subdivision)), + (this.events = t.events), + (this.loop = t.loop), + (this.loopStart = t.loopStart), + (this.loopEnd = t.loopEnd), + (this.playbackRate = t.playbackRate), + (this.probability = t.probability), + (this.humanize = t.humanize), + (this.mute = t.mute), + (this.playbackRate = t.playbackRate)); + } + static getDefaults() { + return Object.assign(di($r.getDefaults(), ["value"]), { + events: [], + loop: !0, + loopEnd: 0, + loopStart: 0, + subdivision: "8n", + }); + } + _seqCallback(t, e) { + null === e || this.mute || this.callback(t, e); + } + get events() { + return this._events; + } + set events(t) { + (this.clear(), + (this._eventsArray = t), + (this._events = this._createSequence(this._eventsArray)), + this._eventsUpdated()); + } + start(t, e) { + return (this._part.start(t, e ? this._indexTime(e) : e), this); + } + stop(t) { + return (this._part.stop(t), this); + } + get subdivision() { + return new Co(this.context, this._subdivision).toSeconds(); + } + _createSequence(t) { + return new Proxy(t, { + get: (t, e) => t[e], + set: (t, e, s) => ( + zn(e) && isFinite(parseInt(e, 10)) && Ln(s) + ? (t[e] = this._createSequence(s)) + : (t[e] = s), + this._eventsUpdated(), + !0 + ), + }); + } + _eventsUpdated() { + (this._part.clear(), + this._rescheduleSequence( + this._eventsArray, + this._subdivision, + this.startOffset, + ), + (this.loopEnd = this.loopEnd)); + } + _rescheduleSequence(t, e, s) { + t.forEach((t, n) => { + const i = n * e + s; + if (Ln(t)) this._rescheduleSequence(t, e / t.length, i); + else { + const e = new Co(this.context, i, "i").toSeconds(); + this._part.add(e, t); + } + }); + } + _indexTime(t) { + return new Co( + this.context, + t * this._subdivision + this.startOffset, + ).toSeconds(); + } + clear() { + return (this._part.clear(), this); + } + dispose() { + return (super.dispose(), this._part.dispose(), this); + } + get loop() { + return this._part.loop; + } + set loop(t) { + this._part.loop = t; + } + get loopStart() { + return this._loopStart; + } + set loopStart(t) { + ((this._loopStart = t), + (this._part.loopStart = this._indexTime(t))); + } + get loopEnd() { + return this._loopEnd; + } + set loopEnd(t) { + ((this._loopEnd = t), + (this._part.loopEnd = + 0 === t + ? this._indexTime(this._eventsArray.length) + : this._indexTime(t))); + } + get startOffset() { + return this._part.startOffset; + } + set startOffset(t) { + this._part.startOffset = t; + } + get playbackRate() { + return this._part.playbackRate; + } + set playbackRate(t) { + this._part.playbackRate = t; + } + get probability() { + return this._part.probability; + } + set probability(t) { + this._part.probability = t; + } + get progress() { + return this._part.progress; + } + get humanize() { + return this._part.humanize; + } + set humanize(t) { + this._part.humanize = t; + } + get length() { + return this._part.length; + } + } + class ha extends io { + constructor() { + const t = ui(ha.getDefaults(), arguments, ["fade"]); + (super(t), + (this.name = "CrossFade"), + (this._panner = this.context.createStereoPanner()), + (this._split = this.context.createChannelSplitter(2)), + (this._g2a = new fr({ + context: this.context, + })), + (this.a = new ho({ + context: this.context, + gain: 0, + })), + (this.b = new ho({ + context: this.context, + gain: 0, + })), + (this.output = new ho({ + context: this.context, + })), + (this._internalChannels = [this.a, this.b]), + (this.fade = new po({ + context: this.context, + units: "normalRange", + value: t.fade, + })), + Di(this, "fade"), + this.context.getConstant(1).connect(this._panner), + this._panner.connect(this._split), + (this._panner.channelCount = 1), + (this._panner.channelCountMode = "explicit"), + ro(this._split, this.a.gain, 0), + ro(this._split, this.b.gain, 1), + this.fade.chain(this._g2a, this._panner.pan), + this.a.connect(this.output), + this.b.connect(this.output)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + fade: 0.5, + }); + } + dispose() { + return ( + super.dispose(), + this.a.dispose(), + this.b.dispose(), + this.output.dispose(), + this.fade.dispose(), + this._g2a.dispose(), + this._panner.disconnect(), + this._split.disconnect(), + this + ); + } + } + class la extends io { + constructor(t) { + (super(t), + (this.name = "Effect"), + (this._dryWet = new ha({ + context: this.context, + })), + (this.wet = this._dryWet.fade), + (this.effectSend = new ho({ + context: this.context, + })), + (this.effectReturn = new ho({ + context: this.context, + })), + (this.input = new ho({ + context: this.context, + })), + (this.output = this._dryWet), + this.input.fan(this._dryWet.a, this.effectSend), + this.effectReturn.connect(this._dryWet.b), + this.wet.setValueAtTime(t.wet, 0), + (this._internalChannels = [this.effectReturn, this.effectSend]), + Di(this, "wet")); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + wet: 1, + }); + } + connectEffect(t) { + return ( + this._internalChannels.push(t), + this.effectSend.chain(t, this.effectReturn), + this + ); + } + dispose() { + return ( + super.dispose(), + this._dryWet.dispose(), + this.effectSend.dispose(), + this.effectReturn.dispose(), + this.wet.dispose(), + this + ); + } + } + class ua extends la { + constructor(t) { + (super(t), + (this.name = "LFOEffect"), + (this._lfo = new ar({ + context: this.context, + frequency: t.frequency, + amplitude: t.depth, + })), + (this.depth = this._lfo.amplitude), + (this.frequency = this._lfo.frequency), + (this.type = t.type), + Di(this, ["frequency", "depth"])); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + frequency: 1, + type: "sine", + depth: 1, + }); + } + start(t) { + return (this._lfo.start(t), this); + } + stop(t) { + return (this._lfo.stop(t), this); + } + sync() { + return (this._lfo.sync(), this); + } + unsync() { + return (this._lfo.unsync(), this); + } + get type() { + return this._lfo.type; + } + set type(t) { + this._lfo.type = t; + } + dispose() { + return ( + super.dispose(), + this._lfo.dispose(), + this.frequency.dispose(), + this.depth.dispose(), + this + ); + } + } + class pa extends ua { + constructor() { + const t = ui(pa.getDefaults(), arguments, [ + "frequency", + "baseFrequency", + "octaves", + ]); + (super(t), + (this.name = "AutoFilter"), + (this.filter = new Mr( + Object.assign(t.filter, { + context: this.context, + }), + )), + this.connectEffect(this.filter), + this._lfo.connect(this.filter.frequency), + (this.octaves = t.octaves), + (this.baseFrequency = t.baseFrequency)); + } + static getDefaults() { + return Object.assign(ua.getDefaults(), { + baseFrequency: 200, + octaves: 2.6, + filter: { + type: "lowpass", + rolloff: -12, + Q: 1, + }, + }); + } + get baseFrequency() { + return this._lfo.min; + } + set baseFrequency(t) { + ((this._lfo.min = this.toFrequency(t)), + (this.octaves = this._octaves)); + } + get octaves() { + return this._octaves; + } + set octaves(t) { + ((this._octaves = t), + (this._lfo.max = this._lfo.min * Math.pow(2, t))); + } + dispose() { + return (super.dispose(), this.filter.dispose(), this); + } + } + class da extends io { + constructor() { + const t = ui(da.getDefaults(), arguments, ["pan"]); + (super(t), + (this.name = "Panner"), + (this._panner = this.context.createStereoPanner()), + (this.input = this._panner), + (this.output = this._panner), + (this.pan = new no({ + context: this.context, + param: this._panner.pan, + value: t.pan, + minValue: -1, + maxValue: 1, + })), + (this._panner.channelCount = t.channelCount), + (this._panner.channelCountMode = "explicit"), + Di(this, "pan")); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + pan: 0, + channelCount: 1, + }); + } + dispose() { + return ( + super.dispose(), + this._panner.disconnect(), + this.pan.dispose(), + this + ); + } + } + class fa extends ua { + constructor() { + const t = ui(fa.getDefaults(), arguments, ["frequency"]); + (super(t), + (this.name = "AutoPanner"), + (this._panner = new da({ + context: this.context, + channelCount: t.channelCount, + })), + this.connectEffect(this._panner), + this._lfo.connect(this._panner.pan), + (this._lfo.min = -1), + (this._lfo.max = 1)); + } + static getDefaults() { + return Object.assign(ua.getDefaults(), { + channelCount: 1, + }); + } + dispose() { + return (super.dispose(), this._panner.dispose(), this); + } + } + class _a extends io { + constructor() { + const t = ui(_a.getDefaults(), arguments, ["smoothing"]); + (super(t), + (this.name = "Follower"), + (this._abs = this.input = + new dr({ + context: this.context, + })), + (this._lowpass = this.output = + new Gr({ + context: this.context, + frequency: 1 / this.toSeconds(t.smoothing), + type: "lowpass", + })), + this._abs.connect(this._lowpass), + (this._smoothing = t.smoothing)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + smoothing: 0.05, + }); + } + get smoothing() { + return this._smoothing; + } + set smoothing(t) { + ((this._smoothing = t), + (this._lowpass.frequency = 1 / this.toSeconds(this.smoothing))); + } + dispose() { + return ( + super.dispose(), + this._abs.dispose(), + this._lowpass.dispose(), + this + ); + } + } + class ma extends la { + constructor() { + const t = ui(ma.getDefaults(), arguments, [ + "baseFrequency", + "octaves", + "sensitivity", + ]); + (super(t), + (this.name = "AutoWah"), + (this._follower = new _a({ + context: this.context, + smoothing: t.follower, + })), + (this._sweepRange = new yr({ + context: this.context, + min: 0, + max: 1, + exponent: 0.5, + })), + (this._baseFrequency = this.toFrequency(t.baseFrequency)), + (this._octaves = t.octaves), + (this._inputBoost = new ho({ + context: this.context, + })), + (this._bandpass = new Mr({ + context: this.context, + rolloff: -48, + frequency: 0, + Q: t.Q, + })), + (this._peaking = new Mr({ + context: this.context, + type: "peaking", + })), + (this._peaking.gain.value = t.gain), + (this.gain = this._peaking.gain), + (this.Q = this._bandpass.Q), + this.effectSend.chain( + this._inputBoost, + this._follower, + this._sweepRange, + ), + this._sweepRange.connect(this._bandpass.frequency), + this._sweepRange.connect(this._peaking.frequency), + this.effectSend.chain( + this._bandpass, + this._peaking, + this.effectReturn, + ), + this._setSweepRange(), + (this.sensitivity = t.sensitivity), + Di(this, ["gain", "Q"])); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + baseFrequency: 100, + octaves: 6, + sensitivity: 0, + Q: 2, + gain: 2, + follower: 0.2, + }); + } + get octaves() { + return this._octaves; + } + set octaves(t) { + ((this._octaves = t), this._setSweepRange()); + } + get follower() { + return this._follower.smoothing; + } + set follower(t) { + this._follower.smoothing = t; + } + get baseFrequency() { + return this._baseFrequency; + } + set baseFrequency(t) { + ((this._baseFrequency = this.toFrequency(t)), + this._setSweepRange()); + } + get sensitivity() { + return Li(1 / this._inputBoost.gain.value); + } + set sensitivity(t) { + this._inputBoost.gain.value = 1 / ji(t); + } + _setSweepRange() { + ((this._sweepRange.min = this._baseFrequency), + (this._sweepRange.max = Math.min( + this._baseFrequency * Math.pow(2, this._octaves), + this.context.sampleRate / 2, + ))); + } + dispose() { + return ( + super.dispose(), + this._follower.dispose(), + this._sweepRange.dispose(), + this._bandpass.dispose(), + this._peaking.dispose(), + this._inputBoost.dispose(), + this + ); + } + } + const ga = "bit-crusher"; + zr( + ga, + "\n\tclass BitCrusherWorklet extends SingleIOProcessor {\n\n\t\tstatic get parameterDescriptors() {\n\t\t\treturn [{\n\t\t\t\tname: \"bits\",\n\t\t\t\tdefaultValue: 12,\n\t\t\t\tminValue: 1,\n\t\t\t\tmaxValue: 16,\n\t\t\t\tautomationRate: 'k-rate'\n\t\t\t}];\n\t\t}\n\n\t\tgenerate(input, _channel, parameters) {\n\t\t\tconst step = Math.pow(0.5, parameters.bits - 1);\n\t\t\tconst val = step * Math.floor(input / step + 0.5);\n\t\t\treturn val;\n\t\t}\n\t}\n", + ); + class va extends la { + constructor() { + const t = ui(va.getDefaults(), arguments, ["bits"]); + (super(t), + (this.name = "BitCrusher"), + (this._bitCrusherWorklet = new ya({ + context: this.context, + bits: t.bits, + })), + this.connectEffect(this._bitCrusherWorklet), + (this.bits = this._bitCrusherWorklet.bits)); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + bits: 4, + }); + } + dispose() { + return (super.dispose(), this._bitCrusherWorklet.dispose(), this); + } + } + class ya extends Wr { + constructor() { + const t = ui(ya.getDefaults(), arguments); + (super(t), + (this.name = "BitCrusherWorklet"), + (this.input = new ho({ + context: this.context, + })), + (this.output = new ho({ + context: this.context, + })), + (this.bits = new no({ + context: this.context, + value: t.bits, + units: "positive", + minValue: 1, + maxValue: 16, + param: this._dummyParam, + swappable: !0, + }))); + } + static getDefaults() { + return Object.assign(Wr.getDefaults(), { + bits: 12, + }); + } + _audioWorkletName() { + return ga; + } + onReady(t) { + oo(this.input, t, this.output); + const e = t.parameters.get("bits"); + this.bits.setParam(e); + } + dispose() { + return ( + super.dispose(), + this.input.dispose(), + this.output.dispose(), + this.bits.dispose(), + this + ); + } + } + class xa extends la { + constructor() { + const t = ui(xa.getDefaults(), arguments, ["order"]); + (super(t), + (this.name = "Chebyshev"), + (this._shaper = new Io({ + context: this.context, + length: 4096, + })), + (this._order = t.order), + this.connectEffect(this._shaper), + (this.order = t.order), + (this.oversample = t.oversample)); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + order: 1, + oversample: "none", + }); + } + _getCoefficient(t, e, s) { + return ( + s.has(e) || + (0 === e + ? s.set(e, 0) + : 1 === e + ? s.set(e, t) + : s.set( + e, + 2 * t * this._getCoefficient(t, e - 1, s) - + this._getCoefficient(t, e - 2, s), + )), + s.get(e) + ); + } + get order() { + return this._order; + } + set order(t) { + (Bn(Number.isInteger(t), "'order' must be an integer"), + (this._order = t), + this._shaper.setMap((e) => + this._getCoefficient(e, t, new Map()), + )); + } + get oversample() { + return this._shaper.oversample; + } + set oversample(t) { + this._shaper.oversample = t; + } + dispose() { + return (super.dispose(), this._shaper.dispose(), this); + } + } + class wa extends io { + constructor() { + const t = ui(wa.getDefaults(), arguments, ["channels"]); + (super(t), + (this.name = "Split"), + (this._splitter = + this.input = + this.output = + this.context.createChannelSplitter(t.channels)), + (this._internalChannels = [this._splitter])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + channels: 2, + }); + } + dispose() { + return (super.dispose(), this._splitter.disconnect(), this); + } + } + class ba extends io { + constructor() { + const t = ui(ba.getDefaults(), arguments, ["channels"]); + (super(t), + (this.name = "Merge"), + (this._merger = + this.output = + this.input = + this.context.createChannelMerger(t.channels))); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + channels: 2, + }); + } + dispose() { + return (super.dispose(), this._merger.disconnect(), this); + } + } + class Ta extends io { + constructor(t) { + (super(t), + (this.name = "StereoEffect"), + (this.input = new ho({ + context: this.context, + })), + (this.input.channelCount = 2), + (this.input.channelCountMode = "explicit"), + (this._dryWet = this.output = + new ha({ + context: this.context, + fade: t.wet, + })), + (this.wet = this._dryWet.fade), + (this._split = new wa({ + context: this.context, + channels: 2, + })), + (this._merge = new ba({ + context: this.context, + channels: 2, + })), + this.input.connect(this._split), + this.input.connect(this._dryWet.a), + this._merge.connect(this._dryWet.b), + Di(this, ["wet"])); + } + connectEffectLeft(...t) { + (this._split.connect(t[0], 0, 0), + oo(...t), + ro(t[t.length - 1], this._merge, 0, 0)); + } + connectEffectRight(...t) { + (this._split.connect(t[0], 1, 0), + oo(...t), + ro(t[t.length - 1], this._merge, 0, 1)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + wet: 1, + }); + } + dispose() { + return ( + super.dispose(), + this._dryWet.dispose(), + this._split.dispose(), + this._merge.dispose(), + this + ); + } + } + class Sa extends Ta { + constructor(t) { + (super(t), + (this.feedback = new po({ + context: this.context, + value: t.feedback, + units: "normalRange", + })), + (this._feedbackL = new ho({ + context: this.context, + })), + (this._feedbackR = new ho({ + context: this.context, + })), + (this._feedbackSplit = new wa({ + context: this.context, + channels: 2, + })), + (this._feedbackMerge = new ba({ + context: this.context, + channels: 2, + })), + this._merge.connect(this._feedbackSplit), + this._feedbackMerge.connect(this._split), + this._feedbackSplit.connect(this._feedbackL, 0, 0), + this._feedbackL.connect(this._feedbackMerge, 0, 0), + this._feedbackSplit.connect(this._feedbackR, 1, 0), + this._feedbackR.connect(this._feedbackMerge, 0, 1), + this.feedback.fan(this._feedbackL.gain, this._feedbackR.gain), + Di(this, ["feedback"])); + } + static getDefaults() { + return Object.assign(Ta.getDefaults(), { + feedback: 0.5, + }); + } + dispose() { + return ( + super.dispose(), + this.feedback.dispose(), + this._feedbackL.dispose(), + this._feedbackR.dispose(), + this._feedbackSplit.dispose(), + this._feedbackMerge.dispose(), + this + ); + } + } + class ka extends Sa { + constructor() { + const t = ui(ka.getDefaults(), arguments, [ + "frequency", + "delayTime", + "depth", + ]); + (super(t), + (this.name = "Chorus"), + (this._depth = t.depth), + (this._delayTime = t.delayTime / 1e3), + (this._lfoL = new ar({ + context: this.context, + frequency: t.frequency, + min: 0, + max: 1, + })), + (this._lfoR = new ar({ + context: this.context, + frequency: t.frequency, + min: 0, + max: 1, + phase: 180, + })), + (this._delayNodeL = new yo({ + context: this.context, + })), + (this._delayNodeR = new yo({ + context: this.context, + })), + (this.frequency = this._lfoL.frequency), + Di(this, ["frequency"]), + this._lfoL.frequency.connect(this._lfoR.frequency), + this.connectEffectLeft(this._delayNodeL), + this.connectEffectRight(this._delayNodeR), + this._lfoL.connect(this._delayNodeL.delayTime), + this._lfoR.connect(this._delayNodeR.delayTime), + (this.depth = this._depth), + (this.type = t.type), + (this.spread = t.spread)); + } + static getDefaults() { + return Object.assign(Sa.getDefaults(), { + frequency: 1.5, + delayTime: 3.5, + depth: 0.7, + type: "sine", + spread: 180, + feedback: 0, + wet: 0.5, + }); + } + get depth() { + return this._depth; + } + set depth(t) { + this._depth = t; + const e = this._delayTime * t; + ((this._lfoL.min = Math.max(this._delayTime - e, 0)), + (this._lfoL.max = this._delayTime + e), + (this._lfoR.min = Math.max(this._delayTime - e, 0)), + (this._lfoR.max = this._delayTime + e)); + } + get delayTime() { + return 1e3 * this._delayTime; + } + set delayTime(t) { + ((this._delayTime = t / 1e3), (this.depth = this._depth)); + } + get type() { + return this._lfoL.type; + } + set type(t) { + ((this._lfoL.type = t), (this._lfoR.type = t)); + } + get spread() { + return this._lfoR.phase - this._lfoL.phase; + } + set spread(t) { + ((this._lfoL.phase = 90 - t / 2), (this._lfoR.phase = t / 2 + 90)); + } + start(t) { + return (this._lfoL.start(t), this._lfoR.start(t), this); + } + stop(t) { + return (this._lfoL.stop(t), this._lfoR.stop(t), this); + } + sync() { + return (this._lfoL.sync(), this._lfoR.sync(), this); + } + unsync() { + return (this._lfoL.unsync(), this._lfoR.unsync(), this); + } + dispose() { + return ( + super.dispose(), + this._lfoL.dispose(), + this._lfoR.dispose(), + this._delayNodeL.dispose(), + this._delayNodeR.dispose(), + this.frequency.dispose(), + this + ); + } + } + class Aa extends la { + constructor() { + const t = ui(Aa.getDefaults(), arguments, ["distortion"]); + (super(t), + (this.name = "Distortion"), + (this._shaper = new Io({ + context: this.context, + length: 4096, + })), + (this._distortion = t.distortion), + this.connectEffect(this._shaper), + (this.distortion = t.distortion), + (this.oversample = t.oversample)); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + distortion: 0.4, + oversample: "none", + }); + } + get distortion() { + return this._distortion; + } + set distortion(t) { + this._distortion = t; + const e = 100 * t, + s = Math.PI / 180; + this._shaper.setMap((t) => + Math.abs(t) < 0.001 + ? 0 + : ((3 + e) * t * 20 * s) / (Math.PI + e * Math.abs(t)), + ); + } + get oversample() { + return this._shaper.oversample; + } + set oversample(t) { + this._shaper.oversample = t; + } + dispose() { + return (super.dispose(), this._shaper.dispose(), this); + } + } + class Ca extends la { + constructor(t) { + (super(t), + (this.name = "FeedbackEffect"), + (this._feedbackGain = new ho({ + context: this.context, + gain: t.feedback, + units: "normalRange", + })), + (this.feedback = this._feedbackGain.gain), + Di(this, "feedback"), + this.effectReturn.chain(this._feedbackGain, this.effectSend)); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + feedback: 0.125, + }); + } + dispose() { + return ( + super.dispose(), + this._feedbackGain.dispose(), + this.feedback.dispose(), + this + ); + } + } + class Oa extends Ca { + constructor() { + const t = ui(Oa.getDefaults(), arguments, [ + "delayTime", + "feedback", + ]); + (super(t), + (this.name = "FeedbackDelay"), + (this._delayNode = new yo({ + context: this.context, + delayTime: t.delayTime, + maxDelay: t.maxDelay, + })), + (this.delayTime = this._delayNode.delayTime), + this.connectEffect(this._delayNode), + Di(this, "delayTime")); + } + static getDefaults() { + return Object.assign(Ca.getDefaults(), { + delayTime: 0.25, + maxDelay: 1, + }); + } + dispose() { + return ( + super.dispose(), + this._delayNode.dispose(), + this.delayTime.dispose(), + this + ); + } + } + class Da extends io { + constructor(t) { + (super(t), + (this.name = "PhaseShiftAllpass"), + (this.input = new ho({ + context: this.context, + })), + (this.output = new ho({ + context: this.context, + })), + (this.offset90 = new ho({ + context: this.context, + })), + (this._bank0 = this._createAllPassFilterBank([ + 0.6923878, 0.9360654322959, 0.988229522686, 0.9987488452737, + ])), + (this._bank1 = this._createAllPassFilterBank([ + 0.4021921162426, 0.856171088242, 0.9722909545651, + 0.9952884791278, + ])), + (this._oneSampleDelay = this.context.createIIRFilter( + [0, 1], + [1, 0], + )), + oo(this.input, ...this._bank0, this._oneSampleDelay, this.output), + oo(this.input, ...this._bank1, this.offset90)); + } + _createAllPassFilterBank(t) { + return t.map((t) => { + const e = [ + [t * t, 0, -1], + [1, 0, -t * t], + ]; + return this.context.createIIRFilter(e[0], e[1]); + }); + } + dispose() { + return ( + super.dispose(), + this.input.dispose(), + this.output.dispose(), + this.offset90.dispose(), + this._bank0.forEach((t) => t.disconnect()), + this._bank1.forEach((t) => t.disconnect()), + this._oneSampleDelay.disconnect(), + this + ); + } + } + class Ma extends la { + constructor() { + const t = ui(Ma.getDefaults(), arguments, ["frequency"]); + (super(t), + (this.name = "FrequencyShifter"), + (this.frequency = new po({ + context: this.context, + units: "frequency", + value: t.frequency, + minValue: -this.context.sampleRate / 2, + maxValue: this.context.sampleRate / 2, + })), + (this._sine = new Zo({ + context: this.context, + type: "sine", + })), + (this._cosine = new Xo({ + context: this.context, + phase: -90, + type: "sine", + })), + (this._sineMultiply = new $o({ + context: this.context, + })), + (this._cosineMultiply = new $o({ + context: this.context, + })), + (this._negate = new _r({ + context: this.context, + })), + (this._add = new ir({ + context: this.context, + })), + (this._phaseShifter = new Da({ + context: this.context, + })), + this.effectSend.connect(this._phaseShifter), + this.frequency.fan(this._sine.frequency, this._cosine.frequency), + this._phaseShifter.offset90.connect(this._cosineMultiply), + this._cosine.connect(this._cosineMultiply.factor), + this._phaseShifter.connect(this._sineMultiply), + this._sine.connect(this._sineMultiply.factor), + this._sineMultiply.connect(this._negate), + this._cosineMultiply.connect(this._add), + this._negate.connect(this._add.addend), + this._add.connect(this.effectReturn)); + const e = this.immediate(); + (this._sine.start(e), this._cosine.start(e)); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + frequency: 0, + }); + } + dispose() { + return ( + super.dispose(), + this.frequency.dispose(), + this._add.dispose(), + this._cosine.dispose(), + this._cosineMultiply.dispose(), + this._negate.dispose(), + this._phaseShifter.dispose(), + this._sine.dispose(), + this._sineMultiply.dispose(), + this + ); + } + } + const Ea = [ + 1557 / 44100, + 1617 / 44100, + 1491 / 44100, + 1422 / 44100, + 1277 / 44100, + 1356 / 44100, + 1188 / 44100, + 1116 / 44100, + ], + Ra = [225, 556, 441, 341]; + class qa extends Ta { + constructor() { + const t = ui(qa.getDefaults(), arguments, [ + "roomSize", + "dampening", + ]); + (super(t), + (this.name = "Freeverb"), + (this._combFilters = []), + (this._allpassFiltersL = []), + (this._allpassFiltersR = []), + (this.roomSize = new po({ + context: this.context, + value: t.roomSize, + units: "normalRange", + })), + (this._allpassFiltersL = Ra.map((t) => { + const e = this.context.createBiquadFilter(); + return ((e.type = "allpass"), (e.frequency.value = t), e); + })), + (this._allpassFiltersR = Ra.map((t) => { + const e = this.context.createBiquadFilter(); + return ((e.type = "allpass"), (e.frequency.value = t), e); + })), + (this._combFilters = Ea.map((e, s) => { + const n = new Qr({ + context: this.context, + dampening: t.dampening, + delayTime: e, + }); + return ( + s < Ea.length / 2 + ? this.connectEffectLeft(n, ...this._allpassFiltersL) + : this.connectEffectRight(n, ...this._allpassFiltersR), + this.roomSize.connect(n.resonance), + n + ); + })), + Di(this, ["roomSize"])); + } + static getDefaults() { + return Object.assign(Ta.getDefaults(), { + roomSize: 0.7, + dampening: 3e3, + }); + } + get dampening() { + return this._combFilters[0].dampening; + } + set dampening(t) { + this._combFilters.forEach((e) => (e.dampening = t)); + } + dispose() { + return ( + super.dispose(), + this._allpassFiltersL.forEach((t) => t.disconnect()), + this._allpassFiltersR.forEach((t) => t.disconnect()), + this._combFilters.forEach((t) => t.dispose()), + this.roomSize.dispose(), + this + ); + } + } + const Ia = [0.06748, 0.06404, 0.08212, 0.09004], + Fa = [0.773, 0.802, 0.753, 0.733], + Va = [347, 113, 37]; + class Na extends Ta { + constructor() { + const t = ui(Na.getDefaults(), arguments, ["roomSize"]); + (super(t), + (this.name = "JCReverb"), + (this._allpassFilters = []), + (this._feedbackCombFilters = []), + (this.roomSize = new po({ + context: this.context, + value: t.roomSize, + units: "normalRange", + })), + (this._scaleRoomSize = new or({ + context: this.context, + min: -0.733, + max: 0.197, + })), + (this._allpassFilters = Va.map((t) => { + const e = this.context.createBiquadFilter(); + return ((e.type = "allpass"), (e.frequency.value = t), e); + })), + (this._feedbackCombFilters = Ia.map((t, e) => { + const s = new Ur({ + context: this.context, + delayTime: t, + }); + return ( + this._scaleRoomSize.connect(s.resonance), + (s.resonance.value = Fa[e]), + e < Ia.length / 2 + ? this.connectEffectLeft(...this._allpassFilters, s) + : this.connectEffectRight(...this._allpassFilters, s), + s + ); + })), + this.roomSize.connect(this._scaleRoomSize), + Di(this, ["roomSize"])); + } + static getDefaults() { + return Object.assign(Ta.getDefaults(), { + roomSize: 0.5, + }); + } + dispose() { + return ( + super.dispose(), + this._allpassFilters.forEach((t) => t.disconnect()), + this._feedbackCombFilters.forEach((t) => t.dispose()), + this.roomSize.dispose(), + this._scaleRoomSize.dispose(), + this + ); + } + } + class Pa extends Sa { + constructor(t) { + (super(t), + this._feedbackL.disconnect(), + this._feedbackL.connect(this._feedbackMerge, 0, 1), + this._feedbackR.disconnect(), + this._feedbackR.connect(this._feedbackMerge, 0, 0), + Di(this, ["feedback"])); + } + } + class ja extends Pa { + constructor() { + const t = ui(ja.getDefaults(), arguments, [ + "delayTime", + "feedback", + ]); + (super(t), + (this.name = "PingPongDelay"), + (this._leftDelay = new yo({ + context: this.context, + maxDelay: t.maxDelay, + })), + (this._rightDelay = new yo({ + context: this.context, + maxDelay: t.maxDelay, + })), + (this._rightPreDelay = new yo({ + context: this.context, + maxDelay: t.maxDelay, + })), + (this.delayTime = new po({ + context: this.context, + units: "time", + value: t.delayTime, + })), + this.connectEffectLeft(this._leftDelay), + this.connectEffectRight(this._rightPreDelay, this._rightDelay), + this.delayTime.fan( + this._leftDelay.delayTime, + this._rightDelay.delayTime, + this._rightPreDelay.delayTime, + ), + this._feedbackL.disconnect(), + this._feedbackL.connect(this._rightDelay), + Di(this, ["delayTime"])); + } + static getDefaults() { + return Object.assign(Pa.getDefaults(), { + delayTime: 0.25, + maxDelay: 1, + }); + } + dispose() { + return ( + super.dispose(), + this._leftDelay.dispose(), + this._rightDelay.dispose(), + this._rightPreDelay.dispose(), + this.delayTime.dispose(), + this + ); + } + } + class La extends Ca { + constructor() { + const t = ui(La.getDefaults(), arguments, ["pitch"]); + (super(t), + (this.name = "PitchShift"), + (this._frequency = new po({ + context: this.context, + })), + (this._delayA = new yo({ + maxDelay: 1, + context: this.context, + })), + (this._lfoA = new ar({ + context: this.context, + min: 0, + max: 0.1, + type: "sawtooth", + }).connect(this._delayA.delayTime)), + (this._delayB = new yo({ + maxDelay: 1, + context: this.context, + })), + (this._lfoB = new ar({ + context: this.context, + min: 0, + max: 0.1, + type: "sawtooth", + phase: 180, + }).connect(this._delayB.delayTime)), + (this._crossFade = new ha({ + context: this.context, + })), + (this._crossFadeLFO = new ar({ + context: this.context, + min: 0, + max: 1, + type: "triangle", + phase: 90, + }).connect(this._crossFade.fade)), + (this._feedbackDelay = new yo({ + delayTime: t.delayTime, + context: this.context, + })), + (this.delayTime = this._feedbackDelay.delayTime), + Di(this, "delayTime"), + (this._pitch = t.pitch), + (this._windowSize = t.windowSize), + this._delayA.connect(this._crossFade.a), + this._delayB.connect(this._crossFade.b), + this._frequency.fan( + this._lfoA.frequency, + this._lfoB.frequency, + this._crossFadeLFO.frequency, + ), + this.effectSend.fan(this._delayA, this._delayB), + this._crossFade.chain(this._feedbackDelay, this.effectReturn)); + const e = this.now(); + (this._lfoA.start(e), + this._lfoB.start(e), + this._crossFadeLFO.start(e), + (this.windowSize = this._windowSize)); + } + static getDefaults() { + return Object.assign(Ca.getDefaults(), { + pitch: 0, + windowSize: 0.1, + delayTime: 0, + feedback: 0, + }); + } + get pitch() { + return this._pitch; + } + set pitch(t) { + this._pitch = t; + let e = 0; + (t < 0 + ? ((this._lfoA.min = 0), + (this._lfoA.max = this._windowSize), + (this._lfoB.min = 0), + (this._lfoB.max = this._windowSize), + (e = zi(t - 1) + 1)) + : ((this._lfoA.min = this._windowSize), + (this._lfoA.max = 0), + (this._lfoB.min = this._windowSize), + (this._lfoB.max = 0), + (e = zi(t) - 1)), + (this._frequency.value = e * (1.2 / this._windowSize))); + } + get windowSize() { + return this._windowSize; + } + set windowSize(t) { + ((this._windowSize = this.toSeconds(t)), + (this.pitch = this._pitch)); + } + dispose() { + return ( + super.dispose(), + this._frequency.dispose(), + this._delayA.dispose(), + this._delayB.dispose(), + this._lfoA.dispose(), + this._lfoB.dispose(), + this._crossFade.dispose(), + this._crossFadeLFO.dispose(), + this._feedbackDelay.dispose(), + this + ); + } + } + class za extends Ta { + constructor() { + const t = ui(za.getDefaults(), arguments, [ + "frequency", + "octaves", + "baseFrequency", + ]); + (super(t), + (this.name = "Phaser"), + (this._lfoL = new ar({ + context: this.context, + frequency: t.frequency, + min: 0, + max: 1, + })), + (this._lfoR = new ar({ + context: this.context, + frequency: t.frequency, + min: 0, + max: 1, + phase: 180, + })), + (this._baseFrequency = this.toFrequency(t.baseFrequency)), + (this._octaves = t.octaves), + (this.Q = new po({ + context: this.context, + value: t.Q, + units: "positive", + })), + (this._filtersL = this._makeFilters(t.stages, this._lfoL)), + (this._filtersR = this._makeFilters(t.stages, this._lfoR)), + (this.frequency = this._lfoL.frequency), + (this.frequency.value = t.frequency), + this.connectEffectLeft(...this._filtersL), + this.connectEffectRight(...this._filtersR), + this._lfoL.frequency.connect(this._lfoR.frequency), + (this.baseFrequency = t.baseFrequency), + (this.octaves = t.octaves), + this._lfoL.start(), + this._lfoR.start(), + Di(this, ["frequency", "Q"])); + } + static getDefaults() { + return Object.assign(Ta.getDefaults(), { + frequency: 0.5, + octaves: 3, + stages: 10, + Q: 10, + baseFrequency: 350, + }); + } + _makeFilters(t, e) { + const s = []; + for (let n = 0; n < t; n++) { + const t = this.context.createBiquadFilter(); + ((t.type = "allpass"), + this.Q.connect(t.Q), + e.connect(t.frequency), + s.push(t)); + } + return s; + } + get octaves() { + return this._octaves; + } + set octaves(t) { + this._octaves = t; + const e = this._baseFrequency * Math.pow(2, t); + ((this._lfoL.max = e), (this._lfoR.max = e)); + } + get baseFrequency() { + return this._baseFrequency; + } + set baseFrequency(t) { + ((this._baseFrequency = this.toFrequency(t)), + (this._lfoL.min = this._baseFrequency), + (this._lfoR.min = this._baseFrequency), + (this.octaves = this._octaves)); + } + dispose() { + return ( + super.dispose(), + this.Q.dispose(), + this._lfoL.dispose(), + this._lfoR.dispose(), + this._filtersL.forEach((t) => t.disconnect()), + this._filtersR.forEach((t) => t.disconnect()), + this.frequency.dispose(), + this + ); + } + } + class Wa extends la { + constructor() { + const t = ui(Wa.getDefaults(), arguments, ["decay"]); + (super(t), + (this.name = "Reverb"), + (this._convolver = this.context.createConvolver()), + (this.ready = Promise.resolve())); + const e = this.toSeconds(t.decay); + (Un(e, 0.001), (this._decay = e)); + const s = this.toSeconds(t.preDelay); + (Un(s, 0), + (this._preDelay = s), + this.generate(), + this.connectEffect(this._convolver)); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + decay: 1.5, + preDelay: 0.01, + }); + } + get decay() { + return this._decay; + } + set decay(t) { + (Un((t = this.toSeconds(t)), 0.001), + (this._decay = t), + this.generate()); + } + get preDelay() { + return this._preDelay; + } + set preDelay(t) { + (Un((t = this.toSeconds(t)), 0), + (this._preDelay = t), + this.generate()); + } + generate() { + return ni(this, void 0, void 0, function* () { + const t = this.ready, + e = new qi( + 2, + this._decay + this._preDelay, + this.context.sampleRate, + ), + s = new zo({ + context: e, + }), + n = new zo({ + context: e, + }), + i = new ba({ + context: e, + }); + (s.connect(i, 0, 0), n.connect(i, 0, 1)); + const o = new ho({ + context: e, + }).toDestination(); + (i.connect(o), + s.start(0), + n.start(0), + o.gain.setValueAtTime(0, 0), + o.gain.setValueAtTime(1, this._preDelay), + o.gain.exponentialApproachValueAtTime( + 0, + this._preDelay, + this.decay, + )); + const r = e.render(); + return ( + (this.ready = r.then(Ei)), + yield t, + (this._convolver.buffer = (yield r).get()), + this + ); + }); + } + dispose() { + return (super.dispose(), this._convolver.disconnect(), this); + } + } + class Ba extends io { + constructor() { + (super(ui(Ba.getDefaults(), arguments)), + (this.name = "MidSideSplit"), + (this._split = this.input = + new wa({ + channels: 2, + context: this.context, + })), + (this._midAdd = new ir({ + context: this.context, + })), + (this.mid = new $o({ + context: this.context, + value: Math.SQRT1_2, + })), + (this._sideSubtract = new mr({ + context: this.context, + })), + (this.side = new $o({ + context: this.context, + value: Math.SQRT1_2, + })), + this._split.connect(this._midAdd, 0), + this._split.connect(this._midAdd.addend, 1), + this._split.connect(this._sideSubtract, 0), + this._split.connect(this._sideSubtract.subtrahend, 1), + this._midAdd.connect(this.mid), + this._sideSubtract.connect(this.side)); + } + dispose() { + return ( + super.dispose(), + this.mid.dispose(), + this.side.dispose(), + this._midAdd.dispose(), + this._sideSubtract.dispose(), + this._split.dispose(), + this + ); + } + } + class Ua extends io { + constructor() { + (super(ui(Ua.getDefaults(), arguments)), + (this.name = "MidSideMerge"), + (this.mid = new ho({ + context: this.context, + })), + (this.side = new ho({ + context: this.context, + })), + (this._left = new ir({ + context: this.context, + })), + (this._leftMult = new $o({ + context: this.context, + value: Math.SQRT1_2, + })), + (this._right = new mr({ + context: this.context, + })), + (this._rightMult = new $o({ + context: this.context, + value: Math.SQRT1_2, + })), + (this._merge = this.output = + new ba({ + context: this.context, + })), + this.mid.fan(this._left), + this.side.connect(this._left.addend), + this.mid.connect(this._right), + this.side.connect(this._right.subtrahend), + this._left.connect(this._leftMult), + this._right.connect(this._rightMult), + this._leftMult.connect(this._merge, 0, 0), + this._rightMult.connect(this._merge, 0, 1)); + } + dispose() { + return ( + super.dispose(), + this.mid.dispose(), + this.side.dispose(), + this._leftMult.dispose(), + this._rightMult.dispose(), + this._left.dispose(), + this._right.dispose(), + this + ); + } + } + class Ga extends la { + constructor(t) { + (super(t), + (this.name = "MidSideEffect"), + (this._midSideMerge = new Ua({ + context: this.context, + })), + (this._midSideSplit = new Ba({ + context: this.context, + })), + (this._midSend = this._midSideSplit.mid), + (this._sideSend = this._midSideSplit.side), + (this._midReturn = this._midSideMerge.mid), + (this._sideReturn = this._midSideMerge.side), + this.effectSend.connect(this._midSideSplit), + this._midSideMerge.connect(this.effectReturn)); + } + connectEffectMid(...t) { + this._midSend.chain(...t, this._midReturn); + } + connectEffectSide(...t) { + this._sideSend.chain(...t, this._sideReturn); + } + dispose() { + return ( + super.dispose(), + this._midSideSplit.dispose(), + this._midSideMerge.dispose(), + this._midSend.dispose(), + this._sideSend.dispose(), + this._midReturn.dispose(), + this._sideReturn.dispose(), + this + ); + } + } + class Qa extends Ga { + constructor() { + const t = ui(Qa.getDefaults(), arguments, ["width"]); + (super(t), + (this.name = "StereoWidener"), + (this.width = new po({ + context: this.context, + value: t.width, + units: "normalRange", + })), + Di(this, ["width"]), + (this._twoTimesWidthMid = new $o({ + context: this.context, + value: 2, + })), + (this._twoTimesWidthSide = new $o({ + context: this.context, + value: 2, + })), + (this._midMult = new $o({ + context: this.context, + })), + this._twoTimesWidthMid.connect(this._midMult.factor), + this.connectEffectMid(this._midMult), + (this._oneMinusWidth = new mr({ + context: this.context, + })), + this._oneMinusWidth.connect(this._twoTimesWidthMid), + ro(this.context.getConstant(1), this._oneMinusWidth), + this.width.connect(this._oneMinusWidth.subtrahend), + (this._sideMult = new $o({ + context: this.context, + })), + this.width.connect(this._twoTimesWidthSide), + this._twoTimesWidthSide.connect(this._sideMult.factor), + this.connectEffectSide(this._sideMult)); + } + static getDefaults() { + return Object.assign(Ga.getDefaults(), { + width: 0.5, + }); + } + dispose() { + return ( + super.dispose(), + this.width.dispose(), + this._midMult.dispose(), + this._sideMult.dispose(), + this._twoTimesWidthMid.dispose(), + this._twoTimesWidthSide.dispose(), + this._oneMinusWidth.dispose(), + this + ); + } + } + class Za extends Ta { + constructor() { + const t = ui(Za.getDefaults(), arguments, ["frequency", "depth"]); + (super(t), + (this.name = "Tremolo"), + (this._lfoL = new ar({ + context: this.context, + type: t.type, + min: 1, + max: 0, + })), + (this._lfoR = new ar({ + context: this.context, + type: t.type, + min: 1, + max: 0, + })), + (this._amplitudeL = new ho({ + context: this.context, + })), + (this._amplitudeR = new ho({ + context: this.context, + })), + (this.frequency = new po({ + context: this.context, + value: t.frequency, + units: "frequency", + })), + (this.depth = new po({ + context: this.context, + value: t.depth, + units: "normalRange", + })), + Di(this, ["frequency", "depth"]), + this.connectEffectLeft(this._amplitudeL), + this.connectEffectRight(this._amplitudeR), + this._lfoL.connect(this._amplitudeL.gain), + this._lfoR.connect(this._amplitudeR.gain), + this.frequency.fan(this._lfoL.frequency, this._lfoR.frequency), + this.depth.fan(this._lfoR.amplitude, this._lfoL.amplitude), + (this.spread = t.spread)); + } + static getDefaults() { + return Object.assign(Ta.getDefaults(), { + frequency: 10, + type: "sine", + depth: 0.5, + spread: 180, + }); + } + start(t) { + return (this._lfoL.start(t), this._lfoR.start(t), this); + } + stop(t) { + return (this._lfoL.stop(t), this._lfoR.stop(t), this); + } + sync() { + return ( + this._lfoL.sync(), + this._lfoR.sync(), + this.context.transport.syncSignal(this.frequency), + this + ); + } + unsync() { + return ( + this._lfoL.unsync(), + this._lfoR.unsync(), + this.context.transport.unsyncSignal(this.frequency), + this + ); + } + get type() { + return this._lfoL.type; + } + set type(t) { + ((this._lfoL.type = t), (this._lfoR.type = t)); + } + get spread() { + return this._lfoR.phase - this._lfoL.phase; + } + set spread(t) { + ((this._lfoL.phase = 90 - t / 2), (this._lfoR.phase = t / 2 + 90)); + } + dispose() { + return ( + super.dispose(), + this._lfoL.dispose(), + this._lfoR.dispose(), + this._amplitudeL.dispose(), + this._amplitudeR.dispose(), + this.frequency.dispose(), + this.depth.dispose(), + this + ); + } + } + class Xa extends la { + constructor() { + const t = ui(Xa.getDefaults(), arguments, ["frequency", "depth"]); + (super(t), + (this.name = "Vibrato"), + (this._delayNode = new yo({ + context: this.context, + delayTime: 0, + maxDelay: t.maxDelay, + })), + (this._lfo = new ar({ + context: this.context, + type: t.type, + min: 0, + max: t.maxDelay, + frequency: t.frequency, + phase: -90, + }) + .start() + .connect(this._delayNode.delayTime)), + (this.frequency = this._lfo.frequency), + (this.depth = this._lfo.amplitude), + (this.depth.value = t.depth), + Di(this, ["frequency", "depth"]), + this.effectSend.chain(this._delayNode, this.effectReturn)); + } + static getDefaults() { + return Object.assign(la.getDefaults(), { + maxDelay: 0.005, + frequency: 5, + depth: 0.1, + type: "sine", + }); + } + get type() { + return this._lfo.type; + } + set type(t) { + this._lfo.type = t; + } + dispose() { + return ( + super.dispose(), + this._delayNode.dispose(), + this._lfo.dispose(), + this.frequency.dispose(), + this.depth.dispose(), + this + ); + } + } + class Ya extends io { + constructor() { + const t = ui(Ya.getDefaults(), arguments, ["type", "size"]); + (super(t), + (this.name = "Analyser"), + (this._analysers = []), + (this._buffers = []), + (this.input = + this.output = + this._gain = + new ho({ + context: this.context, + })), + (this._split = new wa({ + context: this.context, + channels: t.channels, + })), + this.input.connect(this._split), + Un(t.channels, 1)); + for (let e = 0; e < t.channels; e++) + ((this._analysers[e] = this.context.createAnalyser()), + this._split.connect(this._analysers[e], e, 0)); + ((this.size = t.size), + (this.type = t.type), + (this.smoothing = t.smoothing)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + size: 1024, + smoothing: 0.8, + type: "fft", + channels: 1, + }); + } + getValue() { + return ( + this._analysers.forEach((t, e) => { + const s = this._buffers[e]; + "fft" === this._type + ? t.getFloatFrequencyData(s) + : "waveform" === this._type && t.getFloatTimeDomainData(s); + }), + 1 === this.channels ? this._buffers[0] : this._buffers + ); + } + get size() { + return this._analysers[0].frequencyBinCount; + } + set size(t) { + this._analysers.forEach((e, s) => { + ((e.fftSize = 2 * t), (this._buffers[s] = new Float32Array(t))); + }); + } + get channels() { + return this._analysers.length; + } + get type() { + return this._type; + } + set type(t) { + (Bn( + "waveform" === t || "fft" === t, + `Analyser: invalid type: ${t}`, + ), + (this._type = t)); + } + get smoothing() { + return this._analysers[0].smoothingTimeConstant; + } + set smoothing(t) { + this._analysers.forEach((e) => (e.smoothingTimeConstant = t)); + } + dispose() { + return ( + super.dispose(), + this._analysers.forEach((t) => t.disconnect()), + this._split.dispose(), + this._gain.dispose(), + this + ); + } + } + class $a extends io { + constructor() { + (super(ui($a.getDefaults(), arguments)), + (this.name = "MeterBase"), + (this.input = + this.output = + this._analyser = + new Ya({ + context: this.context, + size: 256, + type: "waveform", + }))); + } + dispose() { + return (super.dispose(), this._analyser.dispose(), this); + } + } + class Ha extends $a { + constructor() { + const t = ui(Ha.getDefaults(), arguments, ["smoothing"]); + (super(t), + (this.name = "Meter"), + (this.input = + this.output = + this._analyser = + new Ya({ + context: this.context, + size: 256, + type: "waveform", + channels: t.channelCount, + })), + (this.smoothing = t.smoothing), + (this.normalRange = t.normalRange), + (this._rms = new Array(t.channelCount)), + this._rms.fill(0)); + } + static getDefaults() { + return Object.assign($a.getDefaults(), { + smoothing: 0.8, + normalRange: !1, + channelCount: 1, + }); + } + getLevel() { + return ( + Kn("'getLevel' has been changed to 'getValue'"), + this.getValue() + ); + } + getValue() { + const t = this._analyser.getValue(), + e = (1 === this.channels ? [t] : t).map((t, e) => { + const s = t.reduce((t, e) => t + e * e, 0), + n = Math.sqrt(s / t.length); + return ( + (this._rms[e] = Math.max(n, this._rms[e] * this.smoothing)), + this.normalRange ? this._rms[e] : Li(this._rms[e]) + ); + }); + return 1 === this.channels ? e[0] : e; + } + get channels() { + return this._analyser.channels; + } + dispose() { + return (super.dispose(), this._analyser.dispose(), this); + } + } + class Ja extends $a { + constructor() { + const t = ui(Ja.getDefaults(), arguments, ["size"]); + (super(t), + (this.name = "FFT"), + (this.normalRange = t.normalRange), + (this._analyser.type = "fft"), + (this.size = t.size)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + normalRange: !1, + size: 1024, + smoothing: 0.8, + }); + } + getValue() { + return this._analyser + .getValue() + .map((t) => (this.normalRange ? ji(t) : t)); + } + get size() { + return this._analyser.size; + } + set size(t) { + this._analyser.size = t; + } + get smoothing() { + return this._analyser.smoothing; + } + set smoothing(t) { + this._analyser.smoothing = t; + } + getFrequencyOfIndex(t) { + return ( + Bn( + 0 <= t && t < this.size, + `index must be greater than or equal to 0 and less than ${this.size}`, + ), + (t * this.context.sampleRate) / (2 * this.size) + ); + } + } + class Ka extends $a { + constructor() { + (super(ui(Ka.getDefaults(), arguments)), + (this.name = "DCMeter"), + (this._analyser.type = "waveform"), + (this._analyser.size = 256)); + } + getValue() { + return this._analyser.getValue()[0]; + } + } + class tc extends $a { + constructor() { + const t = ui(tc.getDefaults(), arguments, ["size"]); + (super(t), + (this.name = "Waveform"), + (this._analyser.type = "waveform"), + (this.size = t.size)); + } + static getDefaults() { + return Object.assign($a.getDefaults(), { + size: 1024, + }); + } + getValue() { + return this._analyser.getValue(); + } + get size() { + return this._analyser.size; + } + set size(t) { + this._analyser.size = t; + } + } + class ec extends io { + constructor() { + const t = ui(ec.getDefaults(), arguments, ["solo"]); + (super(t), + (this.name = "Solo"), + (this.input = this.output = + new ho({ + context: this.context, + })), + ec._allSolos.has(this.context) || + ec._allSolos.set(this.context, new Set()), + ec._allSolos.get(this.context).add(this), + (this.solo = t.solo)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + solo: !1, + }); + } + get solo() { + return this._isSoloed(); + } + set solo(t) { + (t ? this._addSolo() : this._removeSolo(), + ec._allSolos.get(this.context).forEach((t) => t._updateSolo())); + } + get muted() { + return 0 === this.input.gain.value; + } + _addSolo() { + (ec._soloed.has(this.context) || + ec._soloed.set(this.context, new Set()), + ec._soloed.get(this.context).add(this)); + } + _removeSolo() { + ec._soloed.has(this.context) && + ec._soloed.get(this.context).delete(this); + } + _isSoloed() { + return ( + ec._soloed.has(this.context) && + ec._soloed.get(this.context).has(this) + ); + } + _noSolos() { + return ( + !ec._soloed.has(this.context) || + (ec._soloed.has(this.context) && + 0 === ec._soloed.get(this.context).size) + ); + } + _updateSolo() { + this._isSoloed() || this._noSolos() + ? (this.input.gain.value = 1) + : (this.input.gain.value = 0); + } + dispose() { + return ( + super.dispose(), + ec._allSolos.get(this.context).delete(this), + this._removeSolo(), + this + ); + } + } + ((ec._allSolos = new Map()), (ec._soloed = new Map())); + class sc extends io { + constructor() { + const t = ui(sc.getDefaults(), arguments, ["pan", "volume"]); + (super(t), + (this.name = "PanVol"), + (this._panner = this.input = + new da({ + context: this.context, + pan: t.pan, + channelCount: t.channelCount, + })), + (this.pan = this._panner.pan), + (this._volume = this.output = + new xo({ + context: this.context, + volume: t.volume, + })), + (this.volume = this._volume.volume), + this._panner.connect(this._volume), + (this.mute = t.mute), + Di(this, ["pan", "volume"])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + mute: !1, + pan: 0, + volume: 0, + channelCount: 1, + }); + } + get mute() { + return this._volume.mute; + } + set mute(t) { + this._volume.mute = t; + } + dispose() { + return ( + super.dispose(), + this._panner.dispose(), + this.pan.dispose(), + this._volume.dispose(), + this.volume.dispose(), + this + ); + } + } + class nc extends io { + constructor() { + const t = ui(nc.getDefaults(), arguments, ["volume", "pan"]); + (super(t), + (this.name = "Channel"), + (this._solo = this.input = + new ec({ + solo: t.solo, + context: this.context, + })), + (this._panVol = this.output = + new sc({ + context: this.context, + pan: t.pan, + volume: t.volume, + mute: t.mute, + channelCount: t.channelCount, + })), + (this.pan = this._panVol.pan), + (this.volume = this._panVol.volume), + this._solo.connect(this._panVol), + Di(this, ["pan", "volume"])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + pan: 0, + volume: 0, + mute: !1, + solo: !1, + channelCount: 1, + }); + } + get solo() { + return this._solo.solo; + } + set solo(t) { + this._solo.solo = t; + } + get muted() { + return this._solo.muted || this.mute; + } + get mute() { + return this._panVol.mute; + } + set mute(t) { + this._panVol.mute = t; + } + _getBus(t) { + return ( + nc.buses.has(t) || + nc.buses.set( + t, + new ho({ + context: this.context, + }), + ), + nc.buses.get(t) + ); + } + send(t, e = 0) { + const s = this._getBus(t), + n = new ho({ + context: this.context, + units: "decibels", + gain: e, + }); + return (this.connect(n), n.connect(s), n); + } + receive(t) { + return (this._getBus(t).connect(this), this); + } + dispose() { + return ( + super.dispose(), + this._panVol.dispose(), + this.pan.dispose(), + this.volume.dispose(), + this._solo.dispose(), + this + ); + } + } + nc.buses = new Map(); + class ic extends io { + constructor() { + (super(ui(ic.getDefaults(), arguments)), + (this.name = "Mono"), + (this.input = new ho({ + context: this.context, + })), + (this._merge = this.output = + new ba({ + channels: 2, + context: this.context, + })), + this.input.connect(this._merge, 0, 0), + this.input.connect(this._merge, 0, 1)); + } + dispose() { + return ( + super.dispose(), + this._merge.dispose(), + this.input.dispose(), + this + ); + } + } + class oc extends io { + constructor() { + const t = ui(oc.getDefaults(), arguments, [ + "lowFrequency", + "highFrequency", + ]); + (super(t), + (this.name = "MultibandSplit"), + (this.input = new ho({ + context: this.context, + })), + (this.output = void 0), + (this.low = new Mr({ + context: this.context, + frequency: 0, + type: "lowpass", + })), + (this._lowMidFilter = new Mr({ + context: this.context, + frequency: 0, + type: "highpass", + })), + (this.mid = new Mr({ + context: this.context, + frequency: 0, + type: "lowpass", + })), + (this.high = new Mr({ + context: this.context, + frequency: 0, + type: "highpass", + })), + (this._internalChannels = [this.low, this.mid, this.high]), + (this.lowFrequency = new po({ + context: this.context, + units: "frequency", + value: t.lowFrequency, + })), + (this.highFrequency = new po({ + context: this.context, + units: "frequency", + value: t.highFrequency, + })), + (this.Q = new po({ + context: this.context, + units: "positive", + value: t.Q, + })), + this.input.fan(this.low, this.high), + this.input.chain(this._lowMidFilter, this.mid), + this.lowFrequency.fan( + this.low.frequency, + this._lowMidFilter.frequency, + ), + this.highFrequency.fan(this.mid.frequency, this.high.frequency), + this.Q.connect(this.low.Q), + this.Q.connect(this._lowMidFilter.Q), + this.Q.connect(this.mid.Q), + this.Q.connect(this.high.Q), + Di(this, [ + "high", + "mid", + "low", + "highFrequency", + "lowFrequency", + ])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + Q: 1, + highFrequency: 2500, + lowFrequency: 400, + }); + } + dispose() { + return ( + super.dispose(), + Mi(this, ["high", "mid", "low", "highFrequency", "lowFrequency"]), + this.low.dispose(), + this._lowMidFilter.dispose(), + this.mid.dispose(), + this.high.dispose(), + this.lowFrequency.dispose(), + this.highFrequency.dispose(), + this.Q.dispose(), + this + ); + } + } + class rc extends io { + constructor() { + const t = ui(rc.getDefaults(), arguments, [ + "positionX", + "positionY", + "positionZ", + ]); + (super(t), + (this.name = "Panner3D"), + (this._panner = + this.input = + this.output = + this.context.createPanner()), + (this.panningModel = t.panningModel), + (this.maxDistance = t.maxDistance), + (this.distanceModel = t.distanceModel), + (this.coneOuterGain = t.coneOuterGain), + (this.coneOuterAngle = t.coneOuterAngle), + (this.coneInnerAngle = t.coneInnerAngle), + (this.refDistance = t.refDistance), + (this.rolloffFactor = t.rolloffFactor), + (this.positionX = new no({ + context: this.context, + param: this._panner.positionX, + value: t.positionX, + })), + (this.positionY = new no({ + context: this.context, + param: this._panner.positionY, + value: t.positionY, + })), + (this.positionZ = new no({ + context: this.context, + param: this._panner.positionZ, + value: t.positionZ, + })), + (this.orientationX = new no({ + context: this.context, + param: this._panner.orientationX, + value: t.orientationX, + })), + (this.orientationY = new no({ + context: this.context, + param: this._panner.orientationY, + value: t.orientationY, + })), + (this.orientationZ = new no({ + context: this.context, + param: this._panner.orientationZ, + value: t.orientationZ, + }))); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + coneInnerAngle: 360, + coneOuterAngle: 360, + coneOuterGain: 0, + distanceModel: "inverse", + maxDistance: 1e4, + orientationX: 0, + orientationY: 0, + orientationZ: 0, + panningModel: "equalpower", + positionX: 0, + positionY: 0, + positionZ: 0, + refDistance: 1, + rolloffFactor: 1, + }); + } + setPosition(t, e, s) { + return ( + (this.positionX.value = t), + (this.positionY.value = e), + (this.positionZ.value = s), + this + ); + } + setOrientation(t, e, s) { + return ( + (this.orientationX.value = t), + (this.orientationY.value = e), + (this.orientationZ.value = s), + this + ); + } + get panningModel() { + return this._panner.panningModel; + } + set panningModel(t) { + this._panner.panningModel = t; + } + get refDistance() { + return this._panner.refDistance; + } + set refDistance(t) { + this._panner.refDistance = t; + } + get rolloffFactor() { + return this._panner.rolloffFactor; + } + set rolloffFactor(t) { + this._panner.rolloffFactor = t; + } + get distanceModel() { + return this._panner.distanceModel; + } + set distanceModel(t) { + this._panner.distanceModel = t; + } + get coneInnerAngle() { + return this._panner.coneInnerAngle; + } + set coneInnerAngle(t) { + this._panner.coneInnerAngle = t; + } + get coneOuterAngle() { + return this._panner.coneOuterAngle; + } + set coneOuterAngle(t) { + this._panner.coneOuterAngle = t; + } + get coneOuterGain() { + return this._panner.coneOuterGain; + } + set coneOuterGain(t) { + this._panner.coneOuterGain = t; + } + get maxDistance() { + return this._panner.maxDistance; + } + set maxDistance(t) { + this._panner.maxDistance = t; + } + dispose() { + return ( + super.dispose(), + this._panner.disconnect(), + this.orientationX.dispose(), + this.orientationY.dispose(), + this.orientationZ.dispose(), + this.positionX.dispose(), + this.positionY.dispose(), + this.positionZ.dispose(), + this + ); + } + } + class ac extends io { + constructor() { + const t = ui(ac.getDefaults(), arguments); + (super(t), + (this.name = "Recorder"), + (this.input = new ho({ + context: this.context, + })), + Bn(ac.supported, "Media Recorder API is not available"), + (this._stream = this.context.createMediaStreamDestination()), + this.input.connect(this._stream), + (this._recorder = new MediaRecorder(this._stream.stream, { + mimeType: t.mimeType, + }))); + } + static getDefaults() { + return io.getDefaults(); + } + get mimeType() { + return this._recorder.mimeType; + } + static get supported() { + return null !== ti && Reflect.has(ti, "MediaRecorder"); + } + get state() { + return "inactive" === this._recorder.state + ? "stopped" + : "paused" === this._recorder.state + ? "paused" + : "started"; + } + start() { + return ni(this, void 0, void 0, function* () { + Bn("started" !== this.state, "Recorder is already started"); + const t = new Promise((t) => { + const e = () => { + (this._recorder.removeEventListener("start", e, !1), t()); + }; + this._recorder.addEventListener("start", e, !1); + }); + return ( + "stopped" === this.state + ? this._recorder.start() + : this._recorder.resume(), + yield t + ); + }); + } + stop() { + return ni(this, void 0, void 0, function* () { + Bn("stopped" !== this.state, "Recorder is not started"); + const t = new Promise((t) => { + const e = (s) => { + (this._recorder.removeEventListener("dataavailable", e, !1), + t(s.data)); + }; + this._recorder.addEventListener("dataavailable", e, !1); + }); + return (this._recorder.stop(), yield t); + }); + } + pause() { + return ( + Bn("started" === this.state, "Recorder must be started"), + this._recorder.pause(), + this + ); + } + dispose() { + return ( + super.dispose(), + this.input.dispose(), + this._stream.disconnect(), + this + ); + } + } + class cc extends io { + constructor() { + const t = ui(cc.getDefaults(), arguments, ["threshold", "ratio"]); + (super(t), + (this.name = "Compressor"), + (this._compressor = this.context.createDynamicsCompressor()), + (this.input = this._compressor), + (this.output = this._compressor), + (this.threshold = new no({ + minValue: this._compressor.threshold.minValue, + maxValue: this._compressor.threshold.maxValue, + context: this.context, + convert: !1, + param: this._compressor.threshold, + units: "decibels", + value: t.threshold, + })), + (this.attack = new no({ + minValue: this._compressor.attack.minValue, + maxValue: this._compressor.attack.maxValue, + context: this.context, + param: this._compressor.attack, + units: "time", + value: t.attack, + })), + (this.release = new no({ + minValue: this._compressor.release.minValue, + maxValue: this._compressor.release.maxValue, + context: this.context, + param: this._compressor.release, + units: "time", + value: t.release, + })), + (this.knee = new no({ + minValue: this._compressor.knee.minValue, + maxValue: this._compressor.knee.maxValue, + context: this.context, + convert: !1, + param: this._compressor.knee, + units: "decibels", + value: t.knee, + })), + (this.ratio = new no({ + minValue: this._compressor.ratio.minValue, + maxValue: this._compressor.ratio.maxValue, + context: this.context, + convert: !1, + param: this._compressor.ratio, + units: "positive", + value: t.ratio, + })), + Di(this, ["knee", "release", "attack", "ratio", "threshold"])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + attack: 0.003, + knee: 30, + ratio: 12, + release: 0.25, + threshold: -24, + }); + } + get reduction() { + return this._compressor.reduction; + } + dispose() { + return ( + super.dispose(), + this._compressor.disconnect(), + this.attack.dispose(), + this.release.dispose(), + this.threshold.dispose(), + this.ratio.dispose(), + this.knee.dispose(), + this + ); + } + } + class hc extends io { + constructor() { + const t = ui(hc.getDefaults(), arguments, [ + "threshold", + "smoothing", + ]); + (super(t), + (this.name = "Gate"), + (this._follower = new _a({ + context: this.context, + smoothing: t.smoothing, + })), + (this._gt = new vr({ + context: this.context, + value: ji(t.threshold), + })), + (this.input = new ho({ + context: this.context, + })), + (this._gate = this.output = + new ho({ + context: this.context, + })), + this.input.connect(this._gate), + this.input.chain(this._follower, this._gt, this._gate.gain)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + smoothing: 0.1, + threshold: -40, + }); + } + get threshold() { + return Li(this._gt.value); + } + set threshold(t) { + this._gt.value = ji(t); + } + get smoothing() { + return this._follower.smoothing; + } + set smoothing(t) { + this._follower.smoothing = t; + } + dispose() { + return ( + super.dispose(), + this.input.dispose(), + this._follower.dispose(), + this._gt.dispose(), + this._gate.dispose(), + this + ); + } + } + class lc extends io { + constructor() { + const t = ui(lc.getDefaults(), arguments, ["threshold"]); + (super(t), + (this.name = "Limiter"), + (this._compressor = + this.input = + this.output = + new cc({ + context: this.context, + ratio: 20, + attack: 0.003, + release: 0.01, + threshold: t.threshold, + })), + (this.threshold = this._compressor.threshold), + Di(this, "threshold")); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + threshold: -12, + }); + } + get reduction() { + return this._compressor.reduction; + } + dispose() { + return ( + super.dispose(), + this._compressor.dispose(), + this.threshold.dispose(), + this + ); + } + } + class uc extends io { + constructor() { + const t = ui(uc.getDefaults(), arguments); + (super(t), + (this.name = "MidSideCompressor"), + (this._midSideSplit = this.input = + new Ba({ + context: this.context, + })), + (this._midSideMerge = this.output = + new Ua({ + context: this.context, + })), + (this.mid = new cc( + Object.assign(t.mid, { + context: this.context, + }), + )), + (this.side = new cc( + Object.assign(t.side, { + context: this.context, + }), + )), + this._midSideSplit.mid.chain(this.mid, this._midSideMerge.mid), + this._midSideSplit.side.chain(this.side, this._midSideMerge.side), + Di(this, ["mid", "side"])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + mid: { + ratio: 3, + threshold: -24, + release: 0.03, + attack: 0.02, + knee: 16, + }, + side: { + ratio: 6, + threshold: -30, + release: 0.25, + attack: 0.03, + knee: 10, + }, + }); + } + dispose() { + return ( + super.dispose(), + this.mid.dispose(), + this.side.dispose(), + this._midSideSplit.dispose(), + this._midSideMerge.dispose(), + this + ); + } + } + class pc extends io { + constructor() { + const t = ui(pc.getDefaults(), arguments); + (super(t), + (this.name = "MultibandCompressor"), + (this._splitter = this.input = + new oc({ + context: this.context, + lowFrequency: t.lowFrequency, + highFrequency: t.highFrequency, + })), + (this.lowFrequency = this._splitter.lowFrequency), + (this.highFrequency = this._splitter.highFrequency), + (this.output = new ho({ + context: this.context, + })), + (this.low = new cc( + Object.assign(t.low, { + context: this.context, + }), + )), + (this.mid = new cc( + Object.assign(t.mid, { + context: this.context, + }), + )), + (this.high = new cc( + Object.assign(t.high, { + context: this.context, + }), + )), + this._splitter.low.chain(this.low, this.output), + this._splitter.mid.chain(this.mid, this.output), + this._splitter.high.chain(this.high, this.output), + Di(this, [ + "high", + "mid", + "low", + "highFrequency", + "lowFrequency", + ])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + lowFrequency: 250, + highFrequency: 2e3, + low: { + ratio: 6, + threshold: -30, + release: 0.25, + attack: 0.03, + knee: 10, + }, + mid: { + ratio: 3, + threshold: -24, + release: 0.03, + attack: 0.02, + knee: 16, + }, + high: { + ratio: 3, + threshold: -24, + release: 0.03, + attack: 0.02, + knee: 16, + }, + }); + } + dispose() { + return ( + super.dispose(), + this._splitter.dispose(), + this.low.dispose(), + this.mid.dispose(), + this.high.dispose(), + this.output.dispose(), + this + ); + } + } + class dc extends io { + constructor() { + const t = ui(dc.getDefaults(), arguments, ["low", "mid", "high"]); + (super(t), + (this.name = "EQ3"), + (this.output = new ho({ + context: this.context, + })), + (this._internalChannels = []), + (this.input = this._multibandSplit = + new oc({ + context: this.context, + highFrequency: t.highFrequency, + lowFrequency: t.lowFrequency, + })), + (this._lowGain = new ho({ + context: this.context, + gain: t.low, + units: "decibels", + })), + (this._midGain = new ho({ + context: this.context, + gain: t.mid, + units: "decibels", + })), + (this._highGain = new ho({ + context: this.context, + gain: t.high, + units: "decibels", + })), + (this.low = this._lowGain.gain), + (this.mid = this._midGain.gain), + (this.high = this._highGain.gain), + (this.Q = this._multibandSplit.Q), + (this.lowFrequency = this._multibandSplit.lowFrequency), + (this.highFrequency = this._multibandSplit.highFrequency), + this._multibandSplit.low.chain(this._lowGain, this.output), + this._multibandSplit.mid.chain(this._midGain, this.output), + this._multibandSplit.high.chain(this._highGain, this.output), + Di(this, ["low", "mid", "high", "lowFrequency", "highFrequency"]), + (this._internalChannels = [this._multibandSplit])); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + high: 0, + highFrequency: 2500, + low: 0, + lowFrequency: 400, + mid: 0, + }); + } + dispose() { + return ( + super.dispose(), + Mi(this, ["low", "mid", "high", "lowFrequency", "highFrequency"]), + this._multibandSplit.dispose(), + this.lowFrequency.dispose(), + this.highFrequency.dispose(), + this._lowGain.dispose(), + this._midGain.dispose(), + this._highGain.dispose(), + this.low.dispose(), + this.mid.dispose(), + this.high.dispose(), + this.Q.dispose(), + this + ); + } + } + class fc extends io { + constructor() { + const t = ui(fc.getDefaults(), arguments, ["url", "onload"]); + (super(t), + (this.name = "Convolver"), + (this._convolver = this.context.createConvolver()), + (this._buffer = new Ri(t.url, (e) => { + ((this.buffer = e), t.onload()); + })), + (this.input = new ho({ + context: this.context, + })), + (this.output = new ho({ + context: this.context, + })), + this._buffer.loaded && (this.buffer = this._buffer), + (this.normalize = t.normalize), + this.input.chain(this._convolver, this.output)); + } + static getDefaults() { + return Object.assign(io.getDefaults(), { + normalize: !0, + onload: Ei, + }); + } + load(t) { + return ni(this, void 0, void 0, function* () { + this.buffer = yield this._buffer.load(t); + }); + } + get buffer() { + return this._buffer.length ? this._buffer : null; + } + set buffer(t) { + (t && this._buffer.set(t), + this._convolver.buffer && + (this.input.disconnect(), + this._convolver.disconnect(), + (this._convolver = this.context.createConvolver()), + this.input.chain(this._convolver, this.output))); + const e = this._buffer.get(); + this._convolver.buffer = e || null; + } + get normalize() { + return this._convolver.normalize; + } + set normalize(t) { + this._convolver.normalize = t; + } + dispose() { + return ( + super.dispose(), + this._buffer.dispose(), + this._convolver.disconnect(), + this + ); + } + } + + function _c() { + return Vi().now(); + } + + function mc() { + return Vi().immediate(); + } + const gc = Vi().transport; + + function vc() { + return Vi().transport; + } + const yc = Vi().destination, + xc = Vi().destination; + + function wc() { + return Vi().destination; + } + const bc = Vi().listener; + + function Tc() { + return Vi().listener; + } + const Sc = Vi().draw; + + function kc() { + return Vi().draw; + } + const Ac = Vi(); + + function Cc() { + return Ri.loaded(); + } + const Oc = Ri, + Dc = So, + Mc = Lo; + })(), + n + ); + })(), +); +//# sourceMappingURL=Tone.js.map